diff --git a/.travis.yml b/.travis.yml index caf2e3389..112cf94f1 100644 --- a/.travis.yml +++ b/.travis.yml @@ -9,13 +9,13 @@ before_install: - pwd - git submodule update --init --recursive - echo "yes" | sudo add-apt-repository "deb http://archive.ubuntu.com/ubuntu `lsb_release -sc` main universe restricted multiverse" - - echo "yes" | sudo apt-add-repository ppa:openmw/deps + - echo "yes" | sudo apt-add-repository ppa:openmw/openmw - sudo apt-get update -qq - - sudo apt-get install -qq libboost-all-dev libgtest-dev google-mock libzzip-dev + - sudo apt-get install -qq libboost-all-dev libgtest-dev google-mock libzzip-dev uuid-dev - sudo apt-get install -qq libqt4-dev libxaw7-dev libxrandr-dev libfreeimage-dev libpng-dev - sudo apt-get install -qq libopenal-dev libmpg123-dev libsndfile1-dev - sudo apt-get install -qq libavcodec-dev libavformat-dev libavdevice-dev libavutil-dev libswscale-dev libpostproc-dev - - sudo apt-get install -qq libbullet-dev libogre-static-dev libmygui-static-dev libsdl2-static-dev libunshield-dev + - sudo apt-get install -qq libbullet-dev libogre-1.8-dev libmygui-dev libsdl2-dev libunshield-dev - sudo mkdir /usr/src/gtest/build - cd /usr/src/gtest/build - sudo cmake .. -DBUILD_SHARED_LIBS=1 @@ -26,7 +26,7 @@ before_script: - cd - - mkdir build - cd build - - cmake .. -DOGRE_STATIC=1 -DMYGUI_STATIC=1 -DBOOST_STATIC=1 -DSDL2_STATIC=1 -DBUILD_WITH_CODE_COVERAGE=1 -DBUILD_UNITTESTS=1 + - cmake .. -DBUILD_WITH_CODE_COVERAGE=1 -DBUILD_UNITTESTS=1 -DBUILD_WITH_DPKG=1 script: - make -j4 after_script: diff --git a/CMakeLists.txt b/CMakeLists.txt index 625239aa0..f6014dff6 100644 --- a/CMakeLists.txt +++ b/CMakeLists.txt @@ -19,7 +19,7 @@ include (OpenMWMacros) # Version set (OPENMW_VERSION_MAJOR 0) -set (OPENMW_VERSION_MINOR 26) +set (OPENMW_VERSION_MINOR 27) set (OPENMW_VERSION_RELEASE 0) set (OPENMW_VERSION "${OPENMW_VERSION_MAJOR}.${OPENMW_VERSION_MINOR}.${OPENMW_VERSION_RELEASE}") @@ -50,7 +50,12 @@ option(USE_MPG123 "use mpg123 + libsndfile for sound" ON) # OS X deployment option(OPENMW_OSX_DEPLOYMENT OFF) -find_program(DPKG_PROGRAM dpkg DOC "dpkg program of Debian-based systems") +if(UNIX AND NOT APPLE) + option(BUILD_WITH_DPKG "enable dpkg-based install for debian and debian derivatives" OFF) + if(BUILD_WITH_DPKG) + find_program(DPKG_PROGRAM dpkg DOC "dpkg program of Debian-based systems") + endif(BUILD_WITH_DPKG) +endif(UNIX AND NOT APPLE) # Location of morrowind data files if (APPLE) @@ -79,7 +84,6 @@ set(OENGINE_OGRE ${LIBDIR}/openengine/ogre/renderer.cpp ${LIBDIR}/openengine/ogre/fader.cpp ${LIBDIR}/openengine/ogre/lights.cpp - ${LIBDIR}/openengine/ogre/particles.cpp ${LIBDIR}/openengine/ogre/selectionbuffer.cpp ${LIBDIR}/openengine/ogre/imagerotate.cpp ) @@ -319,6 +323,9 @@ configure_file(${OpenMW_SOURCE_DIR}/files/openmw.cfg configure_file(${OpenMW_SOURCE_DIR}/files/opencs.cfg "${OpenMW_BINARY_DIR}/opencs.cfg") + +configure_file(${OpenMW_SOURCE_DIR}/files/opencs/defaultfilters + "${OpenMW_BINARY_DIR}/resources/defaultfilters" COPYONLY) if (NOT WIN32 AND NOT APPLE) configure_file(${OpenMW_SOURCE_DIR}/files/openmw.desktop @@ -380,7 +387,6 @@ IF(NOT WIN32 AND NOT APPLE) # Install licenses INSTALL(FILES "DejaVu Font License.txt" DESTINATION "${LICDIR}" ) - INSTALL(FILES "Daedric Font License.txt" DESTINATION "${LICDIR}" ) INSTALL(FILES "OFL.txt" DESTINATION "${LICDIR}" ) INSTALL(FILES "extern/shiny/License.txt" DESTINATION "${LICDIR}" RENAME "Shiny License.txt" ) ENDIF (DPKG_PROGRAM) @@ -428,7 +434,7 @@ IF(NOT WIN32 AND NOT APPLE) Data files from the original game is required to run it.") SET(CPACK_DEBIAN_PACKAGE_NAME "openmw") SET(CPACK_DEBIAN_PACKAGE_VERSION "${VERSION_STRING}") - SET(CPACK_PACKAGE_EXECUTABLES "openmw;OpenMW bsatool;Bsatool esmtool;Esmtool omwlauncher;OMWLauncher mwiniimporter;MWiniImporter") + SET(CPACK_PACKAGE_EXECUTABLES "openmw;OpenMW opencs;OpenCS bsatool;Bsatool esmtool;Esmtool omwlauncher;OMWLauncher mwiniimporter;MWiniImporter") SET(CPACK_DEBIAN_PACKAGE_DEPENDS "libc6 (>= 2.11.2), libfreetype6 (>= 2.2.1), libgcc1 (>= 1:4.1.1), libmpg123-0 (>= 1.12.1), libopenal1 (>= 1:1.12.854), libsndfile1 (>= 1.0.23), libstdc++6 (>= 4.4.5), libuuid1 (>= 2.17.2), libqtgui4 (>= 4.7.0)") SET(CPACK_DEBIAN_PACKAGE_SECTION "Games") @@ -455,13 +461,22 @@ if(WIN32) "${OpenMW_SOURCE_DIR}/GPL3.txt" "${OpenMW_SOURCE_DIR}/OFL.txt" "${OpenMW_SOURCE_DIR}/DejaVu Font License.txt" - "${OpenMW_SOURCE_DIR}/Daedric Font License.txt" "${OpenMW_BINARY_DIR}/settings-default.cfg" "${OpenMW_BINARY_DIR}/transparency-overrides.cfg" - "${OpenMW_BINARY_DIR}/Release/mwiniimport.exe" - "${OpenMW_BINARY_DIR}/Release/omwlauncher.exe" "${OpenMW_BINARY_DIR}/Release/openmw.exe" DESTINATION ".") + + IF(BUILD_LAUNCHER) + INSTALL(PROGRAMS "${OpenMW_BINARY_DIR}/Release/omwlauncher.exe" DESTINATION ".") + ENDIF(BUILD_LAUNCHER) + IF(BUILD_MWINIIMPORTER) + INSTALL(PROGRAMS "${OpenMW_BINARY_DIR}/Release/mwiniimport.exe" DESTINATION ".") + ENDIF(BUILD_MWINIIMPORTER) + IF(BUILD_OPENCS) + INSTALL(PROGRAMS "${OpenMW_BINARY_DIR}/Release/opencs.exe" DESTINATION ".") + INSTALL(FILES "${OpenMW_BINARY_DIR}/opencs.cfg" DESTINATION ".") + ENDIF(BUILD_OPENCS) + INSTALL(DIRECTORY "${OpenMW_BINARY_DIR}/resources" DESTINATION ".") SET(CPACK_GENERATOR "NSIS") @@ -471,7 +486,13 @@ if(WIN32) SET(CPACK_PACKAGE_VERSION_MAJOR ${OPENMW_VERSION_MAJOR}) SET(CPACK_PACKAGE_VERSION_MINOR ${OPENMW_VERSION_MINOR}) SET(CPACK_PACKAGE_VERSION_PATCH ${OPENMW_VERSION_RELEASE}) - SET(CPACK_PACKAGE_EXECUTABLES "openmw;OpenMW;omwlauncher;OpenMW Launcher") + SET(CPACK_PACKAGE_EXECUTABLES "openmw;OpenMW") + IF(BUILD_LAUNCHER) + SET(CPACK_PACKAGE_EXECUTABLES "${CPACK_PACKAGE_EXECUTABLES};omwlauncher;OpenMW Launcher") + ENDIF(BUILD_LAUNCHER) + IF(BUILD_OPENCS) + SET(CPACK_PACKAGE_EXECUTABLES "${CPACK_PACKAGE_EXECUTABLES};opencs;OpenMW Construction Set") + ENDIF(BUILD_OPENCS) SET(CPACK_NSIS_CREATE_ICONS_EXTRA "CreateShortCut '\$SMPROGRAMS\\\\$STARTMENU_FOLDER\\\\Readme.lnk' '\$INSTDIR\\\\readme.txt'") SET(CPACK_NSIS_DELETE_ICONS_EXTRA " !insertmacro MUI_STARTMENU_GETFOLDER Application $MUI_TEMP @@ -668,7 +689,10 @@ if (APPLE) set(CPACK_PACKAGE_VERSION_MINOR ${OPENMW_VERSION_MINO}) set(CPACK_PACKAGE_VERSION_PATCH ${OPENMW_VERSION_RELEASE}) - set(APPS "\${CMAKE_INSTALL_PREFIX}/${INSTALL_SUBDIR}/${APP_BUNDLE_NAME}") + set(OPENMW_APP "\${CMAKE_INSTALL_PREFIX}/${INSTALL_SUBDIR}/${APP_BUNDLE_NAME}") + + set(OPENCS_APP "\${CMAKE_INSTALL_PREFIX}/${INSTALL_SUBDIR}/OpenCS.app") + set(PLUGINS "") set(ABSOLUTE_PLUGINS "") @@ -729,7 +753,8 @@ if (APPLE) cmake_policy(SET CMP0009 OLD) set(BU_CHMOD_BUNDLE_ITEMS ON) include(BundleUtilities) - fixup_bundle(\"${APPS}\" \"${PLUGINS}\" \"${DIRS}\") + fixup_bundle(\"${OPENMW_APP}\" \"${PLUGINS}\" \"${DIRS}\") + fixup_bundle(\"${OPENCS_APP}\" \"\" \"${DIRS}\") " COMPONENT Runtime) include(CPack) endif (APPLE) diff --git a/Daedric Font License.txt b/Daedric Font License.txt deleted file mode 100644 index a1553d0b0..000000000 --- a/Daedric Font License.txt +++ /dev/null @@ -1,10 +0,0 @@ -Dongle's Oblivion Daedric font set -http://www.uesp.net/wiki/Lore:Daedric_Alphabet#Daedric_Font - ---------------------------------------------------- - -This was done entirely as a personal project. Bethesda Softworks graciously granted me the permission for it. I am not connected with them in any way. -You may freely use these fonts to create anything you'd like. You may re-distribute the fonts freely, over the Internet, or by any other means. Always keep the .zip file intact, and this read me included. -Please do not modify and redistribute the fonts without my permission. -You may NOT sell any of these fonts under any circumstances. This includes putting them on compilation font CDs for sale, putting them in a "members only" pay-area of a website, or any other means of financial gain connected in ANY way with the redistribution of any of these fonts. -You have my permission to create and sell any artwork made with these fonts, however you may need to contact Bethesda Softworks before doing so. diff --git a/README_Mac.md b/README_Mac.md deleted file mode 100644 index dc3918368..000000000 --- a/README_Mac.md +++ /dev/null @@ -1,160 +0,0 @@ -#Getting OpenMW Working on OS X - -## Initial setup -First of all, clone OpenMW repo. - - $ git clone github.com/zinnschlag/openmw - -Or use your github url if you forked. - -About dependencies: I prefer not to install them globally (i. e. in /usr/local/), so I'm installing them in directory in my home directory. If OpenMW sources is in $HOME/path/openmw, I'm using $HOME/path/libs/root as prefix for boost and other libs. - -It's useful to create env var for lib install prefix: - - $ export OMW_LIB_PREFIX=$HOME/path/libs/root` - -Most of libs can be installed from [Homebrew][homebrew]. Only mpg123 needs to be installed from source (due to lack of universal compilation support). I think that some of libs can be installed from MacPorts or Fink too. - -As OpenMW currently only supports i386 architecture on OS X, denendencies also should support it. Set some env vars in current terminal: - - $ export CFLAGS="-arch i386" - $ export CXXFLAGS="-arch i386" - $ export LDFLAGS="-arch i386" - -If you close your terminal, you should set env vars again before pcoceeding to next steps! - -## Boost -Download [boost][boost] and install it with the following command: - - $ cd /path/to/boost/source - $ ./bootstrap.sh --prefix=$OMW_LIB_PREFIX - $ ./bjam --build-dir=build --layout=versioned \ - --toolset=darwin architecture=x86 address-model=32 \ - --link-shared,static --prefix=$OMW_LIB_PREFIX install - - -Alternatively you can install boost with homebrew: - - $ brew install boost --universal - -I think MacPorts also should support universal build for boost. - -## Ogre -Download [Ogre][] SDK (tested with 1.7.3), unpack it somewhere and move -`lib/Release/Ogre.framework` into `/Library/Frameworks`. - -## OIS -Download patched [OIS][] and use the XCode project provided. Be sure to set your build architecture to - `i386`. Once it built, locate built OIS.framework with Xcode and move it to `/Library/Frameworks`. - -## mpg123 -Download [MPG 123][mpg123] and build it: - - $ cd /path/to/mpg123/source - $ ./configure --prefix=$OMW_LIB_PREFIX --disable-debug \ - --disable-dependency-tracking \ - --with-optimization=4 \ - --with-audio=dummy \ - --with-default-audio=dummy \ - --with-cpu=sse_alone \ - $ make install - -## libsndfile -Download [libsndfile][] and build it: - - $ cd /path/to/libsndfile/source - $ ./configure --prefix=$OMW_LIB_PREFIX \ - --disable-dependency-tracking - $ make install - -or install with homebrew: - - $ brew install libsndfile --universal - -## Bullet -Download [Bullet][] and build it: - - $ cd /path/to/bullet/source - $ mkdir build - $ cd build - $ cmake -DCMAKE_BUILD_TYPE=Release \ - -DCMAKE_INSTALL_PREFIX=$OMW_LIB_PREFIX \ - -DBUILD_EXTRAS=OFF \ - -DBUILD_DEMOS=OFF \ - -DCMAKE_OSX_ARCHITECTURES=i386 \ - -DCMAKE_INSTALL_NAME_DIR=$OMW_LIB_RPEFIX/lib \ - -G"Unix Makefiles" ../ - $ make install - -or install with homebrew: - - $ brew install bullet --HEAD --universal - -I prefer head because 2.79 has some issue which causes OpenMW to lag. Also you can edit formula and install 2.77, which is stable and haven't mentioned issue. - -## Qt -Install [Qt][qt]. Qt SDK distributed by Nokia is not an option because it's 64 bit only, and OpenMW currently doesn't build for 64 bit on OS X. I'm installing it from Homebrew: - - $ brew install qt --universal - -## Run CMake -Generate the Makefile for OpenMW as follows and build OpenMW: - - $ mkdir /path/to/openmw/build/dir - $ cd /path/to/open/build/dir - $ cmake \ - -D CMAKE_OSX_ARCHITECTURES=i386 \ - -D OGRE_SDK=/path/to/ogre/sdk \ - -D BOOST_INCLUDEDIR=$OMW_LIB_PREFIX/include/boost-1_45 \ - -D BOOST_LIBRARYDIR=$OMW_LIB_PREFIX/lib \ - -D SNDFILE_INCLUDE_DIR=$OMW_LIB_PREFIX/include \ - -D SNDFILE_LIBRARY=$OMW_LIB_PREFIX/lib/libsndfile.a \ - -D MPG123_LIBRARY=$OMW_LIB_PREFIX/lib/libmpg123.a \ - -D MPG123_INCLUDE_DIR=$OMW_LIB_PREFIX/include \ - -D BULLET_DYNAMICS_LIBRARY=$OMW_LIB_PREFIX/lib/libBulletDynamics.a \ - -D BULLET_COLLISION_LIBRARY=$OMW_LIB_PREFIX/lib/libBulletCollision.a \ - -D BULLET_MATH_LIBRARY=$OMW_LIB_PREFIX/lib/libLinearMath.a \ - -D BULLET_SOFTBODY_LIBRARY=$OMW_LIB_PREFIX/lib/libBulletSoftBody.a \ - -D BULLET_INCLUDE_DIR=$OMW_LIB_PREFIX/include/bullet/ \ - -G "Unix Makefiles" /path/to/openmw/source/dir - $ make - -You can use `-G"Xcode"` if you prefer Xcode, or -G"Eclipse CDT4 - Unix Makefiles" -if you prefer Eclipse. You also can specify `-D CMAKE_BUILD_TYPE=Debug` for debug -build. As for CMake 2.8.7 and Xcode 4.3, Xcode generator is broken. Sadly Eclipse CDT also cannot import generated project at least on my machine. - -If all libs installed via homebrew (excluding mpg123), then command would be even simplier: - - $ cmake \ - -D CMAKE_OSX_ARCHITECTURES="i386" \ - -D OGRE_SDK=/path/to/ogre/sdk \ - -D MPG123_LIBRARY=$OMW_LIB_PREFIX/lib/libmpg123.a \ - -D MPG123_INCLUDE_DIR=$OMW_LIB_PREFIX/include \ - -G "Unix Makefiles" /path/to/openmw/source/dir - $ make - -Note for users with recent Xcode versions: you must explicitly specify what set of compilers do you use! If not, gcc will be used for C and Clang for C++. Just add this two -D's to command: `-D CMAKE_C_COMPILER=/usr/bin/clang` and `-D CMAKE_CXX_COMPILER=/usr/bin/clang` - -Note for Xcode 4.3 users: you should specify full path to used SDK, because current CMake (2.8.7) couldn't find SDKs inside Xcode app bundle: - - -D CMAKE_OSX_SYSROOT="/Applications/Xcode.app/Contents/Developer/Platforms/MacOSX.platform/Developer/SDKs/MacOSX10.7.sdk" - -# Run -From your build directory run: - - $ OpenMW.app/Contents/MacOS/openmw -or: - - $ open OpenMW.app -Enjoy! - -[homebrew]: https://github.com/mxcl/homebrew -[boost]: http://www.boost.org -[Ogre]: http://www.ogre3d.org -[Bullet]: http://bulletphysics.org -[OIS]: https://github.com/corristo/ois-fork -[mpg123]: http://www.mpg123.de -[libsndfile]: http://www.mega-nerd.com/libsndfile -[official website]: http://openmw.com -[Will Thimbleby's Ogre Framework]: http://www.thimbleby.net/ogre/ -[qt]: http://qt.nokia.com/ \ No newline at end of file diff --git a/apps/bsatool/bsatool.cpp b/apps/bsatool/bsatool.cpp index e6fcc2567..3781dd066 100644 --- a/apps/bsatool/bsatool.cpp +++ b/apps/bsatool/bsatool.cpp @@ -184,7 +184,7 @@ int list(Bsa::BSAFile& bsa, Arguments& info) { // List all files const Bsa::BSAFile::FileList &files = bsa.getList(); - for(int i=0; i m = esm.getMasters(); + std::vector m = esm.getGameFiles(); if (!m.empty()) { std::cout << "Masters:" << std::endl; @@ -339,6 +339,8 @@ int load(Arguments& info) } std::string id = esm.getHNOString("NAME"); + if (id.empty()) + id = esm.getHNOString("INAM"); if(!quiet && interested) std::cout << "\nRecord: " << n.toString() diff --git a/apps/esmtool/record.cpp b/apps/esmtool/record.cpp index 68e0dcc09..cc09452c9 100644 --- a/apps/esmtool/record.cpp +++ b/apps/esmtool/record.cpp @@ -740,8 +740,8 @@ void Record::print() if (mData.mClass != "") std::cout << " Class: " << mData.mClass << std::endl; std::cout << " Factionless: " << mData.mFactionLess << std::endl; - if (mData.mNpcFaction != "") - std::cout << " NPC Faction: " << mData.mNpcFaction << std::endl; + if (mData.mFaction != "") + std::cout << " NPC Faction: " << mData.mFaction << std::endl; if (mData.mData.mRank != -1) std::cout << " NPC Rank: " << (int)mData.mData.mRank << std::endl; if (mData.mPcFaction != "") @@ -989,8 +989,7 @@ void Record::print() std::cout << " Faction: " << mData.mFaction << std::endl; std::cout << " Flags: " << npcFlags(mData.mFlags) << std::endl; - // Seriously? - if (mData.mNpdt52.mGold == -10) + if (mData.mNpdtType == ESM::NPC::NPC_WITH_AUTOCALCULATED_STATS) { std::cout << " Level: " << mData.mNpdt12.mLevel << std::endl; std::cout << " Reputation: " << (int)mData.mNpdt12.mReputation << std::endl; @@ -1022,7 +1021,7 @@ void Record::print() std::cout << " Luck: " << (int)mData.mNpdt52.mLuck << std::endl; std::cout << " Skills:" << std::endl; - for (int i = 0; i != 27; i++) + for (int i = 0; i != ESM::Skill::Length; i++) std::cout << " " << skillLabel(i) << ": " << (int)((unsigned char)mData.mNpdt52.mSkills[i]) << std::endl; diff --git a/apps/esmtool/record.hpp b/apps/esmtool/record.hpp index 78cf5d436..45b6d0426 100644 --- a/apps/esmtool/record.hpp +++ b/apps/esmtool/record.hpp @@ -24,7 +24,12 @@ namespace EsmTool bool mPrintPlain; public: - RecordBase () { mPrintPlain = false; } + RecordBase () + : mFlags(0) + , mPrintPlain(false) + { + } + virtual ~RecordBase() {} const std::string &getId() const { diff --git a/apps/launcher/CMakeLists.txt b/apps/launcher/CMakeLists.txt index 92cabffff..18c555a24 100644 --- a/apps/launcher/CMakeLists.txt +++ b/apps/launcher/CMakeLists.txt @@ -11,7 +11,9 @@ set(LAUNCHER settings/launchersettings.cpp utils/checkablemessagebox.cpp + utils/profilescombobox.cpp utils/textinputdialog.cpp + utils/lineedit.cpp ${CMAKE_SOURCE_DIR}/files/launcher/launcher.rc ) @@ -32,8 +34,9 @@ set(LAUNCHER_HEADER settings/settingsbase.hpp utils/checkablemessagebox.hpp + utils/profilescombobox.hpp utils/textinputdialog.hpp - + utils/lineedit.hpp ) if(NOT WIN32) LIST(APPEND LAUNCHER_HEADER unshieldthread.hpp) @@ -48,8 +51,11 @@ set(LAUNCHER_HEADER_MOC playpage.hpp textslotmsgbox.hpp - utils/checkablemessagebox.hpp utils/textinputdialog.hpp + utils/checkablemessagebox.hpp + utils/profilescombobox.hpp + utils/lineedit.hpp + ) if(NOT WIN32) @@ -62,6 +68,7 @@ set(LAUNCHER_UI ${CMAKE_SOURCE_DIR}/files/ui/graphicspage.ui ${CMAKE_SOURCE_DIR}/files/ui/mainwindow.ui ${CMAKE_SOURCE_DIR}/files/ui/playpage.ui + ${CMAKE_SOURCE_DIR}/files/ui/contentselector.ui ) source_group(launcher FILES ${LAUNCHER} ${LAUNCHER_HEADER}) diff --git a/apps/launcher/datafilespage.cpp b/apps/launcher/datafilespage.cpp index add3dea40..362d7562c 100644 --- a/apps/launcher/datafilespage.cpp +++ b/apps/launcher/datafilespage.cpp @@ -4,548 +4,300 @@ #include #include #include +#include #include -#include -#include -#include +#include -#include -#include -#include +#include + +#include "utils/textinputdialog.hpp" +#include "utils/profilescombobox.hpp" #include "settings/gamesettings.hpp" #include "settings/launchersettings.hpp" -#include "utils/textinputdialog.hpp" +#include "components/contentselector/view/contentselector.hpp" -DataFilesPage::DataFilesPage(Files::ConfigurationManager &cfg, GameSettings &gameSettings, LauncherSettings &launcherSettings, QWidget *parent) +Launcher::DataFilesPage::DataFilesPage(Files::ConfigurationManager &cfg, GameSettings &gameSettings, LauncherSettings &launcherSettings, QWidget *parent) : mCfgMgr(cfg) , mGameSettings(gameSettings) , mLauncherSettings(launcherSettings) , QWidget(parent) { - setupUi(this); + ui.setupUi (this); + setObjectName ("DataFilesPage"); + mSelector = new ContentSelectorView::ContentSelector (ui.contentSelectorWidget); - // Models - mDataFilesModel = new DataFilesModel(this); - - mMastersProxyModel = new QSortFilterProxyModel(); - mMastersProxyModel->setFilterRegExp(QString("^.*\\.esm")); - mMastersProxyModel->setFilterCaseSensitivity(Qt::CaseInsensitive); - mMastersProxyModel->setSourceModel(mDataFilesModel); - - mPluginsProxyModel = new PluginsProxyModel(); - mPluginsProxyModel->setFilterRegExp(QString("^.*\\.esp")); - mPluginsProxyModel->setFilterCaseSensitivity(Qt::CaseInsensitive); - mPluginsProxyModel->setSourceModel(mDataFilesModel); - - mFilterProxyModel = new QSortFilterProxyModel(); - mFilterProxyModel->setDynamicSortFilter(true); - mFilterProxyModel->setSourceModel(mPluginsProxyModel); - - QCheckBox checkBox; - unsigned int height = checkBox.sizeHint().height() + 4; - - mastersTable->setModel(mMastersProxyModel); - mastersTable->setObjectName("MastersTable"); - mastersTable->setContextMenuPolicy(Qt::CustomContextMenu); - mastersTable->setSortingEnabled(false); - mastersTable->setSelectionBehavior(QAbstractItemView::SelectRows); - mastersTable->setSelectionMode(QAbstractItemView::ExtendedSelection); - mastersTable->setEditTriggers(QAbstractItemView::NoEditTriggers); - mastersTable->setAlternatingRowColors(true); - mastersTable->horizontalHeader()->setStretchLastSection(true); - mastersTable->horizontalHeader()->hide(); - - // Set the row height to the size of the checkboxes - mastersTable->verticalHeader()->setDefaultSectionSize(height); - mastersTable->verticalHeader()->setResizeMode(QHeaderView::Fixed); - mastersTable->verticalHeader()->hide(); - - pluginsTable->setModel(mFilterProxyModel); - pluginsTable->setObjectName("PluginsTable"); - pluginsTable->setContextMenuPolicy(Qt::CustomContextMenu); - pluginsTable->setSortingEnabled(false); - pluginsTable->setSelectionBehavior(QAbstractItemView::SelectRows); - pluginsTable->setSelectionMode(QAbstractItemView::ExtendedSelection); - pluginsTable->setEditTriggers(QAbstractItemView::NoEditTriggers); - pluginsTable->setAlternatingRowColors(true); - pluginsTable->setVerticalScrollMode(QAbstractItemView::ScrollPerItem); - pluginsTable->horizontalHeader()->setStretchLastSection(true); - pluginsTable->horizontalHeader()->hide(); - - pluginsTable->verticalHeader()->setDefaultSectionSize(height); - pluginsTable->verticalHeader()->setResizeMode(QHeaderView::Fixed); - - // Adjust the tableview widths inside the splitter - QList sizeList; - sizeList << mLauncherSettings.value(QString("General/MastersTable/width"), QString("200")).toInt(); - sizeList << mLauncherSettings.value(QString("General/PluginTable/width"), QString("340")).toInt(); - - splitter->setSizes(sizeList); - - // Create a dialog for the new profile name input - mNewProfileDialog = new TextInputDialog(tr("New Profile"), tr("Profile name:"), this); - - connect(profilesComboBox, SIGNAL(currentIndexChanged(int)), this, SLOT(slotCurrentIndexChanged(int))); - - connect(mNewProfileDialog->lineEdit(), SIGNAL(textChanged(QString)), this, SLOT(updateOkButton(QString))); - - connect(pluginsTable, SIGNAL(doubleClicked(QModelIndex)), this, SLOT(setCheckState(QModelIndex))); - connect(mastersTable, SIGNAL(doubleClicked(QModelIndex)), this, SLOT(setCheckState(QModelIndex))); - - connect(pluginsTable, SIGNAL(customContextMenuRequested(QPoint)), this, SLOT(showContextMenu(QPoint))); - connect(mastersTable, SIGNAL(customContextMenuRequested(QPoint)), this, SLOT(showContextMenu(QPoint))); - - connect(mDataFilesModel, SIGNAL(layoutChanged()), this, SLOT(updateViews())); - - connect(filterLineEdit, SIGNAL(textChanged(QString)), this, SLOT(filterChanged(QString))); - - connect(splitter, SIGNAL(splitterMoved(int,int)), this, SLOT(updateSplitter())); - - createActions(); + buildView(); setupDataFiles(); } -void DataFilesPage::createActions() +void Launcher::DataFilesPage::loadSettings() { + QStringList paths = mGameSettings.getDataDirs(); + paths.insert (0, mDataLocal); + PathIterator pathIterator (paths); - // Add the actions to the toolbuttons - newProfileButton->setDefaultAction(newProfileAction); - deleteProfileButton->setDefaultAction(deleteProfileAction); + QString profileName = ui.profilesComboBox->currentText(); - // Context menu actions - mContextMenu = new QMenu(this); - mContextMenu->addAction(checkAction); - mContextMenu->addAction(uncheckAction); + QStringList files = mLauncherSettings.values(QString("Profiles/") + profileName, Qt::MatchExactly); + + QStringList filepaths; + + foreach (const QString &file, files) + { + QString filepath = pathIterator.findFirstPath (file); + + if (!filepath.isEmpty()) + filepaths << filepath; + } + + mSelector->setProfileContent (filepaths); } -void DataFilesPage::setupDataFiles() +void Launcher::DataFilesPage::saveSettings(const QString &profile) { - // Set the encoding to the one found in openmw.cfg or the default - mDataFilesModel->setEncoding(mGameSettings.value(QString("encoding"), QString("win1252"))); + QString profileName = profile; - QStringList paths = mGameSettings.getDataDirs(); + if (profileName.isEmpty()) + profileName = ui.profilesComboBox->currentText(); - foreach (const QString &path, paths) { - mDataFilesModel->addFiles(path); + //retrieve the files selected for the profile + ContentSelectorModel::ContentFileList items = mSelector->selectedFiles(); + + removeProfile (profileName); + + mGameSettings.remove(QString("content")); + + //set the value of the current profile (not necessarily the profile being saved!) + mLauncherSettings.setValue(QString("Profiles/currentprofile"), ui.profilesComboBox->currentText()); + + foreach(const ContentSelectorModel::EsmFile *item, items) { + mLauncherSettings.setMultiValue(QString("Profiles/") + profileName, item->fileName()); + mGameSettings.setMultiValue(QString("content"), item->fileName()); } - QString dataLocal = mGameSettings.getDataLocal(); - if (!dataLocal.isEmpty()) - mDataFilesModel->addFiles(dataLocal); +} - // Sort by date accessed for now - mDataFilesModel->sort(3); +void Launcher::DataFilesPage::buildView() +{ + ui.verticalLayout->insertWidget (0, mSelector->uiWidget()); - QStringList profiles = mLauncherSettings.subKeys(QString("Profiles/")); - QString profile = mLauncherSettings.value(QString("Profiles/currentprofile")); + //tool buttons + ui.newProfileButton->setToolTip ("Create a new profile"); + ui.deleteProfileButton->setToolTip ("Delete an existing profile"); - if (!profiles.isEmpty()) - profilesComboBox->addItems(profiles); + //combo box + ui.profilesComboBox->addItem ("Default"); + ui.profilesComboBox->setPlaceholderText (QString("Select a profile...")); - // Add the current profile if empty - if (profilesComboBox->findText(profile) == -1 && !profile.isEmpty()) - profilesComboBox->addItem(profile); + // Add the actions to the toolbuttons + ui.newProfileButton->setDefaultAction (ui.newProfileAction); + ui.deleteProfileButton->setDefaultAction (ui.deleteProfileAction); - if (profilesComboBox->findText(QString("Default")) == -1) - profilesComboBox->addItem(QString("Default")); + //establish connections + connect (ui.profilesComboBox, SIGNAL (currentIndexChanged(int)), + this, SLOT (slotProfileChanged(int))); - if (profile.isEmpty() || profile == QLatin1String("Default")) { - deleteProfileAction->setEnabled(false); - profilesComboBox->setEditEnabled(false); - profilesComboBox->setCurrentIndex(profilesComboBox->findText(QString("Default"))); - } else { - profilesComboBox->setEditEnabled(true); - profilesComboBox->setCurrentIndex(profilesComboBox->findText(profile)); + connect (ui.profilesComboBox, SIGNAL (profileRenamed(QString, QString)), + this, SLOT (slotProfileRenamed(QString, QString))); + + connect (ui.profilesComboBox, SIGNAL (signalProfileChanged(QString, QString)), + this, SLOT (slotProfileChangedByUser(QString, QString))); +} + +void Launcher::DataFilesPage::removeProfile(const QString &profile) +{ + mLauncherSettings.remove(QString("Profiles/") + profile); +} + +QAbstractItemModel *Launcher::DataFilesPage::profilesModel() const +{ + return ui.profilesComboBox->model(); +} + +int Launcher::DataFilesPage::profilesIndex() const +{ + return ui.profilesComboBox->currentIndex(); +} + +void Launcher::DataFilesPage::setProfile(int index, bool savePrevious) +{ + if (index >= -1 && index < ui.profilesComboBox->count()) + { + QString previous = ui.profilesComboBox->itemText(ui.profilesComboBox->currentIndex()); + QString current = ui.profilesComboBox->itemText(index); + + setProfile (previous, current, savePrevious); } +} - // We do this here to prevent deletion of profiles when initializing the combobox - connect(profilesComboBox, SIGNAL(profileRenamed(QString,QString)), this, SLOT(profileRenamed(QString,QString))); - connect(profilesComboBox, SIGNAL(profileChanged(QString,QString)), this, SLOT(profileChanged(QString,QString))); +void Launcher::DataFilesPage::setProfile (const QString &previous, const QString ¤t, bool savePrevious) +{ + //abort if no change (poss. duplicate signal) + if (previous == current) + return; + + if (!previous.isEmpty() && savePrevious) + saveSettings (previous); + + ui.profilesComboBox->setCurrentProfile (ui.profilesComboBox->findText (current)); loadSettings(); + checkForDefaultProfile(); } -void DataFilesPage::loadSettings() +void Launcher::DataFilesPage::slotProfileDeleted (const QString &item) { - QString profile = mLauncherSettings.value(QString("Profiles/currentprofile")); - - if (profile.isEmpty()) - return; - - mDataFilesModel->uncheckAll(); - - QStringList masters = mLauncherSettings.values(QString("Profiles/") + profile + QString("/master"), Qt::MatchExactly); - QStringList plugins = mLauncherSettings.values(QString("Profiles/") + profile + QString("/plugin"), Qt::MatchExactly); - - foreach (const QString &master, masters) { - QModelIndex index = mDataFilesModel->indexFromItem(mDataFilesModel->findItem(master)); - if (index.isValid()) - mDataFilesModel->setCheckState(index, Qt::Checked); - } - - foreach (const QString &plugin, plugins) { - QModelIndex index = mDataFilesModel->indexFromItem(mDataFilesModel->findItem(plugin)); - if (index.isValid()) - mDataFilesModel->setCheckState(index, Qt::Checked); - } + removeProfile (item); } -void DataFilesPage::saveSettings() +void Launcher::DataFilesPage::slotProfileChangedByUser(const QString &previous, const QString ¤t) { - if (mDataFilesModel->rowCount() < 1) + setProfile(previous, current, true); + emit signalProfileChanged (ui.profilesComboBox->findText(current)); +} + +void Launcher::DataFilesPage::slotProfileRenamed(const QString &previous, const QString ¤t) +{ + if (previous.isEmpty()) return; - QString profile = mLauncherSettings.value(QString("Profiles/currentprofile")); + // Save the new profile name + saveSettings(); - if (profile.isEmpty()) { - profile = profilesComboBox->currentText(); - mLauncherSettings.setValue(QString("Profiles/currentprofile"), profile); - } + // Remove the old one + removeProfile (previous); - mLauncherSettings.remove(QString("Profiles/") + profile + QString("/master")); - mLauncherSettings.remove(QString("Profiles/") + profile + QString("/plugin")); + loadSettings(); +} - mGameSettings.remove(QString("master")); - mGameSettings.remove(QString("plugin")); +void Launcher::DataFilesPage::slotProfileChanged(int index) +{ + setProfile (index, true); +} - QStringList items = mDataFilesModel->checkedItems(); +void Launcher::DataFilesPage::setupDataFiles() +{ + QStringList paths = mGameSettings.getDataDirs(); - foreach(const QString &item, items) { + foreach (const QString &path, paths) + mSelector->addFiles(path); - if (item.endsWith(QString(".esm"), Qt::CaseInsensitive)) { - mLauncherSettings.setMultiValue(QString("Profiles/") + profile + QString("/master"), item); - mGameSettings.setMultiValue(QString("master"), item); + mDataLocal = mGameSettings.getDataLocal(); - } else if (item.endsWith(QString(".esp"), Qt::CaseInsensitive)) { - mLauncherSettings.setMultiValue(QString("Profiles/") + profile + QString("/plugin"), item); - mGameSettings.setMultiValue(QString("plugin"), item); + if (!mDataLocal.isEmpty()) + mSelector->addFiles(mDataLocal); + + QStringList profiles; + QString currentProfile = mLauncherSettings.getSettings().value("Profiles/currentprofile"); + + foreach (QString key, mLauncherSettings.getSettings().keys()) + { + if (key.contains("Profiles/")) + { + QString profile = key.mid (9); + if (profile != "currentprofile") + { + if (!profiles.contains(profile)) + profiles << profile; + } } } + foreach (const QString &item, profiles) + addProfile (item, false); + + setProfile (ui.profilesComboBox->findText(currentProfile), false); + + loadSettings(); } -void DataFilesPage::updateOkButton(const QString &text) +void Launcher::DataFilesPage::on_newProfileAction_triggered() { - // We do this here because we need the profiles combobox text - if (text.isEmpty()) { - mNewProfileDialog->setOkButtonEnabled(false); - return; - } + TextInputDialog newDialog (tr("New Profile"), tr("Profile name:"), this); - (profilesComboBox->findText(text) == -1) - ? mNewProfileDialog->setOkButtonEnabled(true) - : mNewProfileDialog->setOkButtonEnabled(false); + if (newDialog.exec() != QDialog::Accepted) + return; + + QString profile = newDialog.getText(); + + if (profile.isEmpty()) + return; + + saveSettings(); + + mSelector->clearCheckStates(); + + addProfile(profile, true); + + mSelector->setGameFile(); + + saveSettings(); + + emit signalProfileChanged (ui.profilesComboBox->findText(profile)); } -void DataFilesPage::updateSplitter() +void Launcher::DataFilesPage::addProfile (const QString &profile, bool setAsCurrent) { - // Sigh, update the saved splitter size in settings only when moved - // Since getting mSplitter->sizes() if page is hidden returns invalid values - QList sizes = splitter->sizes(); + if (profile.isEmpty()) + return; - mLauncherSettings.setValue(QString("General/MastersTable/width"), QString::number(sizes.at(0))); - mLauncherSettings.setValue(QString("General/PluginsTable/width"), QString::number(sizes.at(1))); + if (ui.profilesComboBox->findText (profile) != -1) + return; + + ui.profilesComboBox->addItem (profile); + + if (setAsCurrent) + setProfile (ui.profilesComboBox->findText (profile), false); } -void DataFilesPage::updateViews() +void Launcher::DataFilesPage::on_deleteProfileAction_triggered() { - // Ensure the columns are hidden because sort() re-enables them - mastersTable->setColumnHidden(1, true); - mastersTable->setColumnHidden(2, true); - mastersTable->setColumnHidden(3, true); - mastersTable->setColumnHidden(4, true); - mastersTable->setColumnHidden(5, true); - mastersTable->setColumnHidden(6, true); - mastersTable->setColumnHidden(7, true); - mastersTable->setColumnHidden(8, true); - - pluginsTable->setColumnHidden(1, true); - pluginsTable->setColumnHidden(2, true); - pluginsTable->setColumnHidden(3, true); - pluginsTable->setColumnHidden(4, true); - pluginsTable->setColumnHidden(5, true); - pluginsTable->setColumnHidden(6, true); - pluginsTable->setColumnHidden(7, true); - pluginsTable->setColumnHidden(8, true); -} - -void DataFilesPage::setProfilesComboBoxIndex(int index) -{ - profilesComboBox->setCurrentIndex(index); -} - -void DataFilesPage::slotCurrentIndexChanged(int index) -{ - emit profileChanged(index); -} - -QAbstractItemModel* DataFilesPage::profilesComboBoxModel() -{ - return profilesComboBox->model(); -} - -int DataFilesPage::profilesComboBoxIndex() -{ - return profilesComboBox->currentIndex(); -} - -void DataFilesPage::on_newProfileAction_triggered() -{ - if (mNewProfileDialog->exec() == QDialog::Accepted) { - QString profile = mNewProfileDialog->lineEdit()->text(); - profilesComboBox->addItem(profile); - profilesComboBox->setCurrentIndex(profilesComboBox->findText(profile)); - } -} - -void DataFilesPage::on_deleteProfileAction_triggered() -{ - QString profile = profilesComboBox->currentText(); + QString profile = ui.profilesComboBox->currentText(); if (profile.isEmpty()) return; + if (!showDeleteMessageBox (profile)) + return; + + // Remove the profile from the combobox + ui.profilesComboBox->removeItem (ui.profilesComboBox->findText (profile)); + + removeProfile(profile); + + saveSettings(); + + loadSettings(); + + checkForDefaultProfile(); +} + +void Launcher::DataFilesPage::checkForDefaultProfile() +{ + //don't allow deleting "Default" profile + bool success = (ui.profilesComboBox->currentText() != "Default"); + + ui.deleteProfileAction->setEnabled (success); + ui.profilesComboBox->setEditEnabled (success); +} + +bool Launcher::DataFilesPage::showDeleteMessageBox (const QString &text) +{ QMessageBox msgBox(this); msgBox.setWindowTitle(tr("Delete Profile")); msgBox.setIcon(QMessageBox::Warning); msgBox.setStandardButtons(QMessageBox::Cancel); - msgBox.setText(tr("Are you sure you want to delete %0?").arg(profile)); + msgBox.setText(tr("Are you sure you want to delete %0?").arg(text)); QAbstractButton *deleteButton = msgBox.addButton(tr("Delete"), QMessageBox::ActionRole); msgBox.exec(); - if (msgBox.clickedButton() == deleteButton) { - mLauncherSettings.remove(QString("Profiles/") + profile + QString("/master")); - mLauncherSettings.remove(QString("Profiles/") + profile + QString("/plugin")); - - // Remove the profile from the combobox - profilesComboBox->removeItem(profilesComboBox->findText(profile)); - } -} - -void DataFilesPage::on_checkAction_triggered() -{ - if (pluginsTable->hasFocus()) - setPluginsCheckstates(Qt::Checked); - - if (mastersTable->hasFocus()) - setMastersCheckstates(Qt::Checked); - -} - -void DataFilesPage::on_uncheckAction_triggered() -{ - if (pluginsTable->hasFocus()) - setPluginsCheckstates(Qt::Unchecked); - - if (mastersTable->hasFocus()) - setMastersCheckstates(Qt::Unchecked); -} - -void DataFilesPage::setMastersCheckstates(Qt::CheckState state) -{ - if (!mastersTable->selectionModel()->hasSelection()) { - return; - } - - QModelIndexList indexes = mastersTable->selectionModel()->selectedIndexes(); - - foreach (const QModelIndex &index, indexes) - { - if (!index.isValid()) - return; - - QModelIndex sourceIndex = mMastersProxyModel->mapToSource(index); - - if (!sourceIndex.isValid()) - return; - - mDataFilesModel->setCheckState(sourceIndex, state); - } -} - -void DataFilesPage::setPluginsCheckstates(Qt::CheckState state) -{ - if (!pluginsTable->selectionModel()->hasSelection()) { - return; - } - - QModelIndexList indexes = pluginsTable->selectionModel()->selectedIndexes(); - - foreach (const QModelIndex &index, indexes) - { - if (!index.isValid()) - return; - - QModelIndex sourceIndex = mPluginsProxyModel->mapToSource( - mFilterProxyModel->mapToSource(index)); - - if (!sourceIndex.isValid()) - return; - - mDataFilesModel->setCheckState(sourceIndex, state); - } -} - -void DataFilesPage::setCheckState(QModelIndex index) -{ - if (!index.isValid()) - return; - - QObject *object = QObject::sender(); - - // Not a signal-slot call - if (!object) - return; - - - if (object->objectName() == QLatin1String("PluginsTable")) { - QModelIndex sourceIndex = mPluginsProxyModel->mapToSource( - mFilterProxyModel->mapToSource(index)); - - if (sourceIndex.isValid()) { - (mDataFilesModel->checkState(sourceIndex) == Qt::Checked) - ? mDataFilesModel->setCheckState(sourceIndex, Qt::Unchecked) - : mDataFilesModel->setCheckState(sourceIndex, Qt::Checked); - } - } - - if (object->objectName() == QLatin1String("MastersTable")) { - QModelIndex sourceIndex = mMastersProxyModel->mapToSource(index); - - if (sourceIndex.isValid()) { - (mDataFilesModel->checkState(sourceIndex) == Qt::Checked) - ? mDataFilesModel->setCheckState(sourceIndex, Qt::Unchecked) - : mDataFilesModel->setCheckState(sourceIndex, Qt::Checked); - } - } - - return; -} - -void DataFilesPage::filterChanged(const QString filter) -{ - QRegExp regExp(filter, Qt::CaseInsensitive, QRegExp::FixedString); - mFilterProxyModel->setFilterRegExp(regExp); -} - -void DataFilesPage::profileChanged(const QString &previous, const QString ¤t) -{ - // Prevent the deletion of the default profile - if (current == QLatin1String("Default")) { - deleteProfileAction->setEnabled(false); - profilesComboBox->setEditEnabled(false); - } else { - deleteProfileAction->setEnabled(true); - profilesComboBox->setEditEnabled(true); - } - - if (previous.isEmpty()) - return; - - if (profilesComboBox->findText(previous) == -1) - return; // Profile was deleted - - // Store the previous profile - mLauncherSettings.setValue(QString("Profiles/currentprofile"), previous); - saveSettings(); - mLauncherSettings.setValue(QString("Profiles/currentprofile"), current); - - loadSettings(); -} - -void DataFilesPage::profileRenamed(const QString &previous, const QString ¤t) -{ - if (previous.isEmpty()) - return; - - // Save the new profile name - mLauncherSettings.setValue(QString("Profiles/currentprofile"), current); - saveSettings(); - - // Remove the old one - mLauncherSettings.remove(QString("Profiles/") + previous + QString("/master")); - mLauncherSettings.remove(QString("Profiles/") + previous + QString("/plugin")); - - // Remove the profile from the combobox - profilesComboBox->removeItem(profilesComboBox->findText(previous)); - - loadSettings(); - -} - -void DataFilesPage::showContextMenu(const QPoint &point) -{ - QObject *object = QObject::sender(); - - // Not a signal-slot call - if (!object) - return; - - if (object->objectName() == QLatin1String("PluginsTable")) { - if (!pluginsTable->selectionModel()->hasSelection()) - return; - - QPoint globalPos = pluginsTable->mapToGlobal(point); - QModelIndexList indexes = pluginsTable->selectionModel()->selectedIndexes(); - - // Show the check/uncheck actions depending on the state of the selected items - uncheckAction->setEnabled(false); - checkAction->setEnabled(false); - - foreach (const QModelIndex &index, indexes) - { - if (!index.isValid()) - return; - - QModelIndex sourceIndex = mPluginsProxyModel->mapToSource( - mFilterProxyModel->mapToSource(index)); - - if (!sourceIndex.isValid()) - return; - - (mDataFilesModel->checkState(sourceIndex) == Qt::Checked) - ? uncheckAction->setEnabled(true) - : checkAction->setEnabled(true); - } - - // Show menu - mContextMenu->exec(globalPos); - } - - if (object->objectName() == QLatin1String("MastersTable")) { - if (!mastersTable->selectionModel()->hasSelection()) - return; - - QPoint globalPos = mastersTable->mapToGlobal(point); - QModelIndexList indexes = mastersTable->selectionModel()->selectedIndexes(); - - // Show the check/uncheck actions depending on the state of the selected items - uncheckAction->setEnabled(false); - checkAction->setEnabled(false); - - foreach (const QModelIndex &index, indexes) - { - if (!index.isValid()) - return; - - QModelIndex sourceIndex = mMastersProxyModel->mapToSource(index); - - if (!sourceIndex.isValid()) - return; - - (mDataFilesModel->checkState(sourceIndex) == Qt::Checked) - ? uncheckAction->setEnabled(true) - : checkAction->setEnabled(true); - } - - mContextMenu->exec(globalPos); - } + return (msgBox.clickedButton() == deleteButton); } diff --git a/apps/launcher/datafilespage.hpp b/apps/launcher/datafilespage.hpp index a0b029330..37603a210 100644 --- a/apps/launcher/datafilespage.hpp +++ b/apps/launcher/datafilespage.hpp @@ -1,88 +1,136 @@ #ifndef DATAFILESPAGE_H #define DATAFILESPAGE_H -#include -#include - #include "ui_datafilespage.h" +#include + + +#include +#include class QSortFilterProxyModel; class QAbstractItemModel; -class QAction; class QMenu; -class DataFilesModel; -class TextInputDialog; -class GameSettings; -class LauncherSettings; -class PluginsProxyModel; - namespace Files { struct ConfigurationManager; } +namespace ContentSelectorView { class ContentSelector; } -class DataFilesPage : public QWidget, private Ui::DataFilesPage +namespace Launcher { - Q_OBJECT + class TextInputDialog; + class GameSettings; + class LauncherSettings; + class ProfilesComboBox; -public: - DataFilesPage(Files::ConfigurationManager &cfg, GameSettings &gameSettings, LauncherSettings &launcherSettings, QWidget *parent = 0); + class DataFilesPage : public QWidget + { + Q_OBJECT - QAbstractItemModel* profilesComboBoxModel(); - int profilesComboBoxIndex(); + ContentSelectorView::ContentSelector *mSelector; + Ui::DataFilesPage ui; - void writeConfig(QString profile = QString()); - void saveSettings(); + public: + explicit DataFilesPage (Files::ConfigurationManager &cfg, GameSettings &gameSettings, + LauncherSettings &launcherSettings, QWidget *parent = 0); -signals: - void profileChanged(int index); + QAbstractItemModel* profilesModel() const; -public slots: - void setCheckState(QModelIndex index); - void setProfilesComboBoxIndex(int index); + int profilesIndex() const; - void filterChanged(const QString filter); - void showContextMenu(const QPoint &point); - void profileChanged(const QString &previous, const QString ¤t); - void profileRenamed(const QString &previous, const QString ¤t); - void updateOkButton(const QString &text); - void updateSplitter(); - void updateViews(); + //void writeConfig(QString profile = QString()); + void saveSettings(const QString &profile = ""); + void loadSettings(); - // Action slots - void on_newProfileAction_triggered(); - void on_deleteProfileAction_triggered(); - void on_checkAction_triggered(); - void on_uncheckAction_triggered(); + signals: + void signalProfileChanged (int index); -private slots: - void slotCurrentIndexChanged(int index); + public slots: + void slotProfileChanged (int index); -private: - DataFilesModel *mDataFilesModel; + private slots: - PluginsProxyModel *mPluginsProxyModel; - QSortFilterProxyModel *mMastersProxyModel; + void slotProfileChangedByUser(const QString &previous, const QString ¤t); + void slotProfileRenamed(const QString &previous, const QString ¤t); + void slotProfileDeleted(const QString &item); - QSortFilterProxyModel *mFilterProxyModel; + void on_newProfileAction_triggered(); + void on_deleteProfileAction_triggered(); - QMenu *mContextMenu; + private: - Files::ConfigurationManager &mCfgMgr; + QMenu *mContextMenu; - GameSettings &mGameSettings; - LauncherSettings &mLauncherSettings; + Files::ConfigurationManager &mCfgMgr; - TextInputDialog *mNewProfileDialog; + GameSettings &mGameSettings; + LauncherSettings &mLauncherSettings; - void setMastersCheckstates(Qt::CheckState state); - void setPluginsCheckstates(Qt::CheckState state); + QString mDataLocal; - void createActions(); - void setupDataFiles(); - void setupConfig(); - void readConfig(); + void setPluginsCheckstates(Qt::CheckState state); - void loadSettings(); + void buildView(); + void setupDataFiles(); + void setupConfig(); + void readConfig(); + void setProfile (int index, bool savePrevious); + void setProfile (const QString &previous, const QString ¤t, bool savePrevious); + void removeProfile (const QString &profile); + bool showDeleteMessageBox (const QString &text); + void addProfile (const QString &profile, bool setAsCurrent); + void checkForDefaultProfile(); -}; + class PathIterator + { + QStringList::ConstIterator mCitEnd; + QStringList::ConstIterator mCitCurrent; + QStringList::ConstIterator mCitBegin; + QString mFile; + QString mFilePath; + public: + PathIterator (const QStringList &list) + { + mCitBegin = list.constBegin(); + mCitCurrent = mCitBegin; + mCitEnd = list.constEnd(); + } + + QString findFirstPath (const QString &file) + { + mCitCurrent = mCitBegin; + mFile = file; + return path(); + } + + QString findNextPath () { return path(); } + + private: + + QString path () + { + bool success = false; + QDir dir; + QFileInfo file; + + while (!success) + { + if (mCitCurrent == mCitEnd) + break; + + dir.setPath (*(mCitCurrent++)); + file.setFile (dir.absoluteFilePath (mFile)); + + success = file.exists(); + } + + if (success) + return file.absoluteFilePath(); + + return ""; + } + + }; + }; +} #endif diff --git a/apps/launcher/graphicspage.cpp b/apps/launcher/graphicspage.cpp index 9308c1d57..8abdf0019 100644 --- a/apps/launcher/graphicspage.cpp +++ b/apps/launcher/graphicspage.cpp @@ -4,20 +4,19 @@ #include #include -#ifdef __APPLE__ +#ifdef MAC_OS_X_VERSION_MIN_REQUIRED +#undef MAC_OS_X_VERSION_MIN_REQUIRED // We need to do this because of Qt: https://bugreports.qt-project.org/browse/QTBUG-22154 #define MAC_OS_X_VERSION_MIN_REQUIRED __ENVIRONMENT_MAC_OS_X_VERSION_MIN_REQUIRED__ -#endif -#include +#endif // MAC_OS_X_VERSION_MIN_REQUIRED -#include +#include #include #include -#include -#include +#include #include "settings/graphicssettings.hpp" @@ -33,11 +32,12 @@ QString getAspect(int x, int y) return QString(QString::number(xaspect) + ":" + QString::number(yaspect)); } -GraphicsPage::GraphicsPage(Files::ConfigurationManager &cfg, GraphicsSettings &graphicsSetting, QWidget *parent) +Launcher::GraphicsPage::GraphicsPage(Files::ConfigurationManager &cfg, GraphicsSettings &graphicsSetting, QWidget *parent) : mCfgMgr(cfg) , mGraphicsSettings(graphicsSetting) , QWidget(parent) { + setObjectName ("GraphicsPage"); setupUi(this); // Set the maximum res we can set in windowed mode @@ -52,15 +52,11 @@ GraphicsPage::GraphicsPage(Files::ConfigurationManager &cfg, GraphicsSettings &g } -bool GraphicsPage::setupOgre() +bool Launcher::GraphicsPage::setupOgre() { - // Create a log manager so we can surpress debug text to stdout/stderr - Ogre::LogManager* logMgr = OGRE_NEW Ogre::LogManager; - logMgr->createLog((mCfgMgr.getLogPath().string() + "/launcherOgre.log"), true, false, false); - try { - mOgre = new Ogre::Root("", "", "./launcherOgre.log"); + mOgre = mOgreInit.init(mCfgMgr.getLogPath().string() + "/launcherOgre.log"); } catch(Ogre::Exception &ex) { @@ -78,40 +74,6 @@ bool GraphicsPage::setupOgre() return false; } - - std::string pluginDir; - const char* pluginEnv = getenv("OPENMW_OGRE_PLUGIN_DIR"); - if (pluginEnv) - pluginDir = pluginEnv; - else - { -#if OGRE_PLATFORM == OGRE_PLATFORM_WIN32 - pluginDir = ".\\"; -#endif -#if OGRE_PLATFORM == OGRE_PLATFORM_APPLE - pluginDir = OGRE_PLUGIN_DIR; -#endif -#if OGRE_PLATFORM == OGRE_PLATFORM_LINUX - pluginDir = OGRE_PLUGIN_DIR_REL; -#endif - } - - QDir dir(QString::fromStdString(pluginDir)); - pluginDir = dir.absolutePath().toStdString(); - - Files::loadOgrePlugin(pluginDir, "RenderSystem_GL", *mOgre); - Files::loadOgrePlugin(pluginDir, "RenderSystem_GL3Plus", *mOgre); - Files::loadOgrePlugin(pluginDir, "RenderSystem_Direct3D9", *mOgre); - -#ifdef ENABLE_PLUGIN_GL - mGLPlugin = new Ogre::GLPlugin(); - mOgre->installPlugin(mGLPlugin); -#endif -#ifdef ENABLE_PLUGIN_Direct3D9 - mD3D9Plugin = new Ogre::D3D9Plugin(); - mOgre->installPlugin(mD3D9Plugin); -#endif - // Get the available renderers and put them in the combobox const Ogre::RenderSystemList &renderers = mOgre->getAvailableRenderers(); @@ -133,7 +95,7 @@ bool GraphicsPage::setupOgre() msgBox.setIcon(QMessageBox::Critical); msgBox.setStandardButtons(QMessageBox::Ok); msgBox.setText(tr("
Could not select a valid render system

\ - Please make sure the plugins.cfg file exists and contains a valid rendering plugin.
")); + Please make sure Ogre plugins were installed correctly.
")); msgBox.exec(); return false; } @@ -156,7 +118,7 @@ bool GraphicsPage::setupOgre() return true; } -bool GraphicsPage::setupSDL() +bool Launcher::GraphicsPage::setupSDL() { int displays = SDL_GetNumVideoDisplays(); @@ -179,7 +141,7 @@ bool GraphicsPage::setupSDL() return true; } -bool GraphicsPage::loadSettings() +bool Launcher::GraphicsPage::loadSettings() { if (!setupSDL()) return false; @@ -218,7 +180,7 @@ bool GraphicsPage::loadSettings() return true; } -void GraphicsPage::saveSettings() +void Launcher::GraphicsPage::saveSettings() { vSyncCheckBox->checkState() ? mGraphicsSettings.setValue(QString("Video/vsync"), QString("true")) : mGraphicsSettings.setValue(QString("Video/vsync"), QString("false")); @@ -245,7 +207,7 @@ void GraphicsPage::saveSettings() mGraphicsSettings.setValue(QString("Video/screen"), QString::number(screenComboBox->currentIndex())); } -QStringList GraphicsPage::getAvailableOptions(const QString &key, Ogre::RenderSystem *renderer) +QStringList Launcher::GraphicsPage::getAvailableOptions(const QString &key, Ogre::RenderSystem *renderer) { QStringList result; @@ -278,7 +240,7 @@ QStringList GraphicsPage::getAvailableOptions(const QString &key, Ogre::RenderSy return result; } -QStringList GraphicsPage::getAvailableResolutions(int screen) +QStringList Launcher::GraphicsPage::getAvailableResolutions(int screen) { QStringList result; SDL_DisplayMode mode; @@ -325,7 +287,7 @@ QStringList GraphicsPage::getAvailableResolutions(int screen) return result; } -QRect GraphicsPage::getMaximumResolution() +QRect Launcher::GraphicsPage::getMaximumResolution() { QRect max; int screens = QApplication::desktop()->screenCount(); @@ -340,7 +302,7 @@ QRect GraphicsPage::getMaximumResolution() return max; } -void GraphicsPage::rendererChanged(const QString &renderer) +void Launcher::GraphicsPage::rendererChanged(const QString &renderer) { mSelectedRenderSystem = mOgre->getRenderSystemByName(renderer.toStdString()); @@ -349,7 +311,7 @@ void GraphicsPage::rendererChanged(const QString &renderer) antiAliasingComboBox->addItems(getAvailableOptions(QString("FSAA"), mSelectedRenderSystem)); } -void GraphicsPage::screenChanged(int screen) +void Launcher::GraphicsPage::screenChanged(int screen) { if (screen >= 0) { resolutionComboBox->clear(); @@ -357,7 +319,7 @@ void GraphicsPage::screenChanged(int screen) } } -void GraphicsPage::slotFullScreenChanged(int state) +void Launcher::GraphicsPage::slotFullScreenChanged(int state) { if (state == Qt::Checked) { standardRadioButton->toggle(); @@ -371,7 +333,7 @@ void GraphicsPage::slotFullScreenChanged(int state) } } -void GraphicsPage::slotStandardToggled(bool checked) +void Launcher::GraphicsPage::slotStandardToggled(bool checked) { if (checked) { resolutionComboBox->setEnabled(true); diff --git a/apps/launcher/graphicspage.hpp b/apps/launcher/graphicspage.hpp index d233ea12e..da4cb9fb3 100644 --- a/apps/launcher/graphicspage.hpp +++ b/apps/launcher/graphicspage.hpp @@ -5,62 +5,53 @@ #include #include -//#include -//#include -// Static plugin headers -#ifdef ENABLE_PLUGIN_GL -# include "OgreGLPlugin.h" -#endif -#ifdef ENABLE_PLUGIN_Direct3D9 -# include "OgreD3D9Plugin.h" -#endif +#include + #include "ui_graphicspage.h" -class GraphicsSettings; namespace Files { struct ConfigurationManager; } -class GraphicsPage : public QWidget, private Ui::GraphicsPage +namespace Launcher { - Q_OBJECT + class GraphicsSettings; -public: - GraphicsPage(Files::ConfigurationManager &cfg, GraphicsSettings &graphicsSettings, QWidget *parent = 0); + class GraphicsPage : public QWidget, private Ui::GraphicsPage + { + Q_OBJECT - void saveSettings(); - bool loadSettings(); + public: + GraphicsPage(Files::ConfigurationManager &cfg, GraphicsSettings &graphicsSettings, QWidget *parent = 0); -public slots: - void rendererChanged(const QString &renderer); - void screenChanged(int screen); + void saveSettings(); + bool loadSettings(); -private slots: - void slotFullScreenChanged(int state); - void slotStandardToggled(bool checked); + public slots: + void rendererChanged(const QString &renderer); + void screenChanged(int screen); -private: - Ogre::Root *mOgre; - Ogre::RenderSystem *mSelectedRenderSystem; - Ogre::RenderSystem *mOpenGLRenderSystem; - Ogre::RenderSystem *mDirect3DRenderSystem; - #ifdef ENABLE_PLUGIN_GL - Ogre::GLPlugin* mGLPlugin; - #endif - #ifdef ENABLE_PLUGIN_Direct3D9 - Ogre::D3D9Plugin* mD3D9Plugin; - #endif + private slots: + void slotFullScreenChanged(int state); + void slotStandardToggled(bool checked); - Files::ConfigurationManager &mCfgMgr; - GraphicsSettings &mGraphicsSettings; + private: + OgreInit::OgreInit mOgreInit; + Ogre::Root *mOgre; + Ogre::RenderSystem *mSelectedRenderSystem; + Ogre::RenderSystem *mOpenGLRenderSystem; + Ogre::RenderSystem *mDirect3DRenderSystem; - QStringList getAvailableOptions(const QString &key, Ogre::RenderSystem *renderer); - QStringList getAvailableResolutions(int screen); - QRect getMaximumResolution(); + Files::ConfigurationManager &mCfgMgr; + GraphicsSettings &mGraphicsSettings; - bool setupOgre(); - bool setupSDL(); -}; + QStringList getAvailableOptions(const QString &key, Ogre::RenderSystem *renderer); + QStringList getAvailableResolutions(int screen); + QRect getMaximumResolution(); + bool setupOgre(); + bool setupSDL(); + }; +} #endif diff --git a/apps/launcher/main.cpp b/apps/launcher/main.cpp index f67f5edcf..156bbf65b 100644 --- a/apps/launcher/main.cpp +++ b/apps/launcher/main.cpp @@ -3,15 +3,15 @@ #include #include -#ifdef __APPLE__ +#ifdef MAC_OS_X_VERSION_MIN_REQUIRED +#undef MAC_OS_X_VERSION_MIN_REQUIRED // We need to do this because of Qt: https://bugreports.qt-project.org/browse/QTBUG-22154 #define MAC_OS_X_VERSION_MIN_REQUIRED __ENVIRONMENT_MAC_OS_X_VERSION_MIN_REQUIRED__ -#endif +#endif // MAC_OS_X_VERSION_MIN_REQUIRED + #include #include "maindialog.hpp" -// SDL workaround -#include "graphicspage.hpp" int main(int argc, char *argv[]) { @@ -49,7 +49,7 @@ int main(int argc, char *argv[]) // Support non-latin characters QTextCodec::setCodecForCStrings(QTextCodec::codecForName("UTF-8")); - MainDialog mainWin; + Launcher::MainDialog mainWin; if (mainWin.setup()) { mainWin.show(); @@ -61,4 +61,3 @@ int main(int argc, char *argv[]) SDL_Quit(); return returnValue; } - diff --git a/apps/launcher/maindialog.cpp b/apps/launcher/maindialog.cpp index 032f70916..a6ac3d78d 100644 --- a/apps/launcher/maindialog.cpp +++ b/apps/launcher/maindialog.cpp @@ -1,5 +1,6 @@ #include "maindialog.hpp" +#include #include #include #include @@ -23,8 +24,8 @@ #include "graphicspage.hpp" #include "datafilespage.hpp" -MainDialog::MainDialog() - : mGameSettings(mCfgMgr) +Launcher::MainDialog::MainDialog(QWidget *parent) + : mGameSettings(mCfgMgr), QMainWindow (parent) { // Install the stylesheet font QFile file; @@ -69,7 +70,7 @@ MainDialog::MainDialog() createIcons(); } -void MainDialog::createIcons() +void Launcher::MainDialog::createIcons() { if (!QIcon::hasThemeIcon("document-new")) QIcon::setThemeName("tango"); @@ -101,15 +102,15 @@ void MainDialog::createIcons() } -void MainDialog::createPages() +void Launcher::MainDialog::createPages() { mPlayPage = new PlayPage(this); mGraphicsPage = new GraphicsPage(mCfgMgr, mGraphicsSettings, this); mDataFilesPage = new DataFilesPage(mCfgMgr, mGameSettings, mLauncherSettings, this); // Set the combobox of the play page to imitate the combobox on the datafilespage - mPlayPage->setProfilesComboBoxModel(mDataFilesPage->profilesComboBoxModel()); - mPlayPage->setProfilesComboBoxIndex(mDataFilesPage->profilesComboBoxIndex()); + mPlayPage->setProfilesModel(mDataFilesPage->profilesModel()); + mPlayPage->setProfilesIndex(mDataFilesPage->profilesIndex()); // Add the pages to the stacked widget pagesWidget->addWidget(mPlayPage); @@ -121,12 +122,12 @@ void MainDialog::createPages() connect(mPlayPage, SIGNAL(playButtonClicked()), this, SLOT(play())); - connect(mPlayPage, SIGNAL(profileChanged(int)), mDataFilesPage, SLOT(setProfilesComboBoxIndex(int))); - connect(mDataFilesPage, SIGNAL(profileChanged(int)), mPlayPage, SLOT(setProfilesComboBoxIndex(int))); + connect(mPlayPage, SIGNAL(signalProfileChanged(int)), mDataFilesPage, SLOT(slotProfileChanged(int))); + connect(mDataFilesPage, SIGNAL(signalProfileChanged(int)), mPlayPage, SLOT(setProfilesIndex(int))); } -bool MainDialog::showFirstRunDialog() +bool Launcher::MainDialog::showFirstRunDialog() { QStringList iniPaths; @@ -261,19 +262,11 @@ bool MainDialog::showFirstRunDialog() // Add a new profile if (msgBox.isChecked()) { mLauncherSettings.setValue(QString("Profiles/currentprofile"), QString("Imported")); + mLauncherSettings.remove(QString("Profiles/Imported/content")); - mLauncherSettings.remove(QString("Profiles/Imported/master")); - mLauncherSettings.remove(QString("Profiles/Imported/plugin")); - - QStringList masters = mGameSettings.values(QString("master")); - QStringList plugins = mGameSettings.values(QString("plugin")); - - foreach (const QString &master, masters) { - mLauncherSettings.setMultiValue(QString("Profiles/Imported/master"), master); - } - - foreach (const QString &plugin, plugins) { - mLauncherSettings.setMultiValue(QString("Profiles/Imported/plugin"), plugin); + QStringList contents = mGameSettings.values(QString("content")); + foreach (const QString &content, contents) { + mLauncherSettings.setMultiValue(QString("Profiles/Imported/content"), content); } } @@ -282,7 +275,7 @@ bool MainDialog::showFirstRunDialog() return true; } -bool MainDialog::setup() +bool Launcher::MainDialog::setup() { if (!setupLauncherSettings()) return false; @@ -311,15 +304,33 @@ bool MainDialog::setup() return true; } -void MainDialog::changePage(QListWidgetItem *current, QListWidgetItem *previous) +void Launcher::MainDialog::changePage(QListWidgetItem *current, QListWidgetItem *previous) { if (!current) current = previous; - pagesWidget->setCurrentIndex(iconWidget->row(current)); + int currentIndex = iconWidget->row(current); + int previousIndex = iconWidget->row(previous); + + pagesWidget->setCurrentIndex(currentIndex); + + DataFilesPage *previousPage = dynamic_cast(pagesWidget->widget(previousIndex)); + DataFilesPage *currentPage = dynamic_cast(pagesWidget->widget(currentIndex)); + + //special call to update/save data files page list view when it's displayed/hidden. + if (previousPage) + { + if (previousPage->objectName() == "DataFilesPage") + previousPage->saveSettings(); + } + else if (currentPage) + { + if (currentPage->objectName() == "DataFilesPage") + currentPage->loadSettings(); + } } -bool MainDialog::setupLauncherSettings() +bool Launcher::MainDialog::setupLauncherSettings() { mLauncherSettings.setMultiValueEnabled(true); @@ -356,7 +367,7 @@ bool MainDialog::setupLauncherSettings() } #ifndef WIN32 -bool expansions(UnshieldThread& cd) +bool Launcher::expansions(Launcher::UnshieldThread& cd) { if(cd.BloodmoonDone()) { @@ -367,7 +378,7 @@ bool expansions(UnshieldThread& cd) QMessageBox expansionsBox; expansionsBox.setText(QObject::tr("
Would you like to install expansions now ? (make sure you have the disc)
\ If you want to install both Bloodmoon and Tribunal, you have to install Tribunal first.
")); - + QAbstractButton* tribunalButton = NULL; if(!cd.TribunalDone()) tribunalButton = expansionsBox.addButton(QObject::tr("&Tribunal"), QMessageBox::ActionRole); @@ -386,7 +397,7 @@ bool expansions(UnshieldThread& cd) { TextSlotMsgBox cdbox; - cdbox.setStandardButtons(QMessageBox::Cancel); + cdbox.setStandardButtons(QMessageBox::Cancel); QObject::connect(&cd,SIGNAL(signalGUI(const QString&)), &cdbox, SLOT(setTextSlot(const QString&))); QObject::connect(&cd,SIGNAL(close()), &cdbox, SLOT(reject())); @@ -405,7 +416,7 @@ bool expansions(UnshieldThread& cd) { TextSlotMsgBox cdbox; - cdbox.setStandardButtons(QMessageBox::Cancel); + cdbox.setStandardButtons(QMessageBox::Cancel); QObject::connect(&cd,SIGNAL(signalGUI(const QString&)), &cdbox, SLOT(setTextSlot(const QString&))); QObject::connect(&cd,SIGNAL(close()), &cdbox, SLOT(reject())); @@ -427,11 +438,37 @@ bool expansions(UnshieldThread& cd) } #endif // WIN32 -bool MainDialog::setupGameSettings() +bool Launcher::MainDialog::setupGameSettings() { QString userPath = QString::fromStdString(mCfgMgr.getUserPath().string()); QString globalPath = QString::fromStdString(mCfgMgr.getGlobalPath().string()); + // Load the user config file first, separately + // So we can write it properly, uncontaminated + QString path = userPath + QLatin1String("openmw.cfg"); + QFile file(path); + + qDebug() << "Loading config file:" << qPrintable(path); + + if (file.exists()) { + if (!file.open(QIODevice::ReadOnly | QIODevice::Text)) { + QMessageBox msgBox; + msgBox.setWindowTitle(tr("Error opening OpenMW configuration file")); + msgBox.setIcon(QMessageBox::Critical); + msgBox.setStandardButtons(QMessageBox::Ok); + msgBox.setText(QObject::tr("
Could not open %0 for reading

\ + Please make sure you have the right permissions \ + and try again.
").arg(file.fileName())); + msgBox.exec(); + return false; + } + QTextStream stream(&file); + stream.setCodec(QTextCodec::codecForName("UTF-8")); + + mGameSettings.readUserFile(stream); + } + + // Now the rest QStringList paths; paths.append(userPath + QString("openmw.cfg")); paths.append(QString("openmw.cfg")); @@ -467,7 +504,7 @@ bool MainDialog::setupGameSettings() foreach (const QString path, mGameSettings.getDataDirs()) { QDir dir(path); QStringList filters; - filters << "*.esp" << "*.esm"; + filters << "*.esp" << "*.esm" << "*.omwgame" << "*.omwaddon"; if (!dir.entryList(filters).isEmpty()) dataDirs.append(path); @@ -485,12 +522,12 @@ bool MainDialog::setupGameSettings() QAbstractButton *dirSelectButton = msgBox.addButton(QObject::tr("Browse to &Install..."), QMessageBox::ActionRole); - + #ifndef WIN32 - QAbstractButton *cdSelectButton = + QAbstractButton *cdSelectButton = msgBox.addButton(QObject::tr("Browse to &CD..."), QMessageBox::ActionRole); #endif - + msgBox.exec(); @@ -505,14 +542,14 @@ bool MainDialog::setupGameSettings() #ifndef WIN32 else if(msgBox.clickedButton() == cdSelectButton) { UnshieldThread cd; - + { TextSlotMsgBox cdbox; - cdbox.setStandardButtons(QMessageBox::Cancel); + cdbox.setStandardButtons(QMessageBox::Cancel); QObject::connect(&cd,SIGNAL(signalGUI(const QString&)), &cdbox, SLOT(setTextSlot(const QString&))); QObject::connect(&cd,SIGNAL(close()), &cdbox, SLOT(reject())); - + cd.SetMorrowindPath( QFileDialog::getOpenFileName( NULL, @@ -526,11 +563,11 @@ bool MainDialog::setupGameSettings() QObject::tr("Select where to extract files to"), QDir::currentPath(), QFileDialog::ShowDirsOnly | QFileDialog::DontResolveSymlinks).toUtf8().constData()); - + cd.start(); cdbox.exec(); } - + while(expansions(cd)); selectedFile = QString::fromStdString(cd.GetMWEsmPath()); @@ -550,7 +587,7 @@ bool MainDialog::setupGameSettings() return true; } -bool MainDialog::setupGraphicsSettings() +bool Launcher::MainDialog::setupGraphicsSettings() { mGraphicsSettings.setMultiValueEnabled(false); @@ -604,7 +641,7 @@ bool MainDialog::setupGraphicsSettings() return true; } -void MainDialog::loadSettings() +void Launcher::MainDialog::loadSettings() { int width = mLauncherSettings.value(QString("General/MainWindow/width")).toInt(); int height = mLauncherSettings.value(QString("General/MainWindow/height")).toInt(); @@ -616,7 +653,7 @@ void MainDialog::loadSettings() move(posX, posY); } -void MainDialog::saveSettings() +void Launcher::MainDialog::saveSettings() { QString width = QString::number(this->width()); QString height = QString::number(this->height()); @@ -634,7 +671,7 @@ void MainDialog::saveSettings() } -bool MainDialog::writeSettings() +bool Launcher::MainDialog::writeSettings() { // Now write all config files saveSettings(); @@ -727,13 +764,13 @@ bool MainDialog::writeSettings() return true; } -void MainDialog::closeEvent(QCloseEvent *event) +void Launcher::MainDialog::closeEvent(QCloseEvent *event) { writeSettings(); event->accept(); } -void MainDialog::play() +void Launcher::MainDialog::play() { if (!writeSettings()) { qApp->quit(); @@ -742,11 +779,11 @@ void MainDialog::play() if(!mGameSettings.hasMaster()) { QMessageBox msgBox; - msgBox.setWindowTitle(tr("No master file selected")); + msgBox.setWindowTitle(tr("No game file selected")); msgBox.setIcon(QMessageBox::Warning); msgBox.setStandardButtons(QMessageBox::Ok); - msgBox.setText(tr("
You do not have any master files selected.

\ - OpenMW will not start without a master file selected.
")); + msgBox.setText(tr("
You do not have no game file selected.

\ + OpenMW will not start without a game file selected.
")); msgBox.exec(); return; } @@ -756,7 +793,7 @@ void MainDialog::play() qApp->quit(); } -bool MainDialog::startProgram(const QString &name, const QStringList &arguments, bool detached) +bool Launcher::MainDialog::startProgram(const QString &name, const QStringList &arguments, bool detached) { QString path = name; #ifdef Q_OS_WIN diff --git a/apps/launcher/maindialog.hpp b/apps/launcher/maindialog.hpp index 824dff6e8..5b8e4908e 100644 --- a/apps/launcher/maindialog.hpp +++ b/apps/launcher/maindialog.hpp @@ -11,57 +11,59 @@ #include "ui_mainwindow.h" -class QListWidget; class QListWidgetItem; -class QStackedWidget; -class QStringList; -class QStringListModel; -class QString; -class PlayPage; -class GraphicsPage; -class DataFilesPage; - -class MainDialog : public QMainWindow, private Ui::MainWindow +namespace Launcher { - Q_OBJECT - -public: - MainDialog(); - bool setup(); - bool showFirstRunDialog(); - -public slots: - void changePage(QListWidgetItem *current, QListWidgetItem *previous); - void play(); - -private: - void createIcons(); - void createPages(); - - bool setupLauncherSettings(); - bool setupGameSettings(); - bool setupGraphicsSettings(); - - void loadSettings(); - void saveSettings(); - bool writeSettings(); - - inline bool startProgram(const QString &name, bool detached = false) { return startProgram(name, QStringList(), detached); } - bool startProgram(const QString &name, const QStringList &arguments, bool detached = false); - - void closeEvent(QCloseEvent *event); - - PlayPage *mPlayPage; - GraphicsPage *mGraphicsPage; - DataFilesPage *mDataFilesPage; - - Files::ConfigurationManager mCfgMgr; - - GameSettings mGameSettings; - GraphicsSettings mGraphicsSettings; - LauncherSettings mLauncherSettings; - -}; + class PlayPage; + class GraphicsPage; + class DataFilesPage; + class UnshieldThread; +#ifndef WIN32 + bool expansions(Launcher::UnshieldThread& cd); +#endif + + class MainDialog : public QMainWindow, private Ui::MainWindow + { + Q_OBJECT + + public: + explicit MainDialog(QWidget *parent = 0); + bool setup(); + bool showFirstRunDialog(); + + public slots: + void changePage(QListWidgetItem *current, QListWidgetItem *previous); + void play(); + + private: + void createIcons(); + void createPages(); + + bool setupLauncherSettings(); + bool setupGameSettings(); + bool setupGraphicsSettings(); + + void loadSettings(); + void saveSettings(); + bool writeSettings(); + + inline bool startProgram(const QString &name, bool detached = false) { return startProgram(name, QStringList(), detached); } + bool startProgram(const QString &name, const QStringList &arguments, bool detached = false); + + void closeEvent(QCloseEvent *event); + + PlayPage *mPlayPage; + GraphicsPage *mGraphicsPage; + DataFilesPage *mDataFilesPage; + + Files::ConfigurationManager mCfgMgr; + + GameSettings mGameSettings; + GraphicsSettings mGraphicsSettings; + LauncherSettings mLauncherSettings; + + }; +} #endif diff --git a/apps/launcher/playpage.cpp b/apps/launcher/playpage.cpp index 46900c595..6cfb9686f 100644 --- a/apps/launcher/playpage.cpp +++ b/apps/launcher/playpage.cpp @@ -6,8 +6,9 @@ #include #endif -PlayPage::PlayPage(QWidget *parent) : QWidget(parent) +Launcher::PlayPage::PlayPage(QWidget *parent) : QWidget(parent) { + setObjectName ("PlayPage"); setupUi(this); // Hacks to get the stylesheet look properly @@ -17,27 +18,22 @@ PlayPage::PlayPage(QWidget *parent) : QWidget(parent) #endif profilesComboBox->setView(new QListView()); - connect(profilesComboBox, SIGNAL(currentIndexChanged(int)), this, SLOT(slotCurrentIndexChanged(int))); + connect(profilesComboBox, SIGNAL(activated(int)), this, SIGNAL (signalProfileChanged(int))); connect(playButton, SIGNAL(clicked()), this, SLOT(slotPlayClicked())); } -void PlayPage::setProfilesComboBoxModel(QAbstractItemModel *model) +void Launcher::PlayPage::setProfilesModel(QAbstractItemModel *model) { profilesComboBox->setModel(model); } -void PlayPage::setProfilesComboBoxIndex(int index) +void Launcher::PlayPage::setProfilesIndex(int index) { profilesComboBox->setCurrentIndex(index); } -void PlayPage::slotCurrentIndexChanged(int index) -{ - emit profileChanged(index); -} - -void PlayPage::slotPlayClicked() +void Launcher::PlayPage::slotPlayClicked() { emit playButtonClicked(); } diff --git a/apps/launcher/playpage.hpp b/apps/launcher/playpage.hpp index 4306396bd..1dc5bb0fe 100644 --- a/apps/launcher/playpage.hpp +++ b/apps/launcher/playpage.hpp @@ -9,27 +9,28 @@ class QComboBox; class QPushButton; class QAbstractItemModel; -class PlayPage : public QWidget, private Ui::PlayPage +namespace Launcher { - Q_OBJECT + class PlayPage : public QWidget, private Ui::PlayPage + { + Q_OBJECT -public: - PlayPage(QWidget *parent = 0); - void setProfilesComboBoxModel(QAbstractItemModel *model); + public: + PlayPage(QWidget *parent = 0); + void setProfilesModel(QAbstractItemModel *model); -signals: - void profileChanged(int index); - void playButtonClicked(); + signals: + void signalProfileChanged(int index); + void playButtonClicked(); -public slots: - void setProfilesComboBoxIndex(int index); + public slots: + void setProfilesIndex(int index); -private slots: - void slotCurrentIndexChanged(int index); - void slotPlayClicked(); + private slots: + void slotPlayClicked(); -}; - + }; +} #endif diff --git a/apps/launcher/settings/gamesettings.cpp b/apps/launcher/settings/gamesettings.cpp index 205879bc3..e7e5cf1ea 100644 --- a/apps/launcher/settings/gamesettings.cpp +++ b/apps/launcher/settings/gamesettings.cpp @@ -9,6 +9,7 @@ #include #include + /** * Workaround for problems with whitespaces in paths in older versions of Boost library */ @@ -26,16 +27,16 @@ namespace boost #endif /* (BOOST_VERSION <= 104600) */ -GameSettings::GameSettings(Files::ConfigurationManager &cfg) +Launcher::GameSettings::GameSettings(Files::ConfigurationManager &cfg) : mCfgMgr(cfg) { } -GameSettings::~GameSettings() +Launcher::GameSettings::~GameSettings() { } -void GameSettings::validatePaths() +void Launcher::GameSettings::validatePaths() { if (mSettings.isEmpty() || !mDataDirs.isEmpty()) return; // Don't re-validate paths if they are already parsed @@ -81,14 +82,24 @@ void GameSettings::validatePaths() } } -QStringList GameSettings::values(const QString &key, const QStringList &defaultValues) +QStringList Launcher::GameSettings::values(const QString &key, const QStringList &defaultValues) { if (!mSettings.values(key).isEmpty()) return mSettings.values(key); return defaultValues; } -bool GameSettings::readFile(QTextStream &stream) +bool Launcher::GameSettings::readFile(QTextStream &stream) +{ + return readFile(stream, mSettings); +} + +bool Launcher::GameSettings::readUserFile(QTextStream &stream) +{ + return readFile(stream, mUserSettings); +} + +bool Launcher::GameSettings::readFile(QTextStream &stream, QMap &settings) { QMap cache; QRegExp keyRe("^([^=]+)\\s*=\\s*(.+)$"); @@ -106,10 +117,10 @@ bool GameSettings::readFile(QTextStream &stream) // Don't remove existing data entries if (key != QLatin1String("data")) - mSettings.remove(key); + settings.remove(key); QStringList values = cache.values(key); - values.append(mSettings.values(key)); + values.append(settings.values(key)); if (!values.contains(value)) { cache.insertMulti(key, value); @@ -117,35 +128,36 @@ bool GameSettings::readFile(QTextStream &stream) } } - if (mSettings.isEmpty()) { - mSettings = cache; // This is the first time we read a file + if (settings.isEmpty()) { + settings = cache; // This is the first time we read a file validatePaths(); return true; } // Merge the changed keys with those which didn't - mSettings.unite(cache); + settings.unite(cache); validatePaths(); return true; } -bool GameSettings::writeFile(QTextStream &stream) + +bool Launcher::GameSettings::writeFile(QTextStream &stream) { // Iterate in reverse order to preserve insertion order - QMapIterator i(mSettings); + QMapIterator i(mUserSettings); i.toBack(); while (i.hasPrevious()) { i.previous(); - if (i.key() == QLatin1String("master") || i.key() == QLatin1String("plugin")) + if (i.key() == QLatin1String("content")) continue; // Quote paths with spaces if (i.key() == QLatin1String("data") - || i.key() == QLatin1String("data-local") - || i.key() == QLatin1String("resources")) + || i.key() == QLatin1String("data-local") + || i.key() == QLatin1String("resources")) { if (i.value().contains(QChar(' '))) { @@ -161,15 +173,24 @@ bool GameSettings::writeFile(QTextStream &stream) } - QStringList masters = mSettings.values(QString("master")); - for (int i = masters.count(); i--;) { - stream << "master=" << masters.at(i) << "\n"; - } - - QStringList plugins = mSettings.values(QString("plugin")); - for (int i = plugins.count(); i--;) { - stream << "plugin=" << plugins.at(i) << "\n"; + QStringList content = mUserSettings.values(QString("content")); + for (int i = content.count(); i--;) { + stream << "content=" << content.at(i) << "\n"; } return true; } + +bool Launcher::GameSettings::hasMaster() +{ + bool result = false; + QStringList content = mSettings.values(QString("content")); + for (int i = 0; i < content.count(); ++i) { + if (content.at(i).contains(".omwgame") || content.at(i).contains(".esm")) { + result = true; + break; + } + } + + return result; +} diff --git a/apps/launcher/settings/gamesettings.hpp b/apps/launcher/settings/gamesettings.hpp index 55b2107e2..df8215074 100644 --- a/apps/launcher/settings/gamesettings.hpp +++ b/apps/launcher/settings/gamesettings.hpp @@ -8,55 +8,72 @@ #include -namespace Files { typedef std::vector PathContainer; - struct ConfigurationManager;} - -class GameSettings +namespace Files { -public: - GameSettings(Files::ConfigurationManager &cfg); - ~GameSettings(); + typedef std::vector PathContainer; + struct ConfigurationManager; +} - inline QString value(const QString &key, const QString &defaultValue = QString()) +namespace Launcher +{ + class GameSettings { - return mSettings.value(key).isEmpty() ? defaultValue : mSettings.value(key); - } + public: + GameSettings(Files::ConfigurationManager &cfg); + ~GameSettings(); + + inline QString value(const QString &key, const QString &defaultValue = QString()) + { + return mSettings.value(key).isEmpty() ? defaultValue : mSettings.value(key); + } - inline void setValue(const QString &key, const QString &value) - { - mSettings.insert(key, value); - } + inline void setValue(const QString &key, const QString &value) + { + mSettings.insert(key, value); + mUserSettings.insert(key, value); + } - inline void setMultiValue(const QString &key, const QString &value) - { - QStringList values = mSettings.values(key); - if (!values.contains(value)) - mSettings.insertMulti(key, value); - } + inline void setMultiValue(const QString &key, const QString &value) + { + QStringList values = mSettings.values(key); + if (!values.contains(value)) + mSettings.insertMulti(key, value); - inline void remove(const QString &key) - { - mSettings.remove(key); - } + values = mUserSettings.values(key); + if (!values.contains(value)) + mUserSettings.insertMulti(key, value); + } - inline QStringList getDataDirs() { return mDataDirs; } - inline void addDataDir(const QString &dir) { if(!dir.isEmpty()) mDataDirs.append(dir); } - inline QString getDataLocal() {return mDataLocal; } - inline bool hasMaster() { return mSettings.count(QString("master")) > 0; } + inline void remove(const QString &key) + { + mSettings.remove(key); + mUserSettings.remove(key); + } - QStringList values(const QString &key, const QStringList &defaultValues = QStringList()); - bool readFile(QTextStream &stream); - bool writeFile(QTextStream &stream); + inline QStringList getDataDirs() { return mDataDirs; } + inline void addDataDir(const QString &dir) { if(!dir.isEmpty()) mDataDirs.append(dir); } + inline QString getDataLocal() {return mDataLocal; } -private: - Files::ConfigurationManager &mCfgMgr; + bool hasMaster(); - void validatePaths(); - QMap mSettings; + QStringList values(const QString &key, const QStringList &defaultValues = QStringList()); - QStringList mDataDirs; - QString mDataLocal; -}; + bool readFile(QTextStream &stream); + bool readFile(QTextStream &stream, QMap &settings); + bool readUserFile(QTextStream &stream); + bool writeFile(QTextStream &stream); + + private: + Files::ConfigurationManager &mCfgMgr; + + void validatePaths(); + QMap mSettings; + QMap mUserSettings; + + QStringList mDataDirs; + QString mDataLocal; + }; +} #endif // GAMESETTINGS_HPP diff --git a/apps/launcher/settings/graphicssettings.cpp b/apps/launcher/settings/graphicssettings.cpp index 0c5580091..9dad3dee6 100644 --- a/apps/launcher/settings/graphicssettings.cpp +++ b/apps/launcher/settings/graphicssettings.cpp @@ -5,15 +5,15 @@ #include #include -GraphicsSettings::GraphicsSettings() +Launcher::GraphicsSettings::GraphicsSettings() { } -GraphicsSettings::~GraphicsSettings() +Launcher::GraphicsSettings::~GraphicsSettings() { } -bool GraphicsSettings::writeFile(QTextStream &stream) +bool Launcher::GraphicsSettings::writeFile(QTextStream &stream) { QString sectionPrefix; QRegExp sectionRe("([^/]+)/(.+)$"); diff --git a/apps/launcher/settings/graphicssettings.hpp b/apps/launcher/settings/graphicssettings.hpp index 3e8617849..6f7c13547 100644 --- a/apps/launcher/settings/graphicssettings.hpp +++ b/apps/launcher/settings/graphicssettings.hpp @@ -3,14 +3,16 @@ #include "settingsbase.hpp" -class GraphicsSettings : public SettingsBase > +namespace Launcher { -public: - GraphicsSettings(); - ~GraphicsSettings(); + class GraphicsSettings : public SettingsBase > + { + public: + GraphicsSettings(); + ~GraphicsSettings(); - bool writeFile(QTextStream &stream); - -}; + bool writeFile(QTextStream &stream); + }; +} #endif // GRAPHICSSETTINGS_HPP diff --git a/apps/launcher/settings/launchersettings.cpp b/apps/launcher/settings/launchersettings.cpp index 5d298e814..705453555 100644 --- a/apps/launcher/settings/launchersettings.cpp +++ b/apps/launcher/settings/launchersettings.cpp @@ -5,15 +5,17 @@ #include #include -LauncherSettings::LauncherSettings() +#include + +Launcher::LauncherSettings::LauncherSettings() { } -LauncherSettings::~LauncherSettings() +Launcher::LauncherSettings::~LauncherSettings() { } -QStringList LauncherSettings::values(const QString &key, Qt::MatchFlags flags) +QStringList Launcher::LauncherSettings::values(const QString &key, Qt::MatchFlags flags) { QMap settings = SettingsBase::getSettings(); @@ -34,7 +36,7 @@ QStringList LauncherSettings::values(const QString &key, Qt::MatchFlags flags) return result; } -QStringList LauncherSettings::subKeys(const QString &key) +QStringList Launcher::LauncherSettings::subKeys(const QString &key) { QMap settings = SettingsBase::getSettings(); QStringList keys = settings.uniqueKeys(); @@ -44,12 +46,9 @@ QStringList LauncherSettings::subKeys(const QString &key) QStringList result; foreach (const QString ¤tKey, keys) { - if (keyRe.indexIn(currentKey) != -1) { - QString prefixedKey = keyRe.cap(1); if(prefixedKey.startsWith(key)) { - QString subKey = prefixedKey.remove(key); if (!subKey.isEmpty()) result.append(subKey); @@ -61,7 +60,7 @@ QStringList LauncherSettings::subKeys(const QString &key) return result; } -bool LauncherSettings::writeFile(QTextStream &stream) +bool Launcher::LauncherSettings::writeFile(QTextStream &stream) { QString sectionPrefix; QRegExp sectionRe("([^/]+)/(.+)$"); diff --git a/apps/launcher/settings/launchersettings.hpp b/apps/launcher/settings/launchersettings.hpp index 60c6f86bc..8acc389a9 100644 --- a/apps/launcher/settings/launchersettings.hpp +++ b/apps/launcher/settings/launchersettings.hpp @@ -3,17 +3,19 @@ #include "settingsbase.hpp" -class LauncherSettings : public SettingsBase > +namespace Launcher { -public: - LauncherSettings(); - ~LauncherSettings(); + class LauncherSettings : public SettingsBase > + { + public: + LauncherSettings(); + ~LauncherSettings(); - QStringList subKeys(const QString &key); - QStringList values(const QString &key, Qt::MatchFlags flags = Qt::MatchExactly); + QStringList subKeys(const QString &key); + QStringList values(const QString &key, Qt::MatchFlags flags = Qt::MatchExactly); - bool writeFile(QTextStream &stream); - -}; + bool writeFile(QTextStream &stream); + }; +} #endif // LAUNCHERSETTINGS_HPP diff --git a/apps/launcher/settings/settingsbase.hpp b/apps/launcher/settings/settingsbase.hpp index ed8ada56c..3a1cf8e30 100644 --- a/apps/launcher/settings/settingsbase.hpp +++ b/apps/launcher/settings/settingsbase.hpp @@ -7,103 +7,105 @@ #include #include -template -class SettingsBase +namespace Launcher { - -public: - SettingsBase() { mMultiValue = false; } - ~SettingsBase() {} - - inline QString value(const QString &key, const QString &defaultValue = QString()) + template + class SettingsBase { - return mSettings.value(key).isEmpty() ? defaultValue : mSettings.value(key); - } - inline void setValue(const QString &key, const QString &value) - { - QStringList values = mSettings.values(key); - if (!values.contains(value)) - mSettings.insert(key, value); - } + public: + SettingsBase() { mMultiValue = false; } + ~SettingsBase() {} - inline void setMultiValue(const QString &key, const QString &value) - { - QStringList values = mSettings.values(key); - if (!values.contains(value)) - mSettings.insertMulti(key, value); - } + inline QString value(const QString &key, const QString &defaultValue = QString()) + { + return mSettings.value(key).isEmpty() ? defaultValue : mSettings.value(key); + } - inline void setMultiValueEnabled(bool enable) - { - mMultiValue = enable; - } + inline void setValue(const QString &key, const QString &value) + { + QStringList values = mSettings.values(key); + if (!values.contains(value)) + mSettings.insert(key, value); + } - inline void remove(const QString &key) - { - mSettings.remove(key); - } + inline void setMultiValue(const QString &key, const QString &value) + { + QStringList values = mSettings.values(key); + if (!values.contains(value)) + mSettings.insertMulti(key, value); + } - Map getSettings() {return mSettings;} + inline void setMultiValueEnabled(bool enable) + { + mMultiValue = enable; + } - bool readFile(QTextStream &stream) - { - mCache.clear(); + inline void remove(const QString &key) + { + mSettings.remove(key); + } - QString sectionPrefix; + Map getSettings() {return mSettings;} - QRegExp sectionRe("^\\[([^]]+)\\]"); - QRegExp keyRe("^([^=]+)\\s*=\\s*(.+)$"); + bool readFile(QTextStream &stream) + { + mCache.clear(); - while (!stream.atEnd()) { - QString line = stream.readLine(); + QString sectionPrefix; - if (line.isEmpty() || line.startsWith("#")) - continue; + QRegExp sectionRe("^\\[([^]]+)\\]"); + QRegExp keyRe("^([^=]+)\\s*=\\s*(.+)$"); - if (sectionRe.exactMatch(line)) { - sectionPrefix = sectionRe.cap(1); - sectionPrefix.append("/"); - continue; - } + while (!stream.atEnd()) { + QString line = stream.readLine(); - if (keyRe.indexIn(line) != -1) { + if (line.isEmpty() || line.startsWith("#")) + continue; - QString key = keyRe.cap(1).trimmed(); - QString value = keyRe.cap(2).trimmed(); + if (sectionRe.exactMatch(line)) { + sectionPrefix = sectionRe.cap(1); + sectionPrefix.append("/"); + continue; + } - if (!sectionPrefix.isEmpty()) - key.prepend(sectionPrefix); + if (keyRe.indexIn(line) != -1) { - mSettings.remove(key); + QString key = keyRe.cap(1).trimmed(); + QString value = keyRe.cap(2).trimmed(); - QStringList values = mCache.values(key); + if (!sectionPrefix.isEmpty()) + key.prepend(sectionPrefix); - if (!values.contains(value)) { - if (mMultiValue) { - mCache.insertMulti(key, value); - } else { - mCache.insert(key, value); + mSettings.remove(key); + + QStringList values = mCache.values(key); + + if (!values.contains(value)) { + if (mMultiValue) { + mCache.insertMulti(key, value); + } else { + mCache.insert(key, value); + } } } } - } - if (mSettings.isEmpty()) { - mSettings = mCache; // This is the first time we read a file + if (mSettings.isEmpty()) { + mSettings = mCache; // This is the first time we read a file + return true; + } + + // Merge the changed keys with those which didn't + mSettings.unite(mCache); return true; } - // Merge the changed keys with those which didn't - mSettings.unite(mCache); - return true; - } - -private: - Map mSettings; - Map mCache; - - bool mMultiValue; -}; + private: + Map mSettings; + Map mCache; + bool mMultiValue; + }; +} #endif // SETTINGSBASE_HPP diff --git a/apps/launcher/textslotmsgbox.cpp b/apps/launcher/textslotmsgbox.cpp index 0607d1cc6..62d9cf576 100644 --- a/apps/launcher/textslotmsgbox.cpp +++ b/apps/launcher/textslotmsgbox.cpp @@ -1,6 +1,6 @@ #include "textslotmsgbox.hpp" -void TextSlotMsgBox::setTextSlot(const QString& string) +void Launcher::TextSlotMsgBox::setTextSlot(const QString& string) { setText(string); } diff --git a/apps/launcher/textslotmsgbox.hpp b/apps/launcher/textslotmsgbox.hpp index a29e2c354..a0fefaa25 100644 --- a/apps/launcher/textslotmsgbox.hpp +++ b/apps/launcher/textslotmsgbox.hpp @@ -3,11 +3,13 @@ #include -class TextSlotMsgBox : public QMessageBox +namespace Launcher { -Q_OBJECT - public slots: - void setTextSlot(const QString& string); -}; - + class TextSlotMsgBox : public QMessageBox + { + Q_OBJECT + public slots: + void setTextSlot(const QString& string); + }; +} #endif diff --git a/apps/launcher/unshieldthread.cpp b/apps/launcher/unshieldthread.cpp index 69b241365..d0dbeb1bd 100644 --- a/apps/launcher/unshieldthread.cpp +++ b/apps/launcher/unshieldthread.cpp @@ -292,30 +292,30 @@ namespace } -bool UnshieldThread::SetMorrowindPath(const std::string& path) +bool Launcher::UnshieldThread::SetMorrowindPath(const std::string& path) { mMorrowindPath = path; return true; } -bool UnshieldThread::SetTribunalPath(const std::string& path) +bool Launcher::UnshieldThread::SetTribunalPath(const std::string& path) { mTribunalPath = path; return true; } -bool UnshieldThread::SetBloodmoonPath(const std::string& path) +bool Launcher::UnshieldThread::SetBloodmoonPath(const std::string& path) { mBloodmoonPath = path; return true; } -void UnshieldThread::SetOutputPath(const std::string& path) +void Launcher::UnshieldThread::SetOutputPath(const std::string& path) { mOutputPath = path; } -bool UnshieldThread::extract_file(Unshield* unshield, bfs::path output_dir, const char* prefix, int index) +bool Launcher::UnshieldThread::extract_file(Unshield* unshield, bfs::path output_dir, const char* prefix, int index) { bool success; bfs::path dirname; @@ -349,7 +349,7 @@ bool UnshieldThread::extract_file(Unshield* unshield, bfs::path output_dir, cons return success; } -void UnshieldThread::extract_cab(const bfs::path& cab, const bfs::path& output_dir, bool extract_ini) +void Launcher::UnshieldThread::extract_cab(const bfs::path& cab, const bfs::path& output_dir, bool extract_ini) { Unshield * unshield; unshield = unshield_open(cab.c_str()); @@ -369,7 +369,7 @@ void UnshieldThread::extract_cab(const bfs::path& cab, const bfs::path& output_d } -bool UnshieldThread::extract() +bool Launcher::UnshieldThread::extract() { bfs::path outputDataFilesDir = mOutputPath; outputDataFilesDir /= "Data Files"; @@ -475,7 +475,7 @@ bool UnshieldThread::extract() return true; } -void UnshieldThread::Done() +void Launcher::UnshieldThread::Done() { // Get rid of unnecessary files bfs::remove_all(mOutputPath / "extract-temp"); @@ -491,28 +491,28 @@ void UnshieldThread::Done() bfs::last_write_time(findFile(mOutputPath, "bloodmoon.esm"), getTime("3 June 2003")); } -std::string UnshieldThread::GetMWEsmPath() +std::string Launcher::UnshieldThread::GetMWEsmPath() { return findFile(mOutputPath / "Data Files", "morrowind.esm").string(); } -bool UnshieldThread::TribunalDone() +bool Launcher::UnshieldThread::TribunalDone() { return mTribunalDone; } -bool UnshieldThread::BloodmoonDone() +bool Launcher::UnshieldThread::BloodmoonDone() { return mBloodmoonDone; } -void UnshieldThread::run() +void Launcher::UnshieldThread::run() { extract(); emit close(); } -UnshieldThread::UnshieldThread() +Launcher::UnshieldThread::UnshieldThread() { unshield_set_log_level(0); mMorrowindDone = false; diff --git a/apps/launcher/unshieldthread.hpp b/apps/launcher/unshieldthread.hpp index 655cb5b53..de6a32b44 100644 --- a/apps/launcher/unshieldthread.hpp +++ b/apps/launcher/unshieldthread.hpp @@ -7,50 +7,52 @@ #include -class UnshieldThread : public QThread +namespace Launcher { - Q_OBJECT + class UnshieldThread : public QThread + { + Q_OBJECT - public: - bool SetMorrowindPath(const std::string& path); - bool SetTribunalPath(const std::string& path); - bool SetBloodmoonPath(const std::string& path); + public: + bool SetMorrowindPath(const std::string& path); + bool SetTribunalPath(const std::string& path); + bool SetBloodmoonPath(const std::string& path); - void SetOutputPath(const std::string& path); - - bool extract(); + void SetOutputPath(const std::string& path); - bool TribunalDone(); - bool BloodmoonDone(); + bool extract(); - void Done(); + bool TribunalDone(); + bool BloodmoonDone(); - std::string GetMWEsmPath(); + void Done(); - UnshieldThread(); + std::string GetMWEsmPath(); - private: + UnshieldThread(); - void extract_cab(const boost::filesystem::path& cab, const boost::filesystem::path& output_dir, bool extract_ini = false); - bool extract_file(Unshield* unshield, boost::filesystem::path output_dir, const char* prefix, int index); - - boost::filesystem::path mMorrowindPath; - boost::filesystem::path mTribunalPath; - boost::filesystem::path mBloodmoonPath; + private: - bool mMorrowindDone; - bool mTribunalDone; - bool mBloodmoonDone; + void extract_cab(const boost::filesystem::path& cab, const boost::filesystem::path& output_dir, bool extract_ini = false); + bool extract_file(Unshield* unshield, boost::filesystem::path output_dir, const char* prefix, int index); - boost::filesystem::path mOutputPath; + boost::filesystem::path mMorrowindPath; + boost::filesystem::path mTribunalPath; + boost::filesystem::path mBloodmoonPath; + + bool mMorrowindDone; + bool mTribunalDone; + bool mBloodmoonDone; + + boost::filesystem::path mOutputPath; - protected: - virtual void run(); - - signals: - void signalGUI(QString); - void close(); -}; + protected: + virtual void run(); + signals: + void signalGUI(QString); + void close(); + }; +} #endif diff --git a/apps/launcher/utils/checkablemessagebox.cpp b/apps/launcher/utils/checkablemessagebox.cpp index 41207a8de..2f775af57 100644 --- a/apps/launcher/utils/checkablemessagebox.cpp +++ b/apps/launcher/utils/checkablemessagebox.cpp @@ -54,72 +54,61 @@ Emulates the QMessageBox API with static conveniences. The message label can open external URLs. */ - -class CheckableMessageBoxPrivate -{ -public: - CheckableMessageBoxPrivate(QDialog *q) +Launcher::CheckableMessageBoxPrivate::CheckableMessageBoxPrivate(QDialog *q) : clickedButton(0) - { - QSizePolicy sizePolicy(QSizePolicy::Minimum, QSizePolicy::Preferred); +{ + QSizePolicy sizePolicy(QSizePolicy::Minimum, QSizePolicy::Preferred); - pixmapLabel = new QLabel(q); - sizePolicy.setHorizontalStretch(0); - sizePolicy.setVerticalStretch(0); - sizePolicy.setHeightForWidth(pixmapLabel->sizePolicy().hasHeightForWidth()); - pixmapLabel->setSizePolicy(sizePolicy); - pixmapLabel->setVisible(false); + pixmapLabel = new QLabel(q); + sizePolicy.setHorizontalStretch(0); + sizePolicy.setVerticalStretch(0); + sizePolicy.setHeightForWidth(pixmapLabel->sizePolicy().hasHeightForWidth()); + pixmapLabel->setSizePolicy(sizePolicy); + pixmapLabel->setVisible(false); - QSpacerItem *pixmapSpacer = - new QSpacerItem(0, 5, QSizePolicy::Minimum, QSizePolicy::MinimumExpanding); + QSpacerItem *pixmapSpacer = + new QSpacerItem(0, 5, QSizePolicy::Minimum, QSizePolicy::MinimumExpanding); - messageLabel = new QLabel(q); - messageLabel->setMinimumSize(QSize(300, 0)); - messageLabel->setWordWrap(true); - messageLabel->setOpenExternalLinks(true); - messageLabel->setTextInteractionFlags(Qt::LinksAccessibleByKeyboard|Qt::LinksAccessibleByMouse); + messageLabel = new QLabel(q); + messageLabel->setMinimumSize(QSize(300, 0)); + messageLabel->setWordWrap(true); + messageLabel->setOpenExternalLinks(true); + messageLabel->setTextInteractionFlags(Qt::LinksAccessibleByKeyboard|Qt::LinksAccessibleByMouse); - QSpacerItem *checkBoxRightSpacer = - new QSpacerItem(1, 1, QSizePolicy::Expanding, QSizePolicy::Minimum); - QSpacerItem *buttonSpacer = - new QSpacerItem(0, 1, QSizePolicy::Minimum, QSizePolicy::Minimum); + QSpacerItem *checkBoxRightSpacer = + new QSpacerItem(1, 1, QSizePolicy::Expanding, QSizePolicy::Minimum); + QSpacerItem *buttonSpacer = + new QSpacerItem(0, 1, QSizePolicy::Minimum, QSizePolicy::Minimum); - checkBox = new QCheckBox(q); - checkBox->setText(CheckableMessageBox::tr("Do not ask again")); + checkBox = new QCheckBox(q); + checkBox->setText(Launcher::CheckableMessageBox::tr("Do not ask again")); - buttonBox = new QDialogButtonBox(q); - buttonBox->setOrientation(Qt::Horizontal); - buttonBox->setStandardButtons(QDialogButtonBox::Cancel|QDialogButtonBox::Ok); + buttonBox = new QDialogButtonBox(q); + buttonBox->setOrientation(Qt::Horizontal); + buttonBox->setStandardButtons(QDialogButtonBox::Cancel|QDialogButtonBox::Ok); - QVBoxLayout *verticalLayout = new QVBoxLayout(); - verticalLayout->addWidget(pixmapLabel); - verticalLayout->addItem(pixmapSpacer); + QVBoxLayout *verticalLayout = new QVBoxLayout(); + verticalLayout->addWidget(pixmapLabel); + verticalLayout->addItem(pixmapSpacer); - QHBoxLayout *horizontalLayout_2 = new QHBoxLayout(); - horizontalLayout_2->addLayout(verticalLayout); - horizontalLayout_2->addWidget(messageLabel); + QHBoxLayout *horizontalLayout_2 = new QHBoxLayout(); + horizontalLayout_2->addLayout(verticalLayout); + horizontalLayout_2->addWidget(messageLabel); - QHBoxLayout *horizontalLayout = new QHBoxLayout(); - horizontalLayout->addWidget(checkBox); - horizontalLayout->addItem(checkBoxRightSpacer); + QHBoxLayout *horizontalLayout = new QHBoxLayout(); + horizontalLayout->addWidget(checkBox); + horizontalLayout->addItem(checkBoxRightSpacer); - QVBoxLayout *verticalLayout_2 = new QVBoxLayout(q); - verticalLayout_2->addLayout(horizontalLayout_2); - verticalLayout_2->addLayout(horizontalLayout); - verticalLayout_2->addItem(buttonSpacer); - verticalLayout_2->addWidget(buttonBox); - } + QVBoxLayout *verticalLayout_2 = new QVBoxLayout(q); + verticalLayout_2->addLayout(horizontalLayout_2); + verticalLayout_2->addLayout(horizontalLayout); + verticalLayout_2->addItem(buttonSpacer); + verticalLayout_2->addWidget(buttonBox); +} - QLabel *pixmapLabel; - QLabel *messageLabel; - QCheckBox *checkBox; - QDialogButtonBox *buttonBox; - QAbstractButton *clickedButton; -}; - -CheckableMessageBox::CheckableMessageBox(QWidget *parent) : +Launcher::CheckableMessageBox::CheckableMessageBox(QWidget *parent) : QDialog(parent), - d(new CheckableMessageBoxPrivate(this)) + d(new Launcher::CheckableMessageBoxPrivate(this)) { setModal(true); setWindowFlags(windowFlags() & ~Qt::WindowContextHelpButtonHint); @@ -129,102 +118,102 @@ CheckableMessageBox::CheckableMessageBox(QWidget *parent) : SLOT(slotClicked(QAbstractButton*))); } -CheckableMessageBox::~CheckableMessageBox() +Launcher::CheckableMessageBox::~CheckableMessageBox() { delete d; } -void CheckableMessageBox::slotClicked(QAbstractButton *b) +void Launcher::CheckableMessageBox::slotClicked(QAbstractButton *b) { d->clickedButton = b; } -QAbstractButton *CheckableMessageBox::clickedButton() const +QAbstractButton *Launcher::CheckableMessageBox::clickedButton() const { return d->clickedButton; } -QDialogButtonBox::StandardButton CheckableMessageBox::clickedStandardButton() const +QDialogButtonBox::StandardButton Launcher::CheckableMessageBox::clickedStandardButton() const { if (d->clickedButton) return d->buttonBox->standardButton(d->clickedButton); return QDialogButtonBox::NoButton; } -QString CheckableMessageBox::text() const +QString Launcher::CheckableMessageBox::text() const { return d->messageLabel->text(); } -void CheckableMessageBox::setText(const QString &t) +void Launcher::CheckableMessageBox::setText(const QString &t) { d->messageLabel->setText(t); } -QPixmap CheckableMessageBox::iconPixmap() const +QPixmap Launcher::CheckableMessageBox::iconPixmap() const { if (const QPixmap *p = d->pixmapLabel->pixmap()) return QPixmap(*p); return QPixmap(); } -void CheckableMessageBox::setIconPixmap(const QPixmap &p) +void Launcher::CheckableMessageBox::setIconPixmap(const QPixmap &p) { d->pixmapLabel->setPixmap(p); d->pixmapLabel->setVisible(!p.isNull()); } -bool CheckableMessageBox::isChecked() const +bool Launcher::CheckableMessageBox::isChecked() const { return d->checkBox->isChecked(); } -void CheckableMessageBox::setChecked(bool s) +void Launcher::CheckableMessageBox::setChecked(bool s) { d->checkBox->setChecked(s); } -QString CheckableMessageBox::checkBoxText() const +QString Launcher::CheckableMessageBox::checkBoxText() const { return d->checkBox->text(); } -void CheckableMessageBox::setCheckBoxText(const QString &t) +void Launcher::CheckableMessageBox::setCheckBoxText(const QString &t) { d->checkBox->setText(t); } -bool CheckableMessageBox::isCheckBoxVisible() const +bool Launcher::CheckableMessageBox::isCheckBoxVisible() const { return d->checkBox->isVisible(); } -void CheckableMessageBox::setCheckBoxVisible(bool v) +void Launcher::CheckableMessageBox::setCheckBoxVisible(bool v) { d->checkBox->setVisible(v); } -QDialogButtonBox::StandardButtons CheckableMessageBox::standardButtons() const +QDialogButtonBox::StandardButtons Launcher::CheckableMessageBox::standardButtons() const { return d->buttonBox->standardButtons(); } -void CheckableMessageBox::setStandardButtons(QDialogButtonBox::StandardButtons s) +void Launcher::CheckableMessageBox::setStandardButtons(QDialogButtonBox::StandardButtons s) { d->buttonBox->setStandardButtons(s); } -QPushButton *CheckableMessageBox::button(QDialogButtonBox::StandardButton b) const +QPushButton *Launcher::CheckableMessageBox::button(QDialogButtonBox::StandardButton b) const { return d->buttonBox->button(b); } -QPushButton *CheckableMessageBox::addButton(const QString &text, QDialogButtonBox::ButtonRole role) +QPushButton *Launcher::CheckableMessageBox::addButton(const QString &text, QDialogButtonBox::ButtonRole role) { return d->buttonBox->addButton(text, role); } -QDialogButtonBox::StandardButton CheckableMessageBox::defaultButton() const +QDialogButtonBox::StandardButton Launcher::CheckableMessageBox::defaultButton() const { foreach (QAbstractButton *b, d->buttonBox->buttons()) if (QPushButton *pb = qobject_cast(b)) @@ -233,7 +222,7 @@ QDialogButtonBox::StandardButton CheckableMessageBox::defaultButton() const return QDialogButtonBox::NoButton; } -void CheckableMessageBox::setDefaultButton(QDialogButtonBox::StandardButton s) +void Launcher::CheckableMessageBox::setDefaultButton(QDialogButtonBox::StandardButton s) { if (QPushButton *b = d->buttonBox->button(s)) { b->setDefault(true); @@ -242,7 +231,7 @@ void CheckableMessageBox::setDefaultButton(QDialogButtonBox::StandardButton s) } QDialogButtonBox::StandardButton -CheckableMessageBox::question(QWidget *parent, +Launcher::CheckableMessageBox::question(QWidget *parent, const QString &title, const QString &question, const QString &checkBoxText, @@ -263,7 +252,7 @@ CheckableMessageBox::question(QWidget *parent, return mb.clickedStandardButton(); } -QMessageBox::StandardButton CheckableMessageBox::dialogButtonBoxToMessageBoxButton(QDialogButtonBox::StandardButton db) +QMessageBox::StandardButton Launcher::CheckableMessageBox::dialogButtonBoxToMessageBoxButton(QDialogButtonBox::StandardButton db) { return static_cast(int(db)); } diff --git a/apps/launcher/utils/checkablemessagebox.hpp b/apps/launcher/utils/checkablemessagebox.hpp index 93fd43fe1..09a501b9c 100644 --- a/apps/launcher/utils/checkablemessagebox.hpp +++ b/apps/launcher/utils/checkablemessagebox.hpp @@ -34,67 +34,83 @@ #include #include -class CheckableMessageBoxPrivate; +class QCheckBox; -class CheckableMessageBox : public QDialog +namespace Launcher { - Q_OBJECT - Q_PROPERTY(QString text READ text WRITE setText) - Q_PROPERTY(QPixmap iconPixmap READ iconPixmap WRITE setIconPixmap) - Q_PROPERTY(bool isChecked READ isChecked WRITE setChecked) - Q_PROPERTY(QString checkBoxText READ checkBoxText WRITE setCheckBoxText) - Q_PROPERTY(QDialogButtonBox::StandardButtons buttons READ standardButtons WRITE setStandardButtons) - Q_PROPERTY(QDialogButtonBox::StandardButton defaultButton READ defaultButton WRITE setDefaultButton) + class CheckableMessageBoxPrivate + { + public: -public: - explicit CheckableMessageBox(QWidget *parent); - virtual ~CheckableMessageBox(); + QLabel *pixmapLabel; + QLabel *messageLabel; + QCheckBox *checkBox; + QDialogButtonBox *buttonBox; + QAbstractButton *clickedButton; - static QDialogButtonBox::StandardButton - question(QWidget *parent, - const QString &title, - const QString &question, - const QString &checkBoxText, - bool *checkBoxSetting, - QDialogButtonBox::StandardButtons buttons = QDialogButtonBox::Yes|QDialogButtonBox::No, - QDialogButtonBox::StandardButton defaultButton = QDialogButtonBox::No); + public: + CheckableMessageBoxPrivate(QDialog *q); + }; - QString text() const; - void setText(const QString &); + class CheckableMessageBox : public QDialog + { + Q_OBJECT + Q_PROPERTY(QString text READ text WRITE setText) + Q_PROPERTY(QPixmap iconPixmap READ iconPixmap WRITE setIconPixmap) + Q_PROPERTY(bool isChecked READ isChecked WRITE setChecked) + Q_PROPERTY(QString checkBoxText READ checkBoxText WRITE setCheckBoxText) + Q_PROPERTY(QDialogButtonBox::StandardButtons buttons READ standardButtons WRITE setStandardButtons) + Q_PROPERTY(QDialogButtonBox::StandardButton defaultButton READ defaultButton WRITE setDefaultButton) - bool isChecked() const; - void setChecked(bool s); + public: + explicit CheckableMessageBox(QWidget *parent); + virtual ~CheckableMessageBox(); - QString checkBoxText() const; - void setCheckBoxText(const QString &); + static QDialogButtonBox::StandardButton + question(QWidget *parent, + const QString &title, + const QString &question, + const QString &checkBoxText, + bool *checkBoxSetting, + QDialogButtonBox::StandardButtons buttons = QDialogButtonBox::Yes|QDialogButtonBox::No, + QDialogButtonBox::StandardButton defaultButton = QDialogButtonBox::No); - bool isCheckBoxVisible() const; - void setCheckBoxVisible(bool); + QString text() const; + void setText(const QString &); - QDialogButtonBox::StandardButtons standardButtons() const; - void setStandardButtons(QDialogButtonBox::StandardButtons s); - QPushButton *button(QDialogButtonBox::StandardButton b) const; - QPushButton *addButton(const QString &text, QDialogButtonBox::ButtonRole role); + bool isChecked() const; + void setChecked(bool s); - QDialogButtonBox::StandardButton defaultButton() const; - void setDefaultButton(QDialogButtonBox::StandardButton s); + QString checkBoxText() const; + void setCheckBoxText(const QString &); - // See static QMessageBox::standardPixmap() - QPixmap iconPixmap() const; - void setIconPixmap (const QPixmap &p); + bool isCheckBoxVisible() const; + void setCheckBoxVisible(bool); - // Query the result - QAbstractButton *clickedButton() const; - QDialogButtonBox::StandardButton clickedStandardButton() const; + QDialogButtonBox::StandardButtons standardButtons() const; + void setStandardButtons(QDialogButtonBox::StandardButtons s); + QPushButton *button(QDialogButtonBox::StandardButton b) const; + QPushButton *addButton(const QString &text, QDialogButtonBox::ButtonRole role); - // Conversion convenience - static QMessageBox::StandardButton dialogButtonBoxToMessageBoxButton(QDialogButtonBox::StandardButton); + QDialogButtonBox::StandardButton defaultButton() const; + void setDefaultButton(QDialogButtonBox::StandardButton s); -private slots: - void slotClicked(QAbstractButton *b); + // See static QMessageBox::standardPixmap() + QPixmap iconPixmap() const; + void setIconPixmap (const QPixmap &p); -private: - CheckableMessageBoxPrivate *d; -}; + // Query the result + QAbstractButton *clickedButton() const; + QDialogButtonBox::StandardButton clickedStandardButton() const; + // Conversion convenience + static QMessageBox::StandardButton dialogButtonBoxToMessageBoxButton(QDialogButtonBox::StandardButton); + + private slots: + void slotClicked(QAbstractButton *b); + + private: + CheckableMessageBoxPrivate *d; + }; +} #endif // CHECKABLEMESSAGEBOX_HPP diff --git a/components/fileorderlist/utils/lineedit.cpp b/apps/launcher/utils/lineedit.cpp similarity index 66% rename from components/fileorderlist/utils/lineedit.cpp rename to apps/launcher/utils/lineedit.cpp index b0f339589..348707580 100644 --- a/components/fileorderlist/utils/lineedit.cpp +++ b/apps/launcher/utils/lineedit.cpp @@ -1,10 +1,12 @@ -#include -#include - #include "lineedit.hpp" LineEdit::LineEdit(QWidget *parent) : QLineEdit(parent) +{ + setupClearButton(); +} + +void LineEdit::setupClearButton() { mClearButton = new QToolButton(this); QPixmap pixmap(":images/clear.png"); @@ -15,13 +17,6 @@ LineEdit::LineEdit(QWidget *parent) mClearButton->hide(); connect(mClearButton, SIGNAL(clicked()), this, SLOT(clear())); connect(this, SIGNAL(textChanged(const QString&)), this, SLOT(updateClearButton(const QString&))); - int frameWidth = style()->pixelMetric(QStyle::PM_DefaultFrameWidth); - - setObjectName(QString("LineEdit")); - setStyleSheet(QString("LineEdit { padding-right: %1px; } ").arg(mClearButton->sizeHint().width() + frameWidth + 1)); - QSize msz = minimumSizeHint(); - setMinimumSize(qMax(msz.width(), mClearButton->sizeHint().height() + frameWidth * 2 + 2), - qMax(msz.height(), mClearButton->sizeHint().height() + frameWidth * 2 + 2)); } void LineEdit::resizeEvent(QResizeEvent *) diff --git a/components/fileorderlist/utils/lineedit.hpp b/apps/launcher/utils/lineedit.hpp similarity index 83% rename from components/fileorderlist/utils/lineedit.hpp rename to apps/launcher/utils/lineedit.hpp index 14bd7b1b4..2dd7da32b 100644 --- a/components/fileorderlist/utils/lineedit.hpp +++ b/apps/launcher/utils/lineedit.hpp @@ -11,6 +11,9 @@ #define LINEEDIT_H #include +#include +#include +#include class QToolButton; @@ -18,6 +21,8 @@ class LineEdit : public QLineEdit { Q_OBJECT + QString mPlaceholderText; + public: LineEdit(QWidget *parent = 0); @@ -27,8 +32,10 @@ protected: private slots: void updateClearButton(const QString &text); -private: +protected: QToolButton *mClearButton; + + void setupClearButton(); }; #endif // LIENEDIT_H diff --git a/components/fileorderlist/utils/profilescombobox.cpp b/apps/launcher/utils/profilescombobox.cpp similarity index 70% rename from components/fileorderlist/utils/profilescombobox.cpp rename to apps/launcher/utils/profilescombobox.cpp index c3ff953ae..c14330724 100644 --- a/components/fileorderlist/utils/profilescombobox.cpp +++ b/apps/launcher/utils/profilescombobox.cpp @@ -5,18 +5,12 @@ #include #include "profilescombobox.hpp" -#include "comboboxlineedit.hpp" ProfilesComboBox::ProfilesComboBox(QWidget *parent) : - QComboBox(parent) + ContentSelectorView::ComboBox(parent) { - mValidator = new QRegExpValidator(QRegExp("^[a-zA-Z0-9_]*$"), this); // Alpha-numeric + underscore - setEditEnabled(true); - setValidator(mValidator); - setCompleter(0); - - connect(this, SIGNAL(currentIndexChanged(int)), this, - SLOT(slotIndexChanged(int))); + connect(this, SIGNAL(activated(int)), this, + SLOT(slotIndexChangedByUser(int))); setInsertPolicy(QComboBox::NoInsert); } @@ -37,6 +31,7 @@ void ProfilesComboBox::setEditEnabled(bool editable) setValidator(mValidator); ComboBoxLineEdit *edit = new ComboBoxLineEdit(this); + setLineEdit(edit); setCompleter(0); @@ -45,6 +40,9 @@ void ProfilesComboBox::setEditEnabled(bool editable) connect(lineEdit(), SIGNAL(textChanged(QString)), this, SLOT(slotTextChanged(QString))); + + connect (lineEdit(), SIGNAL(textChanged(QString)), this, + SIGNAL (signalProfileTextChanged (QString))); } void ProfilesComboBox::slotTextChanged(const QString &text) @@ -82,11 +80,20 @@ void ProfilesComboBox::slotEditingFinished() emit(profileRenamed(previous, current)); } -void ProfilesComboBox::slotIndexChanged(int index) +void ProfilesComboBox::slotIndexChangedByUser(int index) { if (index == -1) return; - emit(profileChanged(mOldProfile, currentText())); - mOldProfile = itemText(index); + emit (signalProfileChanged(mOldProfile, currentText())); + mOldProfile = currentText(); +} + +ProfilesComboBox::ComboBoxLineEdit::ComboBoxLineEdit (QWidget *parent) + : LineEdit (parent) +{ + int frameWidth = style()->pixelMetric(QStyle::PM_DefaultFrameWidth); + + setObjectName(QString("ComboBoxLineEdit")); + setStyleSheet(QString("ComboBoxLineEdit { background-color: transparent; padding-right: %1px; } ").arg(mClearButton->sizeHint().width() + frameWidth + 1)); } diff --git a/apps/launcher/utils/profilescombobox.hpp b/apps/launcher/utils/profilescombobox.hpp new file mode 100644 index 000000000..7b83c41b2 --- /dev/null +++ b/apps/launcher/utils/profilescombobox.hpp @@ -0,0 +1,47 @@ +#ifndef PROFILESCOMBOBOX_HPP +#define PROFILESCOMBOBOX_HPP + +#include "components/contentselector/view/combobox.hpp" +#include "lineedit.hpp" + +#include + +class QString; + +class ProfilesComboBox : public ContentSelectorView::ComboBox +{ + Q_OBJECT + +public: + class ComboBoxLineEdit : public LineEdit + { + public: + explicit ComboBoxLineEdit (QWidget *parent = 0); + }; + +public: + + explicit ProfilesComboBox(QWidget *parent = 0); + void setEditEnabled(bool editable); + void setCurrentProfile(int index) + { + ComboBox::setCurrentIndex(index); + mOldProfile = currentText(); + } + +signals: + void signalProfileTextChanged(const QString &item); + void signalProfileChanged(const QString &previous, const QString ¤t); + void signalProfileChanged(int index); + void profileRenamed(const QString &oldName, const QString &newName); + +private slots: + + void slotEditingFinished(); + void slotIndexChangedByUser(int index); + void slotTextChanged(const QString &text); + +private: + QString mOldProfile; +}; +#endif // PROFILESCOMBOBOX_HPP diff --git a/apps/launcher/utils/textinputdialog.cpp b/apps/launcher/utils/textinputdialog.cpp index a4b36b95e..76cbe32d0 100644 --- a/apps/launcher/utils/textinputdialog.cpp +++ b/apps/launcher/utils/textinputdialog.cpp @@ -7,19 +7,18 @@ #include #include -#include - -TextInputDialog::TextInputDialog(const QString& title, const QString &text, QWidget *parent) : +Launcher::TextInputDialog::TextInputDialog(const QString& title, const QString &text, QWidget *parent) : QDialog(parent) { setWindowFlags(windowFlags() & ~Qt::WindowContextHelpButtonHint); mButtonBox = new QDialogButtonBox(this); mButtonBox->addButton(QDialogButtonBox::Ok); mButtonBox->addButton(QDialogButtonBox::Cancel); + mButtonBox->button(QDialogButtonBox::Ok)->setEnabled (false); // Line edit QValidator *validator = new QRegExpValidator(QRegExp("^[a-zA-Z0-9_]*$"), this); // Alpha-numeric + underscore - mLineEdit = new LineEdit(this); + mLineEdit = new DialogLineEdit(this); mLineEdit->setValidator(validator); mLineEdit->setCompleter(0); @@ -38,34 +37,51 @@ TextInputDialog::TextInputDialog(const QString& title, const QString &text, QWid Q_UNUSED(title); #endif - setOkButtonEnabled(false); setModal(true); connect(mButtonBox, SIGNAL(accepted()), this, SLOT(accept())); connect(mButtonBox, SIGNAL(rejected()), this, SLOT(reject())); + connect(mLineEdit, SIGNAL(textChanged(QString)), this, SLOT(slotUpdateOkButton(QString))); } -int TextInputDialog::exec() +int Launcher::TextInputDialog::exec() { mLineEdit->clear(); mLineEdit->setFocus(); return QDialog::exec(); } -void TextInputDialog::setOkButtonEnabled(bool enabled) +QString Launcher::TextInputDialog::getText() const { - QPushButton *okButton = mButtonBox->button(QDialogButtonBox::Ok); - okButton->setEnabled(enabled); + return mLineEdit->text(); +} - QPalette *palette = new QPalette(); - palette->setColor(QPalette::Text,Qt::red); +void Launcher::TextInputDialog::slotUpdateOkButton(QString text) +{ + bool enabled = !(text.isEmpty()); + mButtonBox->button(QDialogButtonBox::Ok)->setEnabled(enabled); - if (enabled) { + if (enabled) mLineEdit->setPalette(QApplication::palette()); - } else { + else + { // Existing profile name, make the text red + QPalette *palette = new QPalette(); + palette->setColor(QPalette::Text,Qt::red); mLineEdit->setPalette(*palette); } +} + +Launcher::TextInputDialog::DialogLineEdit::DialogLineEdit (QWidget *parent) : + LineEdit (parent) +{ + int frameWidth = style()->pixelMetric(QStyle::PM_DefaultFrameWidth); + + setObjectName(QString("LineEdit")); + setStyleSheet(QString("LineEdit { padding-right: %1px; } ").arg(mClearButton->sizeHint().width() + frameWidth + 1)); + QSize msz = minimumSizeHint(); + setMinimumSize(qMax(msz.width(), mClearButton->sizeHint().height() + frameWidth * 2 + 2), + qMax(msz.height(), mClearButton->sizeHint().height() + frameWidth * 2 + 2)); } diff --git a/apps/launcher/utils/textinputdialog.hpp b/apps/launcher/utils/textinputdialog.hpp index cbb453ac8..bb01778be 100644 --- a/apps/launcher/utils/textinputdialog.hpp +++ b/apps/launcher/utils/textinputdialog.hpp @@ -2,27 +2,39 @@ #define TEXTINPUTDIALOG_HPP #include -//#include "lineedit.hpp" + +#include "lineedit.hpp" class QDialogButtonBox; -class LineEdit; -class TextInputDialog : public QDialog +namespace Launcher { - Q_OBJECT -public: - explicit TextInputDialog(const QString& title, const QString &text, QWidget *parent = 0); - inline LineEdit *lineEdit() { return mLineEdit; } - void setOkButtonEnabled(bool enabled); + class TextInputDialog : public QDialog + { + Q_OBJECT - LineEdit *mLineEdit; + class DialogLineEdit : public LineEdit + { + public: + explicit DialogLineEdit (QWidget *parent = 0); + }; - int exec(); + DialogLineEdit *mLineEdit; + QDialogButtonBox *mButtonBox; -private: - QDialogButtonBox *mButtonBox; + public: - -}; + explicit TextInputDialog(const QString& title, const QString &text, QWidget *parent = 0); + ~TextInputDialog () {} + + QString getText() const; + + int exec(); + + private slots: + void slotUpdateOkButton(QString text); + + }; +} #endif // TEXTINPUTDIALOG_HPP diff --git a/apps/mwiniimporter/importer.cpp b/apps/mwiniimporter/importer.cpp index 8732b3eab..b8b7e4c9d 100644 --- a/apps/mwiniimporter/importer.cpp +++ b/apps/mwiniimporter/importer.cpp @@ -813,8 +813,7 @@ void MwIniImporter::importArchives(multistrmap &cfg, const multistrmap &ini) con } void MwIniImporter::importGameFiles(multistrmap &cfg, const multistrmap &ini) const { - std::vector esmFiles; - std::vector espFiles; + std::vector contentFiles; std::string baseGameFile("Game Files:GameFile"); std::string gameFile(""); @@ -832,29 +831,19 @@ void MwIniImporter::importGameFiles(multistrmap &cfg, const multistrmap &ini) co std::string filetype(entry->substr(entry->length()-3)); Misc::StringUtils::toLower(filetype); - if(filetype.compare("esm") == 0) { - esmFiles.push_back(*entry); - } - else if(filetype.compare("esp") == 0) { - espFiles.push_back(*entry); + if(filetype.compare("esm") == 0 || filetype.compare("esp") == 0) { + contentFiles.push_back(*entry); } } gameFile = ""; } - cfg.erase("master"); - cfg.insert( std::make_pair > ("master", std::vector() ) ); + cfg.erase("content"); + cfg.insert( std::make_pair("content", std::vector() ) ); - for(std::vector::const_iterator it=esmFiles.begin(); it!=esmFiles.end(); ++it) { - cfg["master"].push_back(*it); - } - - cfg.erase("plugin"); - cfg.insert( std::make_pair > ("plugin", std::vector() ) ); - - for(std::vector::const_iterator it=espFiles.begin(); it!=espFiles.end(); ++it) { - cfg["plugin"].push_back(*it); + for(std::vector::const_iterator it=contentFiles.begin(); it!=contentFiles.end(); ++it) { + cfg["content"].push_back(*it); } } diff --git a/apps/opencs/CMakeLists.txt b/apps/opencs/CMakeLists.txt index f918cfebf..1197e2014 100644 --- a/apps/opencs/CMakeLists.txt +++ b/apps/opencs/CMakeLists.txt @@ -5,11 +5,11 @@ opencs_units (. editor) set (CMAKE_BUILD_TYPE DEBUG) opencs_units (model/doc - document + document operation saving ) opencs_units_noqt (model/doc - documentmanager + documentmanager stage savingstate savingstages ) opencs_hdrs_noqt (model/doc @@ -24,27 +24,27 @@ opencs_units (model/world opencs_units_noqt (model/world universalid record commands columnbase scriptcontext cell refidcollection - refidadapter refiddata refidadapterimp ref collectionbase refcollection columns + refidadapter refiddata refidadapterimp ref collectionbase refcollection columns infocollection ) opencs_hdrs_noqt (model/world - columnimp idcollection collection + columnimp idcollection collection info ) opencs_units (model/tools - tools operation reportmodel + tools reportmodel ) opencs_units_noqt (model/tools - stage verifier mandatoryid skillcheck classcheck factioncheck racecheck soundcheck regioncheck + mandatoryid skillcheck classcheck factioncheck racecheck soundcheck regioncheck birthsigncheck spellcheck ) opencs_units (view/doc - viewmanager view operations operation subview startup filedialog newgame filewidget - adjusterwidget + viewmanager view operations operation subview startup filedialog newgame + filewidget adjusterwidget ) @@ -60,13 +60,17 @@ opencs_hdrs_noqt (view/doc opencs_units (view/world table tablesubview scriptsubview util regionmapsubview tablebottombox creator genericcreator cellcreator referenceablecreator referencecreator scenesubview scenetoolbar scenetool - scenetoolmode + scenetoolmode infocreator ) +opencs_units (view/render + scenewidget + ) + opencs_units_noqt (view/world dialoguesubview subviews enumdelegate vartypedelegate recordstatusdelegate idtypedelegate datadisplaydelegate - scripthighlighter idvalidator + scripthighlighter idvalidator dialoguecreator ) @@ -124,11 +128,13 @@ opencs_units (view/filter set (OPENCS_US ) -set (OPENCS_RES ../../files/opencs/resources.qrc - ../../files/launcher/launcher.qrc +set (OPENCS_RES ${CMAKE_SOURCE_DIR}/files/opencs/resources.qrc + ${CMAKE_SOURCE_DIR}/files/launcher/launcher.qrc ) -set (OPENCS_UI ../../files/ui/datafilespage.ui +set (OPENCS_UI + ${CMAKE_SOURCE_DIR}/files/ui/contentselector.ui + ${CMAKE_SOURCE_DIR}/files/ui/filedialog.ui ) source_group (opencs FILES ${OPENCS_SRC} ${OPENCS_HDR}) @@ -146,15 +152,46 @@ qt4_add_resources(OPENCS_RES_SRC ${OPENCS_RES}) include_directories(${CMAKE_CURRENT_BINARY_DIR}) +if(APPLE) + set (OPENCS_MAC_ICON ${CMAKE_SOURCE_DIR}/files/mac/opencs.icns) +else() + set (OPENCS_MAC_ICON "") +endif(APPLE) + add_executable(opencs + MACOSX_BUNDLE ${OPENCS_SRC} ${OPENCS_UI_HDR} ${OPENCS_MOC_SRC} ${OPENCS_RES_SRC} + ${OPENCS_MAC_ICON} ) +if(APPLE) + set_target_properties(opencs PROPERTIES + RUNTIME_OUTPUT_DIRECTORY "${OpenMW_BINARY_DIR}" + OUTPUT_NAME "OpenCS" + MACOSX_BUNDLE_ICON_FILE "opencs.icns" + MACOSX_BUNDLE_BUNDLE_NAME "OpenCS" + MACOSX_BUNDLE_GUI_IDENTIFIER "org.openmw.opencs" + MACOSX_BUNDLE_SHORT_VERSION_STRING ${OPENMW_VERSION} + MACOSX_BUNDLE_BUNDLE_VERSION ${OPENMW_VERSION} + ) + + set_source_files_properties(${OPENCS_MAC_ICON} PROPERTIES + MACOSX_PACKAGE_LOCATION Resources) +endif(APPLE) + target_link_libraries(opencs ${Boost_LIBRARIES} ${QT_LIBRARIES} components ) + +if(DPKG_PROGRAM) + INSTALL(TARGETS opencs RUNTIME DESTINATION games COMPONENT opencs) +endif() + +if(APPLE) + INSTALL(TARGETS opencs BUNDLE DESTINATION OpenMW COMPONENT BUNDLE) +endif() diff --git a/apps/opencs/editor.cpp b/apps/opencs/editor.cpp index 9a6832ec0..1c1e37c2d 100644 --- a/apps/opencs/editor.cpp +++ b/apps/opencs/editor.cpp @@ -6,17 +6,21 @@ #include #include +#include +#include + #include "model/doc/document.hpp" #include "model/world/data.hpp" - -CS::Editor::Editor() : mViewManager (mDocumentManager) +CS::Editor::Editor() + : mDocumentManager (mCfgMgr), mViewManager (mDocumentManager) { mIpcServerName = "org.openmw.OpenCS"; setupDataFiles(); mNewGame.setLocalData (mLocal); + mFileDialog.setLocalData (mLocal); connect (&mViewManager, SIGNAL (newGameRequest ()), this, SLOT (createGame ())); connect (&mViewManager, SIGNAL (newAddonRequest ()), this, SLOT (createAddon ())); @@ -28,23 +32,27 @@ CS::Editor::Editor() : mViewManager (mDocumentManager) connect (&mStartup, SIGNAL (loadDocument()), this, SLOT (loadDocument ())); connect (&mStartup, SIGNAL (editConfig()), this, SLOT (showSettings ())); - connect (&mFileDialog, SIGNAL(openFiles()), this, SLOT(openFiles())); - connect (&mFileDialog, SIGNAL(createNewFile()), this, SLOT(createNewFile())); + connect (&mFileDialog, SIGNAL(signalOpenFiles (const boost::filesystem::path&)), + this, SLOT(openFiles (const boost::filesystem::path&))); + + connect (&mFileDialog, SIGNAL(signalCreateNewFile (const boost::filesystem::path&)), + this, SLOT(createNewFile (const boost::filesystem::path&))); connect (&mNewGame, SIGNAL (createRequest (const boost::filesystem::path&)), - this, SLOT (createNewGame (const boost::filesystem::path&))); + this, SLOT (createNewGame (const boost::filesystem::path&))); } void CS::Editor::setupDataFiles() { boost::program_options::variables_map variables; - boost::program_options::options_description desc; + boost::program_options::options_description desc("Syntax: opencs \nAllowed options"); desc.add_options() ("data", boost::program_options::value()->default_value(Files::PathContainer(), "data")->multitoken()) ("data-local", boost::program_options::value()->default_value("")) ("fs-strict", boost::program_options::value()->implicit_value(true)->default_value(false)) - ("encoding", boost::program_options::value()->default_value("win1252")); + ("encoding", boost::program_options::value()->default_value("win1252")) + ("resources", boost::program_options::value()->default_value("resources")); boost::program_options::notify(variables); @@ -79,13 +87,16 @@ void CS::Editor::setupDataFiles() } // Set the charset for reading the esm/esp files - QString encoding = QString::fromStdString(variables["encoding"].as()); - mFileDialog.setEncoding(encoding); + // QString encoding = QString::fromStdString(variables["encoding"].as()); + //mFileDialog.setEncoding(encoding); dataDirs.insert (dataDirs.end(), dataLocal.begin(), dataLocal.end()); + mDocumentManager.setResourceDir (variables["resources"].as()); + for (Files::PathContainer::const_iterator iter = dataDirs.begin(); iter != dataDirs.end(); ++iter) { + QString path = QString::fromStdString(iter->string()); mFileDialog.addFiles(path); } @@ -109,48 +120,39 @@ void CS::Editor::createGame() void CS::Editor::createAddon() { mStartup.hide(); - - mFileDialog.newFile(); + mFileDialog.showDialog (CSVDoc::ContentAction_New); } void CS::Editor::loadDocument() { mStartup.hide(); - - mFileDialog.openFile(); + mFileDialog.showDialog (CSVDoc::ContentAction_Edit); } -void CS::Editor::openFiles() +void CS::Editor::openFiles (const boost::filesystem::path &savePath) { std::vector files; - QStringList paths = mFileDialog.checkedItemsPaths(); - foreach (const QString &path, paths) { + foreach (const QString &path, mFileDialog.selectedFilePaths()) files.push_back(path.toStdString()); - } - /// \todo Get the save path from the file dialogue - - CSMDoc::Document *document = mDocumentManager.addDocument (files, *files.rbegin(), false); + CSMDoc::Document *document = mDocumentManager.addDocument (files, savePath, false); mViewManager.addView (document); mFileDialog.hide(); } -void CS::Editor::createNewFile() +void CS::Editor::createNewFile (const boost::filesystem::path &savePath) { std::vector files; - QStringList paths = mFileDialog.checkedItemsPaths(); - foreach (const QString &path, paths) { + foreach (const QString &path, mFileDialog.selectedFilePaths()) { files.push_back(path.toStdString()); } - files.push_back(mFileDialog.fileName().toStdString()); + files.push_back(mFileDialog.filename().toStdString()); - /// \todo Get the save path from the file dialogue. - - CSMDoc::Document *document = mDocumentManager.addDocument (files, *files.rbegin(), true); + CSMDoc::Document *document = mDocumentManager.addDocument (files, savePath, true); mViewManager.addView (document); mFileDialog.hide(); @@ -212,6 +214,20 @@ int CS::Editor::run() if (mLocal.empty()) return 1; + // TODO: setting + Ogre::Root::getSingleton().setRenderSystem(Ogre::Root::getSingleton().getRenderSystemByName("OpenGL Rendering Subsystem")); + + Ogre::Root::getSingleton().initialise(false); + + // Create a hidden background window to keep resources + Ogre::NameValuePairList params; + params.insert(std::make_pair("title", "")); + params.insert(std::make_pair("FSAA", "0")); + params.insert(std::make_pair("vsync", "false")); + params.insert(std::make_pair("hidden", "true")); + Ogre::RenderWindow* hiddenWindow = Ogre::Root::getSingleton().createRenderWindow("InactiveHidden", 1, 1, false, ¶ms); + hiddenWindow->setActive(false); + mStartup.show(); QApplication::setQuitOnLastWindowClosed (true); diff --git a/apps/opencs/editor.hpp b/apps/opencs/editor.hpp index c83b2a685..930aa9d64 100644 --- a/apps/opencs/editor.hpp +++ b/apps/opencs/editor.hpp @@ -26,15 +26,15 @@ namespace CS { Q_OBJECT + Files::ConfigurationManager mCfgMgr; CSMSettings::UserSettings mUserSettings; CSMDoc::DocumentManager mDocumentManager; CSVDoc::ViewManager mViewManager; CSVDoc::StartupDialogue mStartup; CSVDoc::NewGameDialogue mNewGame; CSVSettings::UserSettingsDialog mSettings; - FileDialog mFileDialog; + CSVDoc::FileDialog mFileDialog; - Files::ConfigurationManager mCfgMgr; boost::filesystem::path mLocal; void setupDataFiles(); @@ -59,8 +59,8 @@ namespace CS void createAddon(); void loadDocument(); - void openFiles(); - void createNewFile(); + void openFiles (const boost::filesystem::path &path); + void createNewFile (const boost::filesystem::path& path); void createNewGame (const boost::filesystem::path& file); void showStartup(); diff --git a/apps/opencs/main.cpp b/apps/opencs/main.cpp index ef7123c20..341bdc780 100644 --- a/apps/opencs/main.cpp +++ b/apps/opencs/main.cpp @@ -7,6 +7,12 @@ #include #include +#include + +#ifdef Q_OS_MAC +#include +#endif + class Application : public QApplication { private: @@ -33,8 +39,33 @@ class Application : public QApplication int main(int argc, char *argv[]) { Q_INIT_RESOURCE (resources); + + // TODO: Ogre startup shouldn't be here, but it currently has to: + // SceneWidget destructor will delete the created render window, which would be called _after_ Root has shut down :( + OgreInit::OgreInit ogreInit; + ogreInit.init("./opencsOgre.log"); // TODO log path? + Application mApplication (argc, argv); +#ifdef Q_OS_MAC + QDir dir(QCoreApplication::applicationDirPath()); + if (dir.dirName() == "MacOS") { + dir.cdUp(); + dir.cdUp(); + dir.cdUp(); + } + QDir::setCurrent(dir.absolutePath()); + + // force Qt to load only LOCAL plugins, don't touch system Qt installation + QDir pluginsPath(QCoreApplication::applicationDirPath()); + pluginsPath.cdUp(); + pluginsPath.cd("Plugins"); + + QStringList libraryPaths; + libraryPaths << pluginsPath.path() << QCoreApplication::applicationDirPath(); + mApplication.setLibraryPaths(libraryPaths); +#endif + mApplication.setWindowIcon (QIcon (":./opencs.png")); CS::Editor editor; @@ -42,7 +73,7 @@ int main(int argc, char *argv[]) if(!editor.makeIPCServer()) { editor.connectToIPCServer(); - return 0; + // return 0; } return editor.run(); diff --git a/apps/opencs/model/doc/document.cpp b/apps/opencs/model/doc/document.cpp index d7138f671..27f4f498a 100644 --- a/apps/opencs/model/doc/document.cpp +++ b/apps/opencs/model/doc/document.cpp @@ -1,8 +1,15 @@ #include "document.hpp" + #include +#include + +#ifndef Q_MOC_RUN +#include +#endif + void CSMDoc::Document::load (const std::vector::const_iterator& begin, - const std::vector::const_iterator& end, bool lastAsModified) + const std::vector::const_iterator& end, bool lastAsModified) { assert (begin!=end); @@ -12,10 +19,10 @@ void CSMDoc::Document::load (const std::vector::const_i --end2; for (std::vector::const_iterator iter (begin); iter!=end2; ++iter) - getData().loadFile (*iter, true); + getData().loadFile (*iter, true, false); if (lastAsModified) - getData().loadFile (*end2, false); + getData().loadFile (*end2, false, false); } void CSMDoc::Document::addGmsts() @@ -2058,9 +2065,9 @@ void CSMDoc::Document::addOptionalGlobals() { static const char *sGlobals[] = { - "dayspassed", - "pcwerewolf", - "pcyear", + "DaysPassed", + "PCWerewolf", + "PCYear", 0 }; @@ -2137,11 +2144,86 @@ void CSMDoc::Document::createBase() getData().getSkills().add (record); } + + static const char *sVoice[] = + { + "Intruder", + "Attack", + "Hello", + "Thief", + "Alarm", + "Idle", + "Flee", + "Hit", + 0 + }; + + for (int i=0; sVoice[i]; ++i) + { + ESM::Dialogue record; + record.mId = sVoice[i]; + record.mType = ESM::Dialogue::Voice; + record.blank(); + + getData().getTopics().add (record); + } + + static const char *sGreetings[] = + { + "Greeting 0", + "Greeting 1", + "Greeting 2", + "Greeting 3", + "Greeting 4", + "Greeting 5", + "Greeting 6", + "Greeting 7", + "Greeting 8", + "Greeting 9", + 0 + }; + + for (int i=0; sGreetings[i]; ++i) + { + ESM::Dialogue record; + record.mId = sGreetings[i]; + record.mType = ESM::Dialogue::Greeting; + record.blank(); + + getData().getTopics().add (record); + } + + static const char *sPersuasion[] = + { + "Intimidate Success", + "Intimidate Fail", + "Service Refusal", + "Admire Success", + "Taunt Success", + "Bribe Success", + "Info Refusal", + "Admire Fail", + "Taunt Fail", + "Bribe Fail", + 0 + }; + + for (int i=0; sPersuasion[i]; ++i) + { + ESM::Dialogue record; + record.mId = sPersuasion[i]; + record.mType = ESM::Dialogue::Persuasion; + record.blank(); + + getData().getTopics().add (record); + } } -CSMDoc::Document::Document (const std::vector& files, - const boost::filesystem::path& savePath, bool new_) -: mSavePath (savePath), mTools (mData) +CSMDoc::Document::Document (const Files::ConfigurationManager& configuration, const std::vector< boost::filesystem::path >& files, const boost::filesystem::path& savePath, const boost::filesystem::path& resDir, bool new_) + : mSavePath (savePath), mContentFiles (files), mTools (mData), mResDir(resDir), + mProjectPath ((configuration.getUserPath() / "projects") / + (savePath.filename().string() + ".project")), + mSaving (*this, mProjectPath) { if (files.empty()) throw std::runtime_error ("Empty content file sequence"); @@ -2158,6 +2240,44 @@ CSMDoc::Document::Document (const std::vector& files, load (files.begin(), end, !new_); } + if (new_) + { + mData.setDescription (""); + mData.setAuthor (""); + } + + bool filtersFound = false; + + if (boost::filesystem::exists (mProjectPath)) + { + filtersFound = true; + } + else + { + boost::filesystem::path locCustomFiltersPath (configuration.getUserPath()); + locCustomFiltersPath /= "defaultfilters"; + + if (boost::filesystem::exists(locCustomFiltersPath)) + { + boost::filesystem::copy_file (locCustomFiltersPath, mProjectPath); + filtersFound = true; + } + else + { + boost::filesystem::path filters(mResDir); + filters /= "defaultfilters"; + + if (boost::filesystem::exists(filters)) + { + boost::filesystem::copy_file(filters, mProjectPath); + filtersFound = true; + } + } + } + + if (filtersFound) + getData().loadFile (mProjectPath, false, true); + addOptionalGmsts(); addOptionalGlobals(); @@ -2166,9 +2286,10 @@ CSMDoc::Document::Document (const std::vector& files, connect (&mTools, SIGNAL (progress (int, int, int)), this, SLOT (progress (int, int, int))); connect (&mTools, SIGNAL (done (int)), this, SLOT (operationDone (int))); - // dummy implementation -> remove when proper save is implemented. - mSaveCount = 0; - connect (&mSaveTimer, SIGNAL(timeout()), this, SLOT (saving())); + connect (&mSaving, SIGNAL (progress (int, int, int)), this, SLOT (progress (int, int, int))); + connect (&mSaving, SIGNAL (done (int)), this, SLOT (operationDone (int))); + connect (&mSaving, SIGNAL (reportMessage (const QString&, int)), + this, SLOT (reportMessage (const QString&, int))); } CSMDoc::Document::~Document() @@ -2187,7 +2308,7 @@ int CSMDoc::Document::getState() const if (!mUndoStack.isClean()) state |= State_Modified; - if (mSaveCount) + if (mSaving.isRunning()) state |= State_Locked | State_Saving | State_Operation; if (int operations = mTools.getRunningOperations()) @@ -2201,12 +2322,20 @@ const boost::filesystem::path& CSMDoc::Document::getSavePath() const return mSavePath; } +const std::vector& CSMDoc::Document::getContentFiles() const +{ + return mContentFiles; +} + void CSMDoc::Document::save() { - mSaveCount = 1; - mSaveTimer.start (500); + if (mSaving.isRunning()) + throw std::logic_error ( + "Failed to initiate save, because a save operation is already running."); + + mSaving.start(); + emit stateChanged (getState(), this); - emit progress (1, 16, State_Saving, 1, this); } CSMWorld::UniversalId CSMDoc::Document::verify() @@ -2218,46 +2347,28 @@ CSMWorld::UniversalId CSMDoc::Document::verify() void CSMDoc::Document::abortOperation (int type) { - mTools.abortOperation (type); - if (type==State_Saving) - { - mSaveCount=0; - mSaveTimer.stop(); - emit stateChanged (getState(), this); - } + mSaving.abort(); + else + mTools.abortOperation (type); } - void CSMDoc::Document::modificationStateChanged (bool clean) { emit stateChanged (getState(), this); } +void CSMDoc::Document::reportMessage (const QString& message, int type) +{ + /// \todo find a better way to get these messages to the user. + std::cout << message.toUtf8().constData() << std::endl; +} void CSMDoc::Document::operationDone (int type) { emit stateChanged (getState(), this); } -void CSMDoc::Document::saving() -{ - ++mSaveCount; - - emit progress (mSaveCount, 16, State_Saving, 1, this); - - if (mSaveCount>15) - { - //clear the stack before resetting the save state - //to avoid emitting incorrect states - mUndoStack.setClean(); - - mSaveCount = 0; - mSaveTimer.stop(); - emit stateChanged (getState(), this); - } -} - const CSMWorld::Data& CSMDoc::Document::getData() const { return mData; diff --git a/apps/opencs/model/doc/document.hpp b/apps/opencs/model/doc/document.hpp index 3532721ea..437b0c513 100644 --- a/apps/opencs/model/doc/document.hpp +++ b/apps/opencs/model/doc/document.hpp @@ -14,6 +14,7 @@ #include "../tools/tools.hpp" #include "state.hpp" +#include "saving.hpp" class QAbstractItemModel; @@ -23,6 +24,11 @@ namespace ESM struct Global; } +namespace Files +{ + class ConfigurationManager; +} + namespace CSMDoc { class Document : public QObject @@ -32,16 +38,17 @@ namespace CSMDoc private: boost::filesystem::path mSavePath; + std::vector mContentFiles; CSMWorld::Data mData; CSMTools::Tools mTools; + boost::filesystem::path mProjectPath; + Saving mSaving; + boost::filesystem::path mResDir; // It is important that the undo stack is declared last, because on desctruction it fires a signal, that is connected to a slot, that is // using other member variables. Unfortunately this connection is cut only in the QObject destructor, which is way too late. QUndoStack mUndoStack; - int mSaveCount; ///< dummy implementation -> remove when proper save is implemented. - QTimer mSaveTimer; ///< dummy implementation -> remove when proper save is implemented. - // not implemented Document (const Document&); Document& operator= (const Document&); @@ -64,8 +71,7 @@ namespace CSMDoc public: - Document (const std::vector& files, - const boost::filesystem::path& savePath, bool new_); + Document (const Files::ConfigurationManager& configuration, const std::vector< boost::filesystem::path >& files, const boost::filesystem::path& savePath, const boost::filesystem::path& resDir, bool new_); ~Document(); @@ -75,6 +81,10 @@ namespace CSMDoc const boost::filesystem::path& getSavePath() const; + const std::vector& getContentFiles() const; + ///< \attention The last element in this collection is the file that is being edited, + /// but with its original path instead of the save path. + void save(); CSMWorld::UniversalId verify(); @@ -98,10 +108,9 @@ namespace CSMDoc void modificationStateChanged (bool clean); - void operationDone (int type); + void reportMessage (const QString& message, int type); - void saving(); - ///< dummy implementation -> remove when proper save is implemented. + void operationDone (int type); public slots: @@ -110,3 +119,4 @@ namespace CSMDoc } #endif + diff --git a/apps/opencs/model/doc/documentmanager.cpp b/apps/opencs/model/doc/documentmanager.cpp index b079109ea..024c46bea 100644 --- a/apps/opencs/model/doc/documentmanager.cpp +++ b/apps/opencs/model/doc/documentmanager.cpp @@ -4,9 +4,22 @@ #include #include +#include + +#ifndef Q_MOC_RUN +#include +#endif + #include "document.hpp" -CSMDoc::DocumentManager::DocumentManager() {} +CSMDoc::DocumentManager::DocumentManager (const Files::ConfigurationManager& configuration) +: mConfiguration (configuration) +{ + boost::filesystem::path projectPath = configuration.getUserPath() / "projects"; + + if (!boost::filesystem::is_directory (projectPath)) + boost::filesystem::create_directories (projectPath); +} CSMDoc::DocumentManager::~DocumentManager() { @@ -17,7 +30,7 @@ CSMDoc::DocumentManager::~DocumentManager() CSMDoc::Document *CSMDoc::DocumentManager::addDocument (const std::vector& files, const boost::filesystem::path& savePath, bool new_) { - Document *document = new Document (files, savePath, new_); + Document *document = new Document (mConfiguration, files, savePath, mResDir, new_); mDocuments.push_back (document); @@ -35,4 +48,9 @@ bool CSMDoc::DocumentManager::removeDocument (Document *document) delete document; return mDocuments.empty(); +} + +void CSMDoc::DocumentManager::setResourceDir (const boost::filesystem::path& parResDir) +{ + mResDir = boost::filesystem::system_complete(parResDir); } \ No newline at end of file diff --git a/apps/opencs/model/doc/documentmanager.hpp b/apps/opencs/model/doc/documentmanager.hpp index dfded8d5c..b80a18642 100644 --- a/apps/opencs/model/doc/documentmanager.hpp +++ b/apps/opencs/model/doc/documentmanager.hpp @@ -6,6 +6,11 @@ #include +namespace Files +{ + class ConfigurationManager; +} + namespace CSMDoc { class Document; @@ -13,18 +18,18 @@ namespace CSMDoc class DocumentManager { std::vector mDocuments; + const Files::ConfigurationManager& mConfiguration; DocumentManager (const DocumentManager&); DocumentManager& operator= (const DocumentManager&); public: - DocumentManager(); + DocumentManager (const Files::ConfigurationManager& configuration); ~DocumentManager(); - Document *addDocument (const std::vector& files, - const boost::filesystem::path& savePath, bool new_); + Document *addDocument (const std::vector< boost::filesystem::path >& files, const boost::filesystem::path& savePath, bool new_); ///< The ownership of the returned document is not transferred to the caller. /// /// \param new_ Do not load the last content file in \a files and instead create in an @@ -32,6 +37,10 @@ namespace CSMDoc bool removeDocument (Document *document); ///< \return last document removed? + void setResourceDir (const boost::filesystem::path& parResDir); + + private: + boost::filesystem::path mResDir; }; } diff --git a/apps/opencs/model/tools/operation.cpp b/apps/opencs/model/doc/operation.cpp similarity index 50% rename from apps/opencs/model/tools/operation.cpp rename to apps/opencs/model/doc/operation.cpp index 71761cdae..d29cc2631 100644 --- a/apps/opencs/model/tools/operation.cpp +++ b/apps/opencs/model/doc/operation.cpp @@ -6,16 +6,16 @@ #include -#include "../doc/state.hpp" - +#include "state.hpp" #include "stage.hpp" -void CSMTools::Operation::prepareStages() +void CSMDoc::Operation::prepareStages() { mCurrentStage = mStages.begin(); mCurrentStep = 0; mCurrentStepTotal = 0; mTotalSteps = 0; + mError = false; for (std::vector >::iterator iter (mStages.begin()); iter!=mStages.end(); ++iter) { @@ -24,38 +24,61 @@ void CSMTools::Operation::prepareStages() } } -CSMTools::Operation::Operation (int type) : mType (type) {} +CSMDoc::Operation::Operation (int type, bool ordered, bool finalAlways) +: mType (type), mOrdered (ordered), mFinalAlways (finalAlways) +{ + connect (this, SIGNAL (finished()), this, SLOT (operationDone())); +} -CSMTools::Operation::~Operation() +CSMDoc::Operation::~Operation() { for (std::vector >::iterator iter (mStages.begin()); iter!=mStages.end(); ++iter) delete iter->first; } -void CSMTools::Operation::run() +void CSMDoc::Operation::run() { prepareStages(); QTimer timer; - timer.connect (&timer, SIGNAL (timeout()), this, SLOT (verify())); + timer.connect (&timer, SIGNAL (timeout()), this, SLOT (executeStage())); timer.start (0); exec(); } -void CSMTools::Operation::appendStage (Stage *stage) +void CSMDoc::Operation::appendStage (Stage *stage) { mStages.push_back (std::make_pair (stage, 0)); } -void CSMTools::Operation::abort() +bool CSMDoc::Operation::hasError() const { - exit(); + return mError; } -void CSMTools::Operation::verify() +void CSMDoc::Operation::abort() +{ + if (!isRunning()) + return; + + mError = true; + + if (mFinalAlways) + { + if (mStages.begin()!=mStages.end() && mCurrentStage!=--mStages.end()) + { + mCurrentStep = 0; + mCurrentStage = --mStages.end(); + } + } + else + mCurrentStage = mStages.end(); +} + +void CSMDoc::Operation::executeStage() { std::vector messages; @@ -68,7 +91,16 @@ void CSMTools::Operation::verify() } else { - mCurrentStage->first->perform (mCurrentStep++, messages); + try + { + mCurrentStage->first->perform (mCurrentStep++, messages); + } + catch (const std::exception& e) + { + emit reportMessage (e.what(), mType); + abort(); + } + ++mCurrentStepTotal; break; } @@ -81,4 +113,9 @@ void CSMTools::Operation::verify() if (mCurrentStage==mStages.end()) exit(); +} + +void CSMDoc::Operation::operationDone() +{ + emit done (mType); } \ No newline at end of file diff --git a/apps/opencs/model/tools/operation.hpp b/apps/opencs/model/doc/operation.hpp similarity index 64% rename from apps/opencs/model/tools/operation.hpp rename to apps/opencs/model/doc/operation.hpp index 4731c58fa..316eda78f 100644 --- a/apps/opencs/model/tools/operation.hpp +++ b/apps/opencs/model/doc/operation.hpp @@ -1,11 +1,11 @@ -#ifndef CSM_TOOLS_OPERATION_H -#define CSM_TOOLS_OPERATION_H +#ifndef CSM_DOC_OPERATION_H +#define CSM_DOC_OPERATION_H #include #include -namespace CSMTools +namespace CSMDoc { class Stage; @@ -19,12 +19,17 @@ namespace CSMTools int mCurrentStep; int mCurrentStepTotal; int mTotalSteps; + int mOrdered; + bool mFinalAlways; + bool mError; void prepareStages(); public: - Operation (int type); + Operation (int type, bool ordered, bool finalAlways = false); + ///< \param ordered Stages must be executed in the given order. + /// \param finalAlways Execute last stage even if an error occurred during earlier stages. virtual ~Operation(); @@ -35,19 +40,25 @@ namespace CSMTools /// /// \attention Do no call this function while this Operation is running. + bool hasError() const; + signals: void progress (int current, int max, int type); void reportMessage (const QString& message, int type); + void done (int type); + public slots: void abort(); private slots: - void verify(); + void executeStage(); + + void operationDone(); }; } diff --git a/apps/opencs/model/doc/saving.cpp b/apps/opencs/model/doc/saving.cpp new file mode 100644 index 000000000..73278ba97 --- /dev/null +++ b/apps/opencs/model/doc/saving.cpp @@ -0,0 +1,71 @@ + +#include "saving.hpp" + +#include "../world/data.hpp" +#include "../world/idcollection.hpp" + +#include "state.hpp" +#include "savingstages.hpp" +#include "document.hpp" + +CSMDoc::Saving::Saving (Document& document, const boost::filesystem::path& projectPath) +: Operation (State_Saving, true, true), mDocument (document), mState (*this, projectPath) +{ + // save project file + appendStage (new OpenSaveStage (mDocument, mState, true)); + + appendStage (new WriteHeaderStage (mDocument, mState, true)); + + appendStage (new WriteFilterStage (mDocument, mState, CSMFilter::Filter::Scope_Project)); + + appendStage (new CloseSaveStage (mState)); + + // save content file + appendStage (new OpenSaveStage (mDocument, mState, false)); + + appendStage (new WriteHeaderStage (mDocument, mState, false)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getGlobals(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getGmsts(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getSkills(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getClasses(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getFactions(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getRaces(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getSounds(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getScripts(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getRegions(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getBirthsigns(), mState)); + + appendStage (new WriteCollectionStage > + (mDocument.getData().getSpells(), mState)); + + appendStage (new WriteDialogueCollectionStage (mDocument, mState, false)); + + appendStage (new WriteDialogueCollectionStage (mDocument, mState, true)); + + appendStage (new WriteRefIdCollectionStage (mDocument, mState)); + + + appendStage (new CloseSaveStage (mState)); + + appendStage (new FinalSavingStage (mDocument, mState)); +} \ No newline at end of file diff --git a/apps/opencs/model/doc/saving.hpp b/apps/opencs/model/doc/saving.hpp new file mode 100644 index 000000000..cd1bbef98 --- /dev/null +++ b/apps/opencs/model/doc/saving.hpp @@ -0,0 +1,27 @@ +#ifndef CSM_DOC_SAVING_H +#define CSM_DOC_SAVING_H + +#include + +#include "operation.hpp" +#include "savingstate.hpp" + +namespace CSMDoc +{ + class Document; + + class Saving : public Operation + { + Q_OBJECT + + Document& mDocument; + SavingState mState; + + public: + + Saving (Document& document, const boost::filesystem::path& projectPath); + + }; +} + +#endif diff --git a/apps/opencs/model/doc/savingstages.cpp b/apps/opencs/model/doc/savingstages.cpp new file mode 100644 index 000000000..8e9bcfc0d --- /dev/null +++ b/apps/opencs/model/doc/savingstages.cpp @@ -0,0 +1,274 @@ + +#include "savingstages.hpp" + +#include + +#include + +#include + +#include + +#include "../world/infocollection.hpp" + +#include "document.hpp" +#include "savingstate.hpp" + +CSMDoc::OpenSaveStage::OpenSaveStage (Document& document, SavingState& state, bool projectFile) +: mDocument (document), mState (state), mProjectFile (projectFile) +{} + +int CSMDoc::OpenSaveStage::setup() +{ + return 1; +} + +void CSMDoc::OpenSaveStage::perform (int stage, std::vector& messages) +{ + mState.start (mDocument, mProjectFile); + + mState.getStream().open ((mProjectFile ? mState.getPath() : mState.getTmpPath()).string().c_str()); + + if (!mState.getStream().is_open()) + throw std::runtime_error ("failed to open stream for saving"); +} + + +CSMDoc::WriteHeaderStage::WriteHeaderStage (Document& document, SavingState& state, bool simple) +: mDocument (document), mState (state), mSimple (simple) +{} + +int CSMDoc::WriteHeaderStage::setup() +{ + return 1; +} + +void CSMDoc::WriteHeaderStage::perform (int stage, std::vector& messages) +{ + mState.getWriter().setVersion(); + + mState.getWriter().clearMaster(); + + mState.getWriter().setFormat (0); + + if (mSimple) + { + mState.getWriter().setAuthor (""); + mState.getWriter().setDescription (""); + mState.getWriter().setRecordCount (0); + } + else + { + mState.getWriter().setAuthor (mDocument.getData().getAuthor()); + mState.getWriter().setDescription (mDocument.getData().getDescription()); + mState.getWriter().setRecordCount ( + mDocument.getData().count (CSMWorld::RecordBase::State_Modified) + + mDocument.getData().count (CSMWorld::RecordBase::State_ModifiedOnly) + + mDocument.getData().count (CSMWorld::RecordBase::State_Deleted)); + + /// \todo refine dependency list (at least remove redundant dependencies) + std::vector dependencies = mDocument.getContentFiles(); + std::vector::const_iterator end (--dependencies.end()); + + for (std::vector::const_iterator iter (dependencies.begin()); + iter!=end; ++iter) + { + std::string name = iter->filename().string(); + uint64_t size = boost::filesystem::file_size (*iter); + + mState.getWriter().addMaster (name, size); + } + } + + mState.getWriter().save (mState.getStream()); +} + + +CSMDoc::WriteDialogueCollectionStage::WriteDialogueCollectionStage (Document& document, + SavingState& state, bool journal) +: mDocument (document), mState (state), + mTopics (journal ? document.getData().getJournals() : document.getData().getTopics()), + mInfos (journal ? document.getData().getJournalInfos() : document.getData().getTopicInfos()) +{} + +int CSMDoc::WriteDialogueCollectionStage::setup() +{ + return mTopics.getSize(); +} + +void CSMDoc::WriteDialogueCollectionStage::perform (int stage, std::vector& messages) +{ + const CSMWorld::Record& topic = mTopics.getRecord (stage); + + CSMWorld::RecordBase::State state = topic.mState; + + if (state==CSMWorld::RecordBase::State_Deleted) + { + // if the topic is deleted, we do not need to bother with INFO records. + + /// \todo wrote record with delete flag + + return; + } + + // Test, if we need to save anything associated info records. + bool infoModified = false; + + CSMWorld::InfoCollection::Range range = mInfos.getTopicRange (topic.get().mId); + + for (CSMWorld::InfoCollection::RecordConstIterator iter (range.first); iter!=range.second; ++iter) + { + CSMWorld::RecordBase::State state = iter->mState; + + if (state==CSMWorld::RecordBase::State_Modified || + state==CSMWorld::RecordBase::State_ModifiedOnly || + state==CSMWorld::RecordBase::State_Deleted) + { + infoModified = true; + break; + } + } + + if (state==CSMWorld::RecordBase::State_Modified || + state==CSMWorld::RecordBase::State_ModifiedOnly || + infoModified) + { + // always write the topic record + std::string type; + for (int i=0; i<4; ++i) + /// \todo make endianess agnostic (change ESMWriter interface?) + type += reinterpret_cast (&topic.mModified.sRecordId)[i]; + + mState.getWriter().startRecord (type); + mState.getWriter().writeHNCString ("NAME", topic.mModified.mId); + topic.mModified.save (mState.getWriter()); + mState.getWriter().endRecord (type); + + // write modified selected info records + for (CSMWorld::InfoCollection::RecordConstIterator iter (range.first); iter!=range.second; + ++iter) + { + CSMWorld::RecordBase::State state = iter->mState; + + if (state==CSMWorld::RecordBase::State_Deleted) + { + /// \todo wrote record with delete flag + } + else if (state==CSMWorld::RecordBase::State_Modified || + state==CSMWorld::RecordBase::State_ModifiedOnly) + { + ESM::DialInfo info = iter->get(); + info.mId = info.mId.substr (info.mId.find_last_of ('#')+1); + + if (iter!=range.first) + { + CSMWorld::InfoCollection::RecordConstIterator prev = iter; + --prev; + + info.mPrev = + prev->mModified.mId.substr (prev->mModified.mId.find_last_of ('#')+1); + } + + CSMWorld::InfoCollection::RecordConstIterator next = iter; + ++next; + + if (next!=range.second) + { + info.mNext = + next->mModified.mId.substr (next->mModified.mId.find_last_of ('#')+1); + } + + std::string type; + for (int i=0; i<4; ++i) + /// \todo make endianess agnostic (change ESMWriter interface?) + type += reinterpret_cast (&info.sRecordId)[i]; + + mState.getWriter().startRecord (type); + mState.getWriter().writeHNCString ("INAM", info.mId); + info.save (mState.getWriter()); + mState.getWriter().endRecord (type); + } + } + } +} + + +CSMDoc::WriteRefIdCollectionStage::WriteRefIdCollectionStage (Document& document, SavingState& state) +: mDocument (document), mState (state) +{} + +int CSMDoc::WriteRefIdCollectionStage::setup() +{ + return mDocument.getData().getReferenceables().getSize(); +} + +void CSMDoc::WriteRefIdCollectionStage::perform (int stage, std::vector& messages) +{ + mDocument.getData().getReferenceables().save (stage, mState.getWriter()); +} + + +CSMDoc::WriteFilterStage::WriteFilterStage (Document& document, SavingState& state, + CSMFilter::Filter::Scope scope) +: WriteCollectionStage > (document.getData().getFilters(), + state), + mDocument (document), mScope (scope) +{} + +void CSMDoc::WriteFilterStage::perform (int stage, std::vector& messages) +{ + const CSMWorld::Record& record = + mDocument.getData().getFilters().getRecord (stage); + + if (record.get().mScope==mScope) + WriteCollectionStage >::perform (stage, messages); +} + + +CSMDoc::CloseSaveStage::CloseSaveStage (SavingState& state) +: mState (state) +{} + +int CSMDoc::CloseSaveStage::setup() +{ + return 1; +} + +void CSMDoc::CloseSaveStage::perform (int stage, std::vector& messages) +{ + mState.getStream().close(); + + if (!mState.getStream()) + throw std::runtime_error ("saving failed"); +} + + +CSMDoc::FinalSavingStage::FinalSavingStage (Document& document, SavingState& state) +: mDocument (document), mState (state) +{} + +int CSMDoc::FinalSavingStage::setup() +{ + return 1; +} + +void CSMDoc::FinalSavingStage::perform (int stage, std::vector& messages) +{ + if (mState.hasError()) + { + mState.getWriter().close(); + mState.getStream().close(); + + if (boost::filesystem::exists (mState.getTmpPath())) + boost::filesystem::remove (mState.getTmpPath()); + } + else if (!mState.isProjectFile()) + { + if (boost::filesystem::exists (mState.getPath())) + boost::filesystem::remove (mState.getPath()); + + boost::filesystem::rename (mState.getTmpPath(), mState.getPath()); + + mDocument.getUndoStack().setClean(); + } +} \ No newline at end of file diff --git a/apps/opencs/model/doc/savingstages.hpp b/apps/opencs/model/doc/savingstages.hpp new file mode 100644 index 000000000..ca5586511 --- /dev/null +++ b/apps/opencs/model/doc/savingstages.hpp @@ -0,0 +1,201 @@ +#ifndef CSM_DOC_SAVINGSTAGES_H +#define CSM_DOC_SAVINGSTAGES_H + +#include "stage.hpp" + +#include "../world/record.hpp" +#include "../world/idcollection.hpp" + +#include "../filter/filter.hpp" + +#include "savingstate.hpp" + +namespace ESM +{ + struct Dialogue; +} + +namespace CSMWorld +{ + class InfoCollection; +} + +namespace CSMDoc +{ + class Document; + class SavingState; + + class OpenSaveStage : public Stage + { + Document& mDocument; + SavingState& mState; + bool mProjectFile; + + public: + + OpenSaveStage (Document& document, SavingState& state, bool projectFile); + ///< \param projectFile Saving the project file instead of the content file. + + virtual int setup(); + ///< \return number of steps + + virtual void perform (int stage, std::vector& messages); + ///< Messages resulting from this stage will be appended to \a messages. + }; + + class WriteHeaderStage : public Stage + { + Document& mDocument; + SavingState& mState; + bool mSimple; + + public: + + WriteHeaderStage (Document& document, SavingState& state, bool simple); + ///< \param simple Simplified header (used for project files). + + virtual int setup(); + ///< \return number of steps + + virtual void perform (int stage, std::vector& messages); + ///< Messages resulting from this stage will be appended to \a messages. + }; + + + template + class WriteCollectionStage : public Stage + { + const CollectionT& mCollection; + SavingState& mState; + + public: + + WriteCollectionStage (const CollectionT& collection, SavingState& state); + + virtual int setup(); + ///< \return number of steps + + virtual void perform (int stage, std::vector& messages); + ///< Messages resulting from this stage will be appended to \a messages. + }; + + template + WriteCollectionStage::WriteCollectionStage (const CollectionT& collection, + SavingState& state) + : mCollection (collection), mState (state) + {} + + template + int WriteCollectionStage::setup() + { + return mCollection.getSize(); + } + + template + void WriteCollectionStage::perform (int stage, std::vector& messages) + { + CSMWorld::RecordBase::State state = mCollection.getRecord (stage).mState; + + if (state==CSMWorld::RecordBase::State_Modified || + state==CSMWorld::RecordBase::State_ModifiedOnly) + { + std::string type; + for (int i=0; i<4; ++i) + /// \todo make endianess agnostic (change ESMWriter interface?) + type += reinterpret_cast (&mCollection.getRecord (stage).mModified.sRecordId)[i]; + + mState.getWriter().startRecord (type); + mState.getWriter().writeHNCString ("NAME", mCollection.getId (stage)); + mCollection.getRecord (stage).mModified.save (mState.getWriter()); + mState.getWriter().endRecord (type); + } + else if (state==CSMWorld::RecordBase::State_Deleted) + { + /// \todo write record with delete flag + } + } + + + class WriteDialogueCollectionStage : public Stage + { + Document& mDocument; + SavingState& mState; + const CSMWorld::IdCollection& mTopics; + CSMWorld::InfoCollection& mInfos; + + public: + + WriteDialogueCollectionStage (Document& document, SavingState& state, bool journal); + + virtual int setup(); + ///< \return number of steps + + virtual void perform (int stage, std::vector& messages); + ///< Messages resulting from this stage will be appended to \a messages. + }; + + + class WriteRefIdCollectionStage : public Stage + { + Document& mDocument; + SavingState& mState; + + public: + + WriteRefIdCollectionStage (Document& document, SavingState& state); + + virtual int setup(); + ///< \return number of steps + + virtual void perform (int stage, std::vector& messages); + ///< Messages resulting from this stage will be appended to \a messages. + }; + + + class WriteFilterStage : public WriteCollectionStage > + { + Document& mDocument; + CSMFilter::Filter::Scope mScope; + + public: + + WriteFilterStage (Document& document, SavingState& state, CSMFilter::Filter::Scope scope); + + virtual void perform (int stage, std::vector& messages); + ///< Messages resulting from this stage will be appended to \a messages. + }; + + + class CloseSaveStage : public Stage + { + SavingState& mState; + + public: + + CloseSaveStage (SavingState& state); + + virtual int setup(); + ///< \return number of steps + + virtual void perform (int stage, std::vector& messages); + ///< Messages resulting from this stage will be appended to \a messages. + }; + + class FinalSavingStage : public Stage + { + Document& mDocument; + SavingState& mState; + + public: + + FinalSavingStage (Document& document, SavingState& state); + + virtual int setup(); + ///< \return number of steps + + virtual void perform (int stage, std::vector& messages); + ///< Messages resulting from this stage will be appended to \a messages. + }; +} + +#endif diff --git a/apps/opencs/model/doc/savingstate.cpp b/apps/opencs/model/doc/savingstate.cpp new file mode 100644 index 000000000..4a1abb888 --- /dev/null +++ b/apps/opencs/model/doc/savingstate.cpp @@ -0,0 +1,65 @@ + +#include "savingstate.hpp" + +#include "operation.hpp" +#include "document.hpp" + +CSMDoc::SavingState::SavingState (Operation& operation, const boost::filesystem::path& projectPath) +: mOperation (operation), + /// \todo set encoding properly, once config implementation has been fixed. + mEncoder (ToUTF8::calculateEncoding ("win1252")), + mProjectPath (projectPath), mProjectFile (false) +{ + mWriter.setEncoder (&mEncoder); +} + +bool CSMDoc::SavingState::hasError() const +{ + return mOperation.hasError(); +} + +void CSMDoc::SavingState::start (Document& document, bool project) +{ + mProjectFile = project; + + if (mStream.is_open()) + mStream.close(); + + mStream.clear(); + + if (project) + mPath = mProjectPath; + else + mPath = document.getSavePath(); + + boost::filesystem::path file (mPath.filename().string() + ".tmp"); + + mTmpPath = mPath.parent_path(); + + mTmpPath /= file; +} + +const boost::filesystem::path& CSMDoc::SavingState::getPath() const +{ + return mPath; +} + +const boost::filesystem::path& CSMDoc::SavingState::getTmpPath() const +{ + return mTmpPath; +} + +std::ofstream& CSMDoc::SavingState::getStream() +{ + return mStream; +} + +ESM::ESMWriter& CSMDoc::SavingState::getWriter() +{ + return mWriter; +} + +bool CSMDoc::SavingState::isProjectFile() const +{ + return mProjectFile; +} \ No newline at end of file diff --git a/apps/opencs/model/doc/savingstate.hpp b/apps/opencs/model/doc/savingstate.hpp new file mode 100644 index 000000000..8cf7883e5 --- /dev/null +++ b/apps/opencs/model/doc/savingstate.hpp @@ -0,0 +1,50 @@ +#ifndef CSM_DOC_SAVINGSTATE_H +#define CSM_DOC_SAVINGSTATE_H + +#include + +#include + +#include + +namespace CSMDoc +{ + class Operation; + class Document; + + class SavingState + { + Operation& mOperation; + boost::filesystem::path mPath; + boost::filesystem::path mTmpPath; + ToUTF8::Utf8Encoder mEncoder; + std::ofstream mStream; + ESM::ESMWriter mWriter; + boost::filesystem::path mProjectPath; + bool mProjectFile; + + public: + + SavingState (Operation& operation, const boost::filesystem::path& projectPath); + + bool hasError() const; + + void start (Document& document, bool project); + ///< \param project Save project file instead of content file. + + const boost::filesystem::path& getPath() const; + + const boost::filesystem::path& getTmpPath() const; + + std::ofstream& getStream(); + + ESM::ESMWriter& getWriter(); + + bool isProjectFile() const; + ///< Currently saving project file? (instead of content file) + }; + + +} + +#endif \ No newline at end of file diff --git a/apps/opencs/model/doc/stage.cpp b/apps/opencs/model/doc/stage.cpp new file mode 100644 index 000000000..99b765770 --- /dev/null +++ b/apps/opencs/model/doc/stage.cpp @@ -0,0 +1,4 @@ + +#include "stage.hpp" + +CSMDoc::Stage::~Stage() {} \ No newline at end of file diff --git a/apps/opencs/model/tools/stage.hpp b/apps/opencs/model/doc/stage.hpp similarity index 65% rename from apps/opencs/model/tools/stage.hpp rename to apps/opencs/model/doc/stage.hpp index 3020936f3..1f96c60b4 100644 --- a/apps/opencs/model/tools/stage.hpp +++ b/apps/opencs/model/doc/stage.hpp @@ -1,10 +1,10 @@ -#ifndef CSM_TOOLS_STAGE_H -#define CSM_TOOLS_STAGE_H +#ifndef CSM_DOC_STAGE_H +#define CSM_DOC_STAGE_H #include #include -namespace CSMTools +namespace CSMDoc { class Stage { @@ -16,7 +16,7 @@ namespace CSMTools ///< \return number of steps virtual void perform (int stage, std::vector& messages) = 0; - ///< Messages resulting from this tage will be appended to \a messages. + ///< Messages resulting from this stage will be appended to \a messages. }; } diff --git a/apps/opencs/model/filter/andnode.hpp b/apps/opencs/model/filter/andnode.hpp index 980ea554c..887175700 100644 --- a/apps/opencs/model/filter/andnode.hpp +++ b/apps/opencs/model/filter/andnode.hpp @@ -7,8 +7,6 @@ namespace CSMFilter { class AndNode : public NAryNode { - bool mAnd; - public: AndNode (const std::vector >& nodes); diff --git a/apps/opencs/model/filter/ornode.hpp b/apps/opencs/model/filter/ornode.hpp index 63ed2f10c..c39e35095 100644 --- a/apps/opencs/model/filter/ornode.hpp +++ b/apps/opencs/model/filter/ornode.hpp @@ -7,8 +7,6 @@ namespace CSMFilter { class OrNode : public NAryNode { - bool mAnd; - public: OrNode (const std::vector >& nodes); diff --git a/apps/opencs/model/filter/parser.cpp b/apps/opencs/model/filter/parser.cpp index 8f4fcb70c..6e286d943 100644 --- a/apps/opencs/model/filter/parser.cpp +++ b/apps/opencs/model/filter/parser.cpp @@ -61,11 +61,11 @@ namespace CSMFilter bool isString() const; }; - Token::Token (Type type) : mType (type) {} + Token::Token (Type type) : mType (type), mNumber(0.0) {} - Token::Token (Type type, const std::string& string) : mType (type), mString (string) {} + Token::Token (Type type, const std::string& string) : mType (type), mString (string), mNumber(0.0) {} - Token::Token (const std::string& string) : mType (Type_String), mString (string) {} + Token::Token (const std::string& string) : mType (Type_String), mString (string), mNumber(0.0) {} Token::Token (double number) : mType (Type_Number), mNumber (number) {} @@ -614,4 +614,4 @@ boost::shared_ptr CSMFilter::Parser::getFilter() const throw std::logic_error ("No filter available"); return mFilter; -} \ No newline at end of file +} diff --git a/apps/opencs/model/settings/settingsitem.hpp b/apps/opencs/model/settings/settingsitem.hpp index a1daee4ac..87a85e8e4 100644 --- a/apps/opencs/model/settings/settingsitem.hpp +++ b/apps/opencs/model/settings/settingsitem.hpp @@ -44,7 +44,11 @@ namespace CSMSettings inline QStringPair *getValuePair() { return mValuePair; } /// set value range (spinbox / integer use) - inline void setValuePair (QStringPair valuePair) { mValuePair = new QStringPair(valuePair); } + inline void setValuePair (QStringPair valuePair) + { + delete mValuePair; + mValuePair = new QStringPair(valuePair); + } inline bool isMultivalue () { return mIsMultiValue; } diff --git a/apps/opencs/model/tools/birthsigncheck.hpp b/apps/opencs/model/tools/birthsigncheck.hpp index 42b5a6b24..bdd65b44a 100644 --- a/apps/opencs/model/tools/birthsigncheck.hpp +++ b/apps/opencs/model/tools/birthsigncheck.hpp @@ -5,12 +5,12 @@ #include "../world/idcollection.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMTools { /// \brief VerifyStage: make sure that birthsign records are internally consistent - class BirthsignCheckStage : public Stage + class BirthsignCheckStage : public CSMDoc::Stage { const CSMWorld::IdCollection& mBirthsigns; diff --git a/apps/opencs/model/tools/classcheck.hpp b/apps/opencs/model/tools/classcheck.hpp index a29d7c8b7..3604b451c 100644 --- a/apps/opencs/model/tools/classcheck.hpp +++ b/apps/opencs/model/tools/classcheck.hpp @@ -5,12 +5,12 @@ #include "../world/idcollection.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMTools { /// \brief VerifyStage: make sure that class records are internally consistent - class ClassCheckStage : public Stage + class ClassCheckStage : public CSMDoc::Stage { const CSMWorld::IdCollection& mClasses; diff --git a/apps/opencs/model/tools/factioncheck.hpp b/apps/opencs/model/tools/factioncheck.hpp index 868650572..7cd80347d 100644 --- a/apps/opencs/model/tools/factioncheck.hpp +++ b/apps/opencs/model/tools/factioncheck.hpp @@ -5,12 +5,12 @@ #include "../world/idcollection.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMTools { /// \brief VerifyStage: make sure that faction records are internally consistent - class FactionCheckStage : public Stage + class FactionCheckStage : public CSMDoc::Stage { const CSMWorld::IdCollection& mFactions; diff --git a/apps/opencs/model/tools/mandatoryid.hpp b/apps/opencs/model/tools/mandatoryid.hpp index 342e2d754..5fddf08d3 100644 --- a/apps/opencs/model/tools/mandatoryid.hpp +++ b/apps/opencs/model/tools/mandatoryid.hpp @@ -6,7 +6,7 @@ #include "../world/universalid.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMWorld { @@ -16,7 +16,7 @@ namespace CSMWorld namespace CSMTools { /// \brief Verify stage: make sure that records with specific IDs exist. - class MandatoryIdStage : public Stage + class MandatoryIdStage : public CSMDoc::Stage { const CSMWorld::CollectionBase& mIdCollection; CSMWorld::UniversalId mCollectionId; diff --git a/apps/opencs/model/tools/racecheck.hpp b/apps/opencs/model/tools/racecheck.hpp index 155f79902..ff9948bf6 100644 --- a/apps/opencs/model/tools/racecheck.hpp +++ b/apps/opencs/model/tools/racecheck.hpp @@ -5,12 +5,12 @@ #include "../world/idcollection.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMTools { /// \brief VerifyStage: make sure that race records are internally consistent - class RaceCheckStage : public Stage + class RaceCheckStage : public CSMDoc::Stage { const CSMWorld::IdCollection& mRaces; bool mPlayable; diff --git a/apps/opencs/model/tools/regioncheck.hpp b/apps/opencs/model/tools/regioncheck.hpp index b42135651..c8c437cbd 100644 --- a/apps/opencs/model/tools/regioncheck.hpp +++ b/apps/opencs/model/tools/regioncheck.hpp @@ -5,12 +5,12 @@ #include "../world/idcollection.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMTools { /// \brief VerifyStage: make sure that region records are internally consistent - class RegionCheckStage : public Stage + class RegionCheckStage : public CSMDoc::Stage { const CSMWorld::IdCollection& mRegions; diff --git a/apps/opencs/model/tools/skillcheck.hpp b/apps/opencs/model/tools/skillcheck.hpp index 30a3f01ca..662bdadee 100644 --- a/apps/opencs/model/tools/skillcheck.hpp +++ b/apps/opencs/model/tools/skillcheck.hpp @@ -5,12 +5,12 @@ #include "../world/idcollection.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMTools { /// \brief VerifyStage: make sure that skill records are internally consistent - class SkillCheckStage : public Stage + class SkillCheckStage : public CSMDoc::Stage { const CSMWorld::IdCollection& mSkills; diff --git a/apps/opencs/model/tools/soundcheck.hpp b/apps/opencs/model/tools/soundcheck.hpp index a309763a1..00b45cd93 100644 --- a/apps/opencs/model/tools/soundcheck.hpp +++ b/apps/opencs/model/tools/soundcheck.hpp @@ -5,12 +5,12 @@ #include "../world/idcollection.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMTools { /// \brief VerifyStage: make sure that sound records are internally consistent - class SoundCheckStage : public Stage + class SoundCheckStage : public CSMDoc::Stage { const CSMWorld::IdCollection& mSounds; diff --git a/apps/opencs/model/tools/spellcheck.hpp b/apps/opencs/model/tools/spellcheck.hpp index 056639219..880ddafcd 100644 --- a/apps/opencs/model/tools/spellcheck.hpp +++ b/apps/opencs/model/tools/spellcheck.hpp @@ -5,12 +5,12 @@ #include "../world/idcollection.hpp" -#include "stage.hpp" +#include "../doc/stage.hpp" namespace CSMTools { /// \brief VerifyStage: make sure that spell records are internally consistent - class SpellCheckStage : public Stage + class SpellCheckStage : public CSMDoc::Stage { const CSMWorld::IdCollection& mSpells; diff --git a/apps/opencs/model/tools/stage.cpp b/apps/opencs/model/tools/stage.cpp deleted file mode 100644 index 6f4567e57..000000000 --- a/apps/opencs/model/tools/stage.cpp +++ /dev/null @@ -1,4 +0,0 @@ - -#include "stage.hpp" - -CSMTools::Stage::~Stage() {} \ No newline at end of file diff --git a/apps/opencs/model/tools/tools.cpp b/apps/opencs/model/tools/tools.cpp index 803861203..cd4653280 100644 --- a/apps/opencs/model/tools/tools.cpp +++ b/apps/opencs/model/tools/tools.cpp @@ -3,9 +3,8 @@ #include -#include "verifier.hpp" - #include "../doc/state.hpp" +#include "../doc/operation.hpp" #include "../world/data.hpp" #include "../world/universalid.hpp" @@ -21,7 +20,7 @@ #include "birthsigncheck.hpp" #include "spellcheck.hpp" -CSMTools::Operation *CSMTools::Tools::get (int type) +CSMDoc::Operation *CSMTools::Tools::get (int type) { switch (type) { @@ -31,19 +30,19 @@ CSMTools::Operation *CSMTools::Tools::get (int type) return 0; } -const CSMTools::Operation *CSMTools::Tools::get (int type) const +const CSMDoc::Operation *CSMTools::Tools::get (int type) const { return const_cast (this)->get (type); } -CSMTools::Verifier *CSMTools::Tools::getVerifier() +CSMDoc::Operation *CSMTools::Tools::getVerifier() { if (!mVerifier) { - mVerifier = new Verifier; + mVerifier = new CSMDoc::Operation (CSMDoc::State_Verifying, false); connect (mVerifier, SIGNAL (progress (int, int, int)), this, SIGNAL (progress (int, int, int))); - connect (mVerifier, SIGNAL (finished()), this, SLOT (verifierDone())); + connect (mVerifier, SIGNAL (done (int)), this, SIGNAL (done (int))); connect (mVerifier, SIGNAL (reportMessage (const QString&, int)), this, SLOT (verifierMessage (const QString&, int))); @@ -103,7 +102,7 @@ CSMWorld::UniversalId CSMTools::Tools::runVerifier() void CSMTools::Tools::abortOperation (int type) { - if (Operation *operation = get (type)) + if (CSMDoc::Operation *operation = get (type)) operation->abort(); } @@ -118,7 +117,7 @@ int CSMTools::Tools::getRunningOperations() const int result = 0; for (int i=0; sOperations[i]!=-1; ++i) - if (const Operation *operation = get (sOperations[i])) + if (const CSMDoc::Operation *operation = get (sOperations[i])) if (operation->isRunning()) result |= sOperations[i]; @@ -133,11 +132,6 @@ CSMTools::ReportModel *CSMTools::Tools::getReport (const CSMWorld::UniversalId& return mReports.at (id.getIndex()); } -void CSMTools::Tools::verifierDone() -{ - emit done (CSMDoc::State_Verifying); -} - void CSMTools::Tools::verifierMessage (const QString& message, int type) { std::map::iterator iter = mActiveReports.find (type); diff --git a/apps/opencs/model/tools/tools.hpp b/apps/opencs/model/tools/tools.hpp index 652345c6d..0079fab34 100644 --- a/apps/opencs/model/tools/tools.hpp +++ b/apps/opencs/model/tools/tools.hpp @@ -11,10 +11,13 @@ namespace CSMWorld class UniversalId; } +namespace CSMDoc +{ + class Operation; +} + namespace CSMTools { - class Verifier; - class Operation; class ReportModel; class Tools : public QObject @@ -22,7 +25,7 @@ namespace CSMTools Q_OBJECT CSMWorld::Data& mData; - Verifier *mVerifier; + CSMDoc::Operation *mVerifier; std::map mReports; int mNextReportNumber; std::map mActiveReports; // type, report number @@ -31,12 +34,12 @@ namespace CSMTools Tools (const Tools&); Tools& operator= (const Tools&); - Verifier *getVerifier(); + CSMDoc::Operation *getVerifier(); - Operation *get (int type); + CSMDoc::Operation *get (int type); ///< Returns a 0-pointer, if operation hasn't been used yet. - const Operation *get (int type) const; + const CSMDoc::Operation *get (int type) const; ///< Returns a 0-pointer, if operation hasn't been used yet. public: @@ -58,8 +61,6 @@ namespace CSMTools private slots: - void verifierDone(); - void verifierMessage (const QString& message, int type); signals: diff --git a/apps/opencs/model/tools/verifier.cpp b/apps/opencs/model/tools/verifier.cpp deleted file mode 100644 index 9c00d4ea7..000000000 --- a/apps/opencs/model/tools/verifier.cpp +++ /dev/null @@ -1,7 +0,0 @@ - -#include "verifier.hpp" - -#include "../doc/state.hpp" - -CSMTools::Verifier::Verifier() : Operation (CSMDoc::State_Verifying) -{} diff --git a/apps/opencs/model/tools/verifier.hpp b/apps/opencs/model/tools/verifier.hpp deleted file mode 100644 index 054f87169..000000000 --- a/apps/opencs/model/tools/verifier.hpp +++ /dev/null @@ -1,17 +0,0 @@ -#ifndef CSM_TOOLS_VERIFIER_H -#define CSM_TOOLS_VERIFIER_H - -#include "operation.hpp" - -namespace CSMTools -{ - class Verifier : public Operation - { - public: - - Verifier(); - - }; -} - -#endif diff --git a/apps/opencs/model/world/collection.hpp b/apps/opencs/model/world/collection.hpp index 84a00cef8..df144ba7b 100644 --- a/apps/opencs/model/world/collection.hpp +++ b/apps/opencs/model/world/collection.hpp @@ -51,6 +51,18 @@ namespace CSMWorld Collection (const Collection&); Collection& operator= (const Collection&); + protected: + + const std::map& getIdMap() const; + + const std::vector >& getRecords() const; + + bool reorderRowsImp (int baseIndex, const std::vector& newOrder); + ///< Reorder the rows [baseIndex, baseIndex+newOrder.size()) according to the indices + /// given in \a newOrder (baseIndex+newOrder[0] specifies the new index of row baseIndex). + /// + /// \return Success? + public: Collection(); @@ -104,7 +116,8 @@ namespace CSMWorld virtual const Record& getRecord (int index) const; - virtual int getAppendIndex (UniversalId::Type type = UniversalId::Type_None) const; + virtual int getAppendIndex (const std::string& id, + UniversalId::Type type = UniversalId::Type_None) const; ///< \param type Will be ignored, unless the collection supports multiple record types virtual std::vector getIds (bool listDeleted = true) const; @@ -112,12 +125,74 @@ namespace CSMWorld /// /// \param listDeleted include deleted record in the list + virtual void insertRecord (const RecordBase& record, int index, + UniversalId::Type type = UniversalId::Type_None); + ///< Insert record before index. + /// + /// If the record type does not match, an exception is thrown. + /// + /// If the index is invalid either generally (by being out of range) or for the particular + /// record, an exception is thrown. + + virtual bool reorderRows (int baseIndex, const std::vector& newOrder); + ///< Reorder the rows [baseIndex, baseIndex+newOrder.size()) according to the indices + /// given in \a newOrder (baseIndex+newOrder[0] specifies the new index of row baseIndex). + /// + /// \return Success? + void addColumn (Column *column); void setRecord (int index, const Record& record); ///< \attention This function must not change the ID. }; + template + const std::map& Collection::getIdMap() const + { + return mIndex; + } + + template + const std::vector >& Collection::getRecords() const + { + return mRecords; + } + + template + bool Collection::reorderRowsImp (int baseIndex, + const std::vector& newOrder) + { + if (!newOrder.empty()) + { + int size = static_cast (newOrder.size()); + + // check that all indices are present + std::vector test (newOrder); + std::sort (test.begin(), test.end()); + if (*test.begin()!=0 || *--test.end()!=size-1) + return false; + + // reorder records + std::vector > buffer (size); + + for (int i=0; i::iterator iter (mIndex.begin()); iter!=mIndex.end(); + ++iter) + if (iter->second>=baseIndex && iter->secondsecond = newOrder.at (iter->second-baseIndex)+baseIndex; + } + + return true; + } + template Collection::Collection() {} @@ -142,8 +217,7 @@ namespace CSMWorld record2.mState = Record::State_ModifiedOnly; record2.mModified = record; - mRecords.push_back (record2); - mIndex.insert (std::make_pair (Misc::StringUtils::lowerCase (id), mRecords.size()-1)); + insertRecord (record2, getAppendIndex (id)); } else { @@ -260,7 +334,12 @@ namespace CSMWorld ESXRecordT record; IdAccessorT().getId (record) = id; record.blank(); - add (record); + + Record record2; + record2.mState = Record::State_ModifiedOnly; + record2.mModified = record; + + insertRecord (record2, getAppendIndex (id, type), type); } template @@ -286,14 +365,14 @@ namespace CSMWorld void Collection::appendRecord (const RecordBase& record, UniversalId::Type type) { - mRecords.push_back (dynamic_cast&> (record)); - mIndex.insert (std::make_pair (Misc::StringUtils::lowerCase (IdAccessorT().getId ( - dynamic_cast&> (record).get())), - mRecords.size()-1)); + insertRecord (record, + getAppendIndex (IdAccessorT().getId ( + dynamic_cast&> (record).get()), type), type); } template - int Collection::getAppendIndex (UniversalId::Type type) const + int Collection::getAppendIndex (const std::string& id, + UniversalId::Type type) const { return static_cast (mRecords.size()); } @@ -326,6 +405,29 @@ namespace CSMWorld return mRecords.at (index); } + template + void Collection::insertRecord (const RecordBase& record, int index, + UniversalId::Type type) + { + if (index<0 || index>static_cast (mRecords.size())) + throw std::runtime_error ("index out of range"); + + const Record& record2 = dynamic_cast&> (record); + + mRecords.insert (mRecords.begin()+index, record2); + + if (index (mRecords.size())-1) + { + for (std::map::iterator iter (mIndex.begin()); iter!=mIndex.end(); + ++iter) + if (iter->second>=index) + ++(iter->second); + } + + mIndex.insert (std::make_pair (Misc::StringUtils::lowerCase (IdAccessorT().getId ( + record2.get())), index)); + } + template void Collection::setRecord (int index, const Record& record) { @@ -334,6 +436,12 @@ namespace CSMWorld mRecords.at (index) = record; } + + template + bool Collection::reorderRows (int baseIndex, const std::vector& newOrder) + { + return false; + } } #endif diff --git a/apps/opencs/model/world/collectionbase.cpp b/apps/opencs/model/world/collectionbase.cpp index 932ea27b5..241f198cb 100644 --- a/apps/opencs/model/world/collectionbase.cpp +++ b/apps/opencs/model/world/collectionbase.cpp @@ -1,6 +1,31 @@ #include "collectionbase.hpp" +#include + +#include "columnbase.hpp" + CSMWorld::CollectionBase::CollectionBase() {} CSMWorld::CollectionBase::~CollectionBase() {} + +int CSMWorld::CollectionBase::searchColumnIndex (Columns::ColumnId id) const +{ + int columns = getColumns(); + + for (int i=0; i +#include #include "universalid.hpp" +#include "columns.hpp" class QVariant; @@ -76,13 +78,27 @@ namespace CSMWorld virtual const RecordBase& getRecord (int index) const = 0; - virtual int getAppendIndex (UniversalId::Type type = UniversalId::Type_None) const = 0; + virtual int getAppendIndex (const std::string& id, + UniversalId::Type type = UniversalId::Type_None) const = 0; ///< \param type Will be ignored, unless the collection supports multiple record types virtual std::vector getIds (bool listDeleted = true) const = 0; ///< Return a sorted collection of all IDs /// /// \param listDeleted include deleted record in the list + + virtual bool reorderRows (int baseIndex, const std::vector& newOrder) = 0; + ///< Reorder the rows [baseIndex, baseIndex+newOrder.size()) according to the indices + /// given in \a newOrder (baseIndex+newOrder[0] specifies the new index of row baseIndex). + /// + /// \return Success? + + int searchColumnIndex (Columns::ColumnId id) const; + ///< Return index of column with the given \a id. If no such column exists, -1 is returned. + + int findColumnIndex (Columns::ColumnId id) const; + ///< Return index of column with the given \a id. If no such column exists, an exception is + /// thrown. }; } diff --git a/apps/opencs/model/world/columnbase.hpp b/apps/opencs/model/world/columnbase.hpp index c1b423c94..70f38c534 100644 --- a/apps/opencs/model/world/columnbase.hpp +++ b/apps/opencs/model/world/columnbase.hpp @@ -43,7 +43,10 @@ namespace CSMWorld Display_CreatureType, Display_WeaponType, Display_RecordState, - Display_RefRecordType + Display_RefRecordType, + Display_DialogueType, + Display_QuestStatusType, + Display_Gender }; int mColumnId; diff --git a/apps/opencs/model/world/columnimp.hpp b/apps/opencs/model/world/columnimp.hpp index a13ac9a8a..18aac9e0b 100644 --- a/apps/opencs/model/world/columnimp.hpp +++ b/apps/opencs/model/world/columnimp.hpp @@ -9,6 +9,7 @@ #include "columnbase.hpp" #include "columns.hpp" +#include "info.hpp" namespace CSMWorld { @@ -814,14 +815,14 @@ namespace CSMWorld virtual QVariant get (const Record& record) const { - return QString::fromUtf8 (record.get().mCellId.c_str()); + return QString::fromUtf8 (record.get().mCell.c_str()); } virtual void set (Record& record, const QVariant& data) { ESXRecordT record2 = record.get(); - record2.mCellId = data.toString().toUtf8().constData(); + record2.mCell = data.toString().toUtf8().constData(); record.setModified (record2); } @@ -1217,6 +1218,37 @@ namespace CSMWorld } }; + template + struct ScopeColumn : public Column + { + ScopeColumn() + : Column (Columns::ColumnId_Scope, ColumnBase::Display_Integer, 0) + {} + + virtual QVariant get (const Record& record) const + { + return static_cast (record.get().mScope); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + record2.mScope = static_cast (data.toInt()); + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + + virtual bool isUserEditable() const + { + return false; + } + }; + + template struct PosColumn : public Column { @@ -1284,6 +1316,373 @@ namespace CSMWorld return true; } }; + + template + struct DialogueTypeColumn : public Column + { + DialogueTypeColumn (bool hidden = false) + : Column (Columns::ColumnId_DialogueType, ColumnBase::Display_DialogueType, + hidden ? 0 : ColumnBase::Flag_Table | ColumnBase::Flag_Dialogue) + {} + + virtual QVariant get (const Record& record) const + { + return static_cast (record.get().mType); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mType = data.toInt(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + + virtual bool isUserEditable() const + { + return false; + } + }; + + template + struct QuestStatusTypeColumn : public Column + { + QuestStatusTypeColumn() + : Column (Columns::ColumnId_QuestStatusType, ColumnBase::Display_QuestStatusType) + {} + + virtual QVariant get (const Record& record) const + { + return static_cast (record.get().mQuestStatus); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mQuestStatus = static_cast (data.toInt()); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct QuestDescriptionColumn : public Column + { + QuestDescriptionColumn() : Column (Columns::ColumnId_QuestDescription, ColumnBase::Display_String) {} + + virtual QVariant get (const Record& record) const + { + return QString::fromUtf8 (record.get().mResponse.c_str()); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mResponse = data.toString().toUtf8().constData(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct QuestIndexColumn : public Column + { + QuestIndexColumn() + : Column (Columns::ColumnId_QuestIndex, ColumnBase::Display_Integer) + {} + + virtual QVariant get (const Record& record) const + { + return record.get().mData.mDisposition; + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + record2.mData.mDisposition = data.toInt(); + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct TopicColumn : public Column + { + TopicColumn (bool journal) : Column (journal ? Columns::ColumnId_Journal : Columns::ColumnId_Topic, ColumnBase::Display_String) {} + + virtual QVariant get (const Record& record) const + { + return QString::fromUtf8 (record.get().mTopicId.c_str()); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mTopicId = data.toString().toUtf8().constData(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + + virtual bool isUserEditable() const + { + return false; + } + }; + + template + struct ActorColumn : public Column + { + ActorColumn() : Column (Columns::ColumnId_Actor, ColumnBase::Display_String) {} + + virtual QVariant get (const Record& record) const + { + return QString::fromUtf8 (record.get().mActor.c_str()); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mActor = data.toString().toUtf8().constData(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct RaceColumn : public Column + { + RaceColumn() : Column (Columns::ColumnId_Race, ColumnBase::Display_String) {} + + virtual QVariant get (const Record& record) const + { + return QString::fromUtf8 (record.get().mRace.c_str()); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mRace = data.toString().toUtf8().constData(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct ClassColumn : public Column + { + ClassColumn() : Column (Columns::ColumnId_Class, ColumnBase::Display_String) {} + + virtual QVariant get (const Record& record) const + { + return QString::fromUtf8 (record.get().mClass.c_str()); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mClass = data.toString().toUtf8().constData(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct PcFactionColumn : public Column + { + PcFactionColumn() : Column (Columns::ColumnId_PcFaction, ColumnBase::Display_String) {} + + virtual QVariant get (const Record& record) const + { + return QString::fromUtf8 (record.get().mPcFaction.c_str()); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mPcFaction = data.toString().toUtf8().constData(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct ResponseColumn : public Column + { + ResponseColumn() : Column (Columns::ColumnId_Response, ColumnBase::Display_String) {} + + virtual QVariant get (const Record& record) const + { + return QString::fromUtf8 (record.get().mResponse.c_str()); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mResponse = data.toString().toUtf8().constData(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct DispositionColumn : public Column + { + DispositionColumn() + : Column (Columns::ColumnId_Disposition, ColumnBase::Display_Integer) + {} + + virtual QVariant get (const Record& record) const + { + return record.get().mData.mDisposition; + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + record2.mData.mDisposition = data.toInt(); + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct RankColumn : public Column + { + RankColumn() + : Column (Columns::ColumnId_Rank, ColumnBase::Display_Integer) + {} + + virtual QVariant get (const Record& record) const + { + return static_cast (record.get().mData.mRank); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + record2.mData.mRank = static_cast (data.toInt()); + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct PcRankColumn : public Column + { + PcRankColumn() + : Column (Columns::ColumnId_PcRank, ColumnBase::Display_Integer) + {} + + virtual QVariant get (const Record& record) const + { + return static_cast (record.get().mData.mPCrank); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + record2.mData.mPCrank = static_cast (data.toInt()); + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; + + template + struct GenderColumn : public Column + { + GenderColumn() + : Column (Columns::ColumnId_Gender, ColumnBase::Display_Gender) + {} + + virtual QVariant get (const Record& record) const + { + return static_cast (record.get().mData.mGender); + } + + virtual void set (Record& record, const QVariant& data) + { + ESXRecordT record2 = record.get(); + + record2.mData.mGender = data.toInt(); + + record.setModified (record2); + } + + virtual bool isEditable() const + { + return true; + } + }; } #endif diff --git a/apps/opencs/model/world/columns.cpp b/apps/opencs/model/world/columns.cpp index ca37840ad..7a1313720 100644 --- a/apps/opencs/model/world/columns.cpp +++ b/apps/opencs/model/world/columns.cpp @@ -159,6 +159,20 @@ namespace CSMWorld { ColumnId_DoorPositionXRot, "Teleport Rot X" }, { ColumnId_DoorPositionYRot, "Teleport Rot Y" }, { ColumnId_DoorPositionZRot, "Teleport Rot Z" }, + { ColumnId_DialogueType, "Dialogue Type" }, + { ColumnId_QuestIndex, "Quest Index" }, + { ColumnId_QuestStatusType, "Quest Status" }, + { ColumnId_QuestDescription, "Quest Description" }, + { ColumnId_Topic, "Topic" }, + { ColumnId_Journal, "Journal" }, + { ColumnId_Actor, "Actor" }, + { ColumnId_PcFaction, "PC Faction" }, + { ColumnId_Response, "Response" }, + { ColumnId_Disposition, "Disposition" }, + { ColumnId_Rank, "Rank" }, + { ColumnId_Gender, "Gender" }, + { ColumnId_PcRank, "PC Rank" }, + { ColumnId_Scope, "Scope", }, { ColumnId_UseValue1, "Use value 1" }, { ColumnId_UseValue2, "Use value 2" }, @@ -269,6 +283,21 @@ namespace "unknown", "none", "short", "integer", "long", "float", "string", 0 }; + static const char *sDialogueTypeEnums[] = + { + "Topic", "Voice", "Greeting", "Persuasion", 0 + }; + + static const char *sQuestStatusTypes[] = + { + "None", "Name", "Finished", "Restart", 0 + }; + + static const char *sGenderEnums[] = + { + "Male", "Female", 0 + }; + const char **getEnumNames (CSMWorld::Columns::ColumnId column) { switch (column) @@ -283,6 +312,9 @@ namespace case CSMWorld::Columns::ColumnId_WeaponType: return sWeaponTypes; case CSMWorld::Columns::ColumnId_Modification: return sModificationEnums; case CSMWorld::Columns::ColumnId_ValueType: return sVarTypeEnums; + case CSMWorld::Columns::ColumnId_DialogueType: return sDialogueTypeEnums; + case CSMWorld::Columns::ColumnId_QuestStatusType: return sQuestStatusTypes; + case CSMWorld::Columns::ColumnId_Gender: return sGenderEnums; default: return 0; } diff --git a/apps/opencs/model/world/columns.hpp b/apps/opencs/model/world/columns.hpp index 9b26cac4c..52e022e78 100644 --- a/apps/opencs/model/world/columns.hpp +++ b/apps/opencs/model/world/columns.hpp @@ -152,6 +152,20 @@ namespace CSMWorld ColumnId_DoorPositionXRot = 139, ColumnId_DoorPositionYRot = 140, ColumnId_DoorPositionZRot = 141, + ColumnId_DialogueType = 142, + ColumnId_QuestIndex = 143, + ColumnId_QuestStatusType = 144, + ColumnId_QuestDescription = 145, + ColumnId_Topic = 146, + ColumnId_Journal = 147, + ColumnId_Actor = 148, + ColumnId_PcFaction = 149, + ColumnId_Response = 150, + ColumnId_Disposition = 151, + ColumnId_Rank = 152, + ColumnId_Gender = 153, + ColumnId_PcRank = 154, + ColumnId_Scope = 155, // Allocated to a separate value range, so we don't get a collision should we ever need // to extend the number of use values. diff --git a/apps/opencs/model/world/commands.cpp b/apps/opencs/model/world/commands.cpp index f6f421c6a..21feb14be 100644 --- a/apps/opencs/model/world/commands.cpp +++ b/apps/opencs/model/world/commands.cpp @@ -122,4 +122,26 @@ void CSMWorld::DeleteCommand::redo() void CSMWorld::DeleteCommand::undo() { mModel.setRecord (mId, *mOld); +} + + +CSMWorld::ReorderRowsCommand::ReorderRowsCommand (IdTable& model, int baseIndex, + const std::vector& newOrder) +: mModel (model), mBaseIndex (baseIndex), mNewOrder (newOrder) +{} + +void CSMWorld::ReorderRowsCommand::redo() +{ + mModel.reorderRows (mBaseIndex, mNewOrder); +} + +void CSMWorld::ReorderRowsCommand::undo() +{ + int size = static_cast (mNewOrder.size()); + std::vector reverse (size); + + for (int i=0; i #include +#include #include #include @@ -99,6 +100,21 @@ namespace CSMWorld virtual void undo(); }; + + class ReorderRowsCommand : public QUndoCommand + { + IdTable& mModel; + int mBaseIndex; + std::vector mNewOrder; + + public: + + ReorderRowsCommand (IdTable& model, int baseIndex, const std::vector& newOrder); + + virtual void redo(); + + virtual void undo(); + }; } #endif \ No newline at end of file diff --git a/apps/opencs/model/world/data.cpp b/apps/opencs/model/world/data.cpp index 1e290d45f..04e35cdaa 100644 --- a/apps/opencs/model/world/data.cpp +++ b/apps/opencs/model/world/data.cpp @@ -44,6 +44,17 @@ void CSMWorld::Data::appendIds (std::vector& ids, const CollectionB ids.insert (ids.end(), ids2.begin(), ids2.end()); } +int CSMWorld::Data::count (RecordBase::State state, const CollectionBase& collection) +{ + int number = 0; + + for (int i=0; i); @@ -141,6 +152,37 @@ CSMWorld::Data::Data() : mRefs (mCells) mSpells.addColumn (new FlagColumn (Columns::ColumnId_StarterSpell, 0x2)); mSpells.addColumn (new FlagColumn (Columns::ColumnId_AlwaysSucceeds, 0x4)); + mTopics.addColumn (new StringIdColumn); + mTopics.addColumn (new RecordStateColumn); + mTopics.addColumn (new DialogueTypeColumn); + + mJournals.addColumn (new StringIdColumn); + mJournals.addColumn (new RecordStateColumn); + mJournals.addColumn (new DialogueTypeColumn (true)); + + mTopicInfos.addColumn (new StringIdColumn (true)); + mTopicInfos.addColumn (new RecordStateColumn); + mTopicInfos.addColumn (new TopicColumn (false)); + mTopicInfos.addColumn (new ActorColumn); + mTopicInfos.addColumn (new RaceColumn); + mTopicInfos.addColumn (new ClassColumn); + mTopicInfos.addColumn (new FactionColumn); + mTopicInfos.addColumn (new CellColumn); + mTopicInfos.addColumn (new DispositionColumn); + mTopicInfos.addColumn (new RankColumn); + mTopicInfos.addColumn (new GenderColumn); + mTopicInfos.addColumn (new PcFactionColumn); + mTopicInfos.addColumn (new PcRankColumn); + mTopicInfos.addColumn (new SoundFileColumn); + mTopicInfos.addColumn (new ResponseColumn); + + mJournalInfos.addColumn (new StringIdColumn (true)); + mJournalInfos.addColumn (new RecordStateColumn); + mJournalInfos.addColumn (new TopicColumn (true)); + mJournalInfos.addColumn (new QuestStatusTypeColumn); + mJournalInfos.addColumn (new QuestIndexColumn); + mJournalInfos.addColumn (new QuestDescriptionColumn); + mCells.addColumn (new StringIdColumn); mCells.addColumn (new RecordStateColumn); mCells.addColumn (new FixedRecordTypeColumn (UniversalId::Type_Cell)); @@ -184,6 +226,7 @@ CSMWorld::Data::Data() : mRefs (mCells) mFilters.addColumn (new RecordStateColumn); mFilters.addColumn (new FilterColumn); mFilters.addColumn (new DescriptionColumn); + mFilters.addColumn (new ScopeColumn); addModel (new IdTable (&mGlobals), UniversalId::Type_Globals, UniversalId::Type_Global); addModel (new IdTable (&mGmsts), UniversalId::Type_Gmsts, UniversalId::Type_Gmst); @@ -196,6 +239,10 @@ CSMWorld::Data::Data() : mRefs (mCells) addModel (new IdTable (&mRegions), UniversalId::Type_Regions, UniversalId::Type_Region); addModel (new IdTable (&mBirthsigns), UniversalId::Type_Birthsigns, UniversalId::Type_Birthsign); addModel (new IdTable (&mSpells), UniversalId::Type_Spells, UniversalId::Type_Spell); + addModel (new IdTable (&mTopics), UniversalId::Type_Topics, UniversalId::Type_Topic); + addModel (new IdTable (&mJournals), UniversalId::Type_Journals, UniversalId::Type_Journal); + addModel (new IdTable (&mTopicInfos), UniversalId::Type_TopicInfos, UniversalId::Type_TopicInfo); + addModel (new IdTable (&mJournalInfos), UniversalId::Type_JournalInfos, UniversalId::Type_JournalInfo); addModel (new IdTable (&mCells), UniversalId::Type_Cells, UniversalId::Type_Cell); addModel (new IdTable (&mReferenceables), UniversalId::Type_Referenceables, UniversalId::Type_Referenceable); @@ -319,6 +366,47 @@ CSMWorld::IdCollection& CSMWorld::Data::getSpells() return mSpells; } + +const CSMWorld::IdCollection& CSMWorld::Data::getTopics() const +{ + return mTopics; +} + +CSMWorld::IdCollection& CSMWorld::Data::getTopics() +{ + return mTopics; +} + +const CSMWorld::IdCollection& CSMWorld::Data::getJournals() const +{ + return mJournals; +} + +CSMWorld::IdCollection& CSMWorld::Data::getJournals() +{ + return mJournals; +} + +const CSMWorld::InfoCollection& CSMWorld::Data::getTopicInfos() const +{ + return mTopicInfos; +} + +CSMWorld::InfoCollection& CSMWorld::Data::getTopicInfos() +{ + return mTopicInfos; +} + +const CSMWorld::InfoCollection& CSMWorld::Data::getJournalInfos() const +{ + return mJournalInfos; +} + +CSMWorld::InfoCollection& CSMWorld::Data::getJournalInfos() +{ + return mJournalInfos; +} + const CSMWorld::IdCollection& CSMWorld::Data::getCells() const { return mCells; @@ -387,7 +475,7 @@ void CSMWorld::Data::merge() mGlobals.merge(); } -void CSMWorld::Data::loadFile (const boost::filesystem::path& path, bool base) +void CSMWorld::Data::loadFile (const boost::filesystem::path& path, bool base, bool project) { ESM::ESMReader reader; @@ -397,6 +485,11 @@ void CSMWorld::Data::loadFile (const boost::filesystem::path& path, bool base) reader.open (path.string()); + const ESM::Dialogue *dialogue = 0; + + mAuthor = reader.getAuthor(); + mDescription = reader.getDesc(); + // Note: We do not need to send update signals here, because at this point the model is not connected // to any view. while (reader.hasMoreRecs()) @@ -447,9 +540,80 @@ void CSMWorld::Data::loadFile (const boost::filesystem::path& path, bool base) case ESM::REC_STAT: mReferenceables.load (reader, base, UniversalId::Type_Static); break; case ESM::REC_WEAP: mReferenceables.load (reader, base, UniversalId::Type_Weapon); break; + case ESM::REC_DIAL: + { + std::string id = reader.getHNOString ("NAME"); + + ESM::Dialogue record; + record.mId = id; + record.load (reader); + + if (record.mType==ESM::Dialogue::Journal) + { + mJournals.load (record, base); + dialogue = &mJournals.getRecord (id).get(); + } + else if (record.mType==ESM::Dialogue::Deleted) + { + dialogue = 0; // record vector can be shuffled around which would make pointer + // to record invalid + + if (mJournals.tryDelete (id)) + { + /// \todo handle info records + } + else if (mTopics.tryDelete (id)) + { + /// \todo handle info records + } + else + { + /// \todo report deletion of non-existing record + } + } + else + { + mTopics.load (record, base); + dialogue = &mTopics.getRecord (id).get(); + } + + break; + } + + case ESM::REC_INFO: + { + if (!dialogue) + { + /// \todo INFO record without matching DIAL record -> report to user + reader.skipRecord(); + break; + } + + if (dialogue->mType==ESM::Dialogue::Journal) + mJournalInfos.load (reader, base, *dialogue); + else + mTopicInfos.load (reader, base, *dialogue); + + break; + } + + case ESM::REC_FILT: + + if (project) + { + mFilters.load (reader, base); + mFilters.setData (mFilters.getSize()-1, + mFilters.findColumnIndex (CSMWorld::Columns::ColumnId_Scope), + static_cast (CSMFilter::Filter::Scope_Project)); + break; + } + + // fall through (filter record in a content file is an error with format 0) + default: /// \todo throw an exception instead, once all records are implemented + /// or maybe report error and continue? reader.skipRecord(); } } @@ -469,10 +633,50 @@ bool CSMWorld::Data::hasId (const std::string& id) const getRegions().searchId (id)!=-1 || getBirthsigns().searchId (id)!=-1 || getSpells().searchId (id)!=-1 || + getTopics().searchId (id)!=-1 || + getJournals().searchId (id)!=-1 || getCells().searchId (id)!=-1 || getReferenceables().searchId (id)!=-1; } +int CSMWorld::Data::count (RecordBase::State state) const +{ + return + count (state, mGlobals) + + count (state, mGmsts) + + count (state, mSkills) + + count (state, mClasses) + + count (state, mFactions) + + count (state, mRaces) + + count (state, mSounds) + + count (state, mScripts) + + count (state, mRegions) + + count (state, mBirthsigns) + + count (state, mSpells) + + count (state, mCells) + + count (state, mReferenceables); +} + +void CSMWorld::Data::setDescription (const std::string& description) +{ + mDescription = description; +} + +std::string CSMWorld::Data::getDescription() const +{ + return mDescription; +} + +void CSMWorld::Data::setAuthor (const std::string& author) +{ + mAuthor = author; +} + +std::string CSMWorld::Data::getAuthor() const +{ + return mAuthor; +} + std::vector CSMWorld::Data::getIds (bool listDeleted) const { std::vector ids; @@ -487,6 +691,8 @@ std::vector CSMWorld::Data::getIds (bool listDeleted) const appendIds (ids, mRegions, listDeleted); appendIds (ids, mBirthsigns, listDeleted); appendIds (ids, mSpells, listDeleted); + appendIds (ids, mTopics, listDeleted); + appendIds (ids, mJournals, listDeleted); appendIds (ids, mCells, listDeleted); appendIds (ids, mReferenceables, listDeleted); diff --git a/apps/opencs/model/world/data.hpp b/apps/opencs/model/world/data.hpp index e900bb10f..152c3ac41 100644 --- a/apps/opencs/model/world/data.hpp +++ b/apps/opencs/model/world/data.hpp @@ -20,6 +20,7 @@ #include #include #include +#include #include "../filter/filter.hpp" @@ -28,6 +29,7 @@ #include "cell.hpp" #include "refidcollection.hpp" #include "refcollection.hpp" +#include "infocollection.hpp" class QAbstractItemModel; @@ -48,12 +50,18 @@ namespace CSMWorld IdCollection mRegions; IdCollection mBirthsigns; IdCollection mSpells; + IdCollection mTopics; + IdCollection mJournals; + InfoCollection mTopicInfos; + InfoCollection mJournalInfos; IdCollection mCells; RefIdCollection mReferenceables; RefCollection mRefs; IdCollection mFilters; std::vector mModels; std::map mModelIndex; + std::string mAuthor; + std::string mDescription; // not implemented Data (const Data&); @@ -66,6 +74,8 @@ namespace CSMWorld bool listDeleted); ///< Append all IDs from collection to \a ids. + static int count (RecordBase::State state, const CollectionBase& collection); + public: Data(); @@ -116,6 +126,22 @@ namespace CSMWorld IdCollection& getSpells(); + const IdCollection& getTopics() const; + + IdCollection& getTopics(); + + const IdCollection& getJournals() const; + + IdCollection& getJournals(); + + const InfoCollection& getTopicInfos() const; + + InfoCollection& getTopicInfos(); + + const InfoCollection& getJournalInfos() const; + + InfoCollection& getJournalInfos(); + const IdCollection& getCells() const; IdCollection& getCells(); @@ -141,8 +167,10 @@ namespace CSMWorld void merge(); ///< Merge modified into base. - void loadFile (const boost::filesystem::path& path, bool base); + void loadFile (const boost::filesystem::path& path, bool base, bool project); ///< Merging content of a file into base or modified. + /// + /// \param project load project file instead of content file bool hasId (const std::string& id) const; @@ -151,6 +179,17 @@ namespace CSMWorld /// /// \param listDeleted include deleted record in the list + int count (RecordBase::State state) const; + ///< Return number of top-level records with the given \a state. + + void setDescription (const std::string& description); + + std::string getDescription() const; + + void setAuthor (const std::string& author); + + std::string getAuthor() const; + signals: void idListChanged(); diff --git a/apps/opencs/model/world/idcollection.hpp b/apps/opencs/model/world/idcollection.hpp index 04e65eea7..a7b37be5b 100644 --- a/apps/opencs/model/world/idcollection.hpp +++ b/apps/opencs/model/world/idcollection.hpp @@ -7,21 +7,24 @@ namespace CSMWorld { - /// \brief Single type collection of top level records template > class IdCollection : public Collection { public: - void load (ESM::ESMReader& reader, bool base, - UniversalId::Type type = UniversalId::Type_None); - ///< \param type Will be ignored, unless the collection supports multiple record types + void load (ESM::ESMReader& reader, bool base); + + void load (const ESXRecordT& record, bool base); + + bool tryDelete (const std::string& id); + ///< Try deleting \a id. If the id does not exist or can't be deleted the call is ignored. + /// + /// \return Has the ID been deleted? }; template - void IdCollection::load (ESM::ESMReader& reader, bool base, - UniversalId::Type type) + void IdCollection::load (ESM::ESMReader& reader, bool base) { std::string id = reader.getHNOString ("NAME"); @@ -56,31 +59,63 @@ namespace CSMWorld IdAccessorT().getId (record) = id; record.load (reader); - int index = this->searchId (IdAccessorT().getId (record)); - - if (index==-1) - { - // new record - Record record2; - record2.mState = base ? RecordBase::State_BaseOnly : RecordBase::State_ModifiedOnly; - (base ? record2.mBase : record2.mModified) = record; - - this->appendRecord (record2); - } - else - { - // old record - Record record2 = Collection::getRecord (index); - - if (base) - record2.mBase = record; - else - record2.setModified (record); - - this->setRecord (index, record2); - } + load (record, base); } } + + template + void IdCollection::load (const ESXRecordT& record, bool base) + { + int index = this->searchId (IdAccessorT().getId (record)); + + if (index==-1) + { + // new record + Record record2; + record2.mState = base ? RecordBase::State_BaseOnly : RecordBase::State_ModifiedOnly; + (base ? record2.mBase : record2.mModified) = record; + + this->appendRecord (record2); + } + else + { + // old record + Record record2 = Collection::getRecord (index); + + if (base) + record2.mBase = record; + else + record2.setModified (record); + + this->setRecord (index, record2); + } + } + + template + bool IdCollection::tryDelete (const std::string& id) + { + int index = this->searchId (id); + + if (index==-1) + return false; + + Record record = Collection::getRecord (index); + + if (record.isDeleted()) + return false; + + if (record.mState==RecordBase::State_ModifiedOnly) + { + Collection::removeRows (index, 1); + } + else + { + record.mState = RecordBase::State_Deleted; + this->setRecord (index, record); + } + + return true; + } } #endif diff --git a/apps/opencs/model/world/idtable.cpp b/apps/opencs/model/world/idtable.cpp index baaf75289..809d64339 100644 --- a/apps/opencs/model/world/idtable.cpp +++ b/apps/opencs/model/world/idtable.cpp @@ -4,15 +4,12 @@ #include "collectionbase.hpp" #include "columnbase.hpp" -CSMWorld::IdTable::IdTable (CollectionBase *idCollection) : mIdCollection (idCollection) -{ - -} +CSMWorld::IdTable::IdTable (CollectionBase *idCollection, Reordering reordering) +: mIdCollection (idCollection), mReordering (reordering) +{} CSMWorld::IdTable::~IdTable() -{ - -} +{} int CSMWorld::IdTable::rowCount (const QModelIndex & parent) const { @@ -118,7 +115,7 @@ QModelIndex CSMWorld::IdTable::parent (const QModelIndex& index) const void CSMWorld::IdTable::addRecord (const std::string& id, UniversalId::Type type) { - int index = mIdCollection->getAppendIndex(); + int index = mIdCollection->getAppendIndex (id, type); beginInsertRows (QModelIndex(), index, index); @@ -138,7 +135,7 @@ void CSMWorld::IdTable::setRecord (const std::string& id, const RecordBase& reco if (index==-1) { - int index = mIdCollection->getAppendIndex(); + int index = mIdCollection->getAppendIndex (id); beginInsertRows (QModelIndex(), index, index); @@ -161,21 +158,23 @@ const CSMWorld::RecordBase& CSMWorld::IdTable::getRecord (const std::string& id) int CSMWorld::IdTable::searchColumnIndex (Columns::ColumnId id) const { - int columns = mIdCollection->getColumns(); - - for (int i=0; igetColumn (i).mColumnId==id) - return i; - - return -1; + return mIdCollection->searchColumnIndex (id); } int CSMWorld::IdTable::findColumnIndex (Columns::ColumnId id) const { - int index = searchColumnIndex (id); + return mIdCollection->findColumnIndex (id); +} - if (index==-1) - throw std::logic_error ("invalid column index"); +void CSMWorld::IdTable::reorderRows (int baseIndex, const std::vector& newOrder) +{ + if (!newOrder.empty()) + if (mIdCollection->reorderRows (baseIndex, newOrder)) + emit dataChanged (index (baseIndex, 0), + index (baseIndex+newOrder.size()-1, mIdCollection->getColumns()-1)); +} - return index; +CSMWorld::IdTable::Reordering CSMWorld::IdTable::getReordering() const +{ + return mReordering; } \ No newline at end of file diff --git a/apps/opencs/model/world/idtable.hpp b/apps/opencs/model/world/idtable.hpp index 00c577236..e4ae58fd0 100644 --- a/apps/opencs/model/world/idtable.hpp +++ b/apps/opencs/model/world/idtable.hpp @@ -1,6 +1,8 @@ #ifndef CSM_WOLRD_IDTABLE_H #define CSM_WOLRD_IDTABLE_H +#include + #include #include "universalid.hpp" @@ -15,7 +17,18 @@ namespace CSMWorld { Q_OBJECT + public: + + enum Reordering + { + Reordering_None, + Reordering_WithinTopic + }; + + private: + CollectionBase *mIdCollection; + Reordering mReordering; // not implemented IdTable (const IdTable&); @@ -23,7 +36,7 @@ namespace CSMWorld public: - IdTable (CollectionBase *idCollection); + IdTable (CollectionBase *idCollection, Reordering reordering = Reordering_WithinTopic); ///< The ownership of \a idCollection is not transferred. virtual ~IdTable(); @@ -63,6 +76,12 @@ namespace CSMWorld int findColumnIndex (Columns::ColumnId id) const; ///< Return index of column with the given \a id. If no such column exists, an exception is /// thrown. + + void reorderRows (int baseIndex, const std::vector& newOrder); + ///< Reorder the rows [baseIndex, baseIndex+newOrder.size()) according to the indices + /// given in \a newOrder (baseIndex+newOrder[0] specifies the new index of row baseIndex). + + Reordering getReordering() const; }; } diff --git a/apps/opencs/model/world/info.hpp b/apps/opencs/model/world/info.hpp new file mode 100644 index 000000000..1bcb2dc2d --- /dev/null +++ b/apps/opencs/model/world/info.hpp @@ -0,0 +1,14 @@ +#ifndef CSM_WOLRD_INFO_H +#define CSM_WOLRD_INFO_H + +#include + +namespace CSMWorld +{ + struct Info : public ESM::DialInfo + { + std::string mTopicId; + }; +} + +#endif diff --git a/apps/opencs/model/world/infocollection.cpp b/apps/opencs/model/world/infocollection.cpp new file mode 100644 index 000000000..87bb925c2 --- /dev/null +++ b/apps/opencs/model/world/infocollection.cpp @@ -0,0 +1,184 @@ + +#include "infocollection.hpp" + +#include +#include + +#include +#include + +#include + +void CSMWorld::InfoCollection::load (const Info& record, bool base) +{ + int index = searchId (record.mId); + + if (index==-1) + { + // new record + Record record2; + record2.mState = base ? RecordBase::State_BaseOnly : RecordBase::State_ModifiedOnly; + (base ? record2.mBase : record2.mModified) = record; + + int index = -1; + + std::string topic = Misc::StringUtils::lowerCase (record2.get().mTopicId); + + if (!record2.get().mPrev.empty()) + { + index = getIndex (record2.get().mPrev, topic); + + if (index!=-1) + ++index; + } + + if (index==-1 && !record2.get().mNext.empty()) + { + index = getIndex (record2.get().mNext, topic); + } + + if (index==-1) + { + Range range = getTopicRange (topic); + + index = std::distance (getRecords().begin(), range.second); + } + + insertRecord (record2, index); + } + else + { + // old record + Record record2 = getRecord (index); + + if (base) + record2.mBase = record; + else + record2.setModified (record); + + setRecord (index, record2); + } +} + +int CSMWorld::InfoCollection::getIndex (const std::string& id, const std::string& topic) const +{ + std::string fullId = Misc::StringUtils::lowerCase (topic) + "#" + id; + + std::pair range = getTopicRange (topic); + + for (; range.first!=range.second; ++range.first) + if (Misc::StringUtils::lowerCase (range.first->get().mId)==fullId) + return std::distance (getRecords().begin(), range.first); + + return -1; +} + +int CSMWorld::InfoCollection::getAppendIndex (const std::string& id, UniversalId::Type type) const +{ + std::string::size_type separator = id.find_last_of ('#'); + + if (separator==std::string::npos) + throw std::runtime_error ("invalid info ID: " + id); + + std::pair range = getTopicRange (id.substr (0, separator)); + + if (range.first==range.second) + return Collection >::getAppendIndex (id, type); + + return std::distance (getRecords().begin(), range.second); +} + +bool CSMWorld::InfoCollection::reorderRows (int baseIndex, const std::vector& newOrder) +{ + // check if the range is valid + int lastIndex = baseIndex + newOrder.size() -1; + + if (lastIndex>=getSize()) + return false; + + // Check that topics match + if (getRecord (baseIndex).get().mTopicId!=getRecord (lastIndex).get().mTopicId) + return false; + + // reorder + return reorderRowsImp (baseIndex, newOrder); +} + +void CSMWorld::InfoCollection::load (ESM::ESMReader& reader, bool base, const ESM::Dialogue& dialogue) +{ + std::string id = Misc::StringUtils::lowerCase (dialogue.mId) + "#" + + reader.getHNOString ("INAM"); + + if (reader.isNextSub ("DELE")) + { + int index = searchId (id); + + reader.skipRecord(); + + if (index==-1) + { + // deleting a record that does not exist + + // ignore it for now + + /// \todo report the problem to the user + } + else if (base) + { + removeRows (index, 1); + } + else + { + Record record = getRecord (index); + record.mState = RecordBase::State_Deleted; + setRecord (index, record); + } + } + else + { + Info record; + record.mTopicId = dialogue.mId; + record.mId = id; + record.load (reader); + + load (record, base); + } +} + +CSMWorld::InfoCollection::Range CSMWorld::InfoCollection::getTopicRange (const std::string& topic) + const +{ + std::string topic2 = Misc::StringUtils::lowerCase (topic); + + std::map::const_iterator iter = getIdMap().lower_bound (topic2); + + // Skip invalid records: The beginning of a topic string could be identical to another topic + // string. + for (; iter!=getIdMap().end(); ++iter) + { + std::string testTopicId = + Misc::StringUtils::lowerCase (getRecord (iter->second).get().mTopicId); + + if (testTopicId==topic2) + break; + + std::size_t size = topic2.size(); + + if (testTopicId.size()second; + + // Find end + RecordConstIterator end = begin; + + for (; end!=getRecords().end(); ++end) + if (Misc::StringUtils::lowerCase (end->get().mTopicId)!=topic2) + break; + + return Range (begin, end); +} \ No newline at end of file diff --git a/apps/opencs/model/world/infocollection.hpp b/apps/opencs/model/world/infocollection.hpp new file mode 100644 index 000000000..ae61f5d39 --- /dev/null +++ b/apps/opencs/model/world/infocollection.hpp @@ -0,0 +1,50 @@ +#ifndef CSM_WOLRD_INFOCOLLECTION_H +#define CSM_WOLRD_INFOCOLLECTION_H + +#include "collection.hpp" +#include "info.hpp" + +namespace ESM +{ + class Dialogue; +} + +namespace CSMWorld +{ + class InfoCollection : public Collection > + { + public: + + typedef std::vector >::const_iterator RecordConstIterator; + typedef std::pair Range; + + private: + + void load (const Info& record, bool base); + + int getIndex (const std::string& id, const std::string& topic) const; + ///< Return index for record \a id or -1 (if not present; deleted records are considered) + /// + /// \param id info ID without topic prefix + + public: + + virtual int getAppendIndex (const std::string& id, + UniversalId::Type type = UniversalId::Type_None) const; + ///< \param type Will be ignored, unless the collection supports multiple record types + + virtual bool reorderRows (int baseIndex, const std::vector& newOrder); + ///< Reorder the rows [baseIndex, baseIndex+newOrder.size()) according to the indices + /// given in \a newOrder (baseIndex+newOrder[0] specifies the new index of row baseIndex). + /// + /// \return Success? + + void load (ESM::ESMReader& reader, bool base, const ESM::Dialogue& dialogue); + + Range getTopicRange (const std::string& topic) const; + ///< Return iterators that point to the beginning and past the end of the range for + /// the given topic. + }; +} + +#endif \ No newline at end of file diff --git a/apps/opencs/model/world/ref.cpp b/apps/opencs/model/world/ref.cpp index af363bafb..74f60419b 100644 --- a/apps/opencs/model/world/ref.cpp +++ b/apps/opencs/model/world/ref.cpp @@ -6,7 +6,7 @@ void CSMWorld::CellRef::load (ESM::ESMReader &esm, Cell& cell, const std::string& id) { mId = id; - mCellId = cell.mId; + mCell = cell.mId; if (!mDeleted) cell.addRef (mId); diff --git a/apps/opencs/model/world/ref.hpp b/apps/opencs/model/world/ref.hpp index 3d107d675..fcf016ee2 100644 --- a/apps/opencs/model/world/ref.hpp +++ b/apps/opencs/model/world/ref.hpp @@ -16,7 +16,7 @@ namespace CSMWorld struct CellRef : public ESM::CellRef { std::string mId; - std::string mCellId; + std::string mCell; void load (ESM::ESMReader &esm, Cell& cell, const std::string& id); ///< Load cell ref and register it with \a cell. diff --git a/apps/opencs/model/world/refidcollection.cpp b/apps/opencs/model/world/refidcollection.cpp index cda2711cc..86a542c5c 100644 --- a/apps/opencs/model/world/refidcollection.cpp +++ b/apps/opencs/model/world/refidcollection.cpp @@ -530,7 +530,7 @@ void CSMWorld::RefIdCollection::load (ESM::ESMReader& reader, bool base, Univers } } -int CSMWorld::RefIdCollection::getAppendIndex (UniversalId::Type type) const +int CSMWorld::RefIdCollection::getAppendIndex (const std::string& id, UniversalId::Type type) const { return mData.getAppendIndex (type); } @@ -539,3 +539,13 @@ std::vector CSMWorld::RefIdCollection::getIds (bool listDeleted) co { return mData.getIds (listDeleted); } + +bool CSMWorld::RefIdCollection::reorderRows (int baseIndex, const std::vector& newOrder) +{ + return false; +} + +void CSMWorld::RefIdCollection::save (int index, ESM::ESMWriter& writer) const +{ + mData.save (index, writer); +} diff --git a/apps/opencs/model/world/refidcollection.hpp b/apps/opencs/model/world/refidcollection.hpp index 22f83150d..5ff4a70bf 100644 --- a/apps/opencs/model/world/refidcollection.hpp +++ b/apps/opencs/model/world/refidcollection.hpp @@ -9,6 +9,11 @@ #include "collectionbase.hpp" #include "refiddata.hpp" +namespace ESM +{ + class ESMWriter; +} + namespace CSMWorld { class RefIdAdapter; @@ -87,13 +92,21 @@ namespace CSMWorld void load (ESM::ESMReader& reader, bool base, UniversalId::Type type); - virtual int getAppendIndex (UniversalId::Type type) const; + virtual int getAppendIndex (const std::string& id, UniversalId::Type type) const; ///< \param type Will be ignored, unless the collection supports multiple record types virtual std::vector getIds (bool listDeleted) const; ///< Return a sorted collection of all IDs /// /// \param listDeleted include deleted record in the list + + virtual bool reorderRows (int baseIndex, const std::vector& newOrder); + ///< Reorder the rows [baseIndex, baseIndex+newOrder.size()) according to the indices + /// given in \a newOrder (baseIndex+newOrder[0] specifies the new index of row baseIndex). + /// + /// \return Success? + + void save (int index, ESM::ESMWriter& writer) const; }; } diff --git a/apps/opencs/model/world/refiddata.cpp b/apps/opencs/model/world/refiddata.cpp index 9457937f1..8f59b0fe7 100644 --- a/apps/opencs/model/world/refiddata.cpp +++ b/apps/opencs/model/world/refiddata.cpp @@ -218,3 +218,16 @@ std::vector CSMWorld::RefIdData::getIds (bool listDeleted) const return ids; } + +void CSMWorld::RefIdData::save (int index, ESM::ESMWriter& writer) const +{ + LocalIndex localIndex = globalToLocalIndex (index); + + std::map::const_iterator iter = + mRecordContainers.find (localIndex.second); + + if (iter==mRecordContainers.end()) + throw std::logic_error ("invalid local index type"); + + iter->second->save (localIndex.first, writer); +} \ No newline at end of file diff --git a/apps/opencs/model/world/refiddata.hpp b/apps/opencs/model/world/refiddata.hpp index e221fbc7c..9595ab23b 100644 --- a/apps/opencs/model/world/refiddata.hpp +++ b/apps/opencs/model/world/refiddata.hpp @@ -23,6 +23,7 @@ #include #include #include +#include #include "record.hpp" #include "universalid.hpp" @@ -51,6 +52,8 @@ namespace CSMWorld virtual void erase (int index, int count) = 0; virtual std::string getId (int index) const = 0; + + virtual void save (int index, ESM::ESMWriter& writer) const = 0; }; template @@ -71,6 +74,8 @@ namespace CSMWorld virtual void erase (int index, int count); virtual std::string getId (int index) const; + + virtual void save (int index, ESM::ESMWriter& writer) const; }; template @@ -123,6 +128,31 @@ namespace CSMWorld return mContainer.at (index).get().mId; } + template + void RefIdDataContainer::save (int index, ESM::ESMWriter& writer) const + { + CSMWorld::RecordBase::State state = mContainer.at (index).mState; + + if (state==CSMWorld::RecordBase::State_Modified || + state==CSMWorld::RecordBase::State_ModifiedOnly) + { + std::string type; + for (int i=0; i<4; ++i) + /// \todo make endianess agnostic (change ESMWriter interface?) + type += reinterpret_cast (&mContainer.at (index).mModified.sRecordId)[i]; + + writer.startRecord (type); + writer.writeHNCString ("NAME", getId (index)); + mContainer.at (index).mModified.save (writer); + writer.endRecord (type); + } + else if (state==CSMWorld::RecordBase::State_Deleted) + { + /// \todo write record with delete flag + } + } + + class RefIdData { public: @@ -187,6 +217,8 @@ namespace CSMWorld ///< Return a sorted collection of all IDs /// /// \param listDeleted include deleted record in the list + + void save (int index, ESM::ESMWriter& writer) const; }; } diff --git a/apps/opencs/model/world/universalid.cpp b/apps/opencs/model/world/universalid.cpp index c9edd0c16..e633f4f69 100644 --- a/apps/opencs/model/world/universalid.cpp +++ b/apps/opencs/model/world/universalid.cpp @@ -29,6 +29,10 @@ namespace { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_Regions, "Regions", 0 }, { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_Birthsigns, "Birthsigns", 0 }, { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_Spells, "Spells", 0 }, + { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_Topics, "Topics", 0 }, + { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_Journals, "Journals", 0 }, + { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_TopicInfos, "Topic Infos", 0 }, + { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_JournalInfos, "Journal Infos", 0 }, { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_Cells, "Cells", 0 }, { CSMWorld::UniversalId::Class_RecordList, CSMWorld::UniversalId::Type_Referenceables, "Referenceables", 0 }, @@ -54,6 +58,10 @@ namespace { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_Region, "Region", ":./land.png" }, { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_Birthsign, "Birthsign", ":./birthsign.png" }, { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_Spell, "Spell", ":./spell.png" }, + { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_Topic, "Topic", 0 }, + { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_Journal, "Journal", 0 }, + { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_TopicInfo, "TopicInfo", 0 }, + { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_JournalInfo, "JournalInfo", 0 }, { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_Cell, "Cell", ":./cell.png" }, { CSMWorld::UniversalId::Class_Record, CSMWorld::UniversalId::Type_Referenceable, "Referenceables", 0 }, { CSMWorld::UniversalId::Class_RefRecord, CSMWorld::UniversalId::Type_Activator, "Activator", ":./activator.png" }, diff --git a/apps/opencs/model/world/universalid.hpp b/apps/opencs/model/world/universalid.hpp index 246640733..0c17da03b 100644 --- a/apps/opencs/model/world/universalid.hpp +++ b/apps/opencs/model/world/universalid.hpp @@ -87,6 +87,14 @@ namespace CSMWorld Type_RegionMap, Type_Filter, Type_Filters, + Type_Topics, + Type_Topic, + Type_Journals, + Type_Journal, + Type_TopicInfos, + Type_TopicInfo, + Type_JournalInfos, + Type_JournalInfo, Type_Scene }; diff --git a/apps/opencs/view/doc/adjusterwidget.cpp b/apps/opencs/view/doc/adjusterwidget.cpp index 9e01f685c..09e58690f 100644 --- a/apps/opencs/view/doc/adjusterwidget.cpp +++ b/apps/opencs/view/doc/adjusterwidget.cpp @@ -11,7 +11,7 @@ #include CSVDoc::AdjusterWidget::AdjusterWidget (QWidget *parent) -: QWidget (parent), mValid (false) + : QWidget (parent), mValid (false), mAction (ContentAction_Undefined) { QHBoxLayout *layout = new QHBoxLayout (this); @@ -30,6 +30,11 @@ CSVDoc::AdjusterWidget::AdjusterWidget (QWidget *parent) setLayout (layout); } +void CSVDoc::AdjusterWidget::setAction (ContentAction action) +{ + mAction = action; +} + void CSVDoc::AdjusterWidget::setLocalData (const boost::filesystem::path& localData) { mLocalData = localData; @@ -43,41 +48,60 @@ boost::filesystem::path CSVDoc::AdjusterWidget::getPath() const return mResultPath; } +bool CSVDoc::AdjusterWidget::isValid() const +{ + return mValid; +} + +void CSVDoc::AdjusterWidget::setFilenameCheck (bool doCheck) +{ + mDoFilenameCheck = doCheck; +} + void CSVDoc::AdjusterWidget::setName (const QString& name, bool addon) { QString message; - if (name.isEmpty()) + mValid = (!name.isEmpty()); + + if (!mValid) { - mValid = false; message = "No name."; } else { boost::filesystem::path path (name.toUtf8().data()); - path.replace_extension (addon ? ".omwaddon" : ".omwgame"); + bool isLegacyPath = (path.extension() == ".esm" || + path.extension() == ".esp"); - if (path.parent_path().string()==mLocalData.string()) + bool isFilePathChanged = (path.parent_path().string() != mLocalData.string()); + + if (isLegacyPath) + path.replace_extension (addon ? ".omwaddon" : ".omwgame"); + + //if the file came from data-local and is not a legacy file to be converted, + //don't worry about doing a file check. + if (!isFilePathChanged && !isLegacyPath) { // path already points to the local data directory message = QString::fromUtf8 (("Will be saved as: " + path.string()).c_str()); mResultPath = path; - mValid = true; } + //in all other cases, ensure the path points to data-local and do an existing file check else { // path points somewhere else or is a leaf name. - path = mLocalData / path.filename(); + if (isFilePathChanged) + path = mLocalData / path.filename(); message = QString::fromUtf8 (("Will be saved as: " + path.string()).c_str()); mResultPath = path; - mValid = true; if (boost::filesystem::exists (path)) { /// \todo add an user setting to make this an error. - message += "

But a file with the same name already exists. If you continue, it will be overwritten."; + message += "

A file with the same name already exists. If you continue, it will be overwritten."; } } } @@ -88,4 +112,4 @@ void CSVDoc::AdjusterWidget::setName (const QString& name, bool addon) pixmap (QSize (16, 16))); emit stateChanged (mValid); -} \ No newline at end of file +} diff --git a/apps/opencs/view/doc/adjusterwidget.hpp b/apps/opencs/view/doc/adjusterwidget.hpp index f578dc4ae..91e308236 100644 --- a/apps/opencs/view/doc/adjusterwidget.hpp +++ b/apps/opencs/view/doc/adjusterwidget.hpp @@ -9,21 +9,36 @@ class QLabel; namespace CSVDoc { + enum ContentAction + { + ContentAction_New, + ContentAction_Edit, + ContentAction_Undefined + }; + class AdjusterWidget : public QWidget { Q_OBJECT + public: + boost::filesystem::path mLocalData; QLabel *mMessage; QLabel *mIcon; bool mValid; boost::filesystem::path mResultPath; + ContentAction mAction; + bool mDoFilenameCheck; public: AdjusterWidget (QWidget *parent = 0); void setLocalData (const boost::filesystem::path& localData); + void setAction (ContentAction action); + + void setFilenameCheck (bool doCheck); + bool isValid() const; boost::filesystem::path getPath() const; ///< This function must not be called if there is no valid path. @@ -38,4 +53,4 @@ namespace CSVDoc }; } -#endif \ No newline at end of file +#endif diff --git a/apps/opencs/view/doc/filedialog.cpp b/apps/opencs/view/doc/filedialog.cpp index f956317a7..ab56415a1 100644 --- a/apps/opencs/view/doc/filedialog.cpp +++ b/apps/opencs/view/doc/filedialog.cpp @@ -9,264 +9,166 @@ #include #include #include +#include -#include -#include -#include +#include "components/contentselector/model/esmfile.hpp" +#include "components/contentselector/view/contentselector.hpp" -#include +#include "filewidget.hpp" +#include "adjusterwidget.hpp" -FileDialog::FileDialog(QWidget *parent) : - QDialog(parent) +CSVDoc::FileDialog::FileDialog(QWidget *parent) : + QDialog(parent), mSelector (0), mFileWidget (0), mAdjusterWidget (0) { - setupUi(this); + ui.setupUi (this); + resize(400, 400); - // Models - mDataFilesModel = new DataFilesModel(this); - - mMastersProxyModel = new QSortFilterProxyModel(); - mMastersProxyModel->setFilterRegExp(QString("^.*\\.esm")); - mMastersProxyModel->setFilterCaseSensitivity(Qt::CaseInsensitive); - mMastersProxyModel->setSourceModel(mDataFilesModel); - - mPluginsProxyModel = new PluginsProxyModel(); - mPluginsProxyModel->setFilterRegExp(QString("^.*\\.esp")); - mPluginsProxyModel->setFilterCaseSensitivity(Qt::CaseInsensitive); - mPluginsProxyModel->setSourceModel(mDataFilesModel); - - mFilterProxyModel = new QSortFilterProxyModel(); - mFilterProxyModel->setDynamicSortFilter(true); - mFilterProxyModel->setSourceModel(mPluginsProxyModel); - - QCheckBox checkBox; - unsigned int height = checkBox.sizeHint().height() + 4; - - mastersTable->setModel(mMastersProxyModel); - mastersTable->setObjectName("MastersTable"); - mastersTable->setContextMenuPolicy(Qt::CustomContextMenu); - mastersTable->setSortingEnabled(false); - mastersTable->setSelectionBehavior(QAbstractItemView::SelectRows); - mastersTable->setSelectionMode(QAbstractItemView::ExtendedSelection); - mastersTable->setEditTriggers(QAbstractItemView::NoEditTriggers); - mastersTable->setAlternatingRowColors(true); - mastersTable->horizontalHeader()->setStretchLastSection(true); - - // Set the row height to the size of the checkboxes - mastersTable->verticalHeader()->setDefaultSectionSize(height); - mastersTable->verticalHeader()->setResizeMode(QHeaderView::Fixed); - mastersTable->verticalHeader()->hide(); - - pluginsTable->setModel(mFilterProxyModel); - pluginsTable->setObjectName("PluginsTable"); - pluginsTable->setContextMenuPolicy(Qt::CustomContextMenu); - pluginsTable->setSortingEnabled(false); - pluginsTable->setSelectionBehavior(QAbstractItemView::SelectRows); - pluginsTable->setSelectionMode(QAbstractItemView::ExtendedSelection); - pluginsTable->setEditTriggers(QAbstractItemView::NoEditTriggers); - pluginsTable->setAlternatingRowColors(true); - pluginsTable->setVerticalScrollMode(QAbstractItemView::ScrollPerItem); - pluginsTable->horizontalHeader()->setStretchLastSection(true); - - pluginsTable->verticalHeader()->setDefaultSectionSize(height); - pluginsTable->verticalHeader()->setResizeMode(QHeaderView::Fixed); - - // Hide the profile elements - profileLabel->hide(); - profilesComboBox->hide(); - newProfileButton->hide(); - deleteProfileButton->hide(); - - // Add some extra widgets - QHBoxLayout *nameLayout = new QHBoxLayout(); - QSpacerItem *spacer = new QSpacerItem(40, 20, QSizePolicy::Expanding, QSizePolicy::Minimum); - - mNameLabel = new QLabel(tr("File Name:"), this); - - QRegExpValidator *validator = new QRegExpValidator(QRegExp("^[a-zA-Z0-9\\s]*$")); - mNameLineEdit = new LineEdit(this); - mNameLineEdit->setValidator(validator); - - nameLayout->addSpacerItem(spacer); - nameLayout->addWidget(mNameLabel); - nameLayout->addWidget(mNameLineEdit); - - mButtonBox = new QDialogButtonBox(this); - - mCreateButton = new QPushButton(tr("Create"), this); - mCreateButton->setEnabled(false); - - verticalLayout->addLayout(nameLayout); - verticalLayout->addWidget(mButtonBox); - - // Set sizes - QList sizeList; - sizeList << 175; - sizeList << 200; - - splitter->setSizes(sizeList); - - resize(600, 400); - - connect(mDataFilesModel, SIGNAL(layoutChanged()), this, SLOT(updateViews())); - connect(mDataFilesModel, SIGNAL(checkedItemsChanged(QStringList)), this, SLOT(updateOpenButton(QStringList))); - connect(mNameLineEdit, SIGNAL(textChanged(QString)), this, SLOT(updateCreateButton(QString))); - - connect(filterLineEdit, SIGNAL(textChanged(QString)), this, SLOT(filterChanged(QString))); - - connect(pluginsTable, SIGNAL(doubleClicked(QModelIndex)), this, SLOT(setCheckState(QModelIndex))); - connect(mastersTable, SIGNAL(doubleClicked(QModelIndex)), this, SLOT(setCheckState(QModelIndex))); - - connect(mCreateButton, SIGNAL(clicked()), this, SLOT(createButtonClicked())); - - connect(mButtonBox, SIGNAL(accepted()), this, SLOT(accept())); - connect(mButtonBox, SIGNAL(rejected()), this, SLOT(reject())); + setObjectName ("FileDialog"); + mSelector = new ContentSelectorView::ContentSelector (ui.contentSelectorWidget); + mAdjusterWidget = new AdjusterWidget (this); } -void FileDialog::updateViews() +void CSVDoc::FileDialog::addFiles(const QString &path) { - // Ensure the columns are hidden because sort() re-enables them - mastersTable->setColumnHidden(1, true); - mastersTable->setColumnHidden(3, true); - mastersTable->setColumnHidden(4, true); - mastersTable->setColumnHidden(5, true); - mastersTable->setColumnHidden(6, true); - mastersTable->setColumnHidden(7, true); - mastersTable->setColumnHidden(8, true); - mastersTable->resizeColumnsToContents(); - - pluginsTable->setColumnHidden(1, true); - pluginsTable->setColumnHidden(3, true); - pluginsTable->setColumnHidden(4, true); - pluginsTable->setColumnHidden(5, true); - pluginsTable->setColumnHidden(6, true); - pluginsTable->setColumnHidden(7, true); - pluginsTable->setColumnHidden(8, true); - pluginsTable->resizeColumnsToContents(); - + mSelector->addFiles(path); } -void FileDialog::updateOpenButton(const QStringList &items) +QStringList CSVDoc::FileDialog::selectedFilePaths() { - QPushButton *openButton = mButtonBox->button(QDialogButtonBox::Open); + QStringList filePaths; - if (!openButton) - return; + foreach (ContentSelectorModel::EsmFile *file, mSelector->selectedFiles() ) + filePaths.append(file->filePath()); - openButton->setEnabled(!items.isEmpty()); + return filePaths; } -void FileDialog::updateCreateButton(const QString &name) +void CSVDoc::FileDialog::setLocalData (const boost::filesystem::path& localData) { - if (!mCreateButton->isVisible()) - return; - - mCreateButton->setEnabled(!name.isEmpty()); + mAdjusterWidget->setLocalData (localData); } -void FileDialog::filterChanged(const QString &filter) +void CSVDoc::FileDialog::showDialog (ContentAction action) { - QRegExp filterRe(filter, Qt::CaseInsensitive, QRegExp::FixedString); - mFilterProxyModel->setFilterRegExp(filterRe); -} + mAction = action; -void FileDialog::addFiles(const QString &path) -{ - mDataFilesModel->addFiles(path); - mDataFilesModel->sort(3); // Sort by date accessed -} + ui.projectGroupBoxLayout->insertWidget (0, mAdjusterWidget); -void FileDialog::setEncoding(const QString &encoding) -{ - mDataFilesModel->setEncoding(encoding); -} + switch (mAction) + { + case ContentAction_New: + buildNewFileView(); + break; -void FileDialog::setCheckState(QModelIndex index) -{ - if (!index.isValid()) - return; + case ContentAction_Edit: + buildOpenFileView(); + break; - QObject *object = QObject::sender(); - - // Not a signal-slot call - if (!object) - return; - - - if (object->objectName() == QLatin1String("PluginsTable")) { - QModelIndex sourceIndex = mPluginsProxyModel->mapToSource( - mFilterProxyModel->mapToSource(index)); - - if (sourceIndex.isValid()) { - (mDataFilesModel->checkState(sourceIndex) == Qt::Checked) - ? mDataFilesModel->setCheckState(sourceIndex, Qt::Unchecked) - : mDataFilesModel->setCheckState(sourceIndex, Qt::Checked); - } + default: + break; } - if (object->objectName() == QLatin1String("MastersTable")) { - QModelIndex sourceIndex = mMastersProxyModel->mapToSource(index); + mAdjusterWidget->setFilenameCheck (mAction == ContentAction_New); - if (sourceIndex.isValid()) { - (mDataFilesModel->checkState(sourceIndex) == Qt::Checked) - ? mDataFilesModel->setCheckState(sourceIndex, Qt::Unchecked) - : mDataFilesModel->setCheckState(sourceIndex, Qt::Checked); - } - } + //connections common to both dialog view flavors + connect (mSelector, SIGNAL (signalCurrentGamefileIndexChanged (int)), + this, SLOT (slotUpdateAcceptButton (int))); - return; + connect (ui.projectButtonBox, SIGNAL (rejected()), this, SLOT (slotRejected())); + + show(); + raise(); + activateWindow(); } -QStringList FileDialog::checkedItemsPaths() +void CSVDoc::FileDialog::buildNewFileView() { - return mDataFilesModel->checkedItemsPaths(); + setWindowTitle(tr("Create a new addon")); + + QPushButton* createButton = ui.projectButtonBox->button (QDialogButtonBox::Ok); + createButton->setText ("Create"); + createButton->setEnabled (false); + + mFileWidget = new FileWidget (this); + + mFileWidget->setType (true); + mFileWidget->extensionLabelIsVisible(true); + + ui.projectGroupBoxLayout->insertWidget (0, mFileWidget); + + connect (mFileWidget, SIGNAL (nameChanged (const QString&, bool)), + mAdjusterWidget, SLOT (setName (const QString&, bool))); + + connect (mFileWidget, SIGNAL (nameChanged(const QString &, bool)), + this, SLOT (slotUpdateAcceptButton(const QString &, bool))); + + connect (ui.projectButtonBox, SIGNAL (accepted()), this, SLOT (slotNewFile())); } -QString FileDialog::fileName() -{ - return mNameLineEdit->text(); -} - -void FileDialog::openFile() +void CSVDoc::FileDialog::buildOpenFileView() { setWindowTitle(tr("Open")); + ui.projectGroupBox->setTitle (QString("")); - mNameLabel->hide(); - mNameLineEdit->hide(); - mCreateButton->hide(); + ui.projectButtonBox->button(QDialogButtonBox::Ok)->setEnabled (false); - mButtonBox->removeButton(mCreateButton); - mButtonBox->setStandardButtons(QDialogButtonBox::Cancel | QDialogButtonBox::Open); - QPushButton *openButton = mButtonBox->button(QDialogButtonBox::Open); - openButton->setEnabled(false); + connect (mSelector, SIGNAL (signalAddonFileSelected (int)), this, SLOT (slotUpdateAcceptButton (int))); + connect (mSelector, SIGNAL (signalAddonFileUnselected (int)), this, SLOT (slotUpdateAcceptButton (int))); - show(); - raise(); - activateWindow(); + connect (ui.projectButtonBox, SIGNAL (accepted()), this, SLOT (slotOpenFile())); } -void FileDialog::newFile() +void CSVDoc::FileDialog::slotUpdateAcceptButton (int) { - setWindowTitle(tr("New")); + QString name = ""; - mNameLabel->show(); - mNameLineEdit->clear(); - mNameLineEdit->show(); - mCreateButton->show(); + if (mAction == ContentAction_New) + name = mFileWidget->getName(); - mButtonBox->setStandardButtons(QDialogButtonBox::Cancel); - mButtonBox->addButton(mCreateButton, QDialogButtonBox::ActionRole); - - show(); - raise(); - activateWindow(); + slotUpdateAcceptButton (name, true); } -void FileDialog::accept() +void CSVDoc::FileDialog::slotUpdateAcceptButton(const QString &name, bool) { - emit openFiles(); + bool success = (mSelector->selectedFiles().size() > 0); + + bool isNew = (mAction == ContentAction_New); + + if (isNew) + success = success && !(name.isEmpty()); + else + { + ContentSelectorModel::EsmFile *file = mSelector->selectedFiles().back(); + mAdjusterWidget->setName (file->filePath(), !file->isGameFile()); + } + + ui.projectButtonBox->button (QDialogButtonBox::Ok)->setEnabled (success); } -void FileDialog::createButtonClicked() +QString CSVDoc::FileDialog::filename() const { - emit createNewFile(); + if (mAction == ContentAction_New) + return ""; + + return mSelector->currentFile(); +} + +void CSVDoc::FileDialog::slotRejected() +{ + emit rejected(); + close(); +} + +void CSVDoc::FileDialog::slotNewFile() +{ + emit signalCreateNewFile (mAdjusterWidget->getPath()); +} + +void CSVDoc::FileDialog::slotOpenFile() +{ + ContentSelectorModel::EsmFile *file = mSelector->selectedFiles().back(); + + mAdjusterWidget->setName (file->filePath(), !file->isGameFile()); + + emit signalOpenFiles (mAdjusterWidget->getPath()); } diff --git a/apps/opencs/view/doc/filedialog.hpp b/apps/opencs/view/doc/filedialog.hpp index b21618d5d..d9fd56943 100644 --- a/apps/opencs/view/doc/filedialog.hpp +++ b/apps/opencs/view/doc/filedialog.hpp @@ -4,63 +4,71 @@ #include #include -#include "ui_datafilespage.h" +#include +#include "adjusterwidget.hpp" -class QDialogButtonBox; -class QSortFilterProxyModel; -class QAbstractItemModel; -class QPushButton; -class QStringList; -class QString; -class QMenu; +#ifndef CS_QT_BOOST_FILESYSTEM_PATH_DECLARED +#define CS_QT_BOOST_FILESYSTEM_PATH_DECLARED +Q_DECLARE_METATYPE (boost::filesystem::path) +#endif + +#include "ui_filedialog.h" class DataFilesModel; class PluginsProxyModel; -class FileDialog : public QDialog, private Ui::DataFilesPage +namespace ContentSelectorView { - Q_OBJECT -public: - explicit FileDialog(QWidget *parent = 0); - void addFiles(const QString &path); - void setEncoding(const QString &encoding); + class ContentSelector; +} - void openFile(); - void newFile(); - void accepted(); +namespace CSVDoc +{ + class FileWidget; - QStringList checkedItemsPaths(); - QString fileName(); + class FileDialog : public QDialog + { + Q_OBJECT -signals: - void openFiles(); - void createNewFile(); - -public slots: - void accept(); + private: -private slots: - void updateViews(); - void updateOpenButton(const QStringList &items); - void updateCreateButton(const QString &name); - void setCheckState(QModelIndex index); + ContentSelectorView::ContentSelector *mSelector; + Ui::FileDialog ui; + ContentAction mAction; + FileWidget *mFileWidget; + AdjusterWidget *mAdjusterWidget; - void filterChanged(const QString &filter); + public: - void createButtonClicked(); + explicit FileDialog(QWidget *parent = 0); + void showDialog (ContentAction action); -private: - QLabel *mNameLabel; - LineEdit *mNameLineEdit; + void addFiles (const QString &path); - QPushButton *mCreateButton; - QDialogButtonBox *mButtonBox; + QString filename() const; + QStringList selectedFilePaths(); - DataFilesModel *mDataFilesModel; + void setLocalData (const boost::filesystem::path& localData); - PluginsProxyModel *mPluginsProxyModel; - QSortFilterProxyModel *mMastersProxyModel; - QSortFilterProxyModel *mFilterProxyModel; -}; + private: + void buildNewFileView(); + void buildOpenFileView(); + + signals: + + void signalOpenFiles (const boost::filesystem::path &path); + void signalCreateNewFile (const boost::filesystem::path &path); + + void signalUpdateAcceptButton (bool, int); + + private slots: + + void slotNewFile(); + void slotOpenFile(); + void slotUpdateAcceptButton (int); + void slotUpdateAcceptButton (const QString &, bool); + void slotRejected(); + }; +} #endif // FILEDIALOG_HPP diff --git a/apps/opencs/view/doc/filewidget.cpp b/apps/opencs/view/doc/filewidget.cpp index c8f33e92d..9cd2fad42 100644 --- a/apps/opencs/view/doc/filewidget.cpp +++ b/apps/opencs/view/doc/filewidget.cpp @@ -50,4 +50,9 @@ QString CSVDoc::FileWidget::getName() const void CSVDoc::FileWidget::textChanged (const QString& text) { emit nameChanged (getName(), mAddon); -} \ No newline at end of file +} + +void CSVDoc::FileWidget::extensionLabelIsVisible(bool visible) +{ + mType->setVisible(visible); +} diff --git a/apps/opencs/view/doc/filewidget.hpp b/apps/opencs/view/doc/filewidget.hpp index c51c29632..ff09d71a3 100644 --- a/apps/opencs/view/doc/filewidget.hpp +++ b/apps/opencs/view/doc/filewidget.hpp @@ -27,6 +27,8 @@ namespace CSVDoc QString getName() const; + void extensionLabelIsVisible(bool visible); + private slots: void textChanged (const QString& text); diff --git a/apps/opencs/view/doc/newgame.hpp b/apps/opencs/view/doc/newgame.hpp index aa97682ff..9ad7ea169 100644 --- a/apps/opencs/view/doc/newgame.hpp +++ b/apps/opencs/view/doc/newgame.hpp @@ -6,7 +6,10 @@ #include #include +#ifndef CS_QT_BOOST_FILESYSTEM_PATH_DECLARED +#define CS_QT_BOOST_FILESYSTEM_PATH_DECLARED Q_DECLARE_METATYPE (boost::filesystem::path) +#endif class QPushButton; diff --git a/apps/opencs/view/doc/startup.cpp b/apps/opencs/view/doc/startup.cpp index 4cc64f2df..5d59492c6 100644 --- a/apps/opencs/view/doc/startup.cpp +++ b/apps/opencs/view/doc/startup.cpp @@ -104,6 +104,17 @@ CSVDoc::StartupDialogue::StartupDialogue() : mWidth (0), mColumn (2) layout->addWidget (createButtons()); layout->addWidget (createTools()); + /// \todo remove this label once loading and saving are fully implemented + QLabel *warning = new QLabel ("WARNING:

OpenCS is in alpha stage.
The code for loading and saving is incomplete.
This version of OpenCS is only a preview.
Do NOT use it for real editing!
You will lose records both on loading and on saving.

Please note:
If you lose data and come to the OpenMW forum to complain,
we will mock you."); + + QFont font; + font.setPointSize (12); + font.setBold (true); + + warning->setFont (font); + + layout->addWidget (warning, 1); + setLayout (layout); QRect scr = QApplication::desktop()->screenGeometry(); diff --git a/apps/opencs/view/doc/subviewfactoryimp.hpp b/apps/opencs/view/doc/subviewfactoryimp.hpp index 2c4158f85..059b24fd0 100644 --- a/apps/opencs/view/doc/subviewfactoryimp.hpp +++ b/apps/opencs/view/doc/subviewfactoryimp.hpp @@ -26,16 +26,25 @@ namespace CSVDoc template class SubViewFactoryWithCreator : public SubViewFactoryBase { + bool mSorting; + public: + SubViewFactoryWithCreator (bool sorting = true); + virtual CSVDoc::SubView *makeSubView (const CSMWorld::UniversalId& id, CSMDoc::Document& document); }; + template + SubViewFactoryWithCreator::SubViewFactoryWithCreator (bool sorting) + : mSorting (sorting) + {} + template CSVDoc::SubView *SubViewFactoryWithCreator::makeSubView ( const CSMWorld::UniversalId& id, CSMDoc::Document& document) { - return new SubViewT (id, document, CreatorFactoryT()); + return new SubViewT (id, document, CreatorFactoryT(), mSorting); } } diff --git a/apps/opencs/view/doc/view.cpp b/apps/opencs/view/doc/view.cpp index b29250d20..533ca7f57 100644 --- a/apps/opencs/view/doc/view.cpp +++ b/apps/opencs/view/doc/view.cpp @@ -136,35 +136,56 @@ void CSVDoc::View::setupMechanicsMenu() connect (gmsts, SIGNAL (triggered()), this, SLOT (addGmstsSubView())); mechanics->addAction (gmsts); - QAction *skills = new QAction (tr ("Skills"), this); - connect (skills, SIGNAL (triggered()), this, SLOT (addSkillsSubView())); - mechanics->addAction (skills); - - QAction *classes = new QAction (tr ("Classes"), this); - connect (classes, SIGNAL (triggered()), this, SLOT (addClassesSubView())); - mechanics->addAction (classes); - - QAction *factions = new QAction (tr ("Factions"), this); - connect (factions, SIGNAL (triggered()), this, SLOT (addFactionsSubView())); - mechanics->addAction (factions); - - QAction *races = new QAction (tr ("Races"), this); - connect (races, SIGNAL (triggered()), this, SLOT (addRacesSubView())); - mechanics->addAction (races); - QAction *scripts = new QAction (tr ("Scripts"), this); connect (scripts, SIGNAL (triggered()), this, SLOT (addScriptsSubView())); mechanics->addAction (scripts); - QAction *birthsigns = new QAction (tr ("Birthsigns"), this); - connect (birthsigns, SIGNAL (triggered()), this, SLOT (addBirthsignsSubView())); - mechanics->addAction (birthsigns); - QAction *spells = new QAction (tr ("Spells"), this); connect (spells, SIGNAL (triggered()), this, SLOT (addSpellsSubView())); mechanics->addAction (spells); } +void CSVDoc::View::setupCharacterMenu() +{ + QMenu *characters = menuBar()->addMenu (tr ("Characters")); + + QAction *skills = new QAction (tr ("Skills"), this); + connect (skills, SIGNAL (triggered()), this, SLOT (addSkillsSubView())); + characters->addAction (skills); + + QAction *classes = new QAction (tr ("Classes"), this); + connect (classes, SIGNAL (triggered()), this, SLOT (addClassesSubView())); + characters->addAction (classes); + + QAction *factions = new QAction (tr ("Factions"), this); + connect (factions, SIGNAL (triggered()), this, SLOT (addFactionsSubView())); + characters->addAction (factions); + + QAction *races = new QAction (tr ("Races"), this); + connect (races, SIGNAL (triggered()), this, SLOT (addRacesSubView())); + characters->addAction (races); + + QAction *birthsigns = new QAction (tr ("Birthsigns"), this); + connect (birthsigns, SIGNAL (triggered()), this, SLOT (addBirthsignsSubView())); + characters->addAction (birthsigns); + + QAction *topics = new QAction (tr ("Topics"), this); + connect (topics, SIGNAL (triggered()), this, SLOT (addTopicsSubView())); + characters->addAction (topics); + + QAction *journals = new QAction (tr ("Journals"), this); + connect (journals, SIGNAL (triggered()), this, SLOT (addJournalsSubView())); + characters->addAction (journals); + + QAction *topicInfos = new QAction (tr ("Topic Infos"), this); + connect (topicInfos, SIGNAL (triggered()), this, SLOT (addTopicInfosSubView())); + characters->addAction (topicInfos); + + QAction *journalInfos = new QAction (tr ("Journal Infos"), this); + connect (journalInfos, SIGNAL (triggered()), this, SLOT (addJournalInfosSubView())); + characters->addAction (journalInfos); +} + void CSVDoc::View::setupAssetsMenu() { QMenu *assets = menuBar()->addMenu (tr ("&Assets")); @@ -181,6 +202,7 @@ void CSVDoc::View::setupUi() setupViewMenu(); setupWorldMenu(); setupMechanicsMenu(); + setupCharacterMenu(); setupAssetsMenu(); } @@ -412,6 +434,26 @@ void CSVDoc::View::addSceneSubView() addSubView (CSMWorld::UniversalId::Type_Scene); } +void CSVDoc::View::addTopicsSubView() +{ + addSubView (CSMWorld::UniversalId::Type_Topics); +} + +void CSVDoc::View::addJournalsSubView() +{ + addSubView (CSMWorld::UniversalId::Type_Journals); +} + +void CSVDoc::View::addTopicInfosSubView() +{ + addSubView (CSMWorld::UniversalId::Type_TopicInfos); +} + +void CSVDoc::View::addJournalInfosSubView() +{ + addSubView (CSMWorld::UniversalId::Type_JournalInfos); +} + void CSVDoc::View::abortOperation (int type) { mDocument->abortOperation (type); diff --git a/apps/opencs/view/doc/view.hpp b/apps/opencs/view/doc/view.hpp index 6f3c38daa..13c15ec9b 100644 --- a/apps/opencs/view/doc/view.hpp +++ b/apps/opencs/view/doc/view.hpp @@ -63,6 +63,8 @@ namespace CSVDoc void setupMechanicsMenu(); + void setupCharacterMenu(); + void setupAssetsMenu(); void setupUi(); @@ -166,6 +168,14 @@ namespace CSVDoc void addSceneSubView(); + void addTopicsSubView(); + + void addJournalsSubView(); + + void addTopicInfosSubView(); + + void addJournalInfosSubView(); + void toggleShowStatusBar (bool show); }; } diff --git a/apps/opencs/view/doc/viewmanager.cpp b/apps/opencs/view/doc/viewmanager.cpp index 83cd93e5d..4a4dbc124 100644 --- a/apps/opencs/view/doc/viewmanager.cpp +++ b/apps/opencs/view/doc/viewmanager.cpp @@ -74,7 +74,10 @@ CSVDoc::ViewManager::ViewManager (CSMDoc::DocumentManager& documentManager) { CSMWorld::ColumnBase::Display_ArmorType, CSMWorld::Columns::ColumnId_ArmorType, false }, { CSMWorld::ColumnBase::Display_ClothingType, CSMWorld::Columns::ColumnId_ClothingType, false }, { CSMWorld::ColumnBase::Display_CreatureType, CSMWorld::Columns::ColumnId_CreatureType, false }, - { CSMWorld::ColumnBase::Display_WeaponType, CSMWorld::Columns::ColumnId_WeaponType, false } + { CSMWorld::ColumnBase::Display_WeaponType, CSMWorld::Columns::ColumnId_WeaponType, false }, + { CSMWorld::ColumnBase::Display_DialogueType, CSMWorld::Columns::ColumnId_DialogueType, false }, + { CSMWorld::ColumnBase::Display_QuestStatusType, CSMWorld::Columns::ColumnId_QuestStatusType, false }, + { CSMWorld::ColumnBase::Display_Gender, CSMWorld::Columns::ColumnId_Gender, true } }; for (std::size_t i=0; icurrentIndex()) @@ -28,6 +33,15 @@ std::string CSVFilter::FilterCreator::getId() const return getNamespace() + GenericCreator::getId(); } +void CSVFilter::FilterCreator::configureCreateCommand (CSMWorld::CreateCommand& command) const +{ + int index = + dynamic_cast (*getData().getTableModel (getCollectionId())). + findColumnIndex (CSMWorld::Columns::ColumnId_Scope); + + command.addValue (index, mScope->currentIndex()); +} + CSVFilter::FilterCreator::FilterCreator (CSMWorld::Data& data, QUndoStack& undoStack, const CSMWorld::UniversalId& id) : GenericCreator (data, undoStack, id) @@ -39,7 +53,7 @@ CSVFilter::FilterCreator::FilterCreator (CSMWorld::Data& data, QUndoStack& undoS mScope->addItem ("Project"); mScope->addItem ("Session"); - /// \ŧodo re-enable for OpenMW 1.1 + /// \todo re-enable for OpenMW 1.1 // mScope->addItem ("Content"); connect (mScope, SIGNAL (currentIndexChanged (int)), this, SLOT (setScope (int))); diff --git a/apps/opencs/view/filter/filtercreator.hpp b/apps/opencs/view/filter/filtercreator.hpp index 82d38d22c..437d01c8d 100644 --- a/apps/opencs/view/filter/filtercreator.hpp +++ b/apps/opencs/view/filter/filtercreator.hpp @@ -25,6 +25,8 @@ namespace CSVFilter virtual std::string getId() const; + virtual void configureCreateCommand (CSMWorld::CreateCommand& command) const; + public: FilterCreator (CSMWorld::Data& data, QUndoStack& undoStack, diff --git a/apps/opencs/view/render/scenewidget.cpp b/apps/opencs/view/render/scenewidget.cpp new file mode 100644 index 000000000..c8b37e9bb --- /dev/null +++ b/apps/opencs/view/render/scenewidget.cpp @@ -0,0 +1,128 @@ +#include "scenewidget.hpp" + +#include +#include + +#include +#include +#include + +namespace CSVRender +{ + + SceneWidget::SceneWidget(QWidget *parent) + : QWidget(parent) + , mWindow(NULL) + , mCamera(NULL) + , mSceneMgr(NULL) + { + setAttribute(Qt::WA_PaintOnScreen); + setAttribute(Qt::WA_NoSystemBackground); + + mSceneMgr = Ogre::Root::getSingleton().createSceneManager(Ogre::ST_GENERIC); + + // Throw in a random color just to make sure multiple scenes work + Ogre::Real r = Ogre::Math::RangeRandom(0, 1); + Ogre::Real g = Ogre::Math::RangeRandom(0, 1); + Ogre::Real b = Ogre::Math::RangeRandom(0, 1); + mSceneMgr->setAmbientLight(Ogre::ColourValue(r,g,b,1)); + + Ogre::Light* l = mSceneMgr->createLight(); + l->setType (Ogre::Light::LT_DIRECTIONAL); + l->setDirection (Ogre::Vector3(-0.4, -0.7, 0.3)); + l->setDiffuseColour (Ogre::ColourValue(0.7,0.7,0.7)); + + mCamera = mSceneMgr->createCamera("foo"); + + Ogre::Entity* ent = mSceneMgr->createEntity("cube", Ogre::SceneManager::PT_CUBE); + ent->setMaterialName("BaseWhite"); + + mSceneMgr->getRootSceneNode()->attachObject(ent); + + mCamera->setPosition(300,300,300); + mCamera->lookAt(0,0,0); + mCamera->setNearClipDistance(0.1); + mCamera->setFarClipDistance(3000); + } + + void SceneWidget::updateOgreWindow() + { + if (mWindow) + { + Ogre::Root::getSingleton().destroyRenderTarget(mWindow); + mWindow = NULL; + } + + std::stringstream windowHandle; + windowHandle << this->winId(); + + std::stringstream windowTitle; + static int count=0; + windowTitle << ++count; + + Ogre::NameValuePairList params; + + params.insert(std::make_pair("externalWindowHandle", windowHandle.str())); + params.insert(std::make_pair("title", windowTitle.str())); + params.insert(std::make_pair("FSAA", "0")); // TODO setting + params.insert(std::make_pair("vsync", "false")); // TODO setting + + mWindow = Ogre::Root::getSingleton().createRenderWindow(windowTitle.str(), this->width(), this->height(), false, ¶ms); + mWindow->addViewport(mCamera)->setBackgroundColour(Ogre::ColourValue(0.3,0.3,0.3,1)); + + Ogre::Real aspectRatio = Ogre::Real(width()) / Ogre::Real(height()); + mCamera->setAspectRatio(aspectRatio); + } + + SceneWidget::~SceneWidget() + { + Ogre::Root::getSingleton().destroyRenderTarget(mWindow); + } + + void SceneWidget::paintEvent(QPaintEvent* e) + { + if (!mWindow) + updateOgreWindow(); + + mWindow->update(); + e->accept(); + } + + + QPaintEngine* SceneWidget::paintEngine() const + { + // We don't want another paint engine to get in the way. + // So we return nothing. + return NULL; + } + + void SceneWidget::resizeEvent(QResizeEvent *e) + { + if (!mWindow) + return; + + const QSize &newSize = e->size(); + + // TODO: Fix Ogre to handle this more consistently (fixed in 1.9) +#if OGRE_PLATFORM == OGRE_PLATFORM_LINUX + mWindow->resize(newSize.width(), newSize.height()); +#else + mWindow->windowMovedOrResized(); +#endif + + Ogre::Real aspectRatio = Ogre::Real(newSize.width()) / Ogre::Real(newSize.height()); + mCamera->setAspectRatio(aspectRatio); + } + + bool SceneWidget::event(QEvent *e) + { + if (e->type() == QEvent::WinIdChange) + { + // I haven't actually seen this happen yet. + if (mWindow) + updateOgreWindow(); + } + return QWidget::event(e); + } + +} diff --git a/apps/opencs/view/render/scenewidget.hpp b/apps/opencs/view/render/scenewidget.hpp new file mode 100644 index 000000000..355a6331e --- /dev/null +++ b/apps/opencs/view/render/scenewidget.hpp @@ -0,0 +1,40 @@ +#ifndef OPENCS_VIEW_SCENEWIDGET_H +#define OPENCS_VIEW_SCENEWIDGET_H + +#include + +namespace Ogre +{ + class Camera; + class SceneManager; + class RenderWindow; +} + +namespace CSVRender +{ + + class SceneWidget : public QWidget + { + Q_OBJECT + + public: + SceneWidget(QWidget *parent); + virtual ~SceneWidget(void); + + QPaintEngine* paintEngine() const; + + private: + void paintEvent(QPaintEvent* e); + void resizeEvent(QResizeEvent* e); + bool event(QEvent* e); + + void updateOgreWindow(); + + Ogre::Camera* mCamera; + Ogre::SceneManager* mSceneMgr; + Ogre::RenderWindow* mWindow; + }; + +} + +#endif diff --git a/apps/opencs/view/world/dialoguecreator.cpp b/apps/opencs/view/world/dialoguecreator.cpp new file mode 100644 index 000000000..3523d5e32 --- /dev/null +++ b/apps/opencs/view/world/dialoguecreator.cpp @@ -0,0 +1,35 @@ + +#include "dialoguecreator.hpp" + +#include + +#include "../../model/world/data.hpp" +#include "../../model/world/commands.hpp" +#include "../../model/world/columns.hpp" +#include "../../model/world/idtable.hpp" + +void CSVWorld::DialogueCreator::configureCreateCommand (CSMWorld::CreateCommand& command) const +{ + int index = + dynamic_cast (*getData().getTableModel (getCollectionId())). + findColumnIndex (CSMWorld::Columns::ColumnId_DialogueType); + + command.addValue (index, mType); +} + +CSVWorld::DialogueCreator::DialogueCreator (CSMWorld::Data& data, QUndoStack& undoStack, + const CSMWorld::UniversalId& id, int type) +: GenericCreator (data, undoStack, id, true), mType (type) +{} + +CSVWorld::Creator *CSVWorld::TopicCreatorFactory::makeCreator (CSMWorld::Data& data, + QUndoStack& undoStack, const CSMWorld::UniversalId& id) const +{ + return new DialogueCreator (data, undoStack, id, ESM::Dialogue::Topic); +} + +CSVWorld::Creator *CSVWorld::JournalCreatorFactory::makeCreator (CSMWorld::Data& data, + QUndoStack& undoStack, const CSMWorld::UniversalId& id) const +{ + return new DialogueCreator (data, undoStack, id, ESM::Dialogue::Journal); +} \ No newline at end of file diff --git a/apps/opencs/view/world/dialoguecreator.hpp b/apps/opencs/view/world/dialoguecreator.hpp new file mode 100644 index 000000000..26f866909 --- /dev/null +++ b/apps/opencs/view/world/dialoguecreator.hpp @@ -0,0 +1,41 @@ +#ifndef CSV_WORLD_DIALOGUECREATOR_H +#define CSV_WORLD_DIALOGUECREATOR_H + +#include "genericcreator.hpp" + +namespace CSVWorld +{ + class DialogueCreator : public GenericCreator + { + int mType; + + protected: + + virtual void configureCreateCommand (CSMWorld::CreateCommand& command) const; + + public: + + DialogueCreator (CSMWorld::Data& data, QUndoStack& undoStack, + const CSMWorld::UniversalId& id, int type); + }; + + class TopicCreatorFactory : public CreatorFactoryBase + { + public: + + virtual Creator *makeCreator (CSMWorld::Data& data, QUndoStack& undoStack, + const CSMWorld::UniversalId& id) const; + ///< The ownership of the returned Creator is transferred to the caller. + }; + + class JournalCreatorFactory : public CreatorFactoryBase + { + public: + + virtual Creator *makeCreator (CSMWorld::Data& data, QUndoStack& undoStack, + const CSMWorld::UniversalId& id) const; + ///< The ownership of the returned Creator is transferred to the caller. + }; +} + +#endif diff --git a/apps/opencs/view/world/genericcreator.cpp b/apps/opencs/view/world/genericcreator.cpp index df43d6c5f..ba2b3665a 100644 --- a/apps/opencs/view/world/genericcreator.cpp +++ b/apps/opencs/view/world/genericcreator.cpp @@ -57,14 +57,14 @@ const CSMWorld::UniversalId& CSVWorld::GenericCreator::getCollectionId() const } CSVWorld::GenericCreator::GenericCreator (CSMWorld::Data& data, QUndoStack& undoStack, - const CSMWorld::UniversalId& id) + const CSMWorld::UniversalId& id, bool relaxedIdRules) : mData (data), mUndoStack (undoStack), mListId (id), mLocked (false) { mLayout = new QHBoxLayout; mLayout->setContentsMargins (0, 0, 0, 0); mId = new QLineEdit; - mId->setValidator (new IdValidator (this)); + mId->setValidator (new IdValidator (relaxedIdRules, this)); mLayout->addWidget (mId, 1); mCreate = new QPushButton ("Create"); diff --git a/apps/opencs/view/world/genericcreator.hpp b/apps/opencs/view/world/genericcreator.hpp index 6752d8591..8dd2ca911 100644 --- a/apps/opencs/view/world/genericcreator.hpp +++ b/apps/opencs/view/world/genericcreator.hpp @@ -51,7 +51,7 @@ namespace CSVWorld public: GenericCreator (CSMWorld::Data& data, QUndoStack& undoStack, - const CSMWorld::UniversalId& id); + const CSMWorld::UniversalId& id, bool relaxedIdRules = false); virtual void setEditLock (bool locked); diff --git a/apps/opencs/view/world/idvalidator.cpp b/apps/opencs/view/world/idvalidator.cpp index cf6e5d77b..7c210daae 100644 --- a/apps/opencs/view/world/idvalidator.cpp +++ b/apps/opencs/view/world/idvalidator.cpp @@ -12,15 +12,25 @@ bool CSVWorld::IdValidator::isValid (const QChar& c, bool first) const return false; } -CSVWorld::IdValidator::IdValidator (QObject *parent) : QValidator (parent) {} +CSVWorld::IdValidator::IdValidator (bool relaxed, QObject *parent) +: QValidator (parent), mRelaxed (relaxed) +{} QValidator::State CSVWorld::IdValidator::validate (QString& input, int& pos) const { - bool first = true; - - for (QString::const_iterator iter (input.begin()); iter!=input.end(); ++iter, first = false) - if (!isValid (*iter, first)) + if (mRelaxed) + { + if (input.indexOf ('"')!=-1 || input.indexOf ("::")!=-1 || input.indexOf ("#")!=-1) return QValidator::Invalid; + } + else + { + bool first = true; + + for (QString::const_iterator iter (input.begin()); iter!=input.end(); ++iter, first = false) + if (!isValid (*iter, first)) + return QValidator::Invalid; + } return QValidator::Acceptable; } \ No newline at end of file diff --git a/apps/opencs/view/world/idvalidator.hpp b/apps/opencs/view/world/idvalidator.hpp index db0ecb27a..8ca162440 100644 --- a/apps/opencs/view/world/idvalidator.hpp +++ b/apps/opencs/view/world/idvalidator.hpp @@ -7,13 +7,16 @@ namespace CSVWorld { class IdValidator : public QValidator { + bool mRelaxed; + private: bool isValid (const QChar& c, bool first) const; public: - IdValidator (QObject *parent = 0); + IdValidator (bool relaxed = false, QObject *parent = 0); + ///< \param relaxed Relaxed rules for IDs that also functino as user visible text virtual State validate (QString& input, int& pos) const; diff --git a/apps/opencs/view/world/infocreator.cpp b/apps/opencs/view/world/infocreator.cpp new file mode 100644 index 000000000..f09222930 --- /dev/null +++ b/apps/opencs/view/world/infocreator.cpp @@ -0,0 +1,81 @@ + +#include "infocreator.hpp" + +#include + +#include +#include +#include + +#include + +#include "../../model/world/data.hpp" +#include "../../model/world/commands.hpp" +#include "../../model/world/columns.hpp" +#include "../../model/world/idtable.hpp" + +std::string CSVWorld::InfoCreator::getId() const +{ + std::string id = Misc::StringUtils::lowerCase (mTopic->text().toUtf8().constData()); + + std::string unique = QUuid::createUuid().toByteArray().data(); + + unique.erase (std::remove (unique.begin(), unique.end(), '-'), unique.end()); + + unique = unique.substr (1, unique.size()-2); + + return id + '#' + unique; +} + +void CSVWorld::InfoCreator::configureCreateCommand (CSMWorld::CreateCommand& command) const +{ + int index = + dynamic_cast (*getData().getTableModel (getCollectionId())). + findColumnIndex ( + getCollectionId().getType()==CSMWorld::UniversalId::Type_TopicInfos ? + CSMWorld::Columns::ColumnId_Topic : CSMWorld::Columns::ColumnId_Journal); + + command.addValue (index, mTopic->text()); +} + +CSVWorld::InfoCreator::InfoCreator (CSMWorld::Data& data, QUndoStack& undoStack, + const CSMWorld::UniversalId& id) +: GenericCreator (data, undoStack, id) +{ + QLabel *label = new QLabel ("Topic", this); + insertBeforeButtons (label, false); + + mTopic = new QLineEdit (this); + insertBeforeButtons (mTopic, true); + + setManualEditing (false); + + connect (mTopic, SIGNAL (textChanged (const QString&)), this, SLOT (topicChanged())); +} + +void CSVWorld::InfoCreator::reset() +{ + mTopic->setText (""); + GenericCreator::reset(); +} + +std::string CSVWorld::InfoCreator::getErrors() const +{ + // We ignore errors from GenericCreator here, because they can never happen in an InfoCreator. + std::string errors; + + std::string topic = mTopic->text().toUtf8().constData(); + + if ((getCollectionId().getType()==CSMWorld::UniversalId::Type_TopicInfos ? + getData().getTopics() : getData().getJournals()).searchId (topic)==-1) + { + errors += "Invalid Topic ID"; + } + + return errors; +} + +void CSVWorld::InfoCreator::topicChanged() +{ + update(); +} \ No newline at end of file diff --git a/apps/opencs/view/world/infocreator.hpp b/apps/opencs/view/world/infocreator.hpp new file mode 100644 index 000000000..e9cb7e596 --- /dev/null +++ b/apps/opencs/view/world/infocreator.hpp @@ -0,0 +1,42 @@ +#ifndef CSV_WORLD_INFOCREATOR_H +#define CSV_WORLD_INFOCREATOR_H + +#include "genericcreator.hpp" + +class QLineEdit; + +namespace CSMWorld +{ + class InfoCollection; +} + +namespace CSVWorld +{ + class InfoCreator : public GenericCreator + { + Q_OBJECT + + QLineEdit *mTopic; + + virtual std::string getId() const; + + virtual void configureCreateCommand (CSMWorld::CreateCommand& command) const; + + public: + + InfoCreator (CSMWorld::Data& data, QUndoStack& undoStack, + const CSMWorld::UniversalId& id); + + virtual void reset(); + + virtual std::string getErrors() const; + ///< Return formatted error descriptions for the current state of the creator. if an empty + /// string is returned, there is no error. + + private slots: + + void topicChanged(); + }; +} + +#endif diff --git a/apps/opencs/view/world/scenesubview.cpp b/apps/opencs/view/world/scenesubview.cpp index e3618c549..83b30be13 100644 --- a/apps/opencs/view/world/scenesubview.cpp +++ b/apps/opencs/view/world/scenesubview.cpp @@ -9,6 +9,8 @@ #include "../filter/filterbox.hpp" +#include "../render/scenewidget.hpp" + #include "tablebottombox.hpp" #include "creator.hpp" #include "scenetoolbar.hpp" @@ -41,15 +43,10 @@ toolbar->addTool (new SceneToolMode (toolbar)); toolbar->addTool (new SceneToolMode (toolbar)); layout2->addWidget (toolbar, 0); - /// \todo replace with rendering widget - QPalette palette2 (palette()); - palette2.setColor (QPalette::Background, Qt::white); - QLabel *placeholder = new QLabel ("Here goes the 3D scene", this); - placeholder->setAutoFillBackground (true); - placeholder->setPalette (palette2); - placeholder->setAlignment (Qt::AlignHCenter); - layout2->addWidget (placeholder, 1); + CSVRender::SceneWidget* sceneWidget = new CSVRender::SceneWidget(this); + + layout2->addWidget (sceneWidget, 1); layout->insertLayout (0, layout2, 1); @@ -79,4 +76,4 @@ void CSVWorld::SceneSubView::updateEditorSetting(const QString &settingName, con void CSVWorld::SceneSubView::setStatusBar (bool show) { mBottom->setStatusBar (show); -} \ No newline at end of file +} diff --git a/apps/opencs/view/world/subviews.cpp b/apps/opencs/view/world/subviews.cpp index 0e3465b38..74ce03cce 100644 --- a/apps/opencs/view/world/subviews.cpp +++ b/apps/opencs/view/world/subviews.cpp @@ -14,6 +14,8 @@ #include "referenceablecreator.hpp" #include "referencecreator.hpp" #include "scenesubview.hpp" +#include "dialoguecreator.hpp" +#include "infocreator.hpp" void CSVWorld::addSubViewFactories (CSVDoc::SubViewFactoryManager& manager) { @@ -53,6 +55,18 @@ void CSVWorld::addSubViewFactories (CSVDoc::SubViewFactoryManager& manager) manager.add (CSMWorld::UniversalId::Type_References, new CSVDoc::SubViewFactoryWithCreator >); + manager.add (CSMWorld::UniversalId::Type_Topics, + new CSVDoc::SubViewFactoryWithCreator); + + manager.add (CSMWorld::UniversalId::Type_Journals, + new CSVDoc::SubViewFactoryWithCreator); + + manager.add (CSMWorld::UniversalId::Type_TopicInfos, + new CSVDoc::SubViewFactoryWithCreator > (false)); + + manager.add (CSMWorld::UniversalId::Type_JournalInfos, + new CSVDoc::SubViewFactoryWithCreator > (false)); + // Subviews for editing/viewing individual records manager.add (CSMWorld::UniversalId::Type_Script, new CSVDoc::SubViewFactory); diff --git a/apps/opencs/view/world/table.cpp b/apps/opencs/view/world/table.cpp index 6167c084a..71bdb9000 100644 --- a/apps/opencs/view/world/table.cpp +++ b/apps/opencs/view/world/table.cpp @@ -12,6 +12,7 @@ #include "../../model/world/idtableproxymodel.hpp" #include "../../model/world/idtable.hpp" #include "../../model/world/record.hpp" +#include "../../model/world/columns.hpp" #include "recordstatusdelegate.hpp" #include "util.hpp" @@ -32,11 +33,43 @@ void CSVWorld::Table::contextMenuEvent (QContextMenuEvent *event) if (mCreateAction) menu.addAction (mCreateAction); - if (listRevertableSelectedIds().size()>0) - menu.addAction (mRevertAction); + /// \todo Reverting temporarily disabled on tables that support reordering, because + /// revert logic currently can not handle reordering. + if (mModel->getReordering()==CSMWorld::IdTable::Reordering_None) + if (listRevertableSelectedIds().size()>0) + menu.addAction (mRevertAction); if (listDeletableSelectedIds().size()>0) menu.addAction (mDeleteAction); + + if (mModel->getReordering()==CSMWorld::IdTable::Reordering_WithinTopic) + { + /// \todo allow reordering of multiple rows + if (selectedRows.size()==1) + { + int row =selectedRows.begin()->row(); + + int column = mModel->searchColumnIndex (CSMWorld::Columns::ColumnId_Topic); + + if (column==-1) + column = mModel->searchColumnIndex (CSMWorld::Columns::ColumnId_Journal); + + if (column!=-1) + { + if (row>0 && mProxyModel->data (mProxyModel->index (row, column))== + mProxyModel->data (mProxyModel->index (row-1, column))) + { + menu.addAction (mMoveUpAction); + } + + if (rowrowCount()-1 && mProxyModel->data (mProxyModel->index (row, column))== + mProxyModel->data (mProxyModel->index (row+1, column))) + { + menu.addAction (mMoveDownAction); + } + } + } + } } menu.exec (event->globalPos()); @@ -87,19 +120,33 @@ std::vector CSVWorld::Table::listDeletableSelectedIds() const { QModelIndex index = mProxyModel->mapToSource (mProxyModel->index (iter->row(), 0)); + // check record state CSMWorld::RecordBase::State state = static_cast ( mModel->data (mModel->index (index.row(), 1)).toInt()); - if (state!=CSMWorld::RecordBase::State_Deleted) + if (state==CSMWorld::RecordBase::State_Deleted) + continue; + + // check other columns (only relevant for a subset of the tables) + int dialogueTypeIndex = + mModel->searchColumnIndex (CSMWorld::Columns::ColumnId_DialogueType); + + if (dialogueTypeIndex!=-1) { - int columnIndex = mModel->findColumnIndex (CSMWorld::Columns::ColumnId_Id); + int type = mModel->data (mModel->index (index.row(), dialogueTypeIndex)).toInt(); - std::string id = mModel->data (mModel->index (index.row(), columnIndex)). - toString().toUtf8().constData(); - - deletableIds.push_back (id); + if (type!=ESM::Dialogue::Topic && type!=ESM::Dialogue::Journal) + continue; } + + // add the id to the collection + int columnIndex = mModel->findColumnIndex (CSMWorld::Columns::ColumnId_Id); + + std::string id = mModel->data (mModel->index (index.row(), columnIndex)). + toString().toUtf8().constData(); + + deletableIds.push_back (id); } } @@ -107,7 +154,7 @@ std::vector CSVWorld::Table::listDeletableSelectedIds() const } CSVWorld::Table::Table (const CSMWorld::UniversalId& id, CSMWorld::Data& data, QUndoStack& undoStack, - bool createAndDelete) + bool createAndDelete, bool sorting) : mUndoStack (undoStack), mCreateAction (0), mEditLock (false), mRecordStatusDisplay (0) { mModel = &dynamic_cast (*data.getTableModel (id)); @@ -118,7 +165,7 @@ CSVWorld::Table::Table (const CSMWorld::UniversalId& id, CSMWorld::Data& data, Q setModel (mProxyModel); horizontalHeader()->setResizeMode (QHeaderView::Interactive); verticalHeader()->hide(); - setSortingEnabled (true); + setSortingEnabled (sorting); setSelectionBehavior (QAbstractItemView::SelectRows); setSelectionMode (QAbstractItemView::ExtendedSelection); @@ -162,6 +209,14 @@ CSVWorld::Table::Table (const CSMWorld::UniversalId& id, CSMWorld::Data& data, Q connect (mDeleteAction, SIGNAL (triggered()), this, SLOT (deleteRecord())); addAction (mDeleteAction); + mMoveUpAction = new QAction (tr ("Move Up"), this); + connect (mMoveUpAction, SIGNAL (triggered()), this, SLOT (moveUpRecord())); + addAction (mMoveUpAction); + + mMoveDownAction = new QAction (tr ("Move Down"), this); + connect (mMoveDownAction, SIGNAL (triggered()), this, SLOT (moveDownRecord())); + addAction (mMoveDownAction); + connect (mProxyModel, SIGNAL (rowsInserted (const QModelIndex&, int, int)), this, SLOT (tableSizeUpdate())); @@ -240,6 +295,64 @@ void CSVWorld::Table::editRecord() } } +void CSVWorld::Table::moveUpRecord() +{ + QModelIndexList selectedRows = selectionModel()->selectedRows(); + + if (selectedRows.size()==1) + { + int row2 =selectedRows.begin()->row(); + + if (row2>0) + { + int row = row2-1; + + row = mProxyModel->mapToSource (mProxyModel->index (row, 0)).row(); + row2 = mProxyModel->mapToSource (mProxyModel->index (row2, 0)).row(); + + if (row2<=row) + throw std::runtime_error ("Inconsistent row order"); + + std::vector newOrder (row2-row+1); + newOrder[0] = row2-row; + newOrder[row2-row] = 0; + for (int i=1; iselectedRows(); + + if (selectedRows.size()==1) + { + int row =selectedRows.begin()->row(); + + if (rowrowCount()-1) + { + int row2 = row+1; + + row = mProxyModel->mapToSource (mProxyModel->index (row, 0)).row(); + row2 = mProxyModel->mapToSource (mProxyModel->index (row2, 0)).row(); + + if (row2<=row) + throw std::runtime_error ("Inconsistent row order"); + + std::vector newOrder (row2-row+1); + newOrder[0] = row2-row; + newOrder[row2-row] = 0; + for (int i=1; icolumnCount(); @@ -297,4 +410,4 @@ void CSVWorld::Table::requestFocus (const std::string& id) void CSVWorld::Table::recordFilterChanged (boost::shared_ptr filter) { mProxyModel->setFilter (filter); -} \ No newline at end of file +} diff --git a/apps/opencs/view/world/table.hpp b/apps/opencs/view/world/table.hpp index d93109056..889e2847a 100644 --- a/apps/opencs/view/world/table.hpp +++ b/apps/opencs/view/world/table.hpp @@ -34,6 +34,8 @@ namespace CSVWorld QAction *mCreateAction; QAction *mRevertAction; QAction *mDeleteAction; + QAction *mMoveUpAction; + QAction *mMoveDownAction; CSMWorld::IdTableProxyModel *mProxyModel; CSMWorld::IdTable *mModel; bool mEditLock; @@ -49,8 +51,9 @@ namespace CSVWorld public: - Table (const CSMWorld::UniversalId& id, CSMWorld::Data& data, QUndoStack& undoStack, bool createAndDelete); + Table (const CSMWorld::UniversalId& id, CSMWorld::Data& data, QUndoStack& undoStack, bool createAndDelete, bool sorting); ///< \param createAndDelete Allow creation and deletion of records. + /// \param sorting Allow changing order of rows in the view via column headers. void setEditLock (bool locked); @@ -79,6 +82,10 @@ namespace CSVWorld void editRecord(); + void moveUpRecord(); + + void moveDownRecord(); + public slots: void tableSizeUpdate(); diff --git a/apps/opencs/view/world/tablesubview.cpp b/apps/opencs/view/world/tablesubview.cpp index 1e05fbf51..55ded09de 100644 --- a/apps/opencs/view/world/tablesubview.cpp +++ b/apps/opencs/view/world/tablesubview.cpp @@ -12,7 +12,7 @@ #include "creator.hpp" CSVWorld::TableSubView::TableSubView (const CSMWorld::UniversalId& id, CSMDoc::Document& document, - const CreatorFactoryBase& creatorFactory) + const CreatorFactoryBase& creatorFactory, bool sorting) : SubView (id) { QVBoxLayout *layout = new QVBoxLayout; @@ -23,7 +23,7 @@ CSVWorld::TableSubView::TableSubView (const CSMWorld::UniversalId& id, CSMDoc::D new TableBottomBox (creatorFactory, document.getData(), document.getUndoStack(), id, this), 0); layout->insertWidget (0, mTable = - new Table (id, document.getData(), document.getUndoStack(), mBottom->canCreateAndDelete()), 2); + new Table (id, document.getData(), document.getUndoStack(), mBottom->canCreateAndDelete(), sorting), 2); CSVFilter::FilterBox *filterBox = new CSVFilter::FilterBox (document.getData(), this); diff --git a/apps/opencs/view/world/tablesubview.hpp b/apps/opencs/view/world/tablesubview.hpp index d61c78935..56a441a4d 100644 --- a/apps/opencs/view/world/tablesubview.hpp +++ b/apps/opencs/view/world/tablesubview.hpp @@ -26,7 +26,7 @@ namespace CSVWorld public: TableSubView (const CSMWorld::UniversalId& id, CSMDoc::Document& document, - const CreatorFactoryBase& creatorFactory); + const CreatorFactoryBase& creatorFactory, bool sorting); virtual void setEditLock (bool locked); diff --git a/apps/openmw/CMakeLists.txt b/apps/openmw/CMakeLists.txt index b367e2a1e..5a062575c 100644 --- a/apps/openmw/CMakeLists.txt +++ b/apps/openmw/CMakeLists.txt @@ -7,6 +7,9 @@ set(GAME main.cpp engine.cpp ) +if(NOT WIN32) + set(GAME ${GAME} crashcatcher.cpp) +endif() set(GAME_HEADER engine.hpp config.hpp @@ -16,7 +19,7 @@ source_group(game FILES ${GAME} ${GAME_HEADER}) add_openmw_dir (mwrender renderingmanager debugging sky camera animation npcanimation creatureanimation activatoranimation actors objects renderinginterface localmap occlusionquery water shadows - compositors characterpreview externalrendering globalmap videoplayer ripplesimulation refraction + characterpreview externalrendering globalmap videoplayer ripplesimulation refraction terrainstorage ) @@ -34,7 +37,8 @@ add_openmw_dir (mwgui enchantingdialog trainingwindow travelwindow imagebutton exposedwindow cursor spellicons merchantrepair repair soulgemdialog companionwindow bookpage journalviewmodel journalbooks keywordsearch itemmodel containeritemmodel inventoryitemmodel sortfilteritemmodel itemview - tradeitemmodel companionitemmodel pickpocketitemmodel fontloader controllers + tradeitemmodel companionitemmodel pickpocketitemmodel fontloader controllers savegamedialog + recharge ) add_openmw_dir (mwdialogue @@ -58,6 +62,7 @@ add_openmw_dir (mwworld cells localscripts customdata weather inventorystore ptr actionopen actionread actionequip timestamp actionalchemy cellstore actionapply actioneat esmstore store recordcmp fallback actionrepair actionsoulgem livecellref actiondoor + contentloader esmloader omwloader actiontrap ) add_openmw_dir (mwclass @@ -68,7 +73,7 @@ add_openmw_dir (mwclass add_openmw_dir (mwmechanics mechanicsmanagerimp stat character creaturestats magiceffects movement actors objects drawstate spells activespells npcstats aipackage aisequence alchemy aiwander aitravel aifollow - aiescort aiactivate repair enchanting pathfinding security + aiescort aiactivate aicombat repair enchanting pathfinding security spellsuccess spellcasting ) add_openmw_dir (mwbase diff --git a/apps/openmw/crashcatcher.cpp b/apps/openmw/crashcatcher.cpp new file mode 100644 index 000000000..666330666 --- /dev/null +++ b/apps/openmw/crashcatcher.cpp @@ -0,0 +1,449 @@ +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +#include +#include +#include + +#include + +#include + +#ifdef __linux__ +#include +#ifndef PR_SET_PTRACER +#define PR_SET_PTRACER 0x59616d61 +#endif +#elif defined (__APPLE__) +#include +#endif + + +static const char crash_switch[] = "--cc-handle-crash"; + +static const char fatal_err[] = "\n\n*** Fatal Error ***\n"; +static const char pipe_err[] = "!!! Failed to create pipe\n"; +static const char fork_err[] = "!!! Failed to fork debug process\n"; +static const char exec_err[] = "!!! Failed to exec debug process\n"; + +static char argv0[PATH_MAX]; + +static char altstack[SIGSTKSZ]; + + +static struct { + int signum; + pid_t pid; + int has_siginfo; + siginfo_t siginfo; + char buf[1024]; +} crash_info; + + +static const struct { + const char *name; + int signum; +} signals[] = { + { "Segmentation fault", SIGSEGV }, + { "Illegal instruction", SIGILL }, + { "FPU exception", SIGFPE }, + { "System BUS error", SIGBUS }, + { NULL, 0 } +}; + +static const struct { + int code; + const char *name; +} sigill_codes[] = { +#ifndef __FreeBSD__ + { ILL_ILLOPC, "Illegal opcode" }, + { ILL_ILLOPN, "Illegal operand" }, + { ILL_ILLADR, "Illegal addressing mode" }, + { ILL_ILLTRP, "Illegal trap" }, + { ILL_PRVOPC, "Privileged opcode" }, + { ILL_PRVREG, "Privileged register" }, + { ILL_COPROC, "Coprocessor error" }, + { ILL_BADSTK, "Internal stack error" }, +#endif + { 0, NULL } +}; + +static const struct { + int code; + const char *name; +} sigfpe_codes[] = { + { FPE_INTDIV, "Integer divide by zero" }, + { FPE_INTOVF, "Integer overflow" }, + { FPE_FLTDIV, "Floating point divide by zero" }, + { FPE_FLTOVF, "Floating point overflow" }, + { FPE_FLTUND, "Floating point underflow" }, + { FPE_FLTRES, "Floating point inexact result" }, + { FPE_FLTINV, "Floating point invalid operation" }, + { FPE_FLTSUB, "Subscript out of range" }, + { 0, NULL } +}; + +static const struct { + int code; + const char *name; +} sigsegv_codes[] = { +#ifndef __FreeBSD__ + { SEGV_MAPERR, "Address not mapped to object" }, + { SEGV_ACCERR, "Invalid permissions for mapped object" }, +#endif + { 0, NULL } +}; + +static const struct { + int code; + const char *name; +} sigbus_codes[] = { +#ifndef __FreeBSD__ + { BUS_ADRALN, "Invalid address alignment" }, + { BUS_ADRERR, "Non-existent physical address" }, + { BUS_OBJERR, "Object specific hardware error" }, +#endif + { 0, NULL } +}; + +static int (*cc_user_info)(char*, char*); + + +static void gdb_info(pid_t pid) +{ + char respfile[64]; + char cmd_buf[128]; + FILE *f; + int fd; + + /* Create a temp file to put gdb commands into */ + strcpy(respfile, "gdb-respfile-XXXXXX"); + if((fd=mkstemp(respfile)) >= 0 && (f=fdopen(fd, "w")) != NULL) + { + fprintf(f, "attach %d\n" + "shell echo \"\"\n" + "shell echo \"* Loaded Libraries\"\n" + "info sharedlibrary\n" + "shell echo \"\"\n" + "shell echo \"* Threads\"\n" + "info threads\n" + "shell echo \"\"\n" + "shell echo \"* FPU Status\"\n" + "info float\n" + "shell echo \"\"\n" + "shell echo \"* Registers\"\n" + "info registers\n" + "shell echo \"\"\n" + "shell echo \"* Backtrace\"\n" + "thread apply all backtrace full\n" + "detach\n" + "quit\n", pid); + fclose(f); + + /* Run gdb and print process info. */ + snprintf(cmd_buf, sizeof(cmd_buf), "gdb --quiet --batch --command=%s", respfile); + printf("Executing: %s\n", cmd_buf); + fflush(stdout); + + system(cmd_buf); + /* Clean up */ + remove(respfile); + } + else + { + /* Error creating temp file */ + if(fd >= 0) + { + close(fd); + remove(respfile); + } + printf("!!! Could not create gdb command file\n"); + } + fflush(stdout); +} + +static void sys_info(void) +{ +#ifdef __unix__ + system("echo \"System: `uname -a`\""); + putchar('\n'); + fflush(stdout); +#endif +} + + +static size_t safe_write(int fd, const void *buf, size_t len) +{ + size_t ret = 0; + while(ret < len) + { + ssize_t rem; + if((rem=write(fd, (const char*)buf+ret, len-ret)) == -1) + { + if(errno == EINTR) + continue; + break; + } + ret += rem; + } + return ret; +} + +static void crash_catcher(int signum, siginfo_t *siginfo, void *context) +{ + //ucontext_t *ucontext = (ucontext_t*)context; + pid_t dbg_pid; + int fd[2]; + + /* Make sure the effective uid is the real uid */ + if(getuid() != geteuid()) + { + raise(signum); + return; + } + + safe_write(STDERR_FILENO, fatal_err, sizeof(fatal_err)-1); + if(pipe(fd) == -1) + { + safe_write(STDERR_FILENO, pipe_err, sizeof(pipe_err)-1); + raise(signum); + return; + } + + crash_info.signum = signum; + crash_info.pid = getpid(); + crash_info.has_siginfo = !!siginfo; + if(siginfo) + crash_info.siginfo = *siginfo; + if(cc_user_info) + cc_user_info(crash_info.buf, crash_info.buf+sizeof(crash_info.buf)); + + /* Fork off to start a crash handler */ + switch((dbg_pid=fork())) + { + /* Error */ + case -1: + safe_write(STDERR_FILENO, fork_err, sizeof(fork_err)-1); + raise(signum); + return; + + case 0: + dup2(fd[0], STDIN_FILENO); + close(fd[0]); + close(fd[1]); + + execl(argv0, argv0, crash_switch, NULL); + + safe_write(STDERR_FILENO, exec_err, sizeof(exec_err)-1); + _exit(1); + + default: +#ifdef __linux__ + prctl(PR_SET_PTRACER, dbg_pid, 0, 0, 0); +#endif + safe_write(fd[1], &crash_info, sizeof(crash_info)); + close(fd[0]); + close(fd[1]); + + /* Wait; we'll be killed when gdb is done */ + do { + int status; + if(waitpid(dbg_pid, &status, 0) == dbg_pid && + (WIFEXITED(status) || WIFSIGNALED(status))) + { + /* The debug process died before it could kill us */ + raise(signum); + break; + } + } while(1); + } +} + +static void crash_handler(const char *logfile) +{ + const char *sigdesc = ""; + int i; + + if(fread(&crash_info, sizeof(crash_info), 1, stdin) != 1) + { + fprintf(stderr, "!!! Failed to retrieve info from crashed process\n"); + exit(1); + } + + /* Get the signal description */ + for(i = 0;signals[i].name;++i) + { + if(signals[i].signum == crash_info.signum) + { + sigdesc = signals[i].name; + break; + } + } + + if(crash_info.has_siginfo) + { + switch(crash_info.signum) + { + case SIGSEGV: + for(i = 0;sigsegv_codes[i].name;++i) + { + if(sigsegv_codes[i].code == crash_info.siginfo.si_code) + { + sigdesc = sigsegv_codes[i].name; + break; + } + } + break; + + case SIGFPE: + for(i = 0;sigfpe_codes[i].name;++i) + { + if(sigfpe_codes[i].code == crash_info.siginfo.si_code) + { + sigdesc = sigfpe_codes[i].name; + break; + } + } + break; + + case SIGILL: + for(i = 0;sigill_codes[i].name;++i) + { + if(sigill_codes[i].code == crash_info.siginfo.si_code) + { + sigdesc = sigill_codes[i].name; + break; + } + } + break; + + case SIGBUS: + for(i = 0;sigbus_codes[i].name;++i) + { + if(sigbus_codes[i].code == crash_info.siginfo.si_code) + { + sigdesc = sigbus_codes[i].name; + break; + } + } + break; + } + } + fprintf(stderr, "%s (signal %i)\n", sigdesc, crash_info.signum); + if(crash_info.has_siginfo) + fprintf(stderr, "Address: %p\n", crash_info.siginfo.si_addr); + fputc('\n', stderr); + + if(logfile) + { + /* Create crash log file and redirect shell output to it */ + if(freopen(logfile, "wa", stdout) != stdout) + { + fprintf(stderr, "!!! Could not create %s following signal\n", logfile); + exit(1); + } + fprintf(stderr, "Generating %s and killing process %d, please wait... ", logfile, crash_info.pid); + + printf("*** Fatal Error ***\n" + "%s (signal %i)\n", sigdesc, crash_info.signum); + if(crash_info.has_siginfo) + printf("Address: %p\n", crash_info.siginfo.si_addr); + fputc('\n', stdout); + fflush(stdout); + } + + sys_info(); + + crash_info.buf[sizeof(crash_info.buf)-1] = '\0'; + printf("%s\n", crash_info.buf); + fflush(stdout); + + if(crash_info.pid > 0) + { + gdb_info(crash_info.pid); + kill(crash_info.pid, SIGKILL); + } + + if(logfile) + { + char cwd[MAXPATHLEN]; + getcwd(cwd, MAXPATHLEN); + + std::string message = "OpenMW has encountered a fatal error.\nCrash log saved to '" + std::string(cwd) + "/" + std::string(logfile) + "'.\n Please report this to https://bugs.openmw.org !"; + SDL_ShowSimpleMessageBox(0, "Fatal Error", message.c_str(), NULL); + } + exit(0); +} + +int cc_install_handlers(int argc, char **argv, int num_signals, int *signals, const char *logfile, int (*user_info)(char*, char*)) +{ + struct sigaction sa; + stack_t altss; + int retval; + + if(argc == 2 && strcmp(argv[1], crash_switch) == 0) + crash_handler(logfile); + + cc_user_info = user_info; + + if(argv[0][0] == '/') + snprintf(argv0, sizeof(argv0), "%s", argv[0]); + else + { + getcwd(argv0, sizeof(argv0)); + retval = strlen(argv0); + snprintf(argv0+retval, sizeof(argv0)-retval, "/%s", argv[0]); + } + + /* Set an alternate signal stack so SIGSEGVs caused by stack overflows + * still run */ + altss.ss_sp = altstack; + altss.ss_flags = 0; + altss.ss_size = sizeof(altstack); + sigaltstack(&altss, NULL); + + memset(&sa, 0, sizeof(sa)); + sa.sa_sigaction = crash_catcher; + sa.sa_flags = SA_RESETHAND | SA_NODEFER | SA_SIGINFO | SA_ONSTACK; + sigemptyset(&sa.sa_mask); + + retval = 0; + while(num_signals--) + { + if((*signals != SIGSEGV && *signals != SIGILL && *signals != SIGFPE && *signals != SIGABRT && + *signals != SIGBUS) || sigaction(*signals, &sa, NULL) == -1) + { + *signals = 0; + retval = -1; + } + ++signals; + } + return retval; +} + + +// gdb apparently opens FD(s) 3,4,5 (whereas a typical prog uses only stdin=0, stdout=1,stderr=2) +bool +is_debugger_attached(void) +{ + bool rc = false; + FILE *fd = fopen("/tmp", "r"); + + if (fileno(fd) > 5) + { + rc = true; + } + + fclose(fd); + return rc; +} diff --git a/apps/openmw/engine.cpp b/apps/openmw/engine.cpp index e1fd3a0af..f2afb3ba5 100644 --- a/apps/openmw/engine.cpp +++ b/apps/openmw/engine.cpp @@ -1,6 +1,6 @@ #include "engine.hpp" -#include "components/esm/loadcell.hpp" +#include #include #include @@ -18,6 +18,8 @@ #include #include +#include + #include "mwinput/inputmanagerimp.hpp" #include "mwgui/windowmanagerimp.hpp" @@ -147,6 +149,7 @@ OMW::Engine::Engine(Files::ConfigurationManager& configurationManager) , mEncoding(ToUTF8::WINDOWS_1252) , mEncoder(NULL) , mActivationDistanceOverride(-1) + , mGrab(true) { std::srand ( std::time(NULL) ); @@ -210,7 +213,9 @@ void OMW::Engine::loadBSA() } else { - std::cout << "Archive " << *archive << " not found" << std::endl; + std::stringstream message; + message << "Archive '" << *archive << "' not found"; + throw std::runtime_error(message.str()); } } } @@ -261,34 +266,14 @@ void OMW::Engine::setCell (const std::string& cellName) mCellName = cellName; } -// Set master file (esm) -// - If the given name does not have an extension, ".esm" is added automatically - -void OMW::Engine::addMaster (const std::string& master) +void OMW::Engine::addContentFile(const std::string& file) { - mMaster.push_back(master); - std::string &str = mMaster.back(); + if (file.find_last_of(".") == std::string::npos) + { + throw std::runtime_error("Missing extension in content file!"); + } - // Append .esm if not already there - std::string::size_type sep = str.find_last_of ("."); - if (sep == std::string::npos) - { - str += ".esm"; - } -} - -// Add plugin file (esp) -void OMW::Engine::addPlugin (const std::string& plugin) -{ - mPlugins.push_back(plugin); - std::string &str = mPlugins.back(); - - // Append .esp if not already there - std::string::size_type sep = str.find_last_of ("."); - if (sep == std::string::npos) - { - str += ".esp"; - } + mContentFiles.push_back(file); } void OMW::Engine::setScriptsVerbosity(bool scriptsVerbosity) @@ -357,8 +342,7 @@ void OMW::Engine::prepareEngine (Settings::Manager & settings) mOgre->configure( mCfgMgr.getLogPath().string(), renderSystem, - Settings::Manager::getString("opengl rtt mode", "Video"), - false); + Settings::Manager::getString("opengl rtt mode", "Video")); // This has to be added BEFORE MyGUI is initialized, as it needs // to find core.xml here. @@ -370,7 +354,6 @@ void OMW::Engine::prepareEngine (Settings::Manager & settings) addResourcesDirectory(mResDir / "mygui"); addResourcesDirectory(mResDir / "water"); addResourcesDirectory(mResDir / "shadows"); - addZipResource(mResDir / "mygui" / "Obliviontt.zip"); OEngine::Render::WindowSettings windowSettings; windowSettings.fullscreen = settings.getBool("fullscreen", "Video"); @@ -392,7 +375,7 @@ void OMW::Engine::prepareEngine (Settings::Manager & settings) std::string keybinderUser = (mCfgMgr.getUserPath() / "input.xml").string(); bool keybinderUserExists = boost::filesystem::exists(keybinderUser); - MWInput::InputManager* input = new MWInput::InputManager (*mOgre, *this, keybinderUser, keybinderUserExists); + MWInput::InputManager* input = new MWInput::InputManager (*mOgre, *this, keybinderUser, keybinderUserExists, mGrab); mEnvironment.setInputManager (input); MWGui::WindowManager* window = new MWGui::WindowManager( @@ -401,7 +384,7 @@ void OMW::Engine::prepareEngine (Settings::Manager & settings) mEnvironment.setWindowManager (window); // Create the world - mEnvironment.setWorld( new MWWorld::World (*mOgre, mFileCollections, mMaster, mPlugins, + mEnvironment.setWorld( new MWWorld::World (*mOgre, mFileCollections, mContentFiles, mResDir, mCfgMgr.getCachePath(), mEncoder, mFallbackMap, mActivationDistanceOverride)); MWBase::Environment::get().getWorld()->setupPlayer(); @@ -416,8 +399,8 @@ void OMW::Engine::prepareEngine (Settings::Manager & settings) //Load translation data mTranslationDataStorage.setEncoder(mEncoder); - for (size_t i = 0; i < mMaster.size(); i++) - mTranslationDataStorage.loadTranslationData(mFileCollections, mMaster[i]); + for (size_t i = 0; i < mContentFiles.size(); i++) + mTranslationDataStorage.loadTranslationData(mFileCollections, mContentFiles[i]); Compiler::registerExtensions (mExtensions); @@ -432,13 +415,16 @@ void OMW::Engine::prepareEngine (Settings::Manager & settings) mVerboseScripts, *mScriptContext)); // Create game mechanics system - mEnvironment.setMechanicsManager (new MWMechanics::MechanicsManager); + MWMechanics::MechanicsManager* mechanics = new MWMechanics::MechanicsManager; + mEnvironment.setMechanicsManager (mechanics); // Create dialog system mEnvironment.setJournal (new MWDialogue::Journal); mEnvironment.setDialogueManager (new MWDialogue::DialogueManager (mExtensions, mVerboseScripts, mTranslationDataStorage)); mEnvironment.getWorld()->renderPlayer(); + mechanics->buildPlayer(); + window->updatePlayer(); if (!mNewGame) { @@ -482,7 +468,7 @@ void OMW::Engine::prepareEngine (Settings::Manager & settings) void OMW::Engine::go() { assert (!mCellName.empty()); - assert (!mMaster.empty()); + assert (!mContentFiles.empty()); assert (!mOgre); Settings::Manager settings; @@ -503,7 +489,8 @@ void OMW::Engine::go() MWBase::Environment::get().getWindowManager()->executeInConsole (mStartupScript); // Start the main rendering loop - mOgre->start(); + while (!mEnvironment.getRequestExit()) + Ogre::Root::getSingleton().renderOneFrame(); // Save user settings settings.saveUser(settingspath); @@ -530,6 +517,8 @@ void OMW::Engine::activate() std::string script = MWWorld::Class::get (ptr).getScript (ptr); + MWBase::Environment::get().getWorld()->breakInvisibility(MWBase::Environment::get().getWorld()->getPlayer().getPlayer()); + if (!script.empty()) { MWBase::Environment::get().getWorld()->getLocalScripts().setIgnore (ptr); diff --git a/apps/openmw/engine.hpp b/apps/openmw/engine.hpp index 665b0094c..e0f8f94e6 100644 --- a/apps/openmw/engine.hpp +++ b/apps/openmw/engine.hpp @@ -68,8 +68,7 @@ namespace OMW boost::filesystem::path mResDir; OEngine::Render::OgreRenderer *mOgre; std::string mCellName; - std::vector mMaster; - std::vector mPlugins; + std::vector mContentFiles; int mFpsLevel; bool mVerboseScripts; bool mNewGame; @@ -80,6 +79,8 @@ namespace OMW bool mScriptConsoleMode; std::string mStartupScript; int mActivationDistanceOverride; + // Grab mouse? + bool mGrab; Compiler::Extensions mExtensions; Compiler::Context *mScriptContext; @@ -135,13 +136,11 @@ namespace OMW /// Set start cell name (only interiors for now) void setCell(const std::string& cellName); - /// Set master file (esm) - /// - If the given name does not have an extension, ".esm" is added automatically - void addMaster(const std::string& master); - - /// Same as "addMaster", but for plugin files (esp) - /// - If the given name does not have an extension, ".esp" is added automatically - void addPlugin(const std::string& plugin); + /** + * @brief addContentFile - Adds content file (ie. esm/esp, or omwgame/omwaddon) to the content files container. + * @param file - filename (extension is required) + */ + void addContentFile(const std::string& file); /// Enable fps counter void showFPS(int level); @@ -155,6 +154,8 @@ namespace OMW /// Start as a new game. void setNewGame(bool newGame); + void setGrabMouse(bool grab) { mGrab = grab; } + /// Initialise and enter main loop. void go(); diff --git a/apps/openmw/main.cpp b/apps/openmw/main.cpp index 27afd734a..51281e213 100644 --- a/apps/openmw/main.cpp +++ b/apps/openmw/main.cpp @@ -1,8 +1,9 @@ #include +#include #include -#include +#include #include "engine.hpp" #if defined(_WIN32) && !defined(_CONSOLE) @@ -16,6 +17,13 @@ #endif + +#if OGRE_PLATFORM == OGRE_PLATFORM_LINUX || OGRE_PLATFORM == OGRE_PLATFORM_APPLE +#include +extern int cc_install_handlers(int argc, char **argv, int num_signals, int *sigs, const char *logfile, int (*user_info)(char*, char*)); +extern int is_debugger_attached(void); +#endif + // for Ogre::macBundlePath #if OGRE_PLATFORM == OGRE_PLATFORM_APPLE #include @@ -110,11 +118,8 @@ bool parseOptions (int argc, char** argv, OMW::Engine& engine, Files::Configurat ("start", bpo::value()->default_value("Beshara"), "set initial cell") - ("master", bpo::value()->default_value(StringsVector(), "") - ->multitoken(), "master file(s)") - - ("plugin", bpo::value()->default_value(StringsVector(), "") - ->multitoken(), "plugin file(s)") + ("content", bpo::value()->default_value(StringsVector(), "") + ->multitoken(), "content file(s): esm/esp, or omwgame/omwaddon") ("anim-verbose", bpo::value()->implicit_value(true) ->default_value(false), "output animation indices files") @@ -150,9 +155,9 @@ bool parseOptions (int argc, char** argv, OMW::Engine& engine, Files::Configurat ("fallback", bpo::value()->default_value(FallbackMap(), "") ->multitoken()->composing(), "fallback values") - ("activate-dist", bpo::value ()->default_value (-1), "activation distance override"); + ("no-grab", "Don't grab mouse cursor") - ; + ("activate-dist", bpo::value ()->default_value (-1), "activation distance override"); bpo::parsed_options valid_opts = bpo::command_line_parser(argc, argv) .options(desc).allow_unregistered().run(); @@ -182,6 +187,8 @@ bool parseOptions (int argc, char** argv, OMW::Engine& engine, Files::Configurat if (!run) return false; + engine.setGrabMouse(!variables.count("no-grab")); + // Font encoding settings std::string encoding(variables["encoding"].as()); std::cout << ToUTF8::encodingUsingMessage(encoding) << std::endl; @@ -211,29 +218,18 @@ bool parseOptions (int argc, char** argv, OMW::Engine& engine, Files::Configurat engine.setResourceDir(variables["resources"].as()); - // master and plugin - StringsVector master = variables["master"].as(); - if (master.empty()) + StringsVector content = variables["content"].as(); + if (content.empty()) { - std::cout << "No master file given. Aborting...\n"; - return false; + std::cout << "No content file given (esm/esp, nor omwgame/omwaddon). Aborting..." << std::endl; + return false; } - StringsVector plugin = variables["plugin"].as(); - // Removed check for 255 files, which would be the hard-coded limit in Morrowind. - // I'll keep the following variable in, maybe we can use it for something different. - // Say, a feedback like "loading file x/cnt". - // Commenting this out for now to silence compiler warning. - //int cnt = master.size() + plugin.size(); - - // Prepare loading master/plugin files (i.e. send filenames to engine) - for (std::vector::size_type i = 0; i < master.size(); i++) + StringsVector::const_iterator it(content.begin()); + StringsVector::const_iterator end(content.end()); + for (; it != end; ++it) { - engine.addMaster(master[i]); - } - for (std::vector::size_type i = 0; i < plugin.size(); i++) - { - engine.addPlugin(plugin[i]); + engine.addContentFile(*it); } // startup-settings @@ -255,6 +251,18 @@ bool parseOptions (int argc, char** argv, OMW::Engine& engine, Files::Configurat int main(int argc, char**argv) { +#if OGRE_PLATFORM == OGRE_PLATFORM_LINUX || OGRE_PLATFORM == OGRE_PLATFORM_APPLE + // Unix crash catcher + if ((argc == 2 && strcmp(argv[1], "--cc-handle-crash") == 0) || !is_debugger_attached()) + { + int s[5] = { SIGSEGV, SIGILL, SIGFPE, SIGBUS, SIGABRT }; + cc_install_handlers(argc, argv, 5, s, "crash.log", NULL); + std::cout << "Installing crash catcher" << std::endl; + } + else + std::cout << "Running in a debugger, not installing crash catcher" << std::endl; +#endif + #if OGRE_PLATFORM == OGRE_PLATFORM_APPLE // set current dir to bundle path boost::filesystem::path bundlePath = boost::filesystem::path(Ogre::macBundlePath()).parent_path(); @@ -273,7 +281,13 @@ int main(int argc, char**argv) } catch (std::exception &e) { - std::cout << "\nERROR: " << e.what() << std::endl; +#if OGRE_PLATFORM == OGRE_PLATFORM_LINUX || OGRE_PLATFORM == OGRE_PLATFORM_APPLE + if (isatty(fileno(stdin)) || !SDL_WasInit(SDL_INIT_VIDEO)) + std::cerr << "\nERROR: " << e.what() << std::endl; + else +#endif + SDL_ShowSimpleMessageBox(0, "OpenMW: Fatal error", e.what(), NULL); + return 1; } diff --git a/apps/openmw/mwbase/environment.cpp b/apps/openmw/mwbase/environment.cpp index 5a13a50ec..6b309025c 100644 --- a/apps/openmw/mwbase/environment.cpp +++ b/apps/openmw/mwbase/environment.cpp @@ -13,6 +13,7 @@ #include "windowmanager.hpp" MWBase::Environment *MWBase::Environment::sThis = 0; +bool MWBase::Environment::sExit = false; MWBase::Environment::Environment() : mWorld (0), mSoundManager (0), mScriptManager (0), mWindowManager (0), diff --git a/apps/openmw/mwbase/environment.hpp b/apps/openmw/mwbase/environment.hpp index a80e7ef87..466302907 100644 --- a/apps/openmw/mwbase/environment.hpp +++ b/apps/openmw/mwbase/environment.hpp @@ -32,6 +32,8 @@ namespace MWBase InputManager *mInputManager; float mFrameDuration; + static bool sExit; + Environment (const Environment&); ///< not implemented @@ -44,6 +46,9 @@ namespace MWBase ~Environment(); + static void setRequestExit () { sExit = true; } + static bool getRequestExit () { return sExit; } + void setWorld (World *world); void setSoundManager (SoundManager *soundManager); diff --git a/apps/openmw/mwbase/mechanicsmanager.hpp b/apps/openmw/mwbase/mechanicsmanager.hpp index 7e09f9b4d..3ab234de1 100644 --- a/apps/openmw/mwbase/mechanicsmanager.hpp +++ b/apps/openmw/mwbase/mechanicsmanager.hpp @@ -59,6 +59,8 @@ namespace MWBase /// \param paused In game type does not currently advance (this usually means some GUI /// component is up). + virtual void advanceTime (float duration) = 0; + virtual void setPlayerName (const std::string& name) = 0; ///< Set player name. @@ -114,6 +116,13 @@ namespace MWBase /// references that are currently not in the scene should be ignored. virtual bool checkAnimationPlaying(const MWWorld::Ptr& ptr, const std::string& groupName) = 0; + + /// Update magic effects for an actor. Usually done automatically once per frame, but if we're currently + /// paused we may want to do it manually (after equipping permanent enchantment) + virtual void updateMagicEffects (const MWWorld::Ptr& ptr) = 0; + + virtual void toggleAI() = 0; + virtual bool isAIActive() = 0; }; } diff --git a/apps/openmw/mwbase/windowmanager.hpp b/apps/openmw/mwbase/windowmanager.hpp index 1cd867223..c47ad066b 100644 --- a/apps/openmw/mwbase/windowmanager.hpp +++ b/apps/openmw/mwbase/windowmanager.hpp @@ -265,6 +265,7 @@ namespace MWBase virtual void showCompanionWindow(MWWorld::Ptr actor) = 0; virtual void startSpellMaking(MWWorld::Ptr actor) = 0; virtual void startEnchanting(MWWorld::Ptr actor) = 0; + virtual void startRecharge(MWWorld::Ptr soulgem) = 0; virtual void startSelfEnchanting(MWWorld::Ptr soulgem) = 0; virtual void startTraining(MWWorld::Ptr actor) = 0; virtual void startRepair(MWWorld::Ptr actor) = 0; @@ -283,6 +284,9 @@ namespace MWBase virtual void setKeyFocusWidget (MyGUI::Widget* widget) = 0; virtual Loading::Listener* getLoadingScreen() = 0; + + /// Should the cursor be visible? + virtual bool getCursorVisible() = 0; }; } diff --git a/apps/openmw/mwbase/world.hpp b/apps/openmw/mwbase/world.hpp index c39e87826..961d3d958 100644 --- a/apps/openmw/mwbase/world.hpp +++ b/apps/openmw/mwbase/world.hpp @@ -80,7 +80,6 @@ namespace MWBase Render_CollisionDebug, Render_Wireframe, Render_Pathgrid, - Render_Compositors, Render_BoundingBoxes }; @@ -241,7 +240,7 @@ namespace MWBase virtual void localRotateObject (const MWWorld::Ptr& ptr, float x, float y, float z) = 0; - virtual void safePlaceObject(const MWWorld::Ptr& ptr,MWWorld::CellStore &Cell,ESM::Position pos) = 0; + virtual MWWorld::Ptr safePlaceObject(const MWWorld::Ptr& ptr,MWWorld::CellStore &Cell,ESM::Position pos) = 0; ///< place an object in a "safe" location (ie not in the void, etc). virtual void indexToPosition (int cellX, int cellY, float &x, float &y, bool centre = false) @@ -309,14 +308,19 @@ namespace MWBase virtual void update (float duration, bool paused) = 0; - virtual bool placeObject(const MWWorld::Ptr& object, float cursorX, float cursorY) = 0; - ///< place an object into the gameworld at the specified cursor position + virtual bool placeObject (const MWWorld::Ptr& object, float cursorX, float cursorY, int amount) = 0; + ///< copy and place an object into the gameworld at the specified cursor position /// @param object /// @param cursor X (relative 0-1) /// @param cursor Y (relative 0-1) + /// @param number of objects to place /// @return true if the object was placed, or false if it was rejected because the position is too far away - virtual void dropObjectOnGround (const MWWorld::Ptr& actor, const MWWorld::Ptr& object) = 0; + virtual void dropObjectOnGround (const MWWorld::Ptr& actor, const MWWorld::Ptr& object, int amount) = 0; + ///< copy and place an object into the gameworld at the given actor's position + /// @param actor giving the dropped object position + /// @param object + /// @param number of objects to place virtual bool canPlaceObject (float cursorX, float cursorY) = 0; ///< @return true if it is possible to place on object at specified cursor location @@ -357,6 +361,9 @@ namespace MWBase virtual void getItemsOwnedBy (const MWWorld::Ptr& npc, std::vector& out) = 0; ///< get all items in active cells owned by this Npc + virtual bool getLOS(const MWWorld::Ptr& npc,const MWWorld::Ptr& targetNpc) = 0; + ///< get Line of Sight (morrowind stupid implementation) + virtual void enableActorCollision(const MWWorld::Ptr& actor, bool enable) = 0; virtual void setupExternalRendering (MWRender::ExternalRendering& rendering) = 0; @@ -406,6 +413,13 @@ namespace MWBase virtual bool getGodModeState() = 0; virtual bool toggleGodMode() = 0; + + virtual void castSpell (const MWWorld::Ptr& actor) = 0; + + virtual void launchProjectile (const std::string& id, bool stack, const ESM::EffectList& effects, + const MWWorld::Ptr& actor, const std::string& sourceName) = 0; + + virtual void breakInvisibility (const MWWorld::Ptr& actor) = 0; }; } diff --git a/apps/openmw/mwclass/apparatus.cpp b/apps/openmw/mwclass/apparatus.cpp index 697b75579..53c62273d 100644 --- a/apps/openmw/mwclass/apparatus.cpp +++ b/apps/openmw/mwclass/apparatus.cpp @@ -124,7 +124,7 @@ namespace MWClass std::string text; text += "\n#{sQuality}: " + MWGui::ToolTips::toString(ref->mBase->mData.mQuality); text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); diff --git a/apps/openmw/mwclass/armor.cpp b/apps/openmw/mwclass/armor.cpp index a511207c4..5b2b7caa3 100644 --- a/apps/openmw/mwclass/armor.cpp +++ b/apps/openmw/mwclass/armor.cpp @@ -94,7 +94,7 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - std::vector slots; + std::vector slots_; const int size = 11; @@ -116,11 +116,11 @@ namespace MWClass for (int i=0; imBase->mData.mType) { - slots.push_back (int (sMapping[i][1])); + slots_.push_back (int (sMapping[i][1])); break; } - return std::make_pair (slots, false); + return std::make_pair (slots_, false); } int Armor::getEquipmentSkill (const MWWorld::Ptr& ptr) const @@ -169,7 +169,10 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - return ref->mBase->mData.mValue; + if (ptr.getCellRef().mCharge == -1) + return ref->mBase->mData.mValue; + else + return ref->mBase->mData.mValue * (static_cast(ptr.getCellRef().mCharge) / getItemMaxHealth(ptr)); } void Armor::registerSelf() @@ -245,7 +248,7 @@ namespace MWClass + MWGui::ToolTips::toString(ref->mBase->mData.mHealth); text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight) + " (" + typeText + ")"; - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); @@ -281,6 +284,7 @@ namespace MWClass newItem.mEnchant=enchId; const ESM::Armor *record = MWBase::Environment::get().getWorld()->createRecord (newItem); ref->mBase = record; + ref->mRef.mRefID = record->mId; } std::pair Armor::canBeEquipped(const MWWorld::Ptr &ptr, const MWWorld::Ptr &npc) const @@ -288,12 +292,12 @@ namespace MWClass MWWorld::InventoryStore& invStore = MWWorld::Class::get(npc).getInventoryStore(npc); // slots that this item can be equipped in - std::pair, bool> slots = MWWorld::Class::get(ptr).getEquipmentSlots(ptr); + std::pair, bool> slots_ = MWWorld::Class::get(ptr).getEquipmentSlots(ptr); std::string npcRace = npc.get()->mBase->mRace; - for (std::vector::const_iterator slot=slots.first.begin(); - slot!=slots.first.end(); ++slot) + for (std::vector::const_iterator slot=slots_.first.begin(); + slot!=slots_.first.end(); ++slot) { // Beast races cannot equip shoes / boots, or full helms (head part vs hair part) diff --git a/apps/openmw/mwclass/book.cpp b/apps/openmw/mwclass/book.cpp index a692b30d8..1da920970 100644 --- a/apps/openmw/mwclass/book.cpp +++ b/apps/openmw/mwclass/book.cpp @@ -136,7 +136,7 @@ namespace MWClass std::string text; text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); @@ -171,6 +171,7 @@ namespace MWClass newItem.mEnchant=enchId; const ESM::Book *record = MWBase::Environment::get().getWorld()->createRecord (newItem); ref->mBase = record; + ref->mRef.mRefID = record->mId; } boost::shared_ptr Book::use (const MWWorld::Ptr& ptr) const diff --git a/apps/openmw/mwclass/clothing.cpp b/apps/openmw/mwclass/clothing.cpp index 2dbb7ee6f..c162bbe9d 100644 --- a/apps/openmw/mwclass/clothing.cpp +++ b/apps/openmw/mwclass/clothing.cpp @@ -78,12 +78,12 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - std::vector slots; + std::vector slots_; if (ref->mBase->mData.mType==ESM::Clothing::Ring) { - slots.push_back (int (MWWorld::InventoryStore::Slot_LeftRing)); - slots.push_back (int (MWWorld::InventoryStore::Slot_RightRing)); + slots_.push_back (int (MWWorld::InventoryStore::Slot_LeftRing)); + slots_.push_back (int (MWWorld::InventoryStore::Slot_RightRing)); } else { @@ -105,12 +105,12 @@ namespace MWClass for (int i=0; imBase->mData.mType) { - slots.push_back (int (sMapping[i][1])); + slots_.push_back (int (sMapping[i][1])); break; } } - return std::make_pair (slots, false); + return std::make_pair (slots_, false); } int Clothing::getEquipmentSkill (const MWWorld::Ptr& ptr) const @@ -191,7 +191,7 @@ namespace MWClass std::string text; text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); @@ -227,17 +227,18 @@ namespace MWClass newItem.mEnchant=enchId; const ESM::Clothing *record = MWBase::Environment::get().getWorld()->createRecord (newItem); ref->mBase = record; + ref->mRef.mRefID = record->mId; } std::pair Clothing::canBeEquipped(const MWWorld::Ptr &ptr, const MWWorld::Ptr &npc) const { // slots that this item can be equipped in - std::pair, bool> slots = MWWorld::Class::get(ptr).getEquipmentSlots(ptr); + std::pair, bool> slots_ = MWWorld::Class::get(ptr).getEquipmentSlots(ptr); std::string npcRace = npc.get()->mBase->mRace; - for (std::vector::const_iterator slot=slots.first.begin(); - slot!=slots.first.end(); ++slot) + for (std::vector::const_iterator slot=slots_.first.begin(); + slot!=slots_.first.end(); ++slot) { // Beast races cannot equip shoes / boots, or full helms (head part vs hair part) diff --git a/apps/openmw/mwclass/container.cpp b/apps/openmw/mwclass/container.cpp index 783eabff6..55b15a7d2 100644 --- a/apps/openmw/mwclass/container.cpp +++ b/apps/openmw/mwclass/container.cpp @@ -13,8 +13,8 @@ #include "../mwworld/containerstore.hpp" #include "../mwworld/customdata.hpp" #include "../mwworld/cellstore.hpp" -#include "../mwworld/actionapply.hpp" #include "../mwworld/actionopen.hpp" +#include "../mwworld/actiontrap.hpp" #include "../mwworld/physicssystem.hpp" #include "../mwworld/player.hpp" #include "../mwworld/inventorystore.hpp" @@ -147,11 +147,9 @@ namespace MWClass } else { - // Trap activation goes here - std::cout << "Activated trap: " << ptr.getCellRef().mTrap << std::endl; - boost::shared_ptr action(new MWWorld::ActionApply(actor, ptr.getCellRef().mTrap)); + // Activate trap + boost::shared_ptr action(new MWWorld::ActionTrap(actor, ptr.getCellRef().mTrap, ptr)); action->setSound(trapActivationSound); - ptr.getCellRef().mTrap = ""; return action; } } diff --git a/apps/openmw/mwclass/creature.cpp b/apps/openmw/mwclass/creature.cpp index 20f95ab0e..2e7f00dd3 100644 --- a/apps/openmw/mwclass/creature.cpp +++ b/apps/openmw/mwclass/creature.cpp @@ -98,6 +98,8 @@ namespace MWClass data->mContainerStore.fill(ref->mBase->mInventory, getId(ptr), MWBase::Environment::get().getWorld()->getStore()); + data->mContainerStore.add("gold_001", ref->mBase->mData.mGold, ptr); + // store ptr.getRefData().setCustomData (data.release()); } @@ -197,7 +199,7 @@ namespace MWClass else { MWMechanics::DynamicStat fatigue(getCreatureStats(ptr).getFatigue()); - fatigue.setCurrent(fatigue.getCurrent() - damage); + fatigue.setCurrent(fatigue.getCurrent() - damage, true); getCreatureStats(ptr).setFatigue(fatigue); } } diff --git a/apps/openmw/mwclass/door.cpp b/apps/openmw/mwclass/door.cpp index 3a0e4d0ba..3adb4f6fc 100644 --- a/apps/openmw/mwclass/door.cpp +++ b/apps/openmw/mwclass/door.cpp @@ -12,12 +12,12 @@ #include "../mwworld/ptr.hpp" #include "../mwworld/nullaction.hpp" #include "../mwworld/failedaction.hpp" -#include "../mwworld/actionapply.hpp" #include "../mwworld/actionteleport.hpp" #include "../mwworld/actiondoor.hpp" #include "../mwworld/cellstore.hpp" #include "../mwworld/physicssystem.hpp" #include "../mwworld/inventorystore.hpp" +#include "../mwworld/actiontrap.hpp" #include "../mwgui/tooltips.hpp" @@ -109,12 +109,8 @@ namespace MWClass if(!ptr.getCellRef().mTrap.empty()) { // Trap activation - std::cout << "Activated trap: " << ptr.getCellRef().mTrap << std::endl; - - boost::shared_ptr action(new MWWorld::ActionApply(actor, ptr.getCellRef().mTrap)); + boost::shared_ptr action(new MWWorld::ActionTrap(actor, ptr.getCellRef().mTrap, ptr)); action->setSound(trapActivationSound); - ptr.getCellRef().mTrap = ""; - return action; } diff --git a/apps/openmw/mwclass/ingredient.cpp b/apps/openmw/mwclass/ingredient.cpp index f629cc15d..4296d4e1b 100644 --- a/apps/openmw/mwclass/ingredient.cpp +++ b/apps/openmw/mwclass/ingredient.cpp @@ -145,7 +145,7 @@ namespace MWClass std::string text; text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); @@ -156,6 +156,9 @@ namespace MWClass MWMechanics::NpcStats& npcStats = MWWorld::Class::get(player).getNpcStats (player); int alchemySkill = npcStats.getSkill (ESM::Skill::Alchemy).getBase(); + static const float fWortChanceValue = + MWBase::Environment::get().getWorld()->getStore().get().find("fWortChanceValue")->getFloat(); + MWGui::Widgets::SpellEffectList list; for (int i=0; i<4; ++i) { @@ -166,10 +169,10 @@ namespace MWClass params.mAttribute = ref->mBase->mData.mAttributes[i]; params.mSkill = ref->mBase->mData.mSkills[i]; - params.mKnown = ( (i == 0 && alchemySkill >= 15) - || (i == 1 && alchemySkill >= 30) - || (i == 2 && alchemySkill >= 45) - || (i == 3 && alchemySkill >= 60)); + params.mKnown = ( (i == 0 && alchemySkill >= fWortChanceValue) + || (i == 1 && alchemySkill >= fWortChanceValue*2) + || (i == 2 && alchemySkill >= fWortChanceValue*3) + || (i == 3 && alchemySkill >= fWortChanceValue*4)); list.push_back(params); } diff --git a/apps/openmw/mwclass/light.cpp b/apps/openmw/mwclass/light.cpp index a593eb295..6a6133cb9 100644 --- a/apps/openmw/mwclass/light.cpp +++ b/apps/openmw/mwclass/light.cpp @@ -121,12 +121,12 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - std::vector slots; + std::vector slots_; if (ref->mBase->mData.mFlags & ESM::Light::Carry) - slots.push_back (int (MWWorld::InventoryStore::Slot_CarriedLeft)); + slots_.push_back (int (MWWorld::InventoryStore::Slot_CarriedLeft)); - return std::make_pair (slots, false); + return std::make_pair (slots_, false); } int Light::getValue (const MWWorld::Ptr& ptr) const @@ -183,7 +183,7 @@ namespace MWClass std::string text; text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); diff --git a/apps/openmw/mwclass/lockpick.cpp b/apps/openmw/mwclass/lockpick.cpp index 5931a0102..e1dc5b2e1 100644 --- a/apps/openmw/mwclass/lockpick.cpp +++ b/apps/openmw/mwclass/lockpick.cpp @@ -74,11 +74,11 @@ namespace MWClass std::pair, bool> Lockpick::getEquipmentSlots (const MWWorld::Ptr& ptr) const { - std::vector slots; + std::vector slots_; - slots.push_back (int (MWWorld::InventoryStore::Slot_CarriedRight)); + slots_.push_back (int (MWWorld::InventoryStore::Slot_CarriedRight)); - return std::make_pair (slots, false); + return std::make_pair (slots_, false); } int Lockpick::getValue (const MWWorld::Ptr& ptr) const @@ -86,7 +86,10 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - return ref->mBase->mData.mValue; + if (ptr.getCellRef().mCharge == -1) + return ref->mBase->mData.mValue; + else + return ref->mBase->mData.mValue * (static_cast(ptr.getCellRef().mCharge) / getItemMaxHealth(ptr)); } void Lockpick::registerSelf() @@ -138,7 +141,7 @@ namespace MWClass text += "\n#{sUses}: " + MWGui::ToolTips::toString(remainingUses); text += "\n#{sQuality}: " + MWGui::ToolTips::toString(ref->mBase->mData.mQuality); text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); diff --git a/apps/openmw/mwclass/misc.cpp b/apps/openmw/mwclass/misc.cpp index 6247191a9..1a40c4555 100644 --- a/apps/openmw/mwclass/misc.cpp +++ b/apps/openmw/mwclass/misc.cpp @@ -219,7 +219,6 @@ namespace MWClass MWWorld::LiveCellRef *ref = newRef.getPtr().get(); newPtr = MWWorld::Ptr(&cell.mMiscItems.insert(*ref), &cell); - newPtr.getRefData ().setCount(1); newPtr.getCellRef().mGoldValue = goldAmount; } else { MWWorld::LiveCellRef *ref = @@ -242,7 +241,8 @@ namespace MWClass MWWorld::LiveCellRef *ref = item.get(); - return !ref->mBase->mData.mIsKey && (npcServices & ESM::NPC::Misc); + return !ref->mBase->mData.mIsKey && (npcServices & ESM::NPC::Misc) + && !Misc::StringUtils::ciEqual(item.getCellRef().mRefID, "gold_001"); } float Miscellaneous::getWeight(const MWWorld::Ptr &ptr) const diff --git a/apps/openmw/mwclass/npc.cpp b/apps/openmw/mwclass/npc.cpp index 01a0c0a6f..e8b9bfaf2 100644 --- a/apps/openmw/mwclass/npc.cpp +++ b/apps/openmw/mwclass/npc.cpp @@ -20,6 +20,7 @@ #include "../mwmechanics/creaturestats.hpp" #include "../mwmechanics/npcstats.hpp" #include "../mwmechanics/movement.hpp" +#include "../mwmechanics/spellcasting.hpp" #include "../mwworld/ptr.hpp" #include "../mwworld/actiontalk.hpp" @@ -62,7 +63,6 @@ namespace bool male = (npc->mFlags & ESM::NPC::Female) == 0; int level = creatureStats.getLevel(); - for (int i=0; imData.mAttributeValues[i]; @@ -84,7 +84,7 @@ namespace } // skill bonus - for (int attribute=0; attribute (0.5 * (strength + endurance)) + multiplier * (creatureStats.getLevel() - 1)); } + + /** + * @brief autoCalculateSkills + * + * Skills are calculated with following formulae ( http://www.uesp.net/wiki/Morrowind:NPCs#Skills ): + * + * Skills: (Level - 1) × (Majority Multiplier + Specialization Multiplier) + * + * The Majority Multiplier is 1.0 for a Major or Minor Skill, or 0.1 for a Miscellaneous Skill. + * + * The Specialization Multiplier is 0.5 for a Skill in the same Specialization as the class, + * zero for other Skills. + * + * and by adding class, race, specialization bonus. + */ + void autoCalculateSkills(const ESM::NPC* npc, MWMechanics::NpcStats& npcStats) + { + const ESM::Class *class_ = + MWBase::Environment::get().getWorld()->getStore().get().find(npc->mClass); + + unsigned int level = npcStats.getLevel(); + + const ESM::Race *race = MWBase::Environment::get().getWorld()->getStore().get().find(npc->mRace); + + + for (int i = 0; i < 2; ++i) + { + int bonus = (i==0) ? 10 : 25; + + for (int i2 = 0; i2 < 5; ++i2) + { + int index = class_->mData.mSkills[i2][i]; + if (index >= 0 && index < ESM::Skill::Length) + { + npcStats.getSkill(index).setBase (npcStats.getSkill(index).getBase() + bonus); + } + } + } + + for (int skillIndex = 0; skillIndex < ESM::Skill::Length; ++skillIndex) + { + float majorMultiplier = 0.1f; + float specMultiplier = 0.0f; + + int raceBonus = 0; + int specBonus = 0; + + for (int raceSkillIndex = 0; raceSkillIndex < 7; ++raceSkillIndex) + { + if (race->mData.mBonus[raceSkillIndex].mSkill == skillIndex) + { + raceBonus = race->mData.mBonus[raceSkillIndex].mBonus; + break; + } + } + + for (int k = 0; k < 5; ++k) + { + // is this a minor or major skill? + if ((class_->mData.mSkills[k][0] == skillIndex) || (class_->mData.mSkills[k][1] == skillIndex)) + { + majorMultiplier = 1.0f; + break; + } + } + + // is this skill in the same Specialization as the class? + const ESM::Skill* skill = MWBase::Environment::get().getWorld()->getStore().get().find(skillIndex); + if (skill->mData.mSpecialization == class_->mData.mSpecialization) + { + specMultiplier = 0.5f; + specBonus = 5; + } + + npcStats.getSkill(skillIndex).setBase( + std::min( + npcStats.getSkill(skillIndex).getBase() + + 5 + + raceBonus + + specBonus + + static_cast((level-1) * (majorMultiplier + specMultiplier)), 100.0f)); + } + } } namespace MWClass @@ -172,7 +255,7 @@ namespace MWClass { std::string faction = ref->mBase->mFaction; Misc::StringUtils::toLower(faction); - if(ref->mBase->mNpdt52.mGold != -10) + if(ref->mBase->mNpdtType != ESM::NPC::NPC_WITH_AUTOCALCULATED_STATS) { data->mNpcStats.getFactionRanks()[faction] = (int)ref->mBase->mNpdt52.mRank; } @@ -183,9 +266,12 @@ namespace MWClass } // creature stats - if(ref->mBase->mNpdt52.mGold != -10) + int gold=0; + if(ref->mBase->mNpdtType != ESM::NPC::NPC_WITH_AUTOCALCULATED_STATS) { - for (int i=0; i<27; ++i) + gold = ref->mBase->mNpdt52.mGold; + + for (unsigned int i=0; i< ESM::Skill::Length; ++i) data->mNpcStats.getSkill (i).setBase (ref->mBase->mNpdt52.mSkills[i]); data->mNpcStats.getAttribute(0).set (ref->mBase->mNpdt52.mStrength); @@ -206,6 +292,8 @@ namespace MWClass } else { + gold = ref->mBase->mNpdt12.mGold; + for (int i=0; i<3; ++i) data->mNpcStats.setDynamic (i, 10); @@ -214,6 +302,7 @@ namespace MWClass data->mNpcStats.setReputation(ref->mBase->mNpdt12.mReputation); autoCalculateAttributes(ref->mBase, data->mNpcStats); + autoCalculateSkills(ref->mBase, data->mNpcStats); } data->mNpcStats.getAiSequence().fill(ref->mBase->mAiPackage); @@ -235,6 +324,8 @@ namespace MWClass // store ptr.getRefData().setCustomData (data.release()); + getContainerStore(ptr).add("gold_001", gold, ptr); + getInventoryStore(ptr).autoEquip(ptr); } } @@ -254,7 +345,7 @@ namespace MWClass void Npc::insertObjectRendering (const MWWorld::Ptr& ptr, MWRender::RenderingInterface& renderingInterface) const { - renderingInterface.getActors().insertNPC(ptr, getInventoryStore(ptr)); + renderingInterface.getActors().insertNPC(ptr); } void Npc::insertObject(const MWWorld::Ptr& ptr, MWWorld::PhysicsSystem& physics) const @@ -444,6 +535,39 @@ namespace MWClass if(ptr.getRefData().getHandle() == "player") skillUsageSucceeded(ptr, weapskill, 0); + // Apply "On hit" enchanted weapons + std::string enchantmentName = !weapon.isEmpty() ? weapon.getClass().getEnchantment(weapon) : ""; + if (!enchantmentName.empty()) + { + const ESM::Enchantment* enchantment = MWBase::Environment::get().getWorld()->getStore().get().find( + enchantmentName); + if (enchantment->mData.mType == ESM::Enchantment::WhenStrikes) + { + // Check if we have enough charges + const float enchantCost = enchantment->mData.mCost; + int eSkill = stats.getSkill(ESM::Skill::Enchant).getModified(); + const int castCost = std::max(1.f, enchantCost - (enchantCost / 100) * (eSkill - 10)); + + if (weapon.getCellRef().mEnchantmentCharge == -1) + weapon.getCellRef().mEnchantmentCharge = enchantment->mData.mCharge; + if (weapon.getCellRef().mEnchantmentCharge < castCost) + { + if (ptr.getRefData().getHandle() == "player") + MWBase::Environment::get().getWindowManager()->messageBox("#{sMagicInsufficientCharge}"); + } + else + { + weapon.getCellRef().mEnchantmentCharge -= castCost; + + MWMechanics::CastSpell cast(ptr, victim); + cast.cast(weapon); + + if (ptr.getRefData().getHandle() == "player") + skillUsageSucceeded (ptr, ESM::Skill::Enchant, 3); + } + } + } + othercls.onHit(victim, damage, healthdmg, weapon, ptr, true); } @@ -545,7 +669,7 @@ namespace MWClass else { MWMechanics::DynamicStat fatigue(getCreatureStats(ptr).getFatigue()); - fatigue.setCurrent(fatigue.getCurrent() - damage); + fatigue.setCurrent(fatigue.getCurrent() - damage, true); getCreatureStats(ptr).setFatigue(fatigue); } } @@ -587,6 +711,8 @@ namespace MWClass return boost::shared_ptr(new MWWorld::ActionOpen(ptr, true)); if(get(actor).getStance(actor, MWWorld::Class::Sneak)) return boost::shared_ptr(new MWWorld::ActionOpen(ptr)); // stealing + if(get(ptr).getCreatureStats(ptr).isHostile()) + return boost::shared_ptr(new MWWorld::FailedAction("#{sActorInCombat}")); return boost::shared_ptr(new MWWorld::ActionTalk(ptr)); } @@ -899,11 +1025,8 @@ namespace MWClass bool Npc::apply (const MWWorld::Ptr& ptr, const std::string& id, const MWWorld::Ptr& actor) const { - MWMechanics::CreatureStats& stats = getCreatureStats (ptr); - - /// \todo consider instant effects - - return stats.getActiveSpells().addSpell (id, actor); + MWMechanics::CastSpell cast(ptr, ptr); + return cast.cast(id); } void Npc::skillUsageSucceeded (const MWWorld::Ptr& ptr, int skill, int usageType) const diff --git a/apps/openmw/mwclass/potion.cpp b/apps/openmw/mwclass/potion.cpp index 08683a668..e276c58aa 100644 --- a/apps/openmw/mwclass/potion.cpp +++ b/apps/openmw/mwclass/potion.cpp @@ -11,6 +11,7 @@ #include "../mwworld/actiontake.hpp" #include "../mwworld/actionapply.hpp" #include "../mwworld/cellstore.hpp" +#include "../mwworld/containerstore.hpp" #include "../mwworld/physicssystem.hpp" #include "../mwworld/player.hpp" #include "../mwworld/nullaction.hpp" @@ -127,7 +128,7 @@ namespace MWClass std::string text; text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); info.effects = MWGui::Widgets::MWEffectList::effectListFromESM(&ref->mBase->mEffects); @@ -136,13 +137,14 @@ namespace MWClass MWMechanics::NpcStats& npcStats = MWWorld::Class::get(player).getNpcStats (player); int alchemySkill = npcStats.getSkill (ESM::Skill::Alchemy).getBase(); int i=0; + static const float fWortChanceValue = + MWBase::Environment::get().getWorld()->getStore().get().find("fWortChanceValue")->getFloat(); for (MWGui::Widgets::SpellEffectList::iterator it = info.effects.begin(); it != info.effects.end(); ++it) { - /// \todo this code is duplicated from mwclass/ingredient, put it in a helper function - it->mKnown = ( (i == 0 && alchemySkill >= 15) - || (i == 1 && alchemySkill >= 30) - || (i == 2 && alchemySkill >= 45) - || (i == 3 && alchemySkill >= 60)); + it->mKnown = ( (i == 0 && alchemySkill >= fWortChanceValue) + || (i == 1 && alchemySkill >= fWortChanceValue*2) + || (i == 2 && alchemySkill >= fWortChanceValue*3) + || (i == 3 && alchemySkill >= fWortChanceValue*4)); ++i; } @@ -164,10 +166,11 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - ptr.getRefData().setCount (ptr.getRefData().getCount()-1); - MWWorld::Ptr actor = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + // remove used potion (assume it is present in inventory) + ptr.getContainerStore()->remove(ptr, 1, actor); + boost::shared_ptr action ( new MWWorld::ActionApply (actor, ref->mBase->mId)); diff --git a/apps/openmw/mwclass/probe.cpp b/apps/openmw/mwclass/probe.cpp index 951265f40..b54464acd 100644 --- a/apps/openmw/mwclass/probe.cpp +++ b/apps/openmw/mwclass/probe.cpp @@ -73,11 +73,11 @@ namespace MWClass std::pair, bool> Probe::getEquipmentSlots (const MWWorld::Ptr& ptr) const { - std::vector slots; + std::vector slots_; - slots.push_back (int (MWWorld::InventoryStore::Slot_CarriedRight)); + slots_.push_back (int (MWWorld::InventoryStore::Slot_CarriedRight)); - return std::make_pair (slots, false); + return std::make_pair (slots_, false); } int Probe::getValue (const MWWorld::Ptr& ptr) const @@ -85,7 +85,10 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - return ref->mBase->mData.mValue; + if (ptr.getCellRef().mCharge == -1) + return ref->mBase->mData.mValue; + else + return ref->mBase->mData.mValue * (static_cast(ptr.getCellRef().mCharge) / getItemMaxHealth(ptr)); } void Probe::registerSelf() @@ -137,7 +140,7 @@ namespace MWClass text += "\n#{sUses}: " + MWGui::ToolTips::toString(remainingUses); text += "\n#{sQuality}: " + MWGui::ToolTips::toString(ref->mBase->mData.mQuality); text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); diff --git a/apps/openmw/mwclass/repair.cpp b/apps/openmw/mwclass/repair.cpp index 38c15ac92..ce2b4ff10 100644 --- a/apps/openmw/mwclass/repair.cpp +++ b/apps/openmw/mwclass/repair.cpp @@ -76,7 +76,10 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - return ref->mBase->mData.mValue; + if (ptr.getCellRef().mCharge == -1) + return ref->mBase->mData.mValue; + else + return ref->mBase->mData.mValue * (static_cast(ptr.getCellRef().mCharge) / getItemMaxHealth(ptr)); } void Repair::registerSelf() @@ -141,7 +144,7 @@ namespace MWClass text += "\n#{sUses}: " + MWGui::ToolTips::toString(remainingUses); text += "\n#{sQuality}: " + MWGui::ToolTips::toString(ref->mBase->mData.mQuality); text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); if (MWBase::Environment::get().getWindowManager()->getFullHelp()) { text += MWGui::ToolTips::getMiscString(ref->mRef.mOwner, "Owner"); diff --git a/apps/openmw/mwclass/weapon.cpp b/apps/openmw/mwclass/weapon.cpp index 4cb090328..a09e83380 100644 --- a/apps/openmw/mwclass/weapon.cpp +++ b/apps/openmw/mwclass/weapon.cpp @@ -100,23 +100,23 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - std::vector slots; + std::vector slots_; bool stack = false; if (ref->mBase->mData.mType==ESM::Weapon::Arrow || ref->mBase->mData.mType==ESM::Weapon::Bolt) { - slots.push_back (int (MWWorld::InventoryStore::Slot_Ammunition)); + slots_.push_back (int (MWWorld::InventoryStore::Slot_Ammunition)); stack = true; } else if (ref->mBase->mData.mType==ESM::Weapon::MarksmanThrown) { - slots.push_back (int (MWWorld::InventoryStore::Slot_CarriedRight)); + slots_.push_back (int (MWWorld::InventoryStore::Slot_CarriedRight)); stack = true; } else - slots.push_back (int (MWWorld::InventoryStore::Slot_CarriedRight)); + slots_.push_back (int (MWWorld::InventoryStore::Slot_CarriedRight)); - return std::make_pair (slots, stack); + return std::make_pair (slots_, stack); } int Weapon::getEquipmentSkill (const MWWorld::Ptr& ptr) const @@ -154,7 +154,10 @@ namespace MWClass MWWorld::LiveCellRef *ref = ptr.get(); - return ref->mBase->mData.mValue; + if (ptr.getCellRef().mCharge == -1) + return ref->mBase->mData.mValue; + else + return ref->mBase->mData.mValue * (static_cast(ptr.getCellRef().mCharge) / getItemMaxHealth(ptr)); } void Weapon::registerSelf() @@ -343,7 +346,7 @@ namespace MWClass } text += "\n#{sWeight}: " + MWGui::ToolTips::toString(ref->mBase->mData.mWeight); - text += MWGui::ToolTips::getValueString(ref->mBase->mData.mValue, "#{sValue}"); + text += MWGui::ToolTips::getValueString(getValue(ptr), "#{sValue}"); info.enchant = ref->mBase->mEnchant; @@ -370,25 +373,26 @@ namespace MWClass void Weapon::applyEnchantment(const MWWorld::Ptr &ptr, const std::string& enchId, int enchCharge, const std::string& newName) const { - MWWorld::LiveCellRef *ref = - ptr.get(); + MWWorld::LiveCellRef *ref = + ptr.get(); - ESM::Weapon newItem = *ref->mBase; - newItem.mId=""; - newItem.mName=newName; - newItem.mData.mEnchant=enchCharge; - newItem.mEnchant=enchId; - const ESM::Weapon *record = MWBase::Environment::get().getWorld()->createRecord (newItem); - ref->mBase = record; + ESM::Weapon newItem = *ref->mBase; + newItem.mId=""; + newItem.mName=newName; + newItem.mData.mEnchant=enchCharge; + newItem.mEnchant=enchId; + const ESM::Weapon *record = MWBase::Environment::get().getWorld()->createRecord (newItem); + ref->mBase = record; + ref->mRef.mRefID = record->mId; } std::pair Weapon::canBeEquipped(const MWWorld::Ptr &ptr, const MWWorld::Ptr &npc) const { - std::pair, bool> slots = MWWorld::Class::get(ptr).getEquipmentSlots(ptr); + std::pair, bool> slots_ = MWWorld::Class::get(ptr).getEquipmentSlots(ptr); // equip the item in the first free slot - for (std::vector::const_iterator slot=slots.first.begin(); - slot!=slots.first.end(); ++slot) + for (std::vector::const_iterator slot=slots_.first.begin(); + slot!=slots_.first.end(); ++slot) { if(*slot == MWWorld::InventoryStore::Slot_CarriedRight) { diff --git a/apps/openmw/mwdialogue/dialoguemanagerimp.cpp b/apps/openmw/mwdialogue/dialoguemanagerimp.cpp index 52493bf76..3951cedcb 100644 --- a/apps/openmw/mwdialogue/dialoguemanagerimp.cpp +++ b/apps/openmw/mwdialogue/dialoguemanagerimp.cpp @@ -413,10 +413,6 @@ namespace MWDialogue void DialogueManager::goodbyeSelected() { - // Do not close the dialogue window if the player has to answer a question - if (mIsInChoice) - return; - MWBase::Environment::get().getWindowManager()->removeGuiMode(MWGui::GM_Dialogue); // Apply disposition change to NPC's base disposition @@ -474,6 +470,8 @@ namespace MWDialogue void DialogueManager::goodbye() { + mIsInChoice = true; + MWGui::DialogueWindow* win = MWBase::Environment::get().getWindowManager()->getDialogueWindow(); win->goodbye(); diff --git a/apps/openmw/mwdialogue/filter.cpp b/apps/openmw/mwdialogue/filter.cpp index a7b0f1924..11dccde42 100644 --- a/apps/openmw/mwdialogue/filter.cpp +++ b/apps/openmw/mwdialogue/filter.cpp @@ -58,13 +58,13 @@ bool MWDialogue::Filter::testActor (const ESM::DialInfo& info) const } // NPC faction - if (!info.mNpcFaction.empty()) + if (!info.mFaction.empty()) { if (isCreature) return false; MWMechanics::NpcStats& stats = MWWorld::Class::get (mActor).getNpcStats (mActor); - std::map::iterator iter = stats.getFactionRanks().find ( Misc::StringUtils::lowerCase (info.mNpcFaction)); + std::map::iterator iter = stats.getFactionRanks().find ( Misc::StringUtils::lowerCase (info.mFaction)); if (iter==stats.getFactionRanks().end()) return false; diff --git a/apps/openmw/mwgui/alchemywindow.cpp b/apps/openmw/mwgui/alchemywindow.cpp index 1e203dcd0..09f692e4f 100644 --- a/apps/openmw/mwgui/alchemywindow.cpp +++ b/apps/openmw/mwgui/alchemywindow.cpp @@ -47,8 +47,6 @@ namespace MWGui , mIngredients (4) , mSortModel(NULL) { - mAlchemy.setAlchemist (MWBase::Environment::get().getWorld()->getPlayer().getPlayer()); - getWidget(mCreateButton, "CreateButton"); getWidget(mCancelButton, "CancelButton"); getWidget(mIngredients[0], "Ingredient1"); @@ -145,6 +143,8 @@ namespace MWGui void AlchemyWindow::open() { + mAlchemy.setAlchemist (MWBase::Environment::get().getWorld()->getPlayer().getPlayer()); + InventoryItemModel* model = new InventoryItemModel(MWBase::Environment::get().getWorld()->getPlayer().getPlayer()); mSortModel = new SortFilterItemModel(model); mSortModel->setFilter(SortFilterItemModel::Filter_OnlyIngredients); diff --git a/apps/openmw/mwgui/charactercreation.cpp b/apps/openmw/mwgui/charactercreation.cpp index 816f42e3d..b829f219d 100644 --- a/apps/openmw/mwgui/charactercreation.cpp +++ b/apps/openmw/mwgui/charactercreation.cpp @@ -219,9 +219,14 @@ namespace MWGui mReviewDialog->setClass(mPlayerClass); mReviewDialog->setBirthSign(mPlayerBirthSignId); - mReviewDialog->setHealth(mPlayerHealth); - mReviewDialog->setMagicka(mPlayerMagicka); - mReviewDialog->setFatigue(mPlayerFatigue); + { + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + MWMechanics::CreatureStats stats = MWWorld::Class::get(player).getCreatureStats(player); + + mReviewDialog->setHealth ( stats.getHealth() ); + mReviewDialog->setMagicka( stats.getMagicka() ); + mReviewDialog->setFatigue( stats.getFatigue() ); + } { std::map > attributes = MWBase::Environment::get().getWindowManager()->getPlayerAttributeValues(); @@ -258,21 +263,6 @@ namespace MWGui mRaceDialog->doRenderUpdate(); } - void CharacterCreation::setPlayerHealth (const MWMechanics::DynamicStat& value) - { - mPlayerHealth = value; - } - - void CharacterCreation::setPlayerMagicka (const MWMechanics::DynamicStat& value) - { - mPlayerMagicka = value; - } - - void CharacterCreation::setPlayerFatigue (const MWMechanics::DynamicStat& value) - { - mPlayerFatigue = value; - } - void CharacterCreation::onReviewDialogDone(WindowBase* parWindow) { MWBase::Environment::get().getWindowManager()->removeDialog(mReviewDialog); @@ -285,7 +275,9 @@ namespace MWGui { MWBase::Environment::get().getWindowManager()->removeDialog(mReviewDialog); mReviewDialog = 0; + mCreationStage = CSE_ReviewBack; + MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Birth); } @@ -332,24 +324,22 @@ namespace MWGui mPickClassDialog = 0; } + updatePlayerHealth(); + //TODO This bit gets repeated a few times; wrap it in a function + MWBase::Environment::get().getWindowManager()->popGuiMode(); if (mCreationStage == CSE_ReviewNext) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Review); } else if (mCreationStage >= CSE_ClassChosen) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Birth); } else { mCreationStage = CSE_ClassChosen; - MWBase::Environment::get().getWindowManager()->popGuiMode(); } - - updatePlayerHealth(); } void CharacterCreation::onPickClassDialogBack() @@ -403,20 +393,18 @@ namespace MWGui mNameDialog = 0; } + MWBase::Environment::get().getWindowManager()->popGuiMode(); if (mCreationStage == CSE_ReviewNext) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Review); } else if (mCreationStage >= CSE_NameChosen) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Race); } else { mCreationStage = CSE_NameChosen; - MWBase::Environment::get().getWindowManager()->popGuiMode(); } } @@ -462,23 +450,21 @@ namespace MWGui mRaceDialog = 0; } + updatePlayerHealth(); + + MWBase::Environment::get().getWindowManager()->popGuiMode(); if (mCreationStage == CSE_ReviewNext) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Review); } else if (mCreationStage >= CSE_RaceChosen) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Class); } else { mCreationStage = CSE_RaceChosen; - MWBase::Environment::get().getWindowManager()->popGuiMode(); } - - updatePlayerHealth(); } void CharacterCreation::onBirthSignDialogDone(WindowBase* parWindow) @@ -492,18 +478,17 @@ namespace MWGui mBirthSignDialog = 0; } + updatePlayerHealth(); + + MWBase::Environment::get().getWindowManager()->popGuiMode(); if (mCreationStage >= CSE_BirthSignChosen) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Review); } else { mCreationStage = CSE_BirthSignChosen; - MWBase::Environment::get().getWindowManager()->popGuiMode(); } - - updatePlayerHealth(); } void CharacterCreation::onBirthSignDialogBack() @@ -552,23 +537,21 @@ namespace MWGui mCreateClassDialog = 0; } + updatePlayerHealth(); + + MWBase::Environment::get().getWindowManager()->popGuiMode(); if (mCreationStage == CSE_ReviewNext) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Review); } else if (mCreationStage >= CSE_ClassChosen) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Birth); } else { mCreationStage = CSE_ClassChosen; - MWBase::Environment::get().getWindowManager()->popGuiMode(); } - - updatePlayerHealth(); } void CharacterCreation::onCreateClassDialogBack() @@ -722,23 +705,21 @@ namespace MWGui mPlayerClass = *klass; MWBase::Environment::get().getWindowManager()->setPlayerClass(mPlayerClass); + updatePlayerHealth(); + + MWBase::Environment::get().getWindowManager()->popGuiMode(); if (mCreationStage == CSE_ReviewNext) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Review); } else if (mCreationStage >= CSE_ClassChosen) { - MWBase::Environment::get().getWindowManager()->popGuiMode(); MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Birth); } else { mCreationStage = CSE_ClassChosen; - MWBase::Environment::get().getWindowManager()->popGuiMode(); } - - updatePlayerHealth(); } CharacterCreation::~CharacterCreation() diff --git a/apps/openmw/mwgui/charactercreation.hpp b/apps/openmw/mwgui/charactercreation.hpp index bd8826677..b80aaae41 100644 --- a/apps/openmw/mwgui/charactercreation.hpp +++ b/apps/openmw/mwgui/charactercreation.hpp @@ -31,12 +31,6 @@ namespace MWGui //Show a dialog void spawnDialog(const char id); - void setPlayerHealth (const MWMechanics::DynamicStat& value); - - void setPlayerMagicka (const MWMechanics::DynamicStat& value); - - void setPlayerFatigue (const MWMechanics::DynamicStat& value); - void setValue (const std::string& id, const MWMechanics::Stat& value); void setValue (const std::string& id, const MWMechanics::DynamicStat& value); void setValue(const ESM::Skill::SkillEnum parSkill, const MWMechanics::Stat& value); @@ -60,9 +54,6 @@ namespace MWGui std::string mPlayerRaceId; std::string mPlayerBirthSignId; ESM::Class mPlayerClass; - MWMechanics::DynamicStat mPlayerHealth; - MWMechanics::DynamicStat mPlayerMagicka; - MWMechanics::DynamicStat mPlayerFatigue; //Class generation vars unsigned mGenerateClassStep; // Keeps track of current step in Generate Class dialog @@ -104,6 +95,7 @@ namespace MWGui CSE_RaceChosen, CSE_ClassChosen, CSE_BirthSignChosen, + CSE_ReviewBack, CSE_ReviewNext }; diff --git a/apps/openmw/mwgui/companionwindow.cpp b/apps/openmw/mwgui/companionwindow.cpp index 9698608d6..a0a34108e 100644 --- a/apps/openmw/mwgui/companionwindow.cpp +++ b/apps/openmw/mwgui/companionwindow.cpp @@ -86,12 +86,13 @@ void CompanionWindow::onBackgroundSelected() void CompanionWindow::open(const MWWorld::Ptr& npc) { mPtr = npc; - setTitle(MWWorld::Class::get(npc).getName(npc)); updateEncumbranceBar(); mModel = new CompanionItemModel(npc); mSortModel = new SortFilterItemModel(mModel); mItemView->setModel(mSortModel); + + setTitle(MWWorld::Class::get(npc).getName(npc)); } void CompanionWindow::onFrame() diff --git a/apps/openmw/mwgui/console.cpp b/apps/openmw/mwgui/console.cpp index a1e3fb738..96bc204c1 100644 --- a/apps/openmw/mwgui/console.cpp +++ b/apps/openmw/mwgui/console.cpp @@ -246,7 +246,7 @@ namespace MWGui { if(mCurrent != mCommandHistory.end()) { - --mCurrent; + ++mCurrent; if(mCurrent != mCommandHistory.end()) mCommandLine->setCaption(*mCurrent); diff --git a/apps/openmw/mwgui/container.cpp b/apps/openmw/mwgui/container.cpp index bc869e5fe..19ed4dbc0 100644 --- a/apps/openmw/mwgui/container.cpp +++ b/apps/openmw/mwgui/container.cpp @@ -100,6 +100,9 @@ namespace MWGui finish(); targetView->update(); + + // We need to update the view since an other item could be auto-equipped. + mSourceView->update(); } void DragAndDrop::finish() @@ -217,11 +220,13 @@ namespace MWGui mDisposeCorpseButton->setVisible(loot); - setTitle(MWWorld::Class::get(container).getName(container)); - mSortModel = new SortFilterItemModel(mModel); mItemView->setModel (mSortModel); + + // Careful here. setTitle may cause size updates, causing itemview redraw, so make sure to do it last + // or we end up using a possibly invalid model. + setTitle(MWWorld::Class::get(container).getName(container)); } void ContainerWindow::onCloseButtonClicked(MyGUI::Widget* _sender) diff --git a/apps/openmw/mwgui/containeritemmodel.cpp b/apps/openmw/mwgui/containeritemmodel.cpp index eff8fbcc1..6b0fbd890 100644 --- a/apps/openmw/mwgui/containeritemmodel.cpp +++ b/apps/openmw/mwgui/containeritemmodel.cpp @@ -94,9 +94,7 @@ void ContainerItemModel::removeItem (const ItemStack& item, size_t count) { if (stacks(*it, item.mBase)) { - int refCount = it->getRefData().getCount(); - it->getRefData().setCount(std::max(0, refCount - toRemove)); - toRemove -= refCount; + toRemove -= store.remove(*it, toRemove, *source); if (toRemove <= 0) return; } diff --git a/apps/openmw/mwgui/cursor.cpp b/apps/openmw/mwgui/cursor.cpp index c069eca15..9c64f94ca 100644 --- a/apps/openmw/mwgui/cursor.cpp +++ b/apps/openmw/mwgui/cursor.cpp @@ -73,57 +73,4 @@ namespace MWGui return mSize; } - // ---------------------------------------------------------------------------------------- - - Cursor::Cursor() - { - // hide mygui's pointer since we're rendering it ourselves (because mygui's pointer doesn't support rotation) - MyGUI::PointerManager::getInstance().setVisible(false); - - MyGUI::PointerManager::getInstance().eventChangeMousePointer += MyGUI::newDelegate(this, &Cursor::onCursorChange); - - mWidget = MyGUI::Gui::getInstance().createWidget("RotatingSkin",0,0,0,0,MyGUI::Align::Default,"Pointer",""); - - onCursorChange(MyGUI::PointerManager::getInstance().getDefaultPointer()); - } - - Cursor::~Cursor() - { - } - - void Cursor::onCursorChange(const std::string &name) - { - ResourceImageSetPointerFix* imgSetPtr = dynamic_cast( - MyGUI::PointerManager::getInstance().getByName(name)); - assert(imgSetPtr != NULL); - - MyGUI::ResourceImageSet* imgSet = imgSetPtr->getImageSet(); - - std::string texture = imgSet->getIndexInfo(0,0).texture; - - mSize = imgSetPtr->getSize(); - mHotSpot = imgSetPtr->getHotSpot(); - - int rotation = imgSetPtr->getRotation(); - - mWidget->setImageTexture(texture); - MyGUI::ISubWidget* main = mWidget->getSubWidgetMain(); - MyGUI::RotatingSkin* rotatingSubskin = main->castType(); - rotatingSubskin->setCenter(MyGUI::IntPoint(mSize.width/2,mSize.height/2)); - rotatingSubskin->setAngle(Ogre::Degree(rotation).valueRadians()); - } - - void Cursor::update() - { - MyGUI::IntPoint position = MyGUI::InputManager::getInstance().getMousePosition(); - - mWidget->setPosition(position - mHotSpot); - mWidget->setSize(mSize); - } - - void Cursor::setVisible(bool visible) - { - mWidget->setVisible(visible); - } - } diff --git a/apps/openmw/mwgui/cursor.hpp b/apps/openmw/mwgui/cursor.hpp index badf82262..4e3eb9097 100644 --- a/apps/openmw/mwgui/cursor.hpp +++ b/apps/openmw/mwgui/cursor.hpp @@ -39,23 +39,6 @@ namespace MWGui int mRotation; // rotation in degrees }; - class Cursor - { - public: - Cursor(); - ~Cursor(); - void update (); - - void setVisible (bool visible); - - void onCursorChange (const std::string& name); - - private: - MyGUI::ImageBox* mWidget; - - MyGUI::IntSize mSize; - MyGUI::IntPoint mHotSpot; - }; } #endif diff --git a/apps/openmw/mwgui/dialogue.cpp b/apps/openmw/mwgui/dialogue.cpp index c9a780691..914302d84 100644 --- a/apps/openmw/mwgui/dialogue.cpp +++ b/apps/openmw/mwgui/dialogue.cpp @@ -12,6 +12,8 @@ #include "../mwmechanics/npcstats.hpp" #include "../mwworld/class.hpp" +#include "../mwworld/player.hpp" +#include "../mwworld/containerstore.hpp" #include "../mwdialogue/dialoguemanagerimp.hpp" @@ -67,23 +69,24 @@ namespace MWGui void PersuasionDialog::onPersuade(MyGUI::Widget *sender) { + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); MWBase::MechanicsManager::PersuasionType type; if (sender == mAdmireButton) type = MWBase::MechanicsManager::PT_Admire; else if (sender == mIntimidateButton) type = MWBase::MechanicsManager::PT_Intimidate; else if (sender == mTauntButton) type = MWBase::MechanicsManager::PT_Taunt; else if (sender == mBribe10Button) { - MWBase::Environment::get().getWindowManager()->getTradeWindow()->addOrRemoveGold(-10); + player.getClass().getContainerStore(player).remove("gold_001", 10, player); type = MWBase::MechanicsManager::PT_Bribe10; } else if (sender == mBribe100Button) { - MWBase::Environment::get().getWindowManager()->getTradeWindow()->addOrRemoveGold(-100); + player.getClass().getContainerStore(player).remove("gold_001", 100, player); type = MWBase::MechanicsManager::PT_Bribe100; } else /*if (sender == mBribe1000Button)*/ { - MWBase::Environment::get().getWindowManager()->getTradeWindow()->addOrRemoveGold(-1000); + player.getClass().getContainerStore(player).remove("gold_001", 1000, player); type = MWBase::MechanicsManager::PT_Bribe1000; } @@ -299,6 +302,8 @@ namespace MWGui void DialogueWindow::onByeClicked(MyGUI::Widget* _sender) { + if (!mEnabled || MWBase::Environment::get().getDialogueManager()->isInChoice()) + return; MWBase::Environment::get().getDialogueManager()->goodbyeSelected(); } diff --git a/apps/openmw/mwgui/enchantingdialog.cpp b/apps/openmw/mwgui/enchantingdialog.cpp index 98ba8ec2f..d2e914d17 100644 --- a/apps/openmw/mwgui/enchantingdialog.cpp +++ b/apps/openmw/mwgui/enchantingdialog.cpp @@ -4,6 +4,7 @@ #include "../mwbase/environment.hpp" #include "../mwbase/world.hpp" +#include "../mwbase/soundmanager.hpp" #include "../mwworld/player.hpp" #include "../mwworld/manualref.hpp" #include "../mwworld/class.hpp" @@ -298,9 +299,15 @@ namespace MWGui int result = mEnchanting.create(); if(result==1) + { + MWBase::Environment::get().getSoundManager()->playSound("enchant success", 1.f, 1.f); MWBase::Environment::get().getWindowManager()->messageBox ("#{sEnchantmentMenu12}"); + } else + { + MWBase::Environment::get().getSoundManager()->playSound("enchant fail", 1.f, 1.f); MWBase::Environment::get().getWindowManager()->messageBox ("#{sNotifyMessage34}"); + } MWBase::Environment::get().getWindowManager()->removeGuiMode (GM_Enchanting); } diff --git a/apps/openmw/mwgui/hud.cpp b/apps/openmw/mwgui/hud.cpp index edcd49738..a78b1a6d1 100644 --- a/apps/openmw/mwgui/hud.cpp +++ b/apps/openmw/mwgui/hud.cpp @@ -28,6 +28,7 @@ namespace MWGui , mStamina(NULL) , mDrowning(NULL) , mDrowningFrame(NULL) + , mDrowningFlash(NULL) , mWeapImage(NULL) , mSpellImage(NULL) , mWeapStatus(NULL) @@ -53,6 +54,7 @@ namespace MWGui , mSpellVisible(true) , mWorldMouseOver(false) , mEnemyHealthTimer(0) + , mIsDrowning(false) { setCoord(0,0, width, height); @@ -75,6 +77,7 @@ namespace MWGui //Drowning bar getWidget(mDrowningFrame, "DrowningFrame"); getWidget(mDrowning, "Drowning"); + getWidget(mDrowningFlash, "Flash"); mDrowning->setProgressRange(200); const MyGUI::IntSize& viewSize = MyGUI::RenderManager::getInstance().getViewSize(); @@ -171,43 +174,45 @@ namespace MWGui void HUD::setValue(const std::string& id, const MWMechanics::DynamicStat& value) { - static const char *ids[] = - { - "HBar", "MBar", "FBar", 0 - }; + int current = std::max(0, static_cast(value.getCurrent())); + int modified = static_cast(value.getModified()); - for (int i=0; ids[i]; ++i) - if (ids[i]==id) - { - MyGUI::Widget* w; - std::string valStr = boost::lexical_cast(value.getCurrent()) + "/" + boost::lexical_cast(value.getModified()); - switch (i) - { - case 0: - mHealth->setProgressRange (value.getModified()); - mHealth->setProgressPosition (value.getCurrent()); - getWidget(w, "HealthFrame"); - w->setUserString("Caption_HealthDescription", "#{sHealthDesc}\n" + valStr); - break; - case 1: - mMagicka->setProgressRange (value.getModified()); - mMagicka->setProgressPosition (value.getCurrent()); - getWidget(w, "MagickaFrame"); - w->setUserString("Caption_HealthDescription", "#{sIntDesc}\n" + valStr); - break; - case 2: - mStamina->setProgressRange (value.getModified()); - mStamina->setProgressPosition (value.getCurrent()); - getWidget(w, "FatigueFrame"); - w->setUserString("Caption_HealthDescription", "#{sFatDesc}\n" + valStr); - break; - } - } + MyGUI::Widget* w; + std::string valStr = boost::lexical_cast(current) + "/" + boost::lexical_cast(modified); + if (id == "HBar") + { + mHealth->setProgressRange(modified); + mHealth->setProgressPosition(current); + getWidget(w, "HealthFrame"); + w->setUserString("Caption_HealthDescription", "#{sHealthDesc}\n" + valStr); + } + else if (id == "MBar") + { + mMagicka->setProgressRange (modified); + mMagicka->setProgressPosition (current); + getWidget(w, "MagickaFrame"); + w->setUserString("Caption_HealthDescription", "#{sIntDesc}\n" + valStr); + } + else if (id == "FBar") + { + mStamina->setProgressRange (modified); + mStamina->setProgressPosition (current); + getWidget(w, "FatigueFrame"); + w->setUserString("Caption_HealthDescription", "#{sFatDesc}\n" + valStr); + } } void HUD::setDrowningTimeLeft(float time) { - mDrowning->setProgressPosition(time/20.0*200.0); + size_t progress = time/20.0*200.0; + mDrowning->setProgressPosition(progress); + + bool isDrowning = (progress == 0); + if (isDrowning && !mIsDrowning) // Just started drowning + mDrowningFlashTheta = 0.0f; // Start out on bright red every time. + + mDrowningFlash->setVisible(isDrowning); + mIsDrowning = isDrowning; } void HUD::setDrowningBarVisible(bool visible) @@ -232,21 +237,16 @@ namespace MWGui float mouseX = cursorPosition.left / float(viewSize.width); float mouseY = cursorPosition.top / float(viewSize.height); - int origCount = object.getRefData().getCount(); - object.getRefData().setCount(mDragAndDrop->mDraggedCount); - if (world->canPlaceObject(mouseX, mouseY)) - world->placeObject(object, mouseX, mouseY); + world->placeObject(object, mouseX, mouseY, mDragAndDrop->mDraggedCount); else - world->dropObjectOnGround(world->getPlayer().getPlayer(), object); + world->dropObjectOnGround(world->getPlayer().getPlayer(), object, mDragAndDrop->mDraggedCount); MWBase::Environment::get().getWindowManager()->changePointer("arrow"); std::string sound = MWWorld::Class::get(object).getDownSoundId(object); MWBase::Environment::get().getSoundManager()->playSound (sound, 1.0, 1.0); - object.getRefData().setCount(origCount); - // remove object from the container it was coming from mDragAndDrop->mSourceModel->removeItem(mDragAndDrop->mItem, mDragAndDrop->mDraggedCount); mDragAndDrop->finish(); @@ -367,6 +367,9 @@ namespace MWGui mEnemyHealth->setVisible(false); mWeaponSpellBox->setPosition(mWeaponSpellBox->getPosition() + MyGUI::IntPoint(0,20)); } + + if (mIsDrowning) + mDrowningFlashTheta += dt * Ogre::Math::TWO_PI; } void HUD::onResChange(int width, int height) @@ -609,6 +612,12 @@ namespace MWGui mEnemyHealth->setProgressRange(100); mEnemyHealth->setProgressPosition(stats.getHealth().getCurrent() / stats.getHealth().getModified() * 100); } + + if (mIsDrowning) + { + float intensity = (cos(mDrowningFlashTheta) + 1.0f) / 2.0f; + mDrowningFlash->setColour(MyGUI::Colour(intensity, intensity, intensity)); + } } void HUD::setEnemy(const MWWorld::Ptr &enemy) diff --git a/apps/openmw/mwgui/hud.hpp b/apps/openmw/mwgui/hud.hpp index c40742a60..04206fbc8 100644 --- a/apps/openmw/mwgui/hud.hpp +++ b/apps/openmw/mwgui/hud.hpp @@ -67,7 +67,7 @@ namespace MWGui MyGUI::ImageBox* mCrosshair; MyGUI::TextBox* mCellNameBox; MyGUI::TextBox* mWeaponSpellBox; - MyGUI::Widget* mDrowningFrame; + MyGUI::Widget *mDrowningFrame, *mDrowningFlash; MyGUI::Widget* mDummy; @@ -101,6 +101,9 @@ namespace MWGui MWWorld::Ptr mEnemy; float mEnemyHealthTimer; + bool mIsDrowning; + float mDrowningFlashTheta; + void onWorldClicked(MyGUI::Widget* _sender); void onWorldMouseOver(MyGUI::Widget* _sender, int x, int y); void onWorldMouseLostFocus(MyGUI::Widget* _sender, MyGUI::Widget* _new); diff --git a/apps/openmw/mwgui/imagebutton.cpp b/apps/openmw/mwgui/imagebutton.cpp index 98f05373b..f2565f5c0 100644 --- a/apps/openmw/mwgui/imagebutton.cpp +++ b/apps/openmw/mwgui/imagebutton.cpp @@ -42,12 +42,13 @@ namespace MWGui ImageBox::onMouseButtonPressed(_left, _top, _id); } - MyGUI::IntSize ImageButton::getRequestedSize() + MyGUI::IntSize ImageButton::getRequestedSize(bool logError) { Ogre::TexturePtr texture = Ogre::TextureManager::getSingleton().getByName(mImageNormal); if (texture.isNull()) { - std::cerr << "ImageButton: can't find " << mImageNormal << std::endl; + if (logError) + std::cerr << "ImageButton: can't find " << mImageNormal << std::endl; return MyGUI::IntSize(0,0); } return MyGUI::IntSize (texture->getWidth(), texture->getHeight()); diff --git a/apps/openmw/mwgui/imagebutton.hpp b/apps/openmw/mwgui/imagebutton.hpp index f531e2246..f4191a3a5 100644 --- a/apps/openmw/mwgui/imagebutton.hpp +++ b/apps/openmw/mwgui/imagebutton.hpp @@ -14,7 +14,7 @@ namespace MWGui MYGUI_RTTI_DERIVED(ImageButton) public: - MyGUI::IntSize getRequestedSize(); + MyGUI::IntSize getRequestedSize(bool logError = true); protected: virtual void setPropertyOverride(const std::string& _key, const std::string& _value); diff --git a/apps/openmw/mwgui/inventoryitemmodel.cpp b/apps/openmw/mwgui/inventoryitemmodel.cpp index 62a5a75f0..672ea9c16 100644 --- a/apps/openmw/mwgui/inventoryitemmodel.cpp +++ b/apps/openmw/mwgui/inventoryitemmodel.cpp @@ -52,18 +52,12 @@ void InventoryItemModel::copyItem (const ItemStack& item, size_t count) void InventoryItemModel::removeItem (const ItemStack& item, size_t count) { MWWorld::ContainerStore& store = MWWorld::Class::get(mActor).getContainerStore(mActor); + int removed = store.remove(item.mBase, count, mActor); - for (MWWorld::ContainerStoreIterator it = store.begin(); it != store.end(); ++it) - { - if (*it == item.mBase) - { - if (it->getRefData().getCount() < static_cast(count)) - throw std::runtime_error("Not enough items in the stack to remove"); - it->getRefData().setCount(it->getRefData().getCount() - count); - return; - } - } - throw std::runtime_error("Item to remove not found in container store"); + if (removed == 0) + throw std::runtime_error("Item to remove not found in container store"); + else if (removed < static_cast(count)) + throw std::runtime_error("Not enough items in the stack to remove"); } void InventoryItemModel::update() diff --git a/apps/openmw/mwgui/inventorywindow.cpp b/apps/openmw/mwgui/inventorywindow.cpp index 4f616b312..56c474c89 100644 --- a/apps/openmw/mwgui/inventorywindow.cpp +++ b/apps/openmw/mwgui/inventorywindow.cpp @@ -37,10 +37,6 @@ namespace MWGui , mPreviewDirty(true) , mDragAndDrop(dragAndDrop) , mSelectedItem(-1) - , mPositionInventory(0, 342, 498, 258) - , mPositionContainer(0, 342, 498, 258) - , mPositionCompanion(0, 342, 498, 258) - , mPositionBarter(0, 342, 498, 258) , mGuiMode(GM_Inventory) { static_cast(mMainWidget)->eventWindowChangeCoord += MyGUI::newDelegate(this, &InventoryWindow::onWindowResize); @@ -63,8 +59,6 @@ namespace MWGui mItemView->eventItemClicked += MyGUI::newDelegate(this, &InventoryWindow::onItemSelected); mItemView->eventBackgroundClicked += MyGUI::newDelegate(this, &InventoryWindow::onBackgroundSelected); - updatePlayer(); - mFilterAll->eventMouseButtonClick += MyGUI::newDelegate(this, &InventoryWindow::onFilterChanged); mFilterWeapon->eventMouseButtonClick += MyGUI::newDelegate(this, &InventoryWindow::onFilterChanged); mFilterApparel->eventMouseButtonClick += MyGUI::newDelegate(this, &InventoryWindow::onFilterChanged); @@ -73,10 +67,19 @@ namespace MWGui mFilterAll->setStateSelected(true); - setCoord(mPositionInventory.left, mPositionInventory.top, mPositionInventory.width, mPositionInventory.height); - onWindowResize(static_cast(mMainWidget)); + setGuiMode(mGuiMode); - mPreview.setup(); + adjustPanes(); + } + + void InventoryWindow::adjustPanes() + { + const float aspect = 0.5; // fixed aspect ratio for the left pane + mLeftPane->setSize( (mMainWidget->getSize().height-44) * aspect, mMainWidget->getSize().height-44 ); + mRightPane->setCoord( mLeftPane->getPosition().left + (mMainWidget->getSize().height-44) * aspect + 4, + mRightPane->getPosition().top, + mMainWidget->getSize().width - 12 - (mMainWidget->getSize().height-44) * aspect - 15, + mMainWidget->getSize().height-44 ); } void InventoryWindow::updatePlayer() @@ -91,27 +94,36 @@ namespace MWGui void InventoryWindow::setGuiMode(GuiMode mode) { + std::string setting = "inventory"; mGuiMode = mode; switch(mode) { case GM_Container: setPinButtonVisible(false); - mMainWidget->setCoord(mPositionContainer); + setting += " container"; break; case GM_Companion: setPinButtonVisible(false); - mMainWidget->setCoord(mPositionCompanion); + setting += " companion"; break; case GM_Barter: setPinButtonVisible(false); - mMainWidget->setCoord(mPositionBarter); + setting += " barter"; break; case GM_Inventory: default: setPinButtonVisible(true); - mMainWidget->setCoord(mPositionInventory); break; } - onWindowResize(static_cast(mMainWidget)); + + MyGUI::IntSize viewSize = MyGUI::RenderManager::getInstance().getViewSize(); + MyGUI::IntPoint pos (Settings::Manager::getFloat(setting + " x", "Windows") * viewSize.width, + Settings::Manager::getFloat(setting + " y", "Windows") * viewSize.height); + MyGUI::IntSize size (Settings::Manager::getFloat(setting + " w", "Windows") * viewSize.width, + Settings::Manager::getFloat(setting + " h", "Windows") * viewSize.height); + mMainWidget->setPosition(pos); + mMainWidget->setSize(size); + adjustPanes(); + mPreviewDirty = true; } TradeItemModel* InventoryWindow::getTradeModel() @@ -145,10 +157,38 @@ namespace MWGui const ItemStack& item = mTradeModel->getItem(index); - unequipItem(item.mBase); - MWWorld::Ptr object = item.mBase; int count = item.mCount; + + if (item.mType == ItemStack::Type_Equipped) + { + MWWorld::InventoryStore& invStore = MWWorld::Class::get(mPtr).getInventoryStore(mPtr); + MWWorld::Ptr newStack = *invStore.unequipItem(item.mBase, mPtr); + + // The unequipped item was re-stacked. We have to update the index + // since the item pointed does not exist anymore. + if (item.mBase != newStack) + { + // newIndex will store the index of the ItemStack the item was stacked on + int newIndex = -1; + for (size_t i=0; i < mTradeModel->getItemCount(); ++i) + { + if (mTradeModel->getItem(i).mBase == newStack) + { + newIndex = i; + break; + } + } + + if (newIndex == -1) + throw std::runtime_error("Can't find restacked item"); + + index = newIndex; + object = mTradeModel->getItem(index).mBase; + } + + } + bool shift = MyGUI::InputManager::getInstance().isShiftPressed(); if (MyGUI::InputManager::getInstance().isControlPressed()) count = 1; @@ -225,37 +265,44 @@ namespace MWGui void InventoryWindow::open() { + mPtr = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + updateEncumbranceBar(); mItemView->update(); notifyContentChanged(); + adjustPanes(); } void InventoryWindow::onWindowResize(MyGUI::Window* _sender) { - const float aspect = 0.5; // fixed aspect ratio for the left pane - mLeftPane->setSize( (_sender->getSize().height-44) * aspect, _sender->getSize().height-44 ); - mRightPane->setCoord( mLeftPane->getPosition().left + (_sender->getSize().height-44) * aspect + 4, - mRightPane->getPosition().top, - _sender->getSize().width - 12 - (_sender->getSize().height-44) * aspect - 15, - _sender->getSize().height-44 ); - + adjustPanes(); + std::string setting = "inventory"; switch(mGuiMode) { case GM_Container: - mPositionContainer = _sender->getCoord(); + setting += " container"; break; case GM_Companion: - mPositionCompanion = _sender->getCoord(); + setting += " companion"; break; case GM_Barter: - mPositionBarter = _sender->getCoord(); + setting += " barter"; break; - case GM_Inventory: default: - mPositionInventory = _sender->getCoord(); + break; } + MyGUI::IntSize viewSize = MyGUI::RenderManager::getInstance().getViewSize(); + float x = _sender->getPosition().left / float(viewSize.width); + float y = _sender->getPosition().top / float(viewSize.height); + float w = _sender->getSize().width / float(viewSize.width); + float h = _sender->getSize().height / float(viewSize.height); + Settings::Manager::setFloat(setting + " x", "Windows", x); + Settings::Manager::setFloat(setting + " y", "Windows", y); + Settings::Manager::setFloat(setting + " w", "Windows", w); + Settings::Manager::setFloat(setting + " h", "Windows", h); + if (mMainWidget->getSize().width != mLastXSize || mMainWidget->getSize().height != mLastYSize) { mLastXSize = mMainWidget->getSize().width; @@ -375,27 +422,6 @@ namespace MWGui return MWWorld::Ptr(); } - void InventoryWindow::unequipItem(const MWWorld::Ptr& item) - { - MWWorld::InventoryStore& invStore = MWWorld::Class::get(mPtr).getInventoryStore(mPtr); - - for (int slot=0; slot < MWWorld::InventoryStore::Slots; ++slot) - { - MWWorld::ContainerStoreIterator it = invStore.getSlot(slot); - if (it != invStore.end() && *it == item) - { - invStore.equip(slot, invStore.end()); - std::string script = MWWorld::Class::get(*it).getScript(*it); - - // Unset OnPCEquip Variable on item's script, if it has a script with that variable declared - if(script != "") - (*it).getRefData().getLocals().setVarByInt(script, "onpcequip", 0); - - return; - } - } - } - void InventoryWindow::updateEncumbranceBar() { MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); @@ -450,14 +476,6 @@ namespace MWGui if (MWBase::Environment::get().getWindowManager()->getSpellWindow()) MWBase::Environment::get().getWindowManager()->getSpellWindow()->updateSpells(); - // update selected weapon icon - MWWorld::InventoryStore& invStore = MWWorld::Class::get(mPtr).getInventoryStore(mPtr); - MWWorld::ContainerStoreIterator weaponSlot = invStore.getSlot(MWWorld::InventoryStore::Slot_CarriedRight); - if (weaponSlot == invStore.end()) - MWBase::Environment::get().getWindowManager()->unsetSelectedWeapon(); - else - MWBase::Environment::get().getWindowManager()->setSelectedWeapon(*weaponSlot); - mPreviewDirty = true; mArmorRating->setCaptionWithReplacing ("#{sArmor}: " diff --git a/apps/openmw/mwgui/inventorywindow.hpp b/apps/openmw/mwgui/inventorywindow.hpp index 35140437d..94ecfd4c8 100644 --- a/apps/openmw/mwgui/inventorywindow.hpp +++ b/apps/openmw/mwgui/inventorywindow.hpp @@ -76,11 +76,6 @@ namespace MWGui MyGUI::Button* mFilterMagic; MyGUI::Button* mFilterMisc; - MyGUI::IntCoord mPositionInventory; - MyGUI::IntCoord mPositionContainer; - MyGUI::IntCoord mPositionCompanion; - MyGUI::IntCoord mPositionBarter; - GuiMode mGuiMode; int mLastXSize; @@ -103,9 +98,10 @@ namespace MWGui void onAvatarClicked(MyGUI::Widget* _sender); void onPinToggled(); - void unequipItem(const MWWorld::Ptr& item); void updateEncumbranceBar(); void notifyContentChanged(); + + void adjustPanes(); }; } diff --git a/apps/openmw/mwgui/journalwindow.cpp b/apps/openmw/mwgui/journalwindow.cpp index ab8dc1584..f3c9e9c73 100644 --- a/apps/openmw/mwgui/journalwindow.cpp +++ b/apps/openmw/mwgui/journalwindow.cpp @@ -137,15 +137,28 @@ namespace getPage (QuestsPage)->adviseLinkClicked (callback); } - adjustButton(OptionsBTN); + adjustButton(OptionsBTN, true); adjustButton(PrevPageBTN); adjustButton(NextPageBTN); adjustButton(CloseBTN); adjustButton(CancelBTN); - adjustButton(ShowAllBTN); - adjustButton(ShowActiveBTN); + adjustButton(ShowAllBTN, true); + adjustButton(ShowActiveBTN, true); adjustButton(JournalBTN); + MWGui::ImageButton* optionsButton = getWidget(OptionsBTN); + if (optionsButton->getWidth() == 0) + { + // If tribunal is not installed (-> no options button), we still want the Topics button available, + // so place it where the options button would have been + MWGui::ImageButton* topicsButton = getWidget(TopicsBTN); + topicsButton->detachFromWidget(); + topicsButton->attachToWidget(optionsButton->getParent()); + topicsButton->setPosition(optionsButton->getPosition()); + topicsButton->eventMouseButtonClick.clear(); + topicsButton->eventMouseButtonClick += MyGUI::newDelegate(this, &JournalWindowImpl::notifyOptions); + } + MWGui::ImageButton* nextButton = getWidget(NextPageBTN); if (nextButton->getSize().width == 64) { @@ -155,7 +168,7 @@ namespace } adjustButton(TopicsBTN); - adjustButton(QuestsBTN); + adjustButton(QuestsBTN, true); int width = getWidget(TopicsBTN)->getSize().width + getWidget(QuestsBTN)->getSize().width; int topicsWidth = getWidget(TopicsBTN)->getSize().width; int pageWidth = getWidget(RightBookPage)->getSize().width; @@ -167,12 +180,12 @@ namespace mAllQuests = false; } - void adjustButton (char const * name) + void adjustButton (char const * name, bool optional = false) { MWGui::ImageButton* button = getWidget(name); - MyGUI::IntSize diff = button->getSize() - button->getRequestedSize(); - button->setSize(button->getRequestedSize()); + MyGUI::IntSize diff = button->getSize() - button->getRequestedSize(!optional); + button->setSize(button->getRequestedSize(!optional)); if (button->getAlign().isRight()) button->setPosition(button->getPosition() + MyGUI::IntPoint(diff.width,0)); diff --git a/apps/openmw/mwgui/loadingscreen.cpp b/apps/openmw/mwgui/loadingscreen.cpp index 4bd383c2f..868b58209 100644 --- a/apps/openmw/mwgui/loadingscreen.cpp +++ b/apps/openmw/mwgui/loadingscreen.cpp @@ -1,8 +1,6 @@ #include "loadingscreen.hpp" #include -#include -#include #include @@ -199,28 +197,7 @@ namespace MWGui MWBase::Environment::get().getInputManager()->update(0, true); - Ogre::CompositorChain* chain = Ogre::CompositorManager::getSingleton().getCompositorChain(mWindow->getViewport(0)); - - bool hasCompositor = chain->getCompositor ("gbufferFinalizer"); - - - if (!hasCompositor) - { - mWindow->getViewport(0)->setClearEveryFrame(false); - } - else - { - if (!mFirstLoad) - { - mBackgroundMaterial->getTechnique(0)->getPass(0)->getTextureUnitState(0)->setTextureName(chain->getCompositor ("gbufferFinalizer")->getTextureInstance ("no_mrt_output", 0)->getName()); - mRectangle->setVisible(true); - } - - for (unsigned int i = 0; igetNumCompositors(); ++i) - { - Ogre::CompositorManager::getSingleton().setCompositorEnabled(mWindow->getViewport(0), chain->getCompositor(i)->getCompositor()->getName(), false); - } - } + mWindow->getViewport(0)->setClearEveryFrame(false); // First, swap buffers from last draw, then, queue an update of the // window contents, but don't swap buffers (which would have @@ -231,15 +208,8 @@ namespace MWGui mWindow->update(false); - if (!hasCompositor) - mWindow->getViewport(0)->setClearEveryFrame(true); - else - { - for (unsigned int i = 0; igetNumCompositors(); ++i) - { - Ogre::CompositorManager::getSingleton().setCompositorEnabled(mWindow->getViewport(0), chain->getCompositor(i)->getCompositor()->getName(), true); - } - } + mWindow->getViewport(0)->setClearEveryFrame(true); + mRectangle->setVisible(false); diff --git a/apps/openmw/mwgui/mainmenu.cpp b/apps/openmw/mwgui/mainmenu.cpp index 1db6e9ecd..fa7ed2ace 100644 --- a/apps/openmw/mwgui/mainmenu.cpp +++ b/apps/openmw/mwgui/mainmenu.cpp @@ -9,6 +9,8 @@ #include "../mwbase/journal.hpp" #include "../mwbase/dialoguemanager.hpp" +#include "savegamedialog.hpp" + namespace MWGui { @@ -77,7 +79,7 @@ namespace MWGui else if (sender == mButtons["options"]) MWBase::Environment::get().getWindowManager ()->pushGuiMode (GM_Settings); else if (sender == mButtons["exitgame"]) - Ogre::Root::getSingleton ().queueEndRendering (); + MWBase::Environment::get().setRequestExit(); else if (sender == mButtons["newgame"]) { MWBase::Environment::get().getWorld()->startNewGame(); @@ -85,6 +87,19 @@ namespace MWGui MWBase::Environment::get().getDialogueManager()->clear(); MWBase::Environment::get().getJournal()->clear(); } + + else if (sender == mButtons["loadgame"]) + { + MWGui::SaveGameDialog* dialog = new MWGui::SaveGameDialog(); + dialog->setLoadOrSave(true); + dialog->setVisible(true); + } + else if (sender == mButtons["savegame"]) + { + MWGui::SaveGameDialog* dialog = new MWGui::SaveGameDialog(); + dialog->setLoadOrSave(false); + dialog->setVisible(true); + } } } diff --git a/apps/openmw/mwgui/mapwindow.cpp b/apps/openmw/mwgui/mapwindow.cpp index 5ed002d7b..93e1d11a3 100644 --- a/apps/openmw/mwgui/mapwindow.cpp +++ b/apps/openmw/mwgui/mapwindow.cpp @@ -261,6 +261,7 @@ namespace MWGui : MWGui::WindowPinnableBase("openmw_map_window.layout") , mGlobal(false) , mGlobalMap(0) + , mGlobalMapRender(0) { setCoord(500,0,320,300); diff --git a/apps/openmw/mwgui/merchantrepair.cpp b/apps/openmw/mwgui/merchantrepair.cpp index 530594dda..4da166820 100644 --- a/apps/openmw/mwgui/merchantrepair.cpp +++ b/apps/openmw/mwgui/merchantrepair.cpp @@ -13,7 +13,6 @@ #include "../mwworld/containerstore.hpp" #include "inventorywindow.hpp" -#include "tradewindow.hpp" namespace MWGui { @@ -119,7 +118,9 @@ void MerchantRepair::onRepairButtonClick(MyGUI::Widget *sender) MWBase::Environment::get().getSoundManager()->playSound("Repair",1,1); int price = boost::lexical_cast(sender->getUserString("Price")); - MWBase::Environment::get().getWindowManager()->getTradeWindow()->addOrRemoveGold(-price); + + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + player.getClass().getContainerStore(player).remove("gold_001", price, player); startRepair(mActor); } diff --git a/apps/openmw/mwgui/messagebox.cpp b/apps/openmw/mwgui/messagebox.cpp index 48d7ec171..671845552 100644 --- a/apps/openmw/mwgui/messagebox.cpp +++ b/apps/openmw/mwgui/messagebox.cpp @@ -10,7 +10,6 @@ namespace MWGui MessageBoxManager::MessageBoxManager () { - // defines mMessageBoxSpeed = 0.1; mInterMessageBoxe = NULL; mStaticMessageBox = NULL; @@ -19,47 +18,26 @@ namespace MWGui void MessageBoxManager::onFrame (float frameDuration) { - std::vector::iterator it; - for(it = mTimers.begin(); it != mTimers.end();) + std::vector::iterator it; + for(it = mMessageBoxes.begin(); it != mMessageBoxes.end();) { - // if this messagebox is already deleted, remove the timer and move on - if (std::find(mMessageBoxes.begin(), mMessageBoxes.end(), it->messageBox) == mMessageBoxes.end()) + (*it)->mCurrentTime += frameDuration; + if((*it)->mCurrentTime >= (*it)->mMaxTime && *it != mStaticMessageBox) { - it = mTimers.erase(it); - continue; - } - - it->current += frameDuration; - if(it->current >= it->max) - { - it->messageBox->mMarkedToDelete = true; - - if(*mMessageBoxes.begin() == it->messageBox) // if this box is the last one - { - // collect all with mMarkedToDelete and delete them. - // and place the other messageboxes on the right position - int height = 0; - std::vector::iterator it2 = mMessageBoxes.begin(); - while(it2 != mMessageBoxes.end()) - { - if((*it2)->mMarkedToDelete) - { - delete (*it2); - it2 = mMessageBoxes.erase(it2); - } - else { - (*it2)->update(height); - height += (*it2)->getHeight(); - ++it2; - } - } - } - it = mTimers.erase(it); + delete *it; + it = mMessageBoxes.erase(it); } else - { ++it; - } + } + + float height = 0; + it = mMessageBoxes.begin(); + while(it != mMessageBoxes.end()) + { + (*it)->update(height); + height += (*it)->getHeight(); + ++it; } if(mInterMessageBoxe != NULL && mInterMessageBoxe->mMarkedToDelete) { @@ -74,14 +52,13 @@ namespace MWGui void MessageBoxManager::createMessageBox (const std::string& message, bool stat) { MessageBox *box = new MessageBox(*this, message); + box->mCurrentTime = 0; + box->mMaxTime = message.length()*mMessageBoxSpeed; if(stat) mStaticMessageBox = box; - else - removeMessageBox(message.length()*mMessageBoxSpeed, box); mMessageBoxes.push_back(box); - std::vector::iterator it; if(mMessageBoxes.size() > 3) { delete *mMessageBoxes.begin(); @@ -89,7 +66,7 @@ namespace MWGui } int height = 0; - for(it = mMessageBoxes.begin(); it != mMessageBoxes.end(); ++it) + for(std::vector::iterator it = mMessageBoxes.begin(); it != mMessageBoxes.end(); ++it) { (*it)->update(height); height += (*it)->getHeight(); @@ -119,15 +96,6 @@ namespace MWGui return mInterMessageBoxe != NULL; } - void MessageBoxManager::removeMessageBox (float time, MessageBox *msgbox) - { - MessageBoxManagerTimer timer; - timer.current = 0; - timer.max = time; - timer.messageBox = msgbox; - - mTimers.insert(mTimers.end(), timer); - } bool MessageBoxManager::removeMessageBox (MessageBox *msgbox) { @@ -169,56 +137,32 @@ namespace MWGui : Layout("openmw_messagebox.layout") , mMessageBoxManager(parMessageBoxManager) , mMessage(message) + , mCurrentTime(0) + , mMaxTime(0) { // defines - mFixedWidth = 300; mBottomPadding = 20; mNextBoxPadding = 20; - mMarkedToDelete = false; getWidget(mMessageWidget, "message"); mMessageWidget->setOverflowToTheLeft(true); mMessageWidget->setCaptionWithReplacing(mMessage); - - MyGUI::IntSize size; - size.width = mFixedWidth; - size.height = 100; // dummy - - MyGUI::IntCoord coord; - coord.left = 10; // dummy - coord.top = 10; // dummy - - mMessageWidget->setSize(size); - - MyGUI::IntSize textSize = mMessageWidget->getTextSize(); - - size.height = mHeight = textSize.height + 20; // this is the padding between the text and the box - - mMainWidget->setSize(size); - size.width -= 15; // this is to center the text (see messagebox.layout, Widget type="Edit" position="-2 -3 0 0") - mMessageWidget->setSize(size); } void MessageBox::update (int height) { MyGUI::IntSize gameWindowSize = MyGUI::RenderManager::getInstance().getViewSize(); - MyGUI::IntCoord coord; - coord.left = (gameWindowSize.width - mFixedWidth)/2; - coord.top = (gameWindowSize.height - mHeight - height - mBottomPadding); + MyGUI::IntPoint pos; + pos.left = (gameWindowSize.width - mMainWidget->getWidth())/2; + pos.top = (gameWindowSize.height - mMainWidget->getHeight() - height - mBottomPadding); - MyGUI::IntSize size; - size.width = mFixedWidth; - size.height = mHeight; - - mMainWidget->setCoord(coord); - mMainWidget->setSize(size); - mMainWidget->setVisible(true); + mMainWidget->setPosition(pos); } int MessageBox::getHeight () { - return mHeight+mNextBoxPadding; // 20 is the padding between this and the next MessageBox + return mMainWidget->getHeight()+mNextBoxPadding; // 20 is the padding between this and the next MessageBox } diff --git a/apps/openmw/mwgui/messagebox.hpp b/apps/openmw/mwgui/messagebox.hpp index 63840cfe2..aac4704fa 100644 --- a/apps/openmw/mwgui/messagebox.hpp +++ b/apps/openmw/mwgui/messagebox.hpp @@ -19,13 +19,6 @@ namespace MWGui class InteractiveMessageBox; class MessageBoxManager; class MessageBox; - - struct MessageBoxManagerTimer { - float current; - float max; - MessageBox *messageBox; - }; - class MessageBoxManager { public: @@ -36,7 +29,6 @@ namespace MWGui bool createInteractiveMessageBox (const std::string& message, const std::vector& buttons); bool isInteractiveMessageBox (); - void removeMessageBox (float time, MessageBox *msgbox); bool removeMessageBox (MessageBox *msgbox); void setMessageBoxSpeed (int speed); @@ -54,7 +46,6 @@ namespace MWGui std::vector mMessageBoxes; InteractiveMessageBox* mInterMessageBoxe; MessageBox* mStaticMessageBox; - std::vector mTimers; float mMessageBoxSpeed; int mLastButtonPressed; }; @@ -67,14 +58,13 @@ namespace MWGui int getHeight (); void update (int height); - bool mMarkedToDelete; + float mCurrentTime; + float mMaxTime; protected: MessageBoxManager& mMessageBoxManager; - int mHeight; const std::string& mMessage; MyGUI::EditBox* mMessageWidget; - int mFixedWidth; int mBottomPadding; int mNextBoxPadding; }; diff --git a/apps/openmw/mwgui/mode.hpp b/apps/openmw/mwgui/mode.hpp index 879fcb483..50d53abac 100644 --- a/apps/openmw/mwgui/mode.hpp +++ b/apps/openmw/mwgui/mode.hpp @@ -28,6 +28,7 @@ namespace MWGui GM_Travel, GM_SpellCreation, GM_Enchanting, + GM_Recharge, GM_Training, GM_MerchantRepair, diff --git a/apps/openmw/mwgui/quickkeysmenu.cpp b/apps/openmw/mwgui/quickkeysmenu.cpp index 5f749d3d3..395676649 100644 --- a/apps/openmw/mwgui/quickkeysmenu.cpp +++ b/apps/openmw/mwgui/quickkeysmenu.cpp @@ -5,7 +5,7 @@ #include "../mwworld/player.hpp" #include "../mwworld/inventorystore.hpp" #include "../mwworld/actionequip.hpp" -#include "../mwmechanics/spellsuccess.hpp" +#include "../mwmechanics/spellcasting.hpp" #include "../mwgui/inventorywindow.hpp" #include "../mwgui/bookwindow.hpp" #include "../mwgui/scrollwindow.hpp" @@ -284,8 +284,9 @@ namespace MWGui MWWorld::Ptr item = *button->getChildAt (0)->getUserData(); // make sure the item is available - if (item.getRefData ().getCount() == 0) + if (item.getRefData ().getCount() < 1) { + // TODO: Try to find a replacement with the same ID? MWBase::Environment::get().getWindowManager ()->messageBox ( "#{sQuickMenu5} " + MWWorld::Class::get(item).getName(item)); return; diff --git a/apps/openmw/mwgui/recharge.cpp b/apps/openmw/mwgui/recharge.cpp new file mode 100644 index 000000000..b700360ba --- /dev/null +++ b/apps/openmw/mwgui/recharge.cpp @@ -0,0 +1,196 @@ +#include "recharge.hpp" + +#include +#include + +#include "../mwbase/world.hpp" +#include "../mwbase/environment.hpp" +#include "../mwbase/windowmanager.hpp" + +#include "../mwworld/player.hpp" +#include "../mwworld/containerstore.hpp" +#include "../mwworld/class.hpp" + +#include "../mwmechanics/creaturestats.hpp" +#include "../mwmechanics/npcstats.hpp" + +#include "widgets.hpp" + +namespace MWGui +{ + +Recharge::Recharge() + : WindowBase("openmw_recharge_dialog.layout") +{ + getWidget(mBox, "Box"); + getWidget(mView, "View"); + getWidget(mGemBox, "GemBox"); + getWidget(mGemIcon, "GemIcon"); + getWidget(mChargeLabel, "ChargeLabel"); + getWidget(mCancelButton, "CancelButton"); + + mCancelButton->eventMouseButtonClick += MyGUI::newDelegate(this, &Recharge::onCancel); + + setVisible(false); +} + +void Recharge::open() +{ + center(); +} + +void Recharge::start (const MWWorld::Ptr &item) +{ + std::string path = std::string("icons\\"); + path += MWWorld::Class::get(item).getInventoryIcon(item); + int pos = path.rfind("."); + path.erase(pos); + path.append(".dds"); + mGemIcon->setImageTexture (path); + mGemIcon->setUserString("ToolTipType", "ItemPtr"); + mGemIcon->setUserData(item); + + updateView(); +} + +void Recharge::updateView() +{ + MWWorld::Ptr gem = *mGemIcon->getUserData(); + + std::string soul = gem.getCellRef().mSoul; + const ESM::Creature *creature = MWBase::Environment::get().getWorld()->getStore().get().find(soul); + + mChargeLabel->setCaptionWithReplacing("#{sCharges} " + boost::lexical_cast(creature->mData.mSoul)); + + bool toolBoxVisible = (gem.getRefData().getCount() != 0); + mGemBox->setVisible(toolBoxVisible); + + bool toolBoxWasVisible = (mBox->getPosition().top != mGemBox->getPosition().top); + + if (toolBoxVisible && !toolBoxWasVisible) + { + // shrink + mBox->setPosition(mBox->getPosition() + MyGUI::IntPoint(0, mGemBox->getSize().height)); + mBox->setSize(mBox->getSize() - MyGUI::IntSize(0,mGemBox->getSize().height)); + } + else if (!toolBoxVisible && toolBoxWasVisible) + { + // expand + mBox->setPosition(MyGUI::IntPoint (mBox->getPosition().left, mGemBox->getPosition().top)); + mBox->setSize(mBox->getSize() + MyGUI::IntSize(0,mGemBox->getSize().height)); + } + + while (mView->getChildCount()) + MyGUI::Gui::getInstance().destroyWidget(mView->getChildAt(0)); + + int currentY = 0; + + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + MWWorld::ContainerStore& store = MWWorld::Class::get(player).getContainerStore(player); + for (MWWorld::ContainerStoreIterator iter (store.begin()); + iter!=store.end(); ++iter) + { + std::string enchantmentName = iter->getClass().getEnchantment(*iter); + if (enchantmentName.empty()) + continue; + const ESM::Enchantment* enchantment = MWBase::Environment::get().getWorld()->getStore().get().find(enchantmentName); + if (iter->getCellRef().mEnchantmentCharge >= enchantment->mData.mCharge + || iter->getCellRef().mEnchantmentCharge == -1) + continue; + + MyGUI::TextBox* text = mView->createWidget ( + "SandText", MyGUI::IntCoord(8, currentY, mView->getWidth()-8, 18), MyGUI::Align::Default); + text->setCaption(MWWorld::Class::get(*iter).getName(*iter)); + text->setNeedMouseFocus(false); + currentY += 19; + + MyGUI::ImageBox* icon = mView->createWidget ( + "ImageBox", MyGUI::IntCoord(16, currentY, 32, 32), MyGUI::Align::Default); + std::string path = std::string("icons\\"); + path += MWWorld::Class::get(*iter).getInventoryIcon(*iter); + int pos = path.rfind("."); + path.erase(pos); + path.append(".dds"); + icon->setImageTexture (path); + icon->setUserString("ToolTipType", "ItemPtr"); + icon->setUserData(*iter); + icon->eventMouseButtonClick += MyGUI::newDelegate(this, &Recharge::onItemClicked); + icon->eventMouseWheel += MyGUI::newDelegate(this, &Recharge::onMouseWheel); + + Widgets::MWDynamicStatPtr chargeWidget = mView->createWidget + ("MW_ChargeBar", MyGUI::IntCoord(72, currentY+2, 199, 20), MyGUI::Align::Default); + chargeWidget->setValue(iter->getCellRef().mEnchantmentCharge, enchantment->mData.mCharge); + chargeWidget->setNeedMouseFocus(false); + + currentY += 32 + 4; + } + mView->setCanvasSize (MyGUI::IntSize(mView->getWidth(), std::max(mView->getHeight(), currentY))); +} + +void Recharge::onCancel(MyGUI::Widget *sender) +{ + MWBase::Environment::get().getWindowManager()->removeGuiMode(GM_Recharge); +} + +void Recharge::onItemClicked(MyGUI::Widget *sender) +{ + MWWorld::Ptr gem = *mGemIcon->getUserData(); + + if (!gem.getRefData().getCount()) + return; + + MWWorld::Ptr item = *sender->getUserData(); + + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + MWMechanics::CreatureStats& stats = player.getClass().getCreatureStats(player); + MWMechanics::NpcStats& npcStats = player.getClass().getNpcStats(player); + + float luckTerm = 0.1 * stats.getAttribute(ESM::Attribute::Luck).getModified(); + if (luckTerm < 1|| luckTerm > 10) + luckTerm = 1; + + float intelligenceTerm = 0.2 * stats.getAttribute(ESM::Attribute::Intelligence).getModified(); + + if (intelligenceTerm > 20) + intelligenceTerm = 20; + if (intelligenceTerm < 1) + intelligenceTerm = 1; + + float x = (npcStats.getSkill(ESM::Skill::Enchant).getModified() + intelligenceTerm + luckTerm) * stats.getFatigueTerm(); + int roll = std::rand()/ (static_cast (RAND_MAX) + 1) * 100; // [0, 99] + if (roll < x) + { + std::string soul = gem.getCellRef().mSoul; + const ESM::Creature *creature = MWBase::Environment::get().getWorld()->getStore().get().find(soul); + + float restored = creature->mData.mSoul * (roll / x); + + const ESM::Enchantment* enchantment = MWBase::Environment::get().getWorld()->getStore().get().find( + item.getClass().getEnchantment(item)); + item.getCellRef().mEnchantmentCharge = + std::min(item.getCellRef().mEnchantmentCharge + restored, static_cast(enchantment->mData.mCharge)); + + player.getClass().skillUsageSucceeded (player, ESM::Skill::Enchant, 0); + } + + gem.getContainerStore()->remove(gem, 1, player); + + if (gem.getRefData().getCount() == 0) + { + std::string message = MWBase::Environment::get().getWorld()->getStore().get().find("sNotifyMessage51")->getString(); + message = boost::str(boost::format(message) % gem.getClass().getName(gem)); + MWBase::Environment::get().getWindowManager()->messageBox(message); + } + + updateView(); +} + +void Recharge::onMouseWheel(MyGUI::Widget* _sender, int _rel) +{ + if (mView->getViewOffset().top + _rel*0.3 > 0) + mView->setViewOffset(MyGUI::IntPoint(0, 0)); + else + mView->setViewOffset(MyGUI::IntPoint(0, mView->getViewOffset().top + _rel*0.3)); +} + +} diff --git a/apps/openmw/mwgui/recharge.hpp b/apps/openmw/mwgui/recharge.hpp new file mode 100644 index 000000000..2ffc5e10f --- /dev/null +++ b/apps/openmw/mwgui/recharge.hpp @@ -0,0 +1,42 @@ +#ifndef OPENMW_MWGUI_RECHARGE_H +#define OPENMW_MWGUI_RECHARGE_H + +#include "windowbase.hpp" + +#include "../mwworld/ptr.hpp" + +namespace MWGui +{ + +class Recharge : public WindowBase +{ +public: + Recharge(); + + virtual void open(); + + void start (const MWWorld::Ptr& gem); + +protected: + MyGUI::Widget* mBox; + MyGUI::ScrollView* mView; + + MyGUI::Widget* mGemBox; + + MyGUI::ImageBox* mGemIcon; + + MyGUI::TextBox* mChargeLabel; + + MyGUI::Button* mCancelButton; + + void updateView(); + + void onItemClicked (MyGUI::Widget* sender); + void onCancel (MyGUI::Widget* sender); + void onMouseWheel(MyGUI::Widget* _sender, int _rel); + +}; + +} + +#endif diff --git a/apps/openmw/mwgui/savegamedialog.cpp b/apps/openmw/mwgui/savegamedialog.cpp new file mode 100644 index 000000000..a1acd3588 --- /dev/null +++ b/apps/openmw/mwgui/savegamedialog.cpp @@ -0,0 +1,49 @@ +#include "savegamedialog.hpp" +#include "widgets.hpp" + + +namespace MWGui +{ + + SaveGameDialog::SaveGameDialog() + : WindowModal("openmw_savegame_dialog.layout") + { + getWidget(mScreenshot, "Screenshot"); + getWidget(mCharacterSelection, "SelectCharacter"); + getWidget(mInfoText, "InfoText"); + getWidget(mOkButton, "OkButton"); + getWidget(mCancelButton, "CancelButton"); + getWidget(mSaveList, "SaveList"); + getWidget(mSaveNameEdit, "SaveNameEdit"); + getWidget(mSpacer, "Spacer"); + mOkButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SaveGameDialog::onOkButtonClicked); + mCancelButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SaveGameDialog::onCancelButtonClicked); + + } + + void SaveGameDialog::open() + { + center(); + } + + void SaveGameDialog::setLoadOrSave(bool load) + { + mSaveNameEdit->setVisible(!load); + mCharacterSelection->setUserString("Hidden", load ? "false" : "true"); + mCharacterSelection->setVisible(load); + mSpacer->setUserString("Hidden", load ? "false" : "true"); + + center(); + } + + void SaveGameDialog::onCancelButtonClicked(MyGUI::Widget *sender) + { + setVisible(false); + } + + void SaveGameDialog::onOkButtonClicked(MyGUI::Widget *sender) + { + setVisible(false); + } + +} diff --git a/apps/openmw/mwgui/savegamedialog.hpp b/apps/openmw/mwgui/savegamedialog.hpp new file mode 100644 index 000000000..1a3178ef3 --- /dev/null +++ b/apps/openmw/mwgui/savegamedialog.hpp @@ -0,0 +1,37 @@ +#ifndef OPENMW_MWGUI_SAVEGAMEDIALOG_H +#define OPENMW_MWGUI_SAVEGAMEDIALOG_H + +#include "windowbase.hpp" + +namespace MWGui +{ + + class SaveGameDialog : public MWGui::WindowModal + { + public: + SaveGameDialog(); + + virtual void open(); + + void setLoadOrSave(bool load); + + void onCancelButtonClicked (MyGUI::Widget* sender); + void onOkButtonClicked (MyGUI::Widget* sender); + + + private: + MyGUI::ImageBox* mScreenshot; + + MyGUI::ComboBox* mCharacterSelection; + MyGUI::EditBox* mInfoText; + MyGUI::Button* mOkButton; + MyGUI::Button* mCancelButton; + MyGUI::ListBox* mSaveList; + MyGUI::EditBox* mSaveNameEdit; + MyGUI::Widget* mSpacer; + + }; + +} + +#endif diff --git a/apps/openmw/mwgui/settingswindow.cpp b/apps/openmw/mwgui/settingswindow.cpp index 923b9d01d..1969c5651 100644 --- a/apps/openmw/mwgui/settingswindow.cpp +++ b/apps/openmw/mwgui/settingswindow.cpp @@ -31,9 +31,7 @@ namespace std::string textureFilteringToStr(const std::string& val) { - if (val == "none") - return "None"; - else if (val == "anisotropic") + if (val == "anisotropic") return "Anisotropic"; else if (val == "bilinear") return "Bilinear"; @@ -145,7 +143,7 @@ namespace MWGui mReflectObjectsButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); mReflectTerrainButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); mReflectActorsButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); - mTextureFilteringButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onTextureFilteringToggled); + mTextureFilteringButton->eventComboChangePosition += MyGUI::newDelegate(this, &SettingsWindow::onTextureFilteringChanged); mVSyncButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); mFPSButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onFpsToggled); mMenuTransparencySlider->eventScrollChangePosition += MyGUI::newDelegate(this, &SettingsWindow::onSliderChangePosition); @@ -157,7 +155,7 @@ namespace MWGui mShadowsEnabledButton->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); mShadowsLargeDistance->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); - mShadowsTextureSize->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onShadowTextureSize); + mShadowsTextureSize->eventComboChangePosition += MyGUI::newDelegate(this, &SettingsWindow::onShadowTextureSizeChanged); mActorShadows->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); mStaticsShadows->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); mMiscShadows->eventMouseButtonClick += MyGUI::newDelegate(this, &SettingsWindow::onButtonToggled); @@ -297,22 +295,9 @@ namespace MWGui mResolutionList->setIndexSelected(MyGUI::ITEM_NONE); } - void SettingsWindow::onShadowTextureSize(MyGUI::Widget* _sender) + void SettingsWindow::onShadowTextureSizeChanged(MyGUI::ComboBox *_sender, size_t pos) { - std::string size = mShadowsTextureSize->getCaption(); - - if (size == "512") - size = "1024"; - else if (size == "1024") - size = "2048"; - else if (size == "2048") - size = "4096"; - else - size = "512"; - - mShadowsTextureSize->setCaption(size); - - Settings::Manager::setString("texture size", "Shadows", size); + Settings::Manager::setString("texture size", "Shadows", _sender->getItemNameAt(pos)); apply(); } @@ -482,22 +467,9 @@ namespace MWGui apply(); } - void SettingsWindow::onTextureFilteringToggled(MyGUI::Widget* _sender) + void SettingsWindow::onTextureFilteringChanged(MyGUI::ComboBox* _sender, size_t pos) { - std::string current = Settings::Manager::getString("texture filtering", "General"); - std::string next; - if (current == "none") - next = "bilinear"; - else if (current == "bilinear") - next = "trilinear"; - else if (current == "trilinear") - next = "anisotropic"; - else - next = "none"; - - mTextureFilteringButton->setCaption(textureFilteringToStr(next)); - - Settings::Manager::setString("texture filtering", "General", next); + Settings::Manager::setString("texture filtering", "General", Misc::StringUtils::lowerCase(_sender->getItemNameAt(pos))); apply(); } diff --git a/apps/openmw/mwgui/settingswindow.hpp b/apps/openmw/mwgui/settingswindow.hpp index a585bda7e..c81a86ab0 100644 --- a/apps/openmw/mwgui/settingswindow.hpp +++ b/apps/openmw/mwgui/settingswindow.hpp @@ -42,7 +42,7 @@ namespace MWGui MyGUI::ScrollBar* mViewDistanceSlider; MyGUI::ScrollBar* mFOVSlider; MyGUI::ScrollBar* mAnisotropySlider; - MyGUI::Button* mTextureFilteringButton; + MyGUI::ComboBox* mTextureFilteringButton; MyGUI::TextBox* mAnisotropyLabel; MyGUI::Widget* mAnisotropyBox; MyGUI::Button* mWaterShaderButton; @@ -55,7 +55,7 @@ namespace MWGui MyGUI::Button* mShadowsEnabledButton; MyGUI::Button* mShadowsLargeDistance; - MyGUI::Button* mShadowsTextureSize; + MyGUI::ComboBox* mShadowsTextureSize; MyGUI::Button* mActorShadows; MyGUI::Button* mStaticsShadows; MyGUI::Button* mMiscShadows; @@ -76,7 +76,7 @@ namespace MWGui void onOkButtonClicked(MyGUI::Widget* _sender); void onFpsToggled(MyGUI::Widget* _sender); - void onTextureFilteringToggled(MyGUI::Widget* _sender); + void onTextureFilteringChanged(MyGUI::ComboBox* _sender, size_t pos); void onSliderChangePosition(MyGUI::ScrollBar* scroller, size_t pos); void onButtonToggled(MyGUI::Widget* _sender); void onResolutionSelected(MyGUI::ListBox* _sender, size_t index); @@ -85,7 +85,7 @@ namespace MWGui void onShadersToggled(MyGUI::Widget* _sender); void onShaderModeToggled(MyGUI::Widget* _sender); - void onShadowTextureSize(MyGUI::Widget* _sender); + void onShadowTextureSizeChanged(MyGUI::ComboBox* _sender, size_t pos); void onRebindAction(MyGUI::Widget* _sender); void onInputTabMouseWheel(MyGUI::Widget* _sender, int _rel); diff --git a/apps/openmw/mwgui/soulgemdialog.cpp b/apps/openmw/mwgui/soulgemdialog.cpp index b95eec0b6..6d70c85d9 100644 --- a/apps/openmw/mwgui/soulgemdialog.cpp +++ b/apps/openmw/mwgui/soulgemdialog.cpp @@ -21,7 +21,8 @@ namespace MWGui { if (button == 0) { - /// \todo show recharge enchanted item dialog here + MWBase::Environment::get().getWindowManager()->pushGuiMode(GM_Recharge); + MWBase::Environment::get().getWindowManager()->startRecharge(mSoulgem); } else { diff --git a/apps/openmw/mwgui/spellbuyingwindow.cpp b/apps/openmw/mwgui/spellbuyingwindow.cpp index a7fcfdd02..bbd28b2de 100644 --- a/apps/openmw/mwgui/spellbuyingwindow.cpp +++ b/apps/openmw/mwgui/spellbuyingwindow.cpp @@ -10,11 +10,11 @@ #include "../mwworld/player.hpp" #include "../mwworld/class.hpp" +#include "../mwworld/containerstore.hpp" #include "../mwmechanics/creaturestats.hpp" #include "inventorywindow.hpp" -#include "tradewindow.hpp" namespace MWGui { @@ -123,7 +123,7 @@ namespace MWGui MWMechanics::CreatureStats& stats = MWWorld::Class::get(player).getCreatureStats(player); MWMechanics::Spells& spells = stats.getSpells(); spells.add (mSpellsWidgetMap.find(_sender)->second); - MWBase::Environment::get().getWindowManager()->getTradeWindow()->addOrRemoveGold(-price); + player.getClass().getContainerStore(player).remove("gold_001", price, player); startSpellBuying(mPtr); MWBase::Environment::get().getSoundManager()->playSound ("Item Gold Up", 1.0, 1.0); diff --git a/apps/openmw/mwgui/spellcreationdialog.cpp b/apps/openmw/mwgui/spellcreationdialog.cpp index dc86fd825..b9324fea1 100644 --- a/apps/openmw/mwgui/spellcreationdialog.cpp +++ b/apps/openmw/mwgui/spellcreationdialog.cpp @@ -8,13 +8,13 @@ #include "../mwbase/mechanicsmanager.hpp" #include "../mwworld/player.hpp" +#include "../mwworld/containerstore.hpp" -#include "../mwmechanics/spellsuccess.hpp" +#include "../mwmechanics/spellcasting.hpp" #include "tooltips.hpp" #include "class.hpp" #include "inventorywindow.hpp" -#include "tradewindow.hpp" namespace { @@ -89,6 +89,8 @@ namespace MWGui mEffect.mMagnMax = 1; mEffect.mDuration = 1; mEffect.mArea = 0; + mEffect.mSkill = -1; + mEffect.mAttribute = -1; eventEffectAdded(mEffect); onRangeButtonClicked(mRangeButton); @@ -340,13 +342,14 @@ namespace MWGui mSpell.mName = mNameEdit->getCaption(); - MWBase::Environment::get().getWindowManager()->getTradeWindow()->addOrRemoveGold(-boost::lexical_cast(mPriceLabel->getCaption())); + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + + player.getClass().getContainerStore(player).remove("gold_001", boost::lexical_cast(mPriceLabel->getCaption()), player); MWBase::Environment::get().getSoundManager()->playSound ("Item Gold Up", 1.0, 1.0); const ESM::Spell* spell = MWBase::Environment::get().getWorld()->createRecord(mSpell); - MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); MWMechanics::CreatureStats& stats = MWWorld::Class::get(player).getCreatureStats(player); MWMechanics::Spells& spells = stats.getSpells(); spells.add (spell->mId); diff --git a/apps/openmw/mwgui/spellicons.cpp b/apps/openmw/mwgui/spellicons.cpp index 0c303485a..e93e96c4b 100644 --- a/apps/openmw/mwgui/spellicons.cpp +++ b/apps/openmw/mwgui/spellicons.cpp @@ -21,120 +21,41 @@ namespace MWGui { + void EffectSourceVisitor::visit (MWMechanics::EffectKey key, + const std::string& sourceName, float magnitude, float remainingTime) + { + MagicEffectInfo newEffectSource; + newEffectSource.mKey = key; + newEffectSource.mMagnitude = magnitude; + newEffectSource.mPermanent = mIsPermanent; + newEffectSource.mRemainingTime = remainingTime; + newEffectSource.mSource = sourceName; + + mEffectSources[key.mId].push_back(newEffectSource); + } + + void SpellIcons::updateWidgets(MyGUI::Widget *parent, bool adjustSize) { + // TODO: Tracking add/remove/expire would be better than force updating every frame + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); const MWMechanics::CreatureStats& stats = MWWorld::Class::get(player).getCreatureStats(player); - std::map > effects; - // add permanent item enchantments + EffectSourceVisitor visitor; + + // permanent item enchantments & permanent spells + visitor.mIsPermanent = true; MWWorld::InventoryStore& store = MWWorld::Class::get(player).getInventoryStore(player); - for (int slot = 0; slot < MWWorld::InventoryStore::Slots; ++slot) - { - MWWorld::ContainerStoreIterator it = store.getSlot(slot); - if (it == store.end()) - continue; - std::string enchantment = MWWorld::Class::get(*it).getEnchantment(*it); - if (enchantment.empty()) - continue; - const ESM::Enchantment* enchant = MWBase::Environment::get().getWorld()->getStore().get().find(enchantment); - if (enchant->mData.mType != ESM::Enchantment::ConstantEffect) - continue; + store.visitEffectSources(visitor); + stats.getSpells().visitEffectSources(visitor); - const ESM::EffectList& list = enchant->mEffects; - for (std::vector::const_iterator effectIt = list.mList.begin(); - effectIt != list.mList.end(); ++effectIt) - { - const ESM::MagicEffect* magicEffect = - MWBase::Environment::get().getWorld ()->getStore ().get().find(effectIt->mEffectID); + // now add lasting effects + visitor.mIsPermanent = false; + stats.getActiveSpells().visitEffectSources(visitor); - MagicEffectInfo effectInfo; - effectInfo.mSource = MWWorld::Class::get(*it).getName(*it); - effectInfo.mKey = MWMechanics::EffectKey (effectIt->mEffectID); - if (magicEffect->mData.mFlags & ESM::MagicEffect::TargetSkill) - effectInfo.mKey.mArg = effectIt->mSkill; - else if (magicEffect->mData.mFlags & ESM::MagicEffect::TargetAttribute) - effectInfo.mKey.mArg = effectIt->mAttribute; - // just using the min magnitude here, permanent enchantments with a random magnitude just wouldn't make any sense - effectInfo.mMagnitude = effectIt->mMagnMin; - effectInfo.mPermanent = true; - effects[effectIt->mEffectID].push_back (effectInfo); - } - } - - // add permanent spells - const MWMechanics::Spells& spells = stats.getSpells(); - for (MWMechanics::Spells::TIterator it = spells.begin(); it != spells.end(); ++it) - { - const ESM::Spell* spell = MWBase::Environment::get().getWorld()->getStore().get().find(it->first); - - // these are the spell types that are permanently in effect - if (!(spell->mData.mType == ESM::Spell::ST_Ability) - && !(spell->mData.mType == ESM::Spell::ST_Disease) - && !(spell->mData.mType == ESM::Spell::ST_Curse) - && !(spell->mData.mType == ESM::Spell::ST_Blight)) - continue; - const ESM::EffectList& list = spell->mEffects; - for (std::vector::const_iterator effectIt = list.mList.begin(); - effectIt != list.mList.end(); ++effectIt) - { - const ESM::MagicEffect* magicEffect = - MWBase::Environment::get().getWorld ()->getStore ().get().find(effectIt->mEffectID); - MagicEffectInfo effectInfo; - effectInfo.mSource = getSpellDisplayName (it->first); - effectInfo.mKey = MWMechanics::EffectKey (effectIt->mEffectID); - if (magicEffect->mData.mFlags & ESM::MagicEffect::TargetSkill) - effectInfo.mKey.mArg = effectIt->mSkill; - else if (magicEffect->mData.mFlags & ESM::MagicEffect::TargetAttribute) - effectInfo.mKey.mArg = effectIt->mAttribute; - // just using the min magnitude here, permanent spells with a random magnitude just wouldn't make any sense - effectInfo.mMagnitude = effectIt->mMagnMin; - effectInfo.mPermanent = true; - - effects[effectIt->mEffectID].push_back (effectInfo); - } - } - - // add lasting effect spells/potions etc - const MWMechanics::ActiveSpells::TContainer& activeSpells = stats.getActiveSpells().getActiveSpells(); - for (MWMechanics::ActiveSpells::TContainer::const_iterator it = activeSpells.begin(); - it != activeSpells.end(); ++it) - { - const ESM::EffectList& list = getSpellEffectList(it->first); - - float timeScale = MWBase::Environment::get().getWorld()->getTimeScaleFactor(); - - for (std::vector::const_iterator effectIt = list.mList.begin(); - effectIt != list.mList.end(); ++effectIt) - { - const ESM::MagicEffect* magicEffect = - MWBase::Environment::get().getWorld ()->getStore ().get().find(effectIt->mEffectID); - - MagicEffectInfo effectInfo; - effectInfo.mSource = getSpellDisplayName (it->first); - effectInfo.mKey = MWMechanics::EffectKey (effectIt->mEffectID); - if (magicEffect->mData.mFlags & ESM::MagicEffect::TargetSkill) - effectInfo.mKey.mArg = effectIt->mSkill; - else if (magicEffect->mData.mFlags & ESM::MagicEffect::TargetAttribute) - effectInfo.mKey.mArg = effectIt->mAttribute; - effectInfo.mMagnitude = effectIt->mMagnMin + (effectIt->mMagnMax-effectIt->mMagnMin) * it->second.second; - effectInfo.mRemainingTime = effectIt->mDuration + - (it->second.first - MWBase::Environment::get().getWorld()->getTimeStamp())*3600/timeScale; - - // ingredients need special casing for their magnitude / duration - /// \todo duplicated from ActiveSpells, helper function? - if (MWBase::Environment::get().getWorld()->getStore().get().search (it->first)) - { - effectInfo.mRemainingTime = effectIt->mDuration * it->second.second + - (it->second.first - MWBase::Environment::get().getWorld()->getTimeStamp())*3600/timeScale; - - effectInfo.mMagnitude = static_cast (0.05*it->second.second / (0.1 * magicEffect->mData.mBaseCost)); - } - - effects[effectIt->mEffectID].push_back (effectInfo); - } - } + std::map >& effects = visitor.mEffectSources; int w=2; @@ -268,55 +189,4 @@ namespace MWGui } } - - std::string SpellIcons::getSpellDisplayName (const std::string& id) - { - if (const ESM::Spell *spell = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - return spell->mName; - - if (const ESM::Potion *potion = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - return potion->mName; - - if (const ESM::Ingredient *ingredient = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - return ingredient->mName; - - throw std::runtime_error ("ID " + id + " has no display name"); - } - - ESM::EffectList SpellIcons::getSpellEffectList (const std::string& id) - { - if (const ESM::Spell *spell = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - return spell->mEffects; - - if (const ESM::Potion *potion = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - return potion->mEffects; - - if (const ESM::Ingredient *ingredient = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - { - const ESM::MagicEffect *magicEffect = - MWBase::Environment::get().getWorld()->getStore().get().find ( - ingredient->mData.mEffectID[0]); - - ESM::ENAMstruct effect; - effect.mEffectID = ingredient->mData.mEffectID[0]; - effect.mSkill = ingredient->mData.mSkills[0]; - effect.mAttribute = ingredient->mData.mAttributes[0]; - effect.mRange = 0; - effect.mArea = 0; - effect.mDuration = magicEffect->mData.mFlags & ESM::MagicEffect::NoDuration ? 0 : 1; - effect.mMagnMin = 1; - effect.mMagnMax = 1; - ESM::EffectList result; - result.mList.push_back (effect); - return result; - } - throw std::runtime_error("ID " + id + " does not have effects"); - } - } diff --git a/apps/openmw/mwgui/spellicons.hpp b/apps/openmw/mwgui/spellicons.hpp index 818d67b5b..a29e2a00a 100644 --- a/apps/openmw/mwgui/spellicons.hpp +++ b/apps/openmw/mwgui/spellicons.hpp @@ -2,6 +2,7 @@ #define MWGUI_SPELLICONS_H #include +#include #include "../mwmechanics/magiceffects.hpp" @@ -34,14 +35,23 @@ namespace MWGui bool mPermanent; // the effect is permanent }; + class EffectSourceVisitor : public MWMechanics::EffectSourceVisitor + { + public: + bool mIsPermanent; + + std::map > mEffectSources; + + virtual void visit (MWMechanics::EffectKey key, + const std::string& sourceName, float magnitude, float remainingTime = -1); + }; + class SpellIcons { public: void updateWidgets(MyGUI::Widget* parent, bool adjustSize); private: - std::string getSpellDisplayName (const std::string& id); - ESM::EffectList getSpellEffectList (const std::string& id); std::map mWidgetMap; }; diff --git a/apps/openmw/mwgui/spellwindow.cpp b/apps/openmw/mwgui/spellwindow.cpp index d5e3abc11..42a0b9865 100644 --- a/apps/openmw/mwgui/spellwindow.cpp +++ b/apps/openmw/mwgui/spellwindow.cpp @@ -9,7 +9,7 @@ #include "../mwworld/inventorystore.hpp" #include "../mwworld/actionequip.hpp" -#include "../mwmechanics/spellsuccess.hpp" +#include "../mwmechanics/spellcasting.hpp" #include "spellicons.hpp" #include "inventorywindow.hpp" @@ -51,8 +51,6 @@ namespace MWGui setCoord(498, 300, 302, 300); - updateSpells(); - mMainWidget->castType()->eventWindowChangeCoord += MyGUI::newDelegate(this, &SpellWindow::onWindowResize); } @@ -110,9 +108,9 @@ namespace MWGui allowSelectedItem = false; // if the selected item can be equipped, make sure that it actually is equipped - std::pair, bool> slots; - slots = MWWorld::Class::get(selectedItem).getEquipmentSlots(selectedItem); - if (!slots.first.empty()) + std::pair, bool> slots_; + slots_ = MWWorld::Class::get(selectedItem).getEquipmentSlots(selectedItem); + if (!slots_.first.empty()) { bool equipped = false; for (int i=0; i < MWWorld::InventoryStore::Slots; ++i) @@ -284,8 +282,16 @@ namespace MWGui MyGUI::Button* costCharge = mSpellView->createWidget(equipped ? "SpellText" : "SpellTextUnequipped", MyGUI::IntCoord(4, mHeight, mWidth-8, spellHeight), MyGUI::Align::Left | MyGUI::Align::Top); - std::string cost = boost::lexical_cast(enchant->mData.mCost); - std::string charge = boost::lexical_cast(enchant->mData.mCharge); /// \todo track current charge + float enchantCost = enchant->mData.mCost; + MWMechanics::NpcStats &stats = player.getClass().getNpcStats(player); + int eSkill = stats.getSkill(ESM::Skill::Enchant).getModified(); + int castCost = std::max(1.f, enchantCost - (enchantCost / 100) * (eSkill - 10)); + + std::string cost = boost::lexical_cast(castCost); + int currentCharge = int(item.getCellRef().mEnchantmentCharge); + if (currentCharge == -1) + currentCharge = enchant->mData.mCharge; + std::string charge = boost::lexical_cast(currentCharge); if (enchant->mData.mType == ESM::Enchantment::CastOnce) { // this is Morrowind behaviour diff --git a/apps/openmw/mwgui/statswindow.cpp b/apps/openmw/mwgui/statswindow.cpp index 9facdac40..ab6096b7e 100644 --- a/apps/openmw/mwgui/statswindow.cpp +++ b/apps/openmw/mwgui/statswindow.cpp @@ -134,38 +134,28 @@ namespace MWGui void StatsWindow::setValue (const std::string& id, const MWMechanics::DynamicStat& value) { - static const char *ids[] = - { - "HBar", "MBar", "FBar", - 0 - }; + int current = std::max(0, static_cast(value.getCurrent())); + int modified = static_cast(value.getModified()); - for (int i=0; ids[i]; ++i) - { - if (ids[i]==id) - { - std::string id (ids[i]); - setBar (id, id + "T", static_cast(value.getCurrent()), static_cast(value.getModified())); + setBar (id, id + "T", current, modified); - // health, magicka, fatigue tooltip - MyGUI::Widget* w; - std::string valStr = boost::lexical_cast(value.getCurrent()) + "/" + boost::lexical_cast(value.getModified()); - if (i==0) - { - getWidget(w, "Health"); - w->setUserString("Caption_HealthDescription", "#{sHealthDesc}\n" + valStr); - } - else if (i==1) - { - getWidget(w, "Magicka"); - w->setUserString("Caption_HealthDescription", "#{sIntDesc}\n" + valStr); - } - else if (i==2) - { - getWidget(w, "Fatigue"); - w->setUserString("Caption_HealthDescription", "#{sFatDesc}\n" + valStr); - } - } + // health, magicka, fatigue tooltip + MyGUI::Widget* w; + std::string valStr = boost::lexical_cast(current) + "/" + boost::lexical_cast(modified); + if (id == "HBar") + { + getWidget(w, "Health"); + w->setUserString("Caption_HealthDescription", "#{sHealthDesc}\n" + valStr); + } + else if (id == "MBar") + { + getWidget(w, "Magicka"); + w->setUserString("Caption_HealthDescription", "#{sIntDesc}\n" + valStr); + } + else if (id == "FBar") + { + getWidget(w, "Fatigue"); + w->setUserString("Caption_HealthDescription", "#{sFatDesc}\n" + valStr); } } @@ -420,8 +410,6 @@ namespace MWGui } mSkillWidgets.clear(); - mSkillView->setViewOffset (MyGUI::IntPoint(0,0)); - const int valueSize = 40; MyGUI::IntCoord coord1(10, 0, mSkillView->getWidth() - (10 + valueSize) - 24, 18); MyGUI::IntCoord coord2(coord1.left + coord1.width, coord1.top, valueSize, coord1.height); diff --git a/apps/openmw/mwgui/statswindow.hpp b/apps/openmw/mwgui/statswindow.hpp index ac8319bdc..49b44a2e1 100644 --- a/apps/openmw/mwgui/statswindow.hpp +++ b/apps/openmw/mwgui/statswindow.hpp @@ -37,6 +37,8 @@ namespace MWGui void setBounty (int bounty) { if (bounty != mBounty) mChanged = true; this->mBounty = bounty; } void updateSkillArea(); + virtual void open() { onWindowResize(static_cast(mMainWidget)); } + private: void addSkills(const SkillList &skills, const std::string &titleId, const std::string &titleDefault, MyGUI::IntCoord &coord1, MyGUI::IntCoord &coord2); void addSeparator(MyGUI::IntCoord &coord1, MyGUI::IntCoord &coord2); diff --git a/apps/openmw/mwgui/tooltips.cpp b/apps/openmw/mwgui/tooltips.cpp index 3a609aa91..b52c8e3dd 100644 --- a/apps/openmw/mwgui/tooltips.cpp +++ b/apps/openmw/mwgui/tooltips.cpp @@ -110,11 +110,6 @@ namespace MWGui else { - const MyGUI::IntPoint& lastPressed = MyGUI::InputManager::getInstance().getLastPressedPosition(MyGUI::MouseButton::Left); - - if (mousePos == lastPressed) // mouseclick makes tooltip disappear - return; - if (mousePos.left == mLastMouseX && mousePos.top == mLastMouseY) { mRemainingDelay -= frameDuration; @@ -467,7 +462,7 @@ namespace MWGui } Widgets::MWDynamicStatPtr chargeWidget = enchantArea->createWidget ("MW_ChargeBar", chargeCoord, MyGUI::Align::Default, "ToolTipEnchantCharge"); - chargeWidget->setValue(charge, charge); + chargeWidget->setValue(charge, maxCharge); totalSize.height += 24; } } diff --git a/apps/openmw/mwgui/tradewindow.cpp b/apps/openmw/mwgui/tradewindow.cpp index 94141b1a0..d544b83cf 100644 --- a/apps/openmw/mwgui/tradewindow.cpp +++ b/apps/openmw/mwgui/tradewindow.cpp @@ -80,9 +80,8 @@ namespace MWGui } void TradeWindow::startTrade(const MWWorld::Ptr& actor) - { + { mPtr = actor; - setTitle(MWWorld::Class::get(actor).getName(actor)); mCurrentBalance = 0; mCurrentMerchantOffer = 0; @@ -99,6 +98,12 @@ namespace MWGui mItemView->setModel (mSortModel); updateLabels(); + + // Careful here. setTitle may cause size updates, causing itemview redraw, so make sure to do it last + // or we end up using a possibly invalid model. + setTitle(MWWorld::Class::get(actor).getName(actor)); + + onFilterChanged(mFilterAll); } void TradeWindow::onFilterChanged(MyGUI::Widget* _sender) @@ -200,32 +205,17 @@ namespace MWGui sellToNpc(item.mBase, count, true); } - void TradeWindow::addOrRemoveGold(int amount) + void TradeWindow::addOrRemoveGold(int amount, const MWWorld::Ptr& actor) { - bool goldFound = false; - MWWorld::Ptr gold; - MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); - MWWorld::ContainerStore& playerStore = MWWorld::Class::get(player).getContainerStore(player); + MWWorld::ContainerStore& store = MWWorld::Class::get(actor).getContainerStore(actor); - for (MWWorld::ContainerStoreIterator it = playerStore.begin(); - it != playerStore.end(); ++it) + if (amount > 0) { - if (Misc::StringUtils::ciEqual(it->getCellRef().mRefID, "gold_001")) - { - goldFound = true; - gold = *it; - } - } - if (goldFound) - { - gold.getRefData().setCount(gold.getRefData().getCount() + amount); + store.add("gold_001", amount, actor); } else { - assert(amount > 0); - MWWorld::ManualRef ref(MWBase::Environment::get().getWorld()->getStore(), "Gold_001"); - ref.getPtr().getRefData().setCount(amount); - playerStore.add(ref.getPtr(), player); + store.remove("gold_001", - amount, actor); } } @@ -280,6 +270,8 @@ namespace MWGui return; } + MWWorld::Ptr playerPtr = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + if(mCurrentBalance > mCurrentMerchantOffer) { //if npc is a creature: reject (no haggle) @@ -302,7 +294,6 @@ namespace MWGui + MWBase::Environment::get().getDialogueManager()->getTemporaryDispositionChange()),100)); const MWMechanics::NpcStats &sellerStats = MWWorld::Class::get(mPtr).getNpcStats(mPtr); - MWWorld::Ptr playerPtr = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); const MWMechanics::NpcStats &playerStats = MWWorld::Class::get(playerPtr).getNpcStats(playerPtr); float a1 = std::min(playerStats.getSkill(ESM::Skill::Mercantile).getModified(), 100.f); @@ -342,9 +333,12 @@ namespace MWGui mTradeModel->transferItems(); playerItemModel->transferItems(); - // add or remove gold from the player. + // transfer the gold if (mCurrentBalance != 0) - addOrRemoveGold(mCurrentBalance); + { + addOrRemoveGold(mCurrentBalance, playerPtr); + addOrRemoveGold(-mCurrentBalance, mPtr); + } std::string sound = "Item Gold Up"; MWBase::Environment::get().getSoundManager()->playSound (sound, 1.0, 1.0); @@ -445,22 +439,13 @@ namespace MWGui int TradeWindow::getMerchantGold() { - int merchantGold; - - if (mPtr.getTypeName() == typeid(ESM::NPC).name()) + int merchantGold = 0; + MWWorld::ContainerStore store = mPtr.getClass().getContainerStore(mPtr); + for (MWWorld::ContainerStoreIterator it = store.begin(); it != store.end(); ++it) { - MWWorld::LiveCellRef* ref = mPtr.get(); - if (ref->mBase->mNpdt52.mGold == -10) - merchantGold = ref->mBase->mNpdt12.mGold; - else - merchantGold = ref->mBase->mNpdt52.mGold; + if (Misc::StringUtils::ciEqual(it->getCellRef().mRefID, "gold_001")) + merchantGold += it->getRefData().getCount(); } - else // ESM::Creature - { - MWWorld::LiveCellRef* ref = mPtr.get(); - merchantGold = ref->mBase->mData.mGold; - } - return merchantGold; } } diff --git a/apps/openmw/mwgui/tradewindow.hpp b/apps/openmw/mwgui/tradewindow.hpp index 4e905915a..7c11bd539 100644 --- a/apps/openmw/mwgui/tradewindow.hpp +++ b/apps/openmw/mwgui/tradewindow.hpp @@ -28,7 +28,7 @@ namespace MWGui void startTrade(const MWWorld::Ptr& actor); - void addOrRemoveGold(int gold); + void addOrRemoveGold(int gold, const MWWorld::Ptr& actor); void onFrame(float frameDuration); diff --git a/apps/openmw/mwgui/trainingwindow.cpp b/apps/openmw/mwgui/trainingwindow.cpp index 7ddac38f5..04eddcb17 100644 --- a/apps/openmw/mwgui/trainingwindow.cpp +++ b/apps/openmw/mwgui/trainingwindow.cpp @@ -11,11 +11,11 @@ #include "../mwworld/player.hpp" #include "../mwworld/class.hpp" +#include "../mwworld/containerstore.hpp" #include "../mwmechanics/npcstats.hpp" #include "inventorywindow.hpp" -#include "tradewindow.hpp" #include "tooltips.hpp" namespace MWGui @@ -142,7 +142,7 @@ namespace MWGui pcStats.increaseSkill (skillId, *class_, true); // remove gold - MWBase::Environment::get().getWindowManager()->getTradeWindow()->addOrRemoveGold(-price); + player.getClass().getContainerStore(player).remove("gold_001", price, player); // go back to game mode MWBase::Environment::get().getWindowManager()->removeGuiMode (GM_Training); diff --git a/apps/openmw/mwgui/travelwindow.cpp b/apps/openmw/mwgui/travelwindow.cpp index 93ac8299d..dd5da4522 100644 --- a/apps/openmw/mwgui/travelwindow.cpp +++ b/apps/openmw/mwgui/travelwindow.cpp @@ -11,9 +11,9 @@ #include "../mwworld/player.hpp" #include "../mwworld/class.hpp" +#include "../mwworld/containerstore.hpp" #include "inventorywindow.hpp" -#include "tradewindow.hpp" namespace MWGui { @@ -121,13 +121,15 @@ namespace MWGui int price; iss >> price; + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + if (MWBase::Environment::get().getWindowManager()->getInventoryWindow()->getPlayerGold()getTradeWindow ()->addOrRemoveGold (-price); + + player.getClass().getContainerStore(player).remove("gold_001", price, player); MWBase::Environment::get().getWorld ()->getFader ()->fadeOut(1); - MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); ESM::Position pos = *_sender->getUserData(); std::string cellname = _sender->getUserString("Destination"); int x,y; diff --git a/apps/openmw/mwgui/widgets.cpp b/apps/openmw/mwgui/widgets.cpp index 3fc3187e8..c37ae15fa 100644 --- a/apps/openmw/mwgui/widgets.cpp +++ b/apps/openmw/mwgui/widgets.cpp @@ -689,22 +689,26 @@ namespace MWGui int total_width = 0; int total_height = 0; std::vector< std::pair > sizes; + sizes.resize(count); for (unsigned int i = 0; i < count; ++i) { MyGUI::Widget* w = getChildAt(i); bool hstretch = w->getUserString ("HStretch") == "true"; + bool hidden = w->getUserString("Hidden") == "true"; + if (hidden) + continue; h_stretched_count += hstretch; AutoSizedWidget* aw = dynamic_cast(w); if (aw) { - sizes.push_back(std::make_pair(aw->getRequestedSize (), hstretch)); + sizes[i] = std::make_pair(aw->getRequestedSize (), hstretch); total_width += aw->getRequestedSize ().width; total_height = std::max(total_height, aw->getRequestedSize ().height); } else { - sizes.push_back (std::make_pair(w->getSize(), hstretch)); + sizes[i] = std::make_pair(w->getSize(), hstretch); total_width += w->getSize().width; if (!(w->getUserString("VStretch") == "true")) total_height = std::max(total_height, w->getSize().height); @@ -729,8 +733,13 @@ namespace MWGui MyGUI::Widget* w = getChildAt(i); + bool hidden = w->getUserString("Hidden") == "true"; + if (hidden) + continue; + bool vstretch = w->getUserString ("VStretch") == "true"; - int height = vstretch ? total_height : sizes[i].first.height; + int max_height = getSize().height - mPadding*2; + int height = vstretch ? max_height : sizes[i].first.height; MyGUI::IntCoord widgetCoord; widgetCoord.left = curX; @@ -774,6 +783,10 @@ namespace MWGui MyGUI::IntSize size(0,0); for (unsigned int i = 0; i < getChildCount (); ++i) { + bool hidden = getChildAt(i)->getUserString("Hidden") == "true"; + if (hidden) + continue; + AutoSizedWidget* w = dynamic_cast(getChildAt(i)); if (w) { @@ -810,21 +823,27 @@ namespace MWGui int total_height = 0; int total_width = 0; std::vector< std::pair > sizes; + sizes.resize(count); for (unsigned int i = 0; i < count; ++i) { MyGUI::Widget* w = getChildAt(i); + + bool hidden = w->getUserString("Hidden") == "true"; + if (hidden) + continue; + bool vstretch = w->getUserString ("VStretch") == "true"; v_stretched_count += vstretch; AutoSizedWidget* aw = dynamic_cast(w); if (aw) { - sizes.push_back(std::make_pair(aw->getRequestedSize (), vstretch)); + sizes[i] = std::make_pair(aw->getRequestedSize (), vstretch); total_height += aw->getRequestedSize ().height; total_width = std::max(total_width, aw->getRequestedSize ().width); } else { - sizes.push_back (std::make_pair(w->getSize(), vstretch)); + sizes[i] = std::make_pair(w->getSize(), vstretch); total_height += w->getSize().height; if (!(w->getUserString("HStretch") == "true")) @@ -850,8 +869,13 @@ namespace MWGui MyGUI::Widget* w = getChildAt(i); + bool hidden = w->getUserString("Hidden") == "true"; + if (hidden) + continue; + bool hstretch = w->getUserString ("HStretch") == "true"; - int width = hstretch ? total_width : sizes[i].first.width; + int maxWidth = getSize().width - mPadding*2; + int width = hstretch ? maxWidth : sizes[i].first.width; MyGUI::IntCoord widgetCoord; widgetCoord.top = curY; @@ -890,6 +914,10 @@ namespace MWGui MyGUI::IntSize size(0,0); for (unsigned int i = 0; i < getChildCount (); ++i) { + bool hidden = getChildAt(i)->getUserString("Hidden") == "true"; + if (hidden) + continue; + AutoSizedWidget* w = dynamic_cast(getChildAt(i)); if (w) { diff --git a/apps/openmw/mwgui/windowmanagerimp.cpp b/apps/openmw/mwgui/windowmanagerimp.cpp index 4b4d2dfd1..afa020082 100644 --- a/apps/openmw/mwgui/windowmanagerimp.cpp +++ b/apps/openmw/mwgui/windowmanagerimp.cpp @@ -43,6 +43,7 @@ #include "waitdialog.hpp" #include "enchantingdialog.hpp" #include "trainingwindow.hpp" +#include "recharge.hpp" #include "exposedwindow.hpp" #include "cursor.hpp" #include "merchantrepair.hpp" @@ -95,10 +96,10 @@ namespace MWGui , mTrainingWindow(NULL) , mMerchantRepair(NULL) , mSoulgemDialog(NULL) + , mRecharge(NULL) , mRepair(NULL) , mCompanionWindow(NULL) , mTranslationDataStorage (translationDataStorage) - , mSoftwareCursor(NULL) , mCharGen(NULL) , mInputBlocker(NULL) , mCrosshairEnabled(Settings::Manager::getBool ("crosshair", "HUD")) @@ -111,9 +112,6 @@ namespace MWGui , mPlayerMinorSkills() , mPlayerMajorSkills() , mPlayerSkillValues() - , mPlayerHealth() - , mPlayerMagicka() - , mPlayerFatigue() , mGui(NULL) , mGuiModes() , mCursorManager(NULL) @@ -126,7 +124,6 @@ namespace MWGui , mFPS(0.0f) , mTriangleCount(0) , mBatchCount(0) - , mUseHardwareCursors(Settings::Manager::getBool("hardware cursors", "GUI")) { // Set up the GUI system mGuiManager = new OEngine::GUI::MyGUIManager(mRendering->getWindow(), mRendering->getScene(), false, logpath); @@ -171,16 +168,19 @@ namespace MWGui mLoadingScreen->onResChange (w,h); //set up the hardware cursor manager - mSoftwareCursor = new Cursor(); mCursorManager = new SFO::SDLCursorManager(); MyGUI::PointerManager::getInstance().eventChangeMousePointer += MyGUI::newDelegate(this, &WindowManager::onCursorChange); MyGUI::InputManager::getInstance().eventChangeKeyFocus += MyGUI::newDelegate(this, &WindowManager::onKeyFocusChanged); - setUseHardwareCursors(mUseHardwareCursors); + mCursorManager->setEnabled(true); + onCursorChange(MyGUI::PointerManager::getInstance().getDefaultPointer()); - mCursorManager->cursorVisibilityChange(false); + SDL_ShowCursor(false); + + // hide mygui's pointer + MyGUI::PointerManager::getInstance().setVisible(false); } void WindowManager::initUI() @@ -197,18 +197,25 @@ namespace MWGui mDragAndDrop->mDraggedWidget = 0; mDragAndDrop->mDragAndDropWidget = dragAndDropWidget; + mRecharge = new Recharge(); mMenu = new MainMenu(w,h); mMap = new MapWindow(""); + trackWindow(mMap, "map"); mStatsWindow = new StatsWindow(); + trackWindow(mStatsWindow, "stats"); mConsole = new Console(w,h, mConsoleOnlyScripts); + trackWindow(mConsole, "console"); mJournal = JournalWindow::create(JournalViewModel::create ()); mMessageBoxManager = new MessageBoxManager(); mInventoryWindow = new InventoryWindow(mDragAndDrop); mTradeWindow = new TradeWindow(); + trackWindow(mTradeWindow, "barter"); mSpellBuyingWindow = new SpellBuyingWindow(); mTravelWindow = new TravelWindow(); mDialogueWindow = new DialogueWindow(); + trackWindow(mDialogueWindow, "dialogue"); mContainerWindow = new ContainerWindow(mDragAndDrop); + trackWindow(mContainerWindow, "container"); mHud = new HUD(w,h, mShowFPSLevel, mDragAndDrop); mToolTips = new ToolTips(); mScrollWindow = new ScrollWindow(); @@ -217,7 +224,9 @@ namespace MWGui mSettingsWindow = new SettingsWindow(); mConfirmationDialog = new ConfirmationDialog(); mAlchemyWindow = new AlchemyWindow(); + trackWindow(mAlchemyWindow, "alchemy"); mSpellWindow = new SpellWindow(); + trackWindow(mSpellWindow, "spells"); mQuickKeysMenu = new QuickKeysMenu(); mLevelupDialog = new LevelupDialog(); mWaitDialog = new WaitDialog(); @@ -228,6 +237,7 @@ namespace MWGui mRepair = new Repair(); mSoulgemDialog = new SoulgemDialog(mMessageBoxManager); mCompanionWindow = new CompanionWindow(mDragAndDrop, mMessageBoxManager); + trackWindow(mCompanionWindow, "companion"); mInputBlocker = mGui->createWidget("",0,0,w,h,MyGUI::Align::Default,"Windows",""); @@ -246,9 +256,6 @@ namespace MWGui mPlayerSkillValues.insert(std::make_pair(ESM::Skill::sSkillIds[i], MWMechanics::Stat())); } - unsetSelectedSpell(); - unsetSelectedWeapon(); - // Set up visibility updateVisible(); @@ -313,8 +320,8 @@ namespace MWGui delete mMerchantRepair; delete mRepair; delete mSoulgemDialog; - delete mSoftwareCursor; delete mCursorManager; + delete mRecharge; cleanupGarbage(); @@ -343,8 +350,6 @@ namespace MWGui mHud->setBatchCount(mBatchCount); mHud->update(); - - mSoftwareCursor->update(); } void WindowManager::updateVisible() @@ -378,6 +383,7 @@ namespace MWGui mRepair->setVisible(false); mCompanionWindow->setVisible(false); mInventoryWindow->setTrading(false); + mRecharge->setVisible(false); mHud->setVisible(mHudEnabled); @@ -495,6 +501,9 @@ namespace MWGui case GM_SpellCreation: mSpellCreationDialog->setVisible(true); break; + case GM_Recharge: + mRecharge->setVisible(true); + break; case GM_Enchanting: mEnchantingDialog->setVisible(true); break; @@ -578,35 +587,8 @@ namespace MWGui mStatsWindow->setValue (id, value); mHud->setValue (id, value); mCharGen->setValue(id, value); - if (id == "HBar") - { - mPlayerHealth = value; - mCharGen->setPlayerHealth (value); - } - else if (id == "MBar") - { - mPlayerMagicka = value; - mCharGen->setPlayerMagicka (value); - } - else if (id == "FBar") - { - mPlayerFatigue = value; - mCharGen->setPlayerFatigue (value); - } } - #if 0 - MWMechanics::DynamicStat WindowManager::getValue(const std::string& id) - { - if(id == "HBar") - return layerHealth; - else if (id == "MBar") - return mPlayerMagicka; - else if (id == "FBar") - return mPlayerFatigue; - } - #endif - void WindowManager::setValue (const std::string& id, const std::string& value) { mStatsWindow->setValue (id, value); @@ -877,21 +859,9 @@ namespace MWGui MWBase::Environment::get().getInputManager()->setDragDrop(dragDrop); } - void WindowManager::setUseHardwareCursors(bool use) - { - mCursorManager->setEnabled(use); - mSoftwareCursor->setVisible(!use && mCursorVisible); - } - void WindowManager::setCursorVisible(bool visible) { - if(mCursorVisible == visible) - return; - mCursorVisible = visible; - mCursorManager->cursorVisibilityChange(visible); - - mSoftwareCursor->setVisible(!mUseHardwareCursors && visible); } void WindowManager::onRetrieveTag(const MyGUI::UString& _tag, MyGUI::UString& _result) @@ -922,8 +892,6 @@ namespace MWGui mHud->setFpsLevel(Settings::Manager::getInt("fps", "HUD")); mToolTips->setDelay(Settings::Manager::getFloat("tooltip delay", "GUI")); - setUseHardwareCursors(Settings::Manager::getBool("hardware cursors", "GUI")); - for (Settings::CategorySettingVector::const_iterator it = changed.begin(); it != changed.end(); ++it) { @@ -940,6 +908,17 @@ namespace MWGui mLoadingScreen->onResChange (x,y); if (!mHud) return; // UI not initialized yet + + for (std::map::iterator it = mTrackedWindows.begin(); it != mTrackedWindows.end(); ++it) + { + MyGUI::IntPoint pos (Settings::Manager::getFloat(it->second + " x", "Windows") * x, + Settings::Manager::getFloat(it->second+ " y", "Windows") * y); + MyGUI::IntSize size (Settings::Manager::getFloat(it->second + " w", "Windows") * x, + Settings::Manager::getFloat(it->second + " h", "Windows") * y); + it->first->setPosition(pos); + it->first->setSize(size); + } + mHud->onResChange(x, y); mConsole->onResChange(x, y); mMenu->onResChange(x, y); @@ -975,8 +954,6 @@ namespace MWGui void WindowManager::onCursorChange(const std::string &name) { - mSoftwareCursor->onCursorChange(name); - if(!mCursorManager->cursorChanged(name)) return; //the cursor manager doesn't want any more info about this cursor //See if we can get the information we need out of the cursor resource @@ -1320,6 +1297,7 @@ namespace MWGui void WindowManager::changePointer(const std::string &name) { + MyGUI::PointerManager::getInstance().setPointer(name); onCursorChange(name); } @@ -1336,6 +1314,9 @@ namespace MWGui void WindowManager::updatePlayer() { + unsetSelectedSpell(); + unsetSelectedWeapon(); + mInventoryWindow->updatePlayer(); } @@ -1366,4 +1347,45 @@ namespace MWGui return mLoadingScreen; } + void WindowManager::startRecharge(MWWorld::Ptr soulgem) + { + mRecharge->start(soulgem); + } + + bool WindowManager::getCursorVisible() + { + return mCursorVisible; + } + + void WindowManager::trackWindow(OEngine::GUI::Layout *layout, const std::string &name) + { + MyGUI::IntSize viewSize = MyGUI::RenderManager::getInstance().getViewSize(); + MyGUI::IntPoint pos (Settings::Manager::getFloat(name + " x", "Windows") * viewSize.width, + Settings::Manager::getFloat(name + " y", "Windows") * viewSize.height); + MyGUI::IntSize size (Settings::Manager::getFloat(name + " w", "Windows") * viewSize.width, + Settings::Manager::getFloat(name + " h", "Windows") * viewSize.height); + layout->mMainWidget->setPosition(pos); + layout->mMainWidget->setSize(size); + + MyGUI::Window* window = dynamic_cast(layout->mMainWidget); + if (!window) + throw std::runtime_error("Attempting to track size of a non-resizable window"); + window->eventWindowChangeCoord += MyGUI::newDelegate(this, &WindowManager::onWindowChangeCoord); + mTrackedWindows[window] = name; + } + + void WindowManager::onWindowChangeCoord(MyGUI::Window *_sender) + { + std::string setting = mTrackedWindows[_sender]; + MyGUI::IntSize viewSize = MyGUI::RenderManager::getInstance().getViewSize(); + float x = _sender->getPosition().left / float(viewSize.width); + float y = _sender->getPosition().top / float(viewSize.height); + float w = _sender->getSize().width / float(viewSize.width); + float h = _sender->getSize().height / float(viewSize.height); + Settings::Manager::setFloat(setting + " x", "Windows", x); + Settings::Manager::setFloat(setting + " y", "Windows", y); + Settings::Manager::setFloat(setting + " w", "Windows", w); + Settings::Manager::setFloat(setting + " h", "Windows", h); + } + } diff --git a/apps/openmw/mwgui/windowmanagerimp.hpp b/apps/openmw/mwgui/windowmanagerimp.hpp index badb333a7..743160aa8 100644 --- a/apps/openmw/mwgui/windowmanagerimp.hpp +++ b/apps/openmw/mwgui/windowmanagerimp.hpp @@ -16,6 +16,7 @@ namespace MyGUI { class Gui; class Widget; + class Window; class UString; } @@ -77,6 +78,7 @@ namespace MWGui class MerchantRepair; class Repair; class SoulgemDialog; + class Recharge; class CompanionWindow; class WindowManager : public MWBase::WindowManager @@ -263,6 +265,7 @@ namespace MWGui virtual void startTraining(MWWorld::Ptr actor); virtual void startRepair(MWWorld::Ptr actor); virtual void startRepairItem(MWWorld::Ptr item); + virtual void startRecharge(MWWorld::Ptr soulgem); virtual void frameStarted(float dt); @@ -276,9 +279,15 @@ namespace MWGui void onSoulgemDialogButtonPressed (int button); + virtual bool getCursorVisible(); + private: bool mConsoleOnlyScripts; + std::map mTrackedWindows; + void trackWindow(OEngine::GUI::Layout* layout, const std::string& name); + void onWindowChangeCoord(MyGUI::Window* _sender); + OEngine::GUI::MyGUIManager *mGuiManager; OEngine::Render::OgreRenderer *mRendering; HUD *mHud; @@ -313,6 +322,7 @@ namespace MWGui MerchantRepair* mMerchantRepair; SoulgemDialog* mSoulgemDialog; Repair* mRepair; + Recharge* mRecharge; CompanionWindow* mCompanionWindow; Translation::Storage& mTranslationDataStorage; @@ -336,8 +346,6 @@ namespace MWGui std::map > mPlayerAttributes; SkillList mPlayerMajorSkills, mPlayerMinorSkills; std::map > mPlayerSkillValues; - MWMechanics::DynamicStat mPlayerHealth, mPlayerMagicka, mPlayerFatigue; - MyGUI::Gui *mGui; // Gui std::vector mGuiModes; @@ -366,9 +374,6 @@ namespace MWGui unsigned int mTriangleCount; unsigned int mBatchCount; - bool mUseHardwareCursors; - void setUseHardwareCursors(bool use); - /** * Called when MyGUI tries to retrieve a tag. This usually corresponds to a GMST string, * so this method will retrieve the GMST with the name \a _tag and place the result in \a _result diff --git a/apps/openmw/mwinput/inputmanagerimp.cpp b/apps/openmw/mwinput/inputmanagerimp.cpp index 4746260ed..ab2569635 100644 --- a/apps/openmw/mwinput/inputmanagerimp.cpp +++ b/apps/openmw/mwinput/inputmanagerimp.cpp @@ -87,7 +87,7 @@ namespace MWInput { InputManager::InputManager(OEngine::Render::OgreRenderer &ogre, OMW::Engine& engine, - const std::string& userFile, bool userFileExists) + const std::string& userFile, bool userFileExists, bool grab) : mOgre(ogre) , mPlayer(NULL) , mEngine(engine) @@ -111,7 +111,7 @@ namespace MWInput Ogre::RenderWindow* window = ogre.getWindow (); - mInputManager = new SFO::InputWrapper(mOgre.getSDLWindow(), mOgre.getWindow()); + mInputManager = new SFO::InputWrapper(mOgre.getSDLWindow(), mOgre.getWindow(), grab); mInputManager->setMouseEventCallback (this); mInputManager->setKeyboardEventCallback (this); mInputManager->setWindowEventCallback(this); @@ -182,9 +182,6 @@ namespace MWInput case A_GameMenu: toggleMainMenu (); break; - case A_Quit: - exitNow(); - break; case A_Screenshot: screenshot(); break; @@ -267,6 +264,8 @@ namespace MWInput void InputManager::update(float dt, bool loading) { + mInputManager->setMouseVisible(MWBase::Environment::get().getWindowManager()->getCursorVisible()); + mInputManager->capture(loading); // inject some fake mouse movement to force updating MyGUI's widget states // this shouldn't do any harm since we're moving back to the original position afterwards @@ -277,7 +276,8 @@ namespace MWInput if (!loading) mInputBinder->update(dt); - bool main_menu = MWBase::Environment::get().getWindowManager()->containsMode(MWGui::GM_MainMenu); + bool grab = !MWBase::Environment::get().getWindowManager()->containsMode(MWGui::GM_MainMenu) + && MWBase::Environment::get().getWindowManager()->getMode() != MWGui::GM_Console; bool was_relative = mInputManager->getMouseRelative(); bool is_relative = !MWBase::Environment::get().getWindowManager()->isGuiMode(); @@ -287,7 +287,7 @@ namespace MWInput mInputManager->setMouseRelative(is_relative); //we let the mouse escape in the main menu - mInputManager->setGrabPointer(!main_menu); + mInputManager->setGrabPointer(grab); //we switched to non-relative mode, move our cursor to where the in-game //cursor is @@ -505,7 +505,7 @@ namespace MWInput mInputBinder->keyPressed (arg); - if(arg.keysym.sym == SDLK_RETURN + if((arg.keysym.sym == SDLK_RETURN || arg.keysym.sym == SDLK_KP_ENTER) && MWBase::Environment::get().getWindowManager()->isGuiMode()) { // Pressing enter when a messagebox is prompting for "ok" will activate the ok button @@ -644,6 +644,11 @@ namespace MWInput mOgre.windowResized(x,y); } + void InputManager::windowClosed() + { + MWBase::Environment::setRequestExit(); + } + void InputManager::toggleMainMenu() { if (MyGUI::InputManager::getInstance ().isModalAny()) @@ -814,13 +819,6 @@ namespace MWInput mAlwaysRunActive = !mAlwaysRunActive; } - // Exit program now button (which is disabled in GUI mode) - void InputManager::exitNow() - { - if(!MWBase::Environment::get().getWindowManager()->isGuiMode()) - Ogre::Root::getSingleton().queueEndRendering (); - } - void InputManager::resetIdleTime() { if (mTimeIdle < 0) diff --git a/apps/openmw/mwinput/inputmanagerimp.hpp b/apps/openmw/mwinput/inputmanagerimp.hpp index 5f9a752d7..8efa6cfc5 100644 --- a/apps/openmw/mwinput/inputmanagerimp.hpp +++ b/apps/openmw/mwinput/inputmanagerimp.hpp @@ -61,7 +61,7 @@ namespace MWInput public: InputManager(OEngine::Render::OgreRenderer &_ogre, OMW::Engine& engine, - const std::string& userFile, bool userFileExists); + const std::string& userFile, bool userFileExists, bool grab); virtual ~InputManager(); @@ -97,6 +97,7 @@ namespace MWInput virtual void windowVisibilityChange( bool visible ); virtual void windowFocusChange( bool have_focus ); virtual void windowResized (int x, int y); + virtual void windowClosed (); virtual void channelChanged(ICS::Channel* channel, float currentValue, float previousValue); @@ -177,7 +178,6 @@ namespace MWInput void activate(); void toggleWalking(); void toggleAutoMove(); - void exitNow(); void rest(); void quickKey (int index); @@ -194,7 +194,7 @@ namespace MWInput A_GameMenu, - A_Quit, // Exit the program + A_Unused, A_Screenshot, // Take a screenshot diff --git a/apps/openmw/mwmechanics/activespells.cpp b/apps/openmw/mwmechanics/activespells.cpp index 9aca6b7b7..dc79901b0 100644 --- a/apps/openmw/mwmechanics/activespells.cpp +++ b/apps/openmw/mwmechanics/activespells.cpp @@ -1,26 +1,8 @@ - #include "activespells.hpp" -#include - -#include - -#include -#include -#include -#include -#include - -#include "../mwworld/esmstore.hpp" - #include "../mwbase/environment.hpp" #include "../mwbase/world.hpp" -#include "../mwworld/class.hpp" - -#include "creaturestats.hpp" -#include "npcstats.hpp" - namespace MWMechanics { void ActiveSpells::update() const @@ -29,6 +11,7 @@ namespace MWMechanics MWWorld::TimeStamp now = MWBase::Environment::get().getWorld()->getTimeStamp(); + // Erase no longer active spells if (mLastUpdate!=now) { TContainer::iterator iter (mSpells.begin()); @@ -62,162 +45,28 @@ namespace MWMechanics for (TIterator iter (begin()); iter!=end(); ++iter) { - std::pair > effects = getEffectList (iter->first); + const MWWorld::TimeStamp& start = iter->second.mTimeStamp; - const MWWorld::TimeStamp& start = iter->second.first; - float magnitude = iter->second.second; + const std::vector& effects = iter->second.mEffects; - for (std::vector::const_iterator iter (effects.first.mList.begin()); - iter!=effects.first.mList.end(); ++iter) + for (std::vector::const_iterator effectIt = effects.begin(); effectIt != effects.end(); ++effectIt) { - if (iter->mDuration) - { - int duration = iter->mDuration; - - if (effects.second.first) - duration *= magnitude; - - MWWorld::TimeStamp end = start; - end += static_cast (duration)* - MWBase::Environment::get().getWorld()->getTimeScaleFactor()/(60*60); + int duration = effectIt->mDuration; + MWWorld::TimeStamp end = start; + end += static_cast (duration)* + MWBase::Environment::get().getWorld()->getTimeScaleFactor()/(60*60); - if (end>now) - { - EffectParam param; - - if (effects.second.first) - { - const ESM::MagicEffect *magicEffect = - MWBase::Environment::get().getWorld()->getStore().get().find ( - iter->mEffectID); - - if (iter->mDuration==0) - { - param.mMagnitude = - static_cast (magnitude / (0.1 * magicEffect->mData.mBaseCost)); - } - else - { - param.mMagnitude = - static_cast (0.05*magnitude / (0.1 * magicEffect->mData.mBaseCost)); - } - } - else - param.mMagnitude = static_cast ( - (iter->mMagnMax-iter->mMagnMin)*magnitude + iter->mMagnMin); - - mEffects.add (*iter, param); - } - } + if (end>now) + mEffects.add(effectIt->mKey, MWMechanics::EffectParam(effectIt->mMagnitude)); } } } - std::pair > ActiveSpells::getEffectList (const std::string& id) const - { - if (const ESM::Spell *spell = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - return std::make_pair (spell->mEffects, std::make_pair(false, false)); - - if (const ESM::Potion *potion = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - return std::make_pair (potion->mEffects, std::make_pair(false, true)); - - if (const ESM::Ingredient *ingredient = - MWBase::Environment::get().getWorld()->getStore().get().search (id)) - { - const ESM::MagicEffect *magicEffect = - MWBase::Environment::get().getWorld()->getStore().get().find ( - ingredient->mData.mEffectID[0]); - - ESM::ENAMstruct effect; - effect.mEffectID = ingredient->mData.mEffectID[0]; - effect.mSkill = ingredient->mData.mSkills[0]; - effect.mAttribute = ingredient->mData.mAttributes[0]; - effect.mRange = 0; - effect.mArea = 0; - effect.mDuration = magicEffect->mData.mFlags & ESM::MagicEffect::NoDuration ? 0 : 1; - effect.mMagnMin = 1; - effect.mMagnMax = 1; - - std::pair > result; - result.second.second = true; - result.second.first = true; - - result.first.mList.push_back (effect); - - return result; - } - - throw std::runtime_error ("ID " + id + " can not produce lasting effects"); - } - ActiveSpells::ActiveSpells() - : mSpellsChanged (false), mLastUpdate (MWBase::Environment::get().getWorld()->getTimeStamp()) + : mSpellsChanged (false) + , mLastUpdate (MWBase::Environment::get().getWorld()->getTimeStamp()) {} - bool ActiveSpells::addSpell (const std::string& id, const MWWorld::Ptr& actor) - { - std::pair > effects = getEffectList (id); - bool stacks = effects.second.second; - - bool found = false; - - for (std::vector::const_iterator iter (effects.first.mList.begin()); - iter!=effects.first.mList.end(); ++iter) - { - if (iter->mDuration) - { - found = true; - break; - } - } - - if (!found) - return false; - - TContainer::iterator iter = mSpells.find (id); - - float random = static_cast (std::rand()) / RAND_MAX; - - if (effects.second.first) - { - // ingredient -> special treatment required. - const CreatureStats& creatureStats = MWWorld::Class::get (actor).getCreatureStats (actor); - const NpcStats& npcStats = MWWorld::Class::get (actor).getNpcStats (actor); - - float x = - (npcStats.getSkill (ESM::Skill::Alchemy).getModified() + - 0.2 * creatureStats.getAttribute (1).getModified() - + 0.1 * creatureStats.getAttribute (7).getModified()) - * creatureStats.getFatigueTerm(); - random *= 100; - random = random / std::min (x, 100.0f); - random *= 0.25 * x; - } - - if (iter==mSpells.end() || stacks) - mSpells.insert (std::make_pair (id, - std::make_pair (MWBase::Environment::get().getWorld()->getTimeStamp(), random))); - else - iter->second = std::make_pair (MWBase::Environment::get().getWorld()->getTimeStamp(), random); - - mSpellsChanged = true; - - return true; - } - - void ActiveSpells::removeSpell (const std::string& id) - { - TContainer::iterator iter = mSpells.find (id); - - if (iter!=mSpells.end()) - { - mSpells.erase (iter); - mSpellsChanged = true; - } - } - const MagicEffects& ActiveSpells::getMagicEffects() const { update(); @@ -226,36 +75,31 @@ namespace MWMechanics ActiveSpells::TIterator ActiveSpells::begin() const { - update(); return mSpells.begin(); } ActiveSpells::TIterator ActiveSpells::end() const { - update(); return mSpells.end(); } double ActiveSpells::timeToExpire (const TIterator& iterator) const { - std::pair > effects = getEffectList (iterator->first); + const std::vector& effects = iterator->second.mEffects; int duration = 0; - for (std::vector::const_iterator iter (effects.first.mList.begin()); - iter!=effects.first.mList.end(); ++iter) + for (std::vector::const_iterator iter (effects.begin()); + iter!=effects.end(); ++iter) { if (iter->mDuration > duration) duration = iter->mDuration; } - if (effects.second.first) - duration *= iterator->second.second; - double scaledDuration = duration * MWBase::Environment::get().getWorld()->getTimeScaleFactor()/(60*60); - double usedUp = MWBase::Environment::get().getWorld()->getTimeStamp()-iterator->second.first; + double usedUp = MWBase::Environment::get().getWorld()->getTimeStamp() - iterator->second.mTimeStamp; if (usedUp>=scaledDuration) return 0; @@ -281,4 +125,68 @@ namespace MWMechanics { return mSpells; } + + void ActiveSpells::addSpell(const std::string &id, bool stack, std::vector effects, const std::string &displayName) + { + bool exists = false; + for (TContainer::const_iterator it = begin(); it != end(); ++it) + { + if (id == it->first) + exists = true; + } + + ActiveSpellParams params; + params.mTimeStamp = MWBase::Environment::get().getWorld()->getTimeStamp(); + params.mEffects = effects; + params.mDisplayName = displayName; + + if (!exists || stack) + mSpells.insert (std::make_pair(id, params)); + else + mSpells.find(id)->second = params; + + mSpellsChanged = true; + } + + void ActiveSpells::visitEffectSources(EffectSourceVisitor &visitor) const + { + for (TContainer::const_iterator it = begin(); it != end(); ++it) + { + float timeScale = MWBase::Environment::get().getWorld()->getTimeScaleFactor(); + + for (std::vector::const_iterator effectIt = it->second.mEffects.begin(); + effectIt != it->second.mEffects.end(); ++effectIt) + { + std::string name = it->second.mDisplayName; + + float remainingTime = effectIt->mDuration + + (it->second.mTimeStamp - MWBase::Environment::get().getWorld()->getTimeStamp())*3600/timeScale; + float magnitude = effectIt->mMagnitude; + + if (magnitude) + visitor.visit(effectIt->mKey, name, magnitude, remainingTime); + } + } + } + + void ActiveSpells::purgeAll() + { + mSpells.clear(); + } + + void ActiveSpells::purgeEffect(short effectId) + { + for (TContainer::iterator it = mSpells.begin(); it != mSpells.end(); ++it) + { + for (std::vector::iterator effectIt = it->second.mEffects.begin(); + effectIt != it->second.mEffects.end();) + { + if (effectIt->mKey.mId == effectId) + effectIt = it->second.mEffects.erase(effectIt); + else + effectIt++; + } + } + + } } diff --git a/apps/openmw/mwmechanics/activespells.hpp b/apps/openmw/mwmechanics/activespells.hpp index 8c859b2cb..b3f499c6b 100644 --- a/apps/openmw/mwmechanics/activespells.hpp +++ b/apps/openmw/mwmechanics/activespells.hpp @@ -9,16 +9,7 @@ #include "magiceffects.hpp" -namespace ESM -{ - struct Spell; - struct EffectList; -} - -namespace MWWorld -{ - class Ptr; -} +#include namespace MWMechanics { @@ -30,12 +21,32 @@ namespace MWMechanics { public: - typedef std::multimap > TContainer; + // Parameters of an effect concerning lasting effects. + // Note we are not using ENAMstruct since the magnitude may be modified by magic resistance, etc. + // It could also be a negative magnitude, in case of inversing an effect, e.g. Absorb spell causes damage on target, but heals the caster. + struct Effect + { + float mMagnitude; + EffectKey mKey; + float mDuration; + }; + + struct ActiveSpellParams + { + std::vector mEffects; + MWWorld::TimeStamp mTimeStamp; + std::string mDisplayName; + + // TODO: To handle CASTER_LINKED flag (spell is purged when caster dies), + // we should probably store a handle to the caster here. + }; + + typedef std::multimap TContainer; typedef TContainer::const_iterator TIterator; private: - mutable TContainer mSpells; // spellId, (time of casting, relative magnitude) + mutable TContainer mSpells; mutable MagicEffects mEffects; mutable bool mSpellsChanged; mutable MWWorld::TimeStamp mLastUpdate; @@ -44,25 +55,9 @@ namespace MWMechanics void rebuildEffects() const; - std::pair > getEffectList (const std::string& id) const; - ///< @return (EffectList, (isIngredient, stacks)) - - public: - - ActiveSpells(); - - bool addSpell (const std::string& id, const MWWorld::Ptr& actor); - ///< Overwrites an existing spell with the same ID. If the spell does not have any - /// non-instant effects, it is ignored. - /// - /// \return Has the spell been added? - - void removeSpell (const std::string& id); - - bool isSpellActive (std::string id) const; - ///< case insensitive - - const MagicEffects& getMagicEffects() const; + double timeToExpire (const TIterator& iterator) const; + ///< Returns time (in in-game hours) until the spell pointed to by \a iterator + /// expires. const TContainer& getActiveSpells() const; @@ -70,9 +65,33 @@ namespace MWMechanics TIterator end() const; - double timeToExpire (const TIterator& iterator) const; - ///< Returns time (in in-game hours) until the spell pointed to by \a iterator - /// expires. + public: + + ActiveSpells(); + + /// Add lasting effects + /// + /// \brief addSpell + /// \param id ID for stacking purposes. + /// \param stack If false, the spell is not added if one with the same ID exists already. + /// \param effects + /// \param displayName Name for display in magic menu. + /// + void addSpell (const std::string& id, bool stack, std::vector effects, const std::string& displayName); + + /// Remove all active effects with this id + void purgeEffect (short effectId); + + /// Remove all active effects + void purgeAll (); + + bool isSpellActive (std::string id) const; + ///< case insensitive + + const MagicEffects& getMagicEffects() const; + + void visitEffectSources (MWMechanics::EffectSourceVisitor& visitor) const; + }; } diff --git a/apps/openmw/mwmechanics/actors.cpp b/apps/openmw/mwmechanics/actors.cpp index 42851dea3..22a641b34 100644 --- a/apps/openmw/mwmechanics/actors.cpp +++ b/apps/openmw/mwmechanics/actors.cpp @@ -12,6 +12,8 @@ #include "../mwworld/class.hpp" #include "../mwworld/inventorystore.hpp" #include "../mwworld/player.hpp" +#include "../mwworld/manualref.hpp" +#include "../mwworld/actionequip.hpp" #include "../mwbase/world.hpp" #include "../mwbase/environment.hpp" @@ -22,6 +24,30 @@ #include "creaturestats.hpp" #include "movement.hpp" +#include "../mwbase/environment.hpp" +#include "../mwbase/mechanicsmanager.hpp" + +#include "aicombat.hpp" + +namespace +{ + +void adjustBoundItem (const std::string& item, bool bound, const MWWorld::Ptr& actor) +{ + if (bound) + { + MWWorld::Ptr newPtr = *actor.getClass().getContainerStore(actor).add(item, 1, actor); + MWWorld::ActionEquip action(newPtr); + action.execute(actor); + } + else + { + actor.getClass().getContainerStore(actor).remove(item, 1, actor); + } +} + +} + namespace MWMechanics { void Actors::updateActor (const MWWorld::Ptr& ptr, float duration) @@ -29,13 +55,48 @@ namespace MWMechanics // magic effects adjustMagicEffects (ptr); calculateDynamicStats (ptr); - calculateCreatureStatModifiers (ptr); + calculateCreatureStatModifiers (ptr, duration); if(!MWBase::Environment::get().getWindowManager()->isGuiMode()) { // AI - CreatureStats& creatureStats = MWWorld::Class::get (ptr).getCreatureStats (ptr); - creatureStats.getAiSequence().execute (ptr); + if(MWBase::Environment::get().getMechanicsManager()->isAIActive()) + { + CreatureStats& creatureStats = MWWorld::Class::get (ptr).getCreatureStats (ptr); + //engage combat or not? + if(ptr != MWBase::Environment::get().getWorld()->getPlayer().getPlayer() && !creatureStats.isHostile()) + { + ESM::Position playerpos = MWBase::Environment::get().getWorld()->getPlayer().getPlayer().getRefData().getPosition(); + ESM::Position actorpos = ptr.getRefData().getPosition(); + float d = sqrt((actorpos.pos[0] - playerpos.pos[0])*(actorpos.pos[0] - playerpos.pos[0]) + +(actorpos.pos[1] - playerpos.pos[1])*(actorpos.pos[1] - playerpos.pos[1]) + +(actorpos.pos[2] - playerpos.pos[2])*(actorpos.pos[2] - playerpos.pos[2])); + float fight = ptr.getClass().getCreatureStats(ptr).getAiSetting(1); + float disp = 100; //creatures don't have disposition, so set it to 100 by default + if(ptr.getTypeName() == typeid(ESM::NPC).name()) + { + disp = MWBase::Environment::get().getMechanicsManager()->getDerivedDisposition(ptr); + } + bool LOS = MWBase::Environment::get().getWorld()->getLOS(ptr,MWBase::Environment::get().getWorld()->getPlayer().getPlayer()); + if( ( (fight == 100 ) + || (fight >= 95 && d <= 3000) + || (fight >= 90 && d <= 2000) + || (fight >= 80 && d <= 1000) + || (fight >= 80 && disp <= 40) + || (fight >= 70 && disp <= 35 && d <= 1000) + || (fight >= 60 && disp <= 30 && d <= 1000) + || (fight >= 50 && disp == 0) + || (fight >= 40 && disp <= 10 && d <= 500) ) + && LOS + ) + { + creatureStats.getAiSequence().stack(AiCombat("player")); + creatureStats.setHostile(true); + } + } + + creatureStats.getAiSequence().execute (ptr,duration); + } // fatigue restoration calculateRestoration(ptr, duration); @@ -47,6 +108,7 @@ namespace MWMechanics if(!paused) { updateDrowning(ptr, duration); + calculateNpcStatModifiers(ptr); updateEquippedLight(ptr, duration); } } @@ -98,6 +160,8 @@ namespace MWMechanics void Actors::calculateRestoration (const MWWorld::Ptr& ptr, float duration) { + if (ptr.getClass().getCreatureStats(ptr).isDead()) + return; CreatureStats& stats = MWWorld::Class::get (ptr).getCreatureStats (ptr); const MWWorld::Store& settings = MWBase::Environment::get().getWorld()->getStore().get(); @@ -144,7 +208,7 @@ namespace MWMechanics stats.setFatigue (fatigue); } - void Actors::calculateCreatureStatModifiers (const MWWorld::Ptr& ptr) + void Actors::calculateCreatureStatModifiers (const MWWorld::Ptr& ptr, float duration) { CreatureStats &creatureStats = MWWorld::Class::get(ptr).getCreatureStats(ptr); const MagicEffects &effects = creatureStats.getMagicEffects(); @@ -154,7 +218,8 @@ namespace MWMechanics { Stat stat = creatureStats.getAttribute(i); stat.setModifier(effects.get(EffectKey(ESM::MagicEffect::FortifyAttribute, i)).mMagnitude - - effects.get(EffectKey(ESM::MagicEffect::DrainAttribute, i)).mMagnitude); + effects.get(EffectKey(ESM::MagicEffect::DrainAttribute, i)).mMagnitude - + effects.get(EffectKey(ESM::MagicEffect::AbsorbAttribute, i)).mMagnitude); creatureStats.setAttribute(i, stat); } @@ -163,11 +228,178 @@ namespace MWMechanics for(int i = 0;i < 3;++i) { DynamicStat stat = creatureStats.getDynamic(i); - stat.setModifier(effects.get(EffectKey(80+i)).mMagnitude - - effects.get(EffectKey(18+i)).mMagnitude); + stat.setModifier(effects.get(EffectKey(ESM::MagicEffect::FortifyHealth+i)).mMagnitude - + effects.get(EffectKey(ESM::MagicEffect::DrainHealth+i)).mMagnitude); + + + float currentDiff = creatureStats.getMagicEffects().get(EffectKey(ESM::MagicEffect::RestoreHealth+i)).mMagnitude + - creatureStats.getMagicEffects().get(EffectKey(ESM::MagicEffect::DamageHealth+i)).mMagnitude + - creatureStats.getMagicEffects().get(EffectKey(ESM::MagicEffect::AbsorbHealth+i)).mMagnitude; + stat.setCurrent(stat.getCurrent() + currentDiff * duration); creatureStats.setDynamic(i, stat); } + + // Apply damage ticks + int damageEffects[] = { + ESM::MagicEffect::FireDamage, ESM::MagicEffect::ShockDamage, ESM::MagicEffect::FrostDamage, ESM::MagicEffect::Poison, + ESM::MagicEffect::SunDamage + }; + + DynamicStat health = creatureStats.getHealth(); + for (unsigned int i=0; iisExterior()) + continue; + float time = MWBase::Environment::get().getWorld()->getTimeStamp().getHour(); + float timeDiff = std::min(7.f, std::max(0.f, std::abs(time - 13))); + float damageScale = 1.f - timeDiff / 7.f; + // When cloudy, the sun damage effect is halved + static float fMagicSunBlockedMult = MWBase::Environment::get().getWorld()->getStore().get().find( + "fMagicSunBlockedMult")->getFloat(); + + int weather = MWBase::Environment::get().getWorld()->getCurrentWeather(); + if (weather > 1) + damageScale *= fMagicSunBlockedMult; + health.setCurrent(health.getCurrent() - magnitude * duration * damageScale); + } + else + health.setCurrent(health.getCurrent() - magnitude * duration); + + } + creatureStats.setHealth(health); + + // TODO: dirty flag for magic effects to avoid some unnecessary work below? + + // Update bound effects + static std::map boundItemsMap; + if (boundItemsMap.empty()) + { + boundItemsMap[ESM::MagicEffect::BoundBattleAxe] = "battle_axe"; + boundItemsMap[ESM::MagicEffect::BoundBoots] = "boots"; + boundItemsMap[ESM::MagicEffect::BoundCuirass] = "cuirass"; + boundItemsMap[ESM::MagicEffect::BoundDagger] = "dagger"; + boundItemsMap[ESM::MagicEffect::BoundGloves] = "gauntlet"; // Note: needs both _left and _right variants, see below + boundItemsMap[ESM::MagicEffect::BoundHelm] = "helm"; + boundItemsMap[ESM::MagicEffect::BoundLongbow] = "longbow"; + boundItemsMap[ESM::MagicEffect::BoundLongsword] = "longsword"; + boundItemsMap[ESM::MagicEffect::BoundMace] = "mace"; + boundItemsMap[ESM::MagicEffect::BoundShield] = "shield"; + boundItemsMap[ESM::MagicEffect::BoundSpear] = "spear"; + } + + for (std::map::iterator it = boundItemsMap.begin(); it != boundItemsMap.end(); ++it) + { + bool found = creatureStats.mBoundItems.find(it->first) != creatureStats.mBoundItems.end(); + int magnitude = creatureStats.getMagicEffects().get(EffectKey(it->first)).mMagnitude; + if (found != (magnitude > 0)) + { + std::string item = "bound_" + it->second; + if (it->first == ESM::MagicEffect::BoundGloves) + { + adjustBoundItem(item + "_left", magnitude > 0, ptr); + adjustBoundItem(item + "_right", magnitude > 0, ptr); + } + else + adjustBoundItem(item, magnitude > 0, ptr); + + if (magnitude > 0) + creatureStats.mBoundItems.insert(it->first); + else + creatureStats.mBoundItems.erase(it->first); + } + } + + // Update summon effects + static std::map summonMap; + if (summonMap.empty()) + { + summonMap[ESM::MagicEffect::SummonAncestralGhost] = "ancestor_ghost_summon"; + summonMap[ESM::MagicEffect::SummonBear] = "BM_bear_black_summon"; + summonMap[ESM::MagicEffect::SummonBonelord] = "bonelord_summon"; + summonMap[ESM::MagicEffect::SummonBonewalker] = "bonewalker_summon"; + summonMap[ESM::MagicEffect::SummonBonewolf] = "BM_wolf_bone_summon"; + summonMap[ESM::MagicEffect::SummonCenturionSphere] = "centurion_sphere_summon"; + summonMap[ESM::MagicEffect::SummonClannfear] = "clannfear_summon"; + summonMap[ESM::MagicEffect::SummonDaedroth] = "daedroth_summon"; + summonMap[ESM::MagicEffect::SummonDremora] = "dremora_summon"; + summonMap[ESM::MagicEffect::SummonFabricant] = "fabricant_summon"; + summonMap[ESM::MagicEffect::SummonFlameAtronach] = "atronach_flame_summon"; + summonMap[ESM::MagicEffect::SummonFrostAtronach] = "atronach_frost_summon"; + summonMap[ESM::MagicEffect::SummonGoldenSaint] = "golden saint_summon"; + summonMap[ESM::MagicEffect::SummonGreaterBonewalker] = "bonewalker_greater_summ"; + summonMap[ESM::MagicEffect::SummonHunger] = "hunger_summon"; + summonMap[ESM::MagicEffect::SummonScamp] = "scamp_summon"; + summonMap[ESM::MagicEffect::SummonSkeletalMinion] = "skeleton_summon"; + summonMap[ESM::MagicEffect::SummonStormAtronach] = "atronach_storm_summon"; + summonMap[ESM::MagicEffect::SummonWingedTwilight] = "winged twilight_summon"; + summonMap[ESM::MagicEffect::SummonWolf] = "BM_wolf_grey_summon"; + } + + for (std::map::iterator it = summonMap.begin(); it != summonMap.end(); ++it) + { + bool found = creatureStats.mSummonedCreatures.find(it->first) != creatureStats.mSummonedCreatures.end(); + int magnitude = creatureStats.getMagicEffects().get(EffectKey(it->first)).mMagnitude; + if (found != (magnitude > 0)) + { + if (magnitude > 0) + { + ESM::Position ipos = ptr.getRefData().getPosition(); + Ogre::Vector3 pos(ipos.pos[0],ipos.pos[1],ipos.pos[2]); + Ogre::Quaternion rot(Ogre::Radian(-ipos.rot[2]), Ogre::Vector3::UNIT_Z); + const float distance = 50; + pos = pos + distance*rot.yAxis(); + ipos.pos[0] = pos.x; + ipos.pos[1] = pos.y; + ipos.pos[2] = pos.z; + ipos.rot[0] = 0; + ipos.rot[1] = 0; + ipos.rot[2] = 0; + + MWWorld::CellStore* store = ptr.getCell(); + MWWorld::ManualRef ref(MWBase::Environment::get().getWorld()->getStore(), it->second, 1); + ref.getPtr().getCellRef().mPos = ipos; + + // TODO: Add AI to follow player and fight for him + + creatureStats.mSummonedCreatures.insert(std::make_pair(it->first, + MWBase::Environment::get().getWorld()->safePlaceObject(ref.getPtr(),*store,ipos).getRefData().getHandle())); + + } + else + { + std::string handle = creatureStats.mSummonedCreatures[it->first]; + // TODO: Show death animation before deleting? We shouldn't allow looting the corpse while the animation + // plays though, which is a rather lame exploit in vanilla. + MWWorld::Ptr ptr = MWBase::Environment::get().getWorld()->searchPtrViaHandle(handle); + if (!ptr.isEmpty()) + { + MWBase::Environment::get().getWorld()->deleteObject(ptr); + creatureStats.mSummonedCreatures.erase(it->first); + } + } + } + } + } + + void Actors::calculateNpcStatModifiers (const MWWorld::Ptr& ptr) + { + NpcStats &npcStats = MWWorld::Class::get(ptr).getNpcStats(ptr); + const MagicEffects &effects = npcStats.getMagicEffects(); + + // skills + for(int i = 0;i < ESM::Skill::Length;++i) + { + Stat& skill = npcStats.getSkill(i); + skill.setModifier(effects.get(EffectKey(ESM::MagicEffect::FortifySkill, i)).mMagnitude - + effects.get(EffectKey(ESM::MagicEffect::DrainSkill, i)).mMagnitude - + effects.get(EffectKey(ESM::MagicEffect::AbsorbSkill, i)).mMagnitude); + } } void Actors::updateDrowning(const MWWorld::Ptr& ptr, float duration) @@ -229,7 +461,7 @@ namespace MWMechanics heldIter->getClass().setRemainingUsageTime(*heldIter, timeRemaining); else { - heldIter->getRefData().setCount(0); // remove it + inventoryStore.remove(*heldIter, 1, ptr); // remove it return; } } @@ -238,7 +470,7 @@ namespace MWMechanics // Both NPC and player lights extinguish in water. if(MWBase::Environment::get().getWorld()->isSwimming(ptr)) { - heldIter->getRefData().setCount(0); // remove it + inventoryStore.remove(*heldIter, 1, ptr); // remove it // ...But, only the player makes a sound. if(isPlayer) @@ -248,7 +480,7 @@ namespace MWMechanics } } - Actors::Actors() : mDuration (0) {} + Actors::Actors() {} void Actors::addActor (const MWWorld::Ptr& ptr) { @@ -284,12 +516,12 @@ namespace MWMechanics } } - void Actors::dropActors (const MWWorld::Ptr::CellStore *cellStore) + void Actors::dropActors (const MWWorld::Ptr::CellStore *cellStore, const MWWorld::Ptr& ignore) { PtrControllerMap::iterator iter = mActors.begin(); while(iter != mActors.end()) { - if(iter->first.getCell()==cellStore) + if(iter->first.getCell()==cellStore && iter->first != ignore) { delete iter->second; mActors.erase(iter++); @@ -301,13 +533,8 @@ namespace MWMechanics void Actors::update (float duration, bool paused) { - mDuration += duration; - - //if (mDuration>=0.25) + if (!paused) { - float totalDuration = mDuration; - mDuration = 0; - for(PtrControllerMap::iterator iter(mActors.begin());iter != mActors.end();iter++) { const MWWorld::Class &cls = MWWorld::Class::get(iter->first); @@ -319,9 +546,9 @@ namespace MWMechanics if(iter->second->isDead()) iter->second->resurrect(); - updateActor(iter->first, totalDuration); + updateActor(iter->first, duration); if(iter->first.getTypeName() == typeid(ESM::NPC).name()) - updateNpc(iter->first, totalDuration, paused); + updateNpc(iter->first, duration, paused); if(!stats.isDead()) continue; @@ -357,11 +584,17 @@ namespace MWMechanics if(!paused) { + // Note: we need to do this before any of the animations are updated. + // Reaching the text keys may trigger Hit / Spellcast (and as such, particles), + // so updating VFX immediately after that would just remove the particle effects instantly. + // There needs to be a magic effect update in between. + for(PtrControllerMap::iterator iter(mActors.begin());iter != mActors.end();++iter) + iter->second->updateContinuousVfx(); + for(PtrControllerMap::iterator iter(mActors.begin());iter != mActors.end();++iter) iter->second->update(duration); } } - void Actors::restoreDynamicStats() { for(PtrControllerMap::iterator iter(mActors.begin());iter != mActors.end();++iter) diff --git a/apps/openmw/mwmechanics/actors.hpp b/apps/openmw/mwmechanics/actors.hpp index a77e52ba3..6afdefdbd 100644 --- a/apps/openmw/mwmechanics/actors.hpp +++ b/apps/openmw/mwmechanics/actors.hpp @@ -30,15 +30,16 @@ namespace MWMechanics std::map mDeathCount; - float mDuration; - void updateNpc(const MWWorld::Ptr &ptr, float duration, bool paused); + + void adjustMagicEffects (const MWWorld::Ptr& creature); void calculateDynamicStats (const MWWorld::Ptr& ptr); - void calculateCreatureStatModifiers (const MWWorld::Ptr& ptr); + void calculateCreatureStatModifiers (const MWWorld::Ptr& ptr, float duration); + void calculateNpcStatModifiers (const MWWorld::Ptr& ptr); void calculateRestoration (const MWWorld::Ptr& ptr, float duration); @@ -50,6 +51,10 @@ namespace MWMechanics Actors(); + /// Update magic effects for an actor. Usually done automatically once per frame, but if we're currently + /// paused we may want to do it manually (after equipping permanent enchantment) + void updateMagicEffects (const MWWorld::Ptr& ptr) { adjustMagicEffects(ptr); } + void addActor (const MWWorld::Ptr& ptr); ///< Register an actor for stats management /// @@ -63,8 +68,8 @@ namespace MWMechanics void updateActor(const MWWorld::Ptr &old, const MWWorld::Ptr& ptr); ///< Updates an actor with a new Ptr - void dropActors (const MWWorld::CellStore *cellStore); - ///< Deregister all actors in the given cell. + void dropActors (const MWWorld::CellStore *cellStore, const MWWorld::Ptr& ignore); + ///< Deregister all actors (except for \a ignore) in the given cell. void update (float duration, bool paused); ///< Update actor stats and store desired velocity vectors in \a movement diff --git a/apps/openmw/mwmechanics/aiactivate.cpp b/apps/openmw/mwmechanics/aiactivate.cpp index b94c8c259..ee0dcf96e 100644 --- a/apps/openmw/mwmechanics/aiactivate.cpp +++ b/apps/openmw/mwmechanics/aiactivate.cpp @@ -9,7 +9,7 @@ MWMechanics::AiActivate *MWMechanics::AiActivate::clone() const { return new AiActivate(*this); } -bool MWMechanics::AiActivate::execute (const MWWorld::Ptr& actor) +bool MWMechanics::AiActivate::execute (const MWWorld::Ptr& actor,float duration) { std::cout << "AiActivate completed.\n"; return true; diff --git a/apps/openmw/mwmechanics/aiactivate.hpp b/apps/openmw/mwmechanics/aiactivate.hpp index 7f3d4016d..f922e238c 100644 --- a/apps/openmw/mwmechanics/aiactivate.hpp +++ b/apps/openmw/mwmechanics/aiactivate.hpp @@ -12,7 +12,7 @@ namespace MWMechanics public: AiActivate(const std::string &objectId); virtual AiActivate *clone() const; - virtual bool execute (const MWWorld::Ptr& actor); + virtual bool execute (const MWWorld::Ptr& actor,float duration); ///< \return Package completed? virtual int getTypeId() const; diff --git a/apps/openmw/mwmechanics/aicombat.cpp b/apps/openmw/mwmechanics/aicombat.cpp new file mode 100644 index 000000000..39a97df6c --- /dev/null +++ b/apps/openmw/mwmechanics/aicombat.cpp @@ -0,0 +1,148 @@ +#include "aicombat.hpp" + +#include "movement.hpp" + +#include "../mwworld/class.hpp" +#include "../mwworld/player.hpp" +#include "../mwworld/timestamp.hpp" +#include "../mwbase/world.hpp" +#include "../mwbase/environment.hpp" +#include "../mwbase/mechanicsmanager.hpp" + +#include "creaturestats.hpp" +#include "npcstats.hpp" + +#include "OgreMath.h" + +namespace +{ + static float sgn(float a) + { + if(a > 0) + return 1.0; + return -1.0; + } +} + +namespace MWMechanics +{ + + AiCombat::AiCombat(const std::string &targetId) + :mTargetId(targetId),mTimer(0),mTimer2(0) + { + } + + bool AiCombat::execute (const MWWorld::Ptr& actor,float duration) + { + if(!MWWorld::Class::get(actor).getCreatureStats(actor).isHostile()) return true; + + const MWWorld::Ptr target = MWBase::Environment::get().getWorld()->getPtr(mTargetId, false); + + if(MWWorld::Class::get(actor).getCreatureStats(actor).getHealth().getCurrent() <= 0) return true; + + if(actor.getTypeName() == typeid(ESM::NPC).name()) + { + MWWorld::Class::get(actor). + MWWorld::Class::get(actor).setStance(actor, MWWorld::Class::Run,true); + MWMechanics::DrawState_ state = MWWorld::Class::get(actor).getNpcStats(actor).getDrawState(); + if (state == MWMechanics::DrawState_Spell || state == MWMechanics::DrawState_Nothing) + MWWorld::Class::get(actor).getNpcStats(actor).setDrawState(MWMechanics::DrawState_Weapon); + //MWWorld::Class::get(actor).getCreatureStats(actor).setAttackingOrSpell(true); + } + ESM::Position pos = actor.getRefData().getPosition(); + const ESM::Pathgrid *pathgrid = + MWBase::Environment::get().getWorld()->getStore().get().search(*actor.getCell()->mCell); + + float xCell = 0; + float yCell = 0; + + if (actor.getCell()->mCell->isExterior()) + { + xCell = actor.getCell()->mCell->mData.mX * ESM::Land::REAL_SIZE; + yCell = actor.getCell()->mCell->mData.mY * ESM::Land::REAL_SIZE; + } + + ESM::Pathgrid::Point dest; + dest.mX = target.getRefData().getPosition().pos[0]; + dest.mY = target.getRefData().getPosition().pos[1]; + dest.mZ = target.getRefData().getPosition().pos[2]; + + ESM::Pathgrid::Point start; + start.mX = pos.pos[0]; + start.mY = pos.pos[1]; + start.mZ = pos.pos[2]; + + mTimer2 = mTimer2 + duration; + + if(!mPathFinder.isPathConstructed()) + mPathFinder.buildPath(start, dest, pathgrid, xCell, yCell, true); + else + { + mPathFinder2.buildPath(start, dest, pathgrid, xCell, yCell, true); + ESM::Pathgrid::Point lastPt = mPathFinder.getPath().back(); + if((mTimer2 > 0.25)&&(mPathFinder2.getPathSize() < mPathFinder.getPathSize() || + (dest.mX - lastPt.mX)*(dest.mX - lastPt.mX)+(dest.mY - lastPt.mY)*(dest.mY - lastPt.mY)+(dest.mZ - lastPt.mZ)*(dest.mZ - lastPt.mZ) > 200*200)) + { + mTimer2 = 0; + mPathFinder = mPathFinder2; + } + } + + mPathFinder.checkPathCompleted(pos.pos[0],pos.pos[1],pos.pos[2]); + + float zAngle = mPathFinder.getZAngleToNext(pos.pos[0], pos.pos[1]); + MWBase::Environment::get().getWorld()->rotateObject(actor, 0, 0, zAngle, false); + MWWorld::Class::get(actor).getMovementSettings(actor).mPosition[1] = 1; + + + float range = 100; + MWWorld::Class::get(actor).getCreatureStats(actor).setAttackingOrSpell(false); + if((dest.mX - start.mX)*(dest.mX - start.mX)+(dest.mY - start.mY)*(dest.mY - start.mY)+(dest.mZ - start.mZ)*(dest.mZ - start.mZ) + < range*range) + { + float directionX = dest.mX - start.mX; + float directionY = dest.mY - start.mY; + float directionResult = sqrt(directionX * directionX + directionY * directionY); + + zAngle = Ogre::Radian( acos(directionY / directionResult) * sgn(asin(directionX / directionResult)) ).valueDegrees(); + MWBase::Environment::get().getWorld()->rotateObject(actor, 0, 0, zAngle, false); + + mPathFinder.clearPath(); + + if(mTimer == 0) + { + MWWorld::Class::get(actor).getCreatureStats(actor).setAttackingOrSpell(false); + //mTimer = mTimer + duration; + } + if( mTimer > 1) + { + MWWorld::Class::get(actor).getCreatureStats(actor).setAttackingOrSpell(true); + mTimer = 0; + } + else + { + mTimer = mTimer + duration; + } + + MWWorld::Class::get(actor).getMovementSettings(actor).mPosition[1] = 0; + //MWWorld::Class::get(actor).getCreatureStats(actor).setAttackingOrSpell(!MWWorld::Class::get(actor).getCreatureStats(actor).getAttackingOrSpell()); + } + return false; + } + + int AiCombat::getTypeId() const + { + return 5; + } + + unsigned int AiCombat::getPriority() const + { + return 1; + } + + AiCombat *MWMechanics::AiCombat::clone() const + { + return new AiCombat(*this); + } +} + diff --git a/apps/openmw/mwmechanics/aicombat.hpp b/apps/openmw/mwmechanics/aicombat.hpp new file mode 100644 index 000000000..fa71e261f --- /dev/null +++ b/apps/openmw/mwmechanics/aicombat.hpp @@ -0,0 +1,36 @@ +#ifndef GAME_MWMECHANICS_AICOMBAT_H +#define GAME_MWMECHANICS_AICOMBAT_H + +#include "aipackage.hpp" + +#include "pathfinding.hpp" + +#include "movement.hpp" + +namespace MWMechanics +{ + class AiCombat : public AiPackage + { + public: + AiCombat(const std::string &targetId); + + virtual AiCombat *clone() const; + + virtual bool execute (const MWWorld::Ptr& actor,float duration); + ///< \return Package completed? + + virtual int getTypeId() const; + + virtual unsigned int getPriority() const; + + private: + std::string mTargetId; + + PathFinder mPathFinder; + PathFinder mPathFinder2; + float mTimer; + float mTimer2; + }; +} + +#endif \ No newline at end of file diff --git a/apps/openmw/mwmechanics/aiescort.cpp b/apps/openmw/mwmechanics/aiescort.cpp index 556e0b126..3615c8546 100644 --- a/apps/openmw/mwmechanics/aiescort.cpp +++ b/apps/openmw/mwmechanics/aiescort.cpp @@ -71,7 +71,7 @@ namespace MWMechanics return new AiEscort(*this); } - bool AiEscort::execute (const MWWorld::Ptr& actor) + bool AiEscort::execute (const MWWorld::Ptr& actor,float duration) { // If AiEscort has ran for as long or longer then the duration specified // and the duration is not infinite, the package is complete. diff --git a/apps/openmw/mwmechanics/aiescort.hpp b/apps/openmw/mwmechanics/aiescort.hpp index 3ae604035..f3f6d2bd9 100644 --- a/apps/openmw/mwmechanics/aiescort.hpp +++ b/apps/openmw/mwmechanics/aiescort.hpp @@ -18,7 +18,7 @@ namespace MWMechanics virtual AiEscort *clone() const; - virtual bool execute (const MWWorld::Ptr& actor); + virtual bool execute (const MWWorld::Ptr& actor,float duration); ///< \return Package completed? virtual int getTypeId() const; diff --git a/apps/openmw/mwmechanics/aifollow.cpp b/apps/openmw/mwmechanics/aifollow.cpp index dab9e0283..73bf9259a 100644 --- a/apps/openmw/mwmechanics/aifollow.cpp +++ b/apps/openmw/mwmechanics/aifollow.cpp @@ -15,7 +15,7 @@ MWMechanics::AiFollow *MWMechanics::AiFollow::clone() const return new AiFollow(*this); } - bool MWMechanics::AiFollow::execute (const MWWorld::Ptr& actor) + bool MWMechanics::AiFollow::execute (const MWWorld::Ptr& actor,float duration) { std::cout << "AiFollow completed.\n"; return true; diff --git a/apps/openmw/mwmechanics/aifollow.hpp b/apps/openmw/mwmechanics/aifollow.hpp index 0b37b0a2d..39df024e4 100644 --- a/apps/openmw/mwmechanics/aifollow.hpp +++ b/apps/openmw/mwmechanics/aifollow.hpp @@ -13,7 +13,7 @@ namespace MWMechanics AiFollow(const std::string &ActorId,float duration, float X, float Y, float Z); AiFollow(const std::string &ActorId,const std::string &CellId,float duration, float X, float Y, float Z); virtual AiFollow *clone() const; - virtual bool execute (const MWWorld::Ptr& actor); + virtual bool execute (const MWWorld::Ptr& actor,float duration); ///< \return Package completed? virtual int getTypeId() const; diff --git a/apps/openmw/mwmechanics/aipackage.hpp b/apps/openmw/mwmechanics/aipackage.hpp index d286fbba8..5832198da 100644 --- a/apps/openmw/mwmechanics/aipackage.hpp +++ b/apps/openmw/mwmechanics/aipackage.hpp @@ -17,11 +17,14 @@ namespace MWMechanics virtual AiPackage *clone() const = 0; - virtual bool execute (const MWWorld::Ptr& actor) = 0; + virtual bool execute (const MWWorld::Ptr& actor,float duration) = 0; ///< \return Package completed? virtual int getTypeId() const = 0; ///< 0: Wanter, 1 Travel, 2 Escort, 3 Follow, 4 Activate + + virtual unsigned int getPriority() const {return 0;} + ///< higher number is higher priority (0 beeing the lowest) }; } diff --git a/apps/openmw/mwmechanics/aisequence.cpp b/apps/openmw/mwmechanics/aisequence.cpp index 2f06b849a..6d461e5f6 100644 --- a/apps/openmw/mwmechanics/aisequence.cpp +++ b/apps/openmw/mwmechanics/aisequence.cpp @@ -8,6 +8,14 @@ #include "aitravel.hpp" #include "aifollow.hpp" #include "aiactivate.hpp" +#include "aicombat.hpp" + +#include "../mwworld/class.hpp" +#include "creaturestats.hpp" +#include "npcstats.hpp" +#include "../mwbase/environment.hpp" +#include "../mwbase/world.hpp" +#include "../mwworld/player.hpp" void MWMechanics::AiSequence::copy (const AiSequence& sequence) { @@ -29,6 +37,7 @@ MWMechanics::AiSequence& MWMechanics::AiSequence::operator= (const AiSequence& s { clear(); copy (sequence); + mDone = sequence.mDone; } return *this; @@ -52,17 +61,20 @@ bool MWMechanics::AiSequence::isPackageDone() const return mDone; } -void MWMechanics::AiSequence::execute (const MWWorld::Ptr& actor) +void MWMechanics::AiSequence::execute (const MWWorld::Ptr& actor,float duration) { - if (!mPackages.empty()) + if(actor != MWBase::Environment::get().getWorld()->getPlayer().getPlayer()) { - if (mPackages.front()->execute (actor)) + if (!mPackages.empty()) { - mPackages.erase (mPackages.begin()); - mDone = true; + if (mPackages.front()->execute (actor,duration)) + { + mPackages.erase (mPackages.begin()); + mDone = true; + } + else + mDone = false; } - else - mDone = false; } } @@ -76,7 +88,14 @@ void MWMechanics::AiSequence::clear() void MWMechanics::AiSequence::stack (const AiPackage& package) { - mPackages.push_front (package.clone()); + for(std::list::iterator it = mPackages.begin(); it != mPackages.end(); it++) + { + if(mPackages.front()->getPriority() <= package.getPriority()) + mPackages.insert(it,package.clone()); + } + + if(mPackages.empty()) + mPackages.push_front (package.clone()); } void MWMechanics::AiSequence::queue (const AiPackage& package) diff --git a/apps/openmw/mwmechanics/aisequence.hpp b/apps/openmw/mwmechanics/aisequence.hpp index 9f70daeb8..0976ef099 100644 --- a/apps/openmw/mwmechanics/aisequence.hpp +++ b/apps/openmw/mwmechanics/aisequence.hpp @@ -18,6 +18,7 @@ namespace MWMechanics class AiSequence { std::list mPackages; + bool mDone; void copy (const AiSequence& sequence); @@ -33,17 +34,17 @@ namespace MWMechanics virtual ~AiSequence(); int getTypeId() const; - ///< -1: None, 0: Wanter, 1 Travel, 2 Escort, 3 Follow, 4 Activate + ///< -1: None, 0: Wanter, 1 Travel, 2 Escort, 3 Follow, 4 Activate, 5 Combat bool isPackageDone() const; ///< Has a package been completed during the last update? - void execute (const MWWorld::Ptr& actor); + void execute (const MWWorld::Ptr& actor,float duration); ///< Execute package. void clear(); ///< Remove all packages. - + void stack (const AiPackage& package); ///< Add \a package to the front of the sequence (suspends current package) diff --git a/apps/openmw/mwmechanics/aitravel.cpp b/apps/openmw/mwmechanics/aitravel.cpp index d47a49c70..08d758638 100644 --- a/apps/openmw/mwmechanics/aitravel.cpp +++ b/apps/openmw/mwmechanics/aitravel.cpp @@ -31,7 +31,7 @@ namespace MWMechanics return new AiTravel(*this); } - bool AiTravel::execute (const MWWorld::Ptr& actor) + bool AiTravel::execute (const MWWorld::Ptr& actor,float duration) { MWBase::World *world = MWBase::Environment::get().getWorld(); ESM::Position pos = actor.getRefData().getPosition(); diff --git a/apps/openmw/mwmechanics/aitravel.hpp b/apps/openmw/mwmechanics/aitravel.hpp index 6eb9af8ce..b479dfd43 100644 --- a/apps/openmw/mwmechanics/aitravel.hpp +++ b/apps/openmw/mwmechanics/aitravel.hpp @@ -13,7 +13,7 @@ namespace MWMechanics AiTravel(float x, float y, float z); virtual AiTravel *clone() const; - virtual bool execute (const MWWorld::Ptr& actor); + virtual bool execute (const MWWorld::Ptr& actor,float duration); ///< \return Package completed? virtual int getTypeId() const; diff --git a/apps/openmw/mwmechanics/aiwander.cpp b/apps/openmw/mwmechanics/aiwander.cpp index 96a41883b..f66f7ca62 100644 --- a/apps/openmw/mwmechanics/aiwander.cpp +++ b/apps/openmw/mwmechanics/aiwander.cpp @@ -63,7 +63,7 @@ namespace MWMechanics return new AiWander(*this); } - bool AiWander::execute (const MWWorld::Ptr& actor) + bool AiWander::execute (const MWWorld::Ptr& actor,float duration) { MWBase::World *world = MWBase::Environment::get().getWorld(); if(mDuration) @@ -144,12 +144,12 @@ namespace MWMechanics mCurrentNode = mAllowedNodes[index]; mAllowedNodes.erase(mAllowedNodes.begin() + index); } - - if(mAllowedNodes.empty()) - mDistance = 0; } } + if(mAllowedNodes.empty()) + mDistance = 0; + // Don't try to move if you are in a new cell (ie: positioncell command called) but still play idles. if(mDistance && (mCellX != actor.getCell()->mCell->mData.mX || mCellY != actor.getCell()->mCell->mData.mY)) mDistance = 0; @@ -200,6 +200,7 @@ namespace MWMechanics { if(!mPathFinder.isPathConstructed()) { + assert(mAllowedNodes.size()); unsigned int randNode = (int)(rand() / ((double)RAND_MAX + 1) * mAllowedNodes.size()); Ogre::Vector3 destNodePos(mAllowedNodes[randNode].mX, mAllowedNodes[randNode].mY, mAllowedNodes[randNode].mZ); diff --git a/apps/openmw/mwmechanics/aiwander.hpp b/apps/openmw/mwmechanics/aiwander.hpp index c82ccc215..48bc62c62 100644 --- a/apps/openmw/mwmechanics/aiwander.hpp +++ b/apps/openmw/mwmechanics/aiwander.hpp @@ -16,7 +16,7 @@ namespace MWMechanics AiWander(int distance, int duration, int timeOfDay, const std::vector& idle, bool repeat); virtual AiPackage *clone() const; - virtual bool execute (const MWWorld::Ptr& actor); + virtual bool execute (const MWWorld::Ptr& actor,float duration); ///< \return Package completed? virtual int getTypeId() const; ///< 0: Wander diff --git a/apps/openmw/mwmechanics/alchemy.cpp b/apps/openmw/mwmechanics/alchemy.cpp index 1d992be41..f994c28b8 100644 --- a/apps/openmw/mwmechanics/alchemy.cpp +++ b/apps/openmw/mwmechanics/alchemy.cpp @@ -30,13 +30,13 @@ std::set MWMechanics::Alchemy::listEffects() const { std::map effects; - + for (TIngredientsIterator iter (mIngredients.begin()); iter!=mIngredients.end(); ++iter) { if (!iter->isEmpty()) { const MWWorld::LiveCellRef *ingredient = iter->get(); - + for (int i=0; i<4; ++i) if (ingredient->mBase->mData.mEffectID[i]!=-1) { @@ -48,13 +48,13 @@ std::set MWMechanics::Alchemy::listEffects() const } } } - + std::set effects2; - + for (std::map::const_iterator iter (effects.begin()); iter!=effects.end(); ++iter) if (iter->second>1) effects2.insert (iter->first); - + return effects2; } @@ -67,7 +67,7 @@ void MWMechanics::Alchemy::applyTools (int flags, float& value) const int tool = negative ? ESM::Apparatus::Retort : ESM::Apparatus::Albemic; int setup = 0; - + if (!mTools[tool].isEmpty() && !mTools[ESM::Apparatus::Calcinator].isEmpty()) setup = 1; else if (!mTools[tool].isEmpty()) @@ -82,23 +82,23 @@ void MWMechanics::Alchemy::applyTools (int flags, float& value) const mTools[ESM::Apparatus::Calcinator].get()->mBase->mData.mQuality : 0; float quality = 1; - + switch (setup) { case 1: - + quality = negative ? 2 * toolQuality + 3 * calcinatorQuality : (magnitude && duration ? 2 * toolQuality + calcinatorQuality : 2/3.0 * (toolQuality + calcinatorQuality) + 0.5); break; - + case 2: - + quality = negative ? 1+toolQuality : (magnitude && duration ? toolQuality : toolQuality + 0.5); break; - + case 3: - + quality = magnitude && duration ? calcinatorQuality : calcinatorQuality + 0.5; break; } @@ -110,8 +110,8 @@ void MWMechanics::Alchemy::applyTools (int flags, float& value) const else { if (quality==0) - throw std::runtime_error ("invalid derived alchemy apparatus quality"); - + throw std::runtime_error ("invalid derived alchemy apparatus quality"); + value /= quality; } } @@ -141,21 +141,21 @@ void MWMechanics::Alchemy::updateEffects() for (std::set::const_iterator iter (effects.begin()); iter!=effects.end(); ++iter) { const ESM::MagicEffect *magicEffect = - MWBase::Environment::get().getWorld()->getStore().get().find (iter->mId); - + MWBase::Environment::get().getWorld()->getStore().get().find (iter->mId); + if (magicEffect->mData.mBaseCost<=0) { std::ostringstream os; os << "invalid base cost for magic effect " << iter->mId; throw std::runtime_error (os.str()); } - + float fPotionT1MagMul = MWBase::Environment::get().getWorld()->getStore().get().find ("fPotionT1MagMult")->getFloat(); if (fPotionT1MagMul<=0) throw std::runtime_error ("invalid gmst: fPotionT1MagMul"); - + float fPotionT1DurMult = MWBase::Environment::get().getWorld()->getStore().get().find ("fPotionT1DurMult")->getFloat(); @@ -172,25 +172,25 @@ void MWMechanics::Alchemy::updateEffects() if (!(magicEffect->mData.mFlags & ESM::MagicEffect::NoDuration)) applyTools (magicEffect->mData.mFlags, duration); - - duration = static_cast (duration+0.5); + + duration = static_cast (duration+0.5); magnitude = static_cast (magnitude+0.5); if (magnitude>0 && duration>0) { ESM::ENAMstruct effect; effect.mEffectID = iter->mId; - + effect.mSkill = effect.mAttribute = iter->mArg; // somewhat hack-ish, but should work - + effect.mRange = 0; - effect.mArea = 0; - + effect.mArea = 0; + effect.mDuration = duration; effect.mMagnMin = effect.mMagnMax = magnitude; mEffects.push_back (effect); - } + } } } @@ -204,14 +204,14 @@ const ESM::Potion *MWMechanics::Alchemy::getRecord() const { if (iter->mEffects.mList.size() != mEffects.size()) continue; - - bool mismatch = false; + + bool mismatch = false; for (int i=0; i (iter->mEffects.mList.size()); ++i) { const ESM::ENAMstruct& first = iter->mEffects.mList[i]; const ESM::ENAMstruct& second = mEffects[i]; - + if (first.mEffectID!=second.mEffectID || first.mArea!=second.mArea || first.mRange!=second.mRange || @@ -225,29 +225,30 @@ const ESM::Potion *MWMechanics::Alchemy::getRecord() const break; } } - + if (!mismatch) return &(*iter); } - + return 0; } void MWMechanics::Alchemy::removeIngredients() { bool needsUpdate = false; - + for (TIngredientsContainer::iterator iter (mIngredients.begin()); iter!=mIngredients.end(); ++iter) if (!iter->isEmpty()) { - iter->getRefData().setCount (iter->getRefData().getCount()-1); + iter->getContainerStore()->remove(*iter, 1, mAlchemist); + if (iter->getRefData().getCount()<1) { needsUpdate = true; *iter = MWWorld::Ptr(); } } - + if (needsUpdate) updateEffects(); } @@ -255,39 +256,38 @@ void MWMechanics::Alchemy::removeIngredients() void MWMechanics::Alchemy::addPotion (const std::string& name) { const ESM::Potion *record = getRecord(); - + if (!record) { ESM::Potion newRecord; - + newRecord.mData.mWeight = 0; - + for (TIngredientsIterator iter (beginIngredients()); iter!=endIngredients(); ++iter) if (!iter->isEmpty()) newRecord.mData.mWeight += iter->get()->mBase->mData.mWeight; - + newRecord.mData.mWeight /= countIngredients(); - + newRecord.mData.mValue = mValue; newRecord.mData.mAutoCalc = 0; - + newRecord.mName = name; - int index = static_cast (std::rand()/static_cast (RAND_MAX)*6); + int index = static_cast (std::rand()/(static_cast (RAND_MAX)+1)*6); assert (index>=0 && index<6); - + static const char *name[] = { "standard", "bargain", "cheap", "fresh", "exclusive", "quality" }; - + newRecord.mModel = "m\\misc_potion_" + std::string (name[index]) + "_01.nif"; newRecord.mIcon = "m\\tx_potion_" + std::string (name[index]) + "_01.dds"; - + newRecord.mEffects.mList = mEffects; - + record = MWBase::Environment::get().getWorld()->createRecord (newRecord); } - - MWWorld::ManualRef ref (MWBase::Environment::get().getWorld()->getStore(), record->mId); - MWWorld::Class::get (mAlchemist).getContainerStore (mAlchemist).add (ref.getPtr(), mAlchemist); + + mAlchemist.getClass().getContainerStore (mAlchemist).add (record->mId, 1, mAlchemist); } void MWMechanics::Alchemy::increaseSkill() @@ -299,7 +299,7 @@ float MWMechanics::Alchemy::getChance() const { const CreatureStats& creatureStats = MWWorld::Class::get (mAlchemist).getCreatureStats (mAlchemist); const NpcStats& npcStats = MWWorld::Class::get (mAlchemist).getNpcStats (mAlchemist); - + return (npcStats.getSkill (ESM::Skill::Alchemy).getModified() + 0.1 * creatureStats.getAttribute (1).getModified() @@ -320,34 +320,34 @@ int MWMechanics::Alchemy::countIngredients() const void MWMechanics::Alchemy::setAlchemist (const MWWorld::Ptr& npc) { mAlchemist = npc; - + mIngredients.resize (4); std::fill (mIngredients.begin(), mIngredients.end(), MWWorld::Ptr()); - + mTools.resize (4); - + std::fill (mTools.begin(), mTools.end(), MWWorld::Ptr()); - + mEffects.clear(); - + MWWorld::ContainerStore& store = MWWorld::Class::get (npc).getContainerStore (npc); - + for (MWWorld::ContainerStoreIterator iter (store.begin (MWWorld::ContainerStore::Type_Apparatus)); iter!=store.end(); ++iter) - { + { MWWorld::LiveCellRef* ref = iter->get(); - + int type = ref->mBase->mData.mType; - + if (type<0 || type>=static_cast (mTools.size())) throw std::runtime_error ("invalid apparatus type"); - + if (!mTools[type].isEmpty()) if (ref->mBase->mData.mQuality<=mTools[type].get()->mBase->mData.mQuality) continue; - - mTools[type] = *iter; + + mTools[type] = *iter; } } @@ -389,19 +389,19 @@ int MWMechanics::Alchemy::addIngredient (const MWWorld::Ptr& ingredient) { slot = i; break; - } - + } + if (slot==-1) return -1; - + for (TIngredientsIterator iter (mIngredients.begin()); iter!=mIngredients.end(); ++iter) if (!iter->isEmpty() && ingredient.get()==iter->get()) return -1; - + mIngredients[slot] = ingredient; - + updateEffects(); - + return slot; } @@ -428,7 +428,7 @@ std::string MWMechanics::Alchemy::getPotionName() const { if (const ESM::Potion *potion = getRecord()) return potion->mName; - + return ""; } @@ -436,13 +436,13 @@ MWMechanics::Alchemy::Result MWMechanics::Alchemy::create (const std::string& na { if (mTools[ESM::Apparatus::MortarPestle].isEmpty()) return Result_NoMortarAndPestle; - + if (countIngredients()<2) return Result_LessThanTwoIngredients; if (name.empty() && getPotionName().empty()) return Result_NoName; - + if (beginEffects()==endEffects()) return Result_NoEffects; @@ -455,7 +455,7 @@ MWMechanics::Alchemy::Result MWMechanics::Alchemy::create (const std::string& na addPotion (name); removeIngredients(); - + increaseSkill(); return Result_Success; diff --git a/apps/openmw/mwmechanics/character.cpp b/apps/openmw/mwmechanics/character.cpp index c4260d907..da3ed2523 100644 --- a/apps/openmw/mwmechanics/character.cpp +++ b/apps/openmw/mwmechanics/character.cpp @@ -350,6 +350,7 @@ CharacterController::CharacterController(const MWWorld::Ptr &ptr, MWRender::Anim , mSkipAnim(false) , mSecondsOfRunning(0) , mSecondsOfSwimming(0) + , mFallHeight(0) { if(!mAnimation) return; @@ -425,6 +426,11 @@ bool CharacterController::updateNpcState(bool onground, bool inwater, bool isrun { forcestateupdate = true; + // Shields shouldn't be visible during spellcasting + // There seems to be no text keys for this purpose, except maybe for "[un]equip start/stop", + // but they are also present in weapon drawing animation. + mAnimation->showShield(weaptype != WeapType_Spell); + std::string weapgroup; if(weaptype == WeapType_None) { @@ -442,6 +448,7 @@ bool CharacterController::updateNpcState(bool onground, bool inwater, bool isrun MWRender::Animation::Group_UpperBody, true, 1.0f, "equip start", "equip stop", 0.0f, 0); mUpperBodyState = UpperCharState_EquipingWeap; + if(isWerewolf) { const MWWorld::ESMStore &store = MWBase::Environment::get().getWorld()->getStore(); @@ -494,6 +501,7 @@ bool CharacterController::updateNpcState(bool onground, bool inwater, bool isrun { if(mUpperBodyState == UpperCharState_WeapEquiped) { + MWBase::Environment::get().getWorld()->breakInvisibility(mPtr); mAttackType.clear(); if(mWeaponType == WeapType_Spell) { @@ -512,6 +520,15 @@ bool CharacterController::updateNpcState(bool onground, bool inwater, bool isrun const ESM::MagicEffect *effect; effect = store.get().find(effectentry.mEffectID); + const ESM::Static* castStatic = store.get().find (effect->mCasting); + mAnimation->addEffect("meshes\\" + castStatic->mModel, effect->mIndex); + + castStatic = MWBase::Environment::get().getWorld()->getStore().get().find ("VFX_Hands"); + //mAnimation->addEffect("meshes\\" + castStatic->mModel, -1, false, "Bip01 L Hand", effect->mParticle); + //mAnimation->addEffect("meshes\\" + castStatic->mModel, -1, false, "Bip01 R Hand", effect->mParticle); + mAnimation->addEffect("meshes\\" + castStatic->mModel, -1, false, "Left Hand", effect->mParticle); + mAnimation->addEffect("meshes\\" + castStatic->mModel, -1, false, "Right Hand", effect->mParticle); + switch(effectentry.mRange) { case 0: mAttackType = "self"; break; @@ -531,6 +548,11 @@ bool CharacterController::updateNpcState(bool onground, bool inwater, bool isrun else sndMgr->playSound3D(mPtr, schools[effect->mData.mSchool]+" cast", 1.0f, 1.0f); } + if (inv.getSelectedEnchantItem() != inv.end()) + { + // Enchanted items cast immediately (no animation) + MWBase::Environment::get().getWorld()->castSpell(mPtr); + } } else if(mWeaponType == WeapType_PickProbe) { @@ -555,10 +577,8 @@ bool CharacterController::updateNpcState(bool onground, bool inwater, bool isrun if(!resultSound.empty()) MWBase::Environment::get().getSoundManager()->playSound(resultSound, 1.0f, 1.0f); - // tool used up? - if(!item.getRefData().getCount()) - MWBase::Environment::get().getWindowManager()->unsetSelectedWeapon(); - else + // Set again, just to update the charge bar + if(item.getRefData().getCount()) MWBase::Environment::get().getWindowManager()->setSelectedWeapon(item); } else @@ -708,6 +728,8 @@ void CharacterController::update(float duration) const MWWorld::Class &cls = MWWorld::Class::get(mPtr); Ogre::Vector3 movement(0.0f); + updateVisibility(); + if(!cls.isActor()) { if(mAnimQueue.size() > 1) @@ -774,7 +796,7 @@ void CharacterController::update(float duration) if(!onground && !flying && !inwater) { - // The player is in the air (either getting up —ascending part of jump— or falling). + // In the air (either getting up —ascending part of jump— or falling). if (world->isSlowFalling(mPtr)) { @@ -809,8 +831,7 @@ void CharacterController::update(float duration) } else if(vec.z > 0.0f && mJumpState == JumpState_None) { - // The player has started a jump. - + // Started a jump. float z = cls.getJump(mPtr); if(vec.x == 0 && vec.y == 0) vec = Ogre::Vector3(0.0f, 0.0f, z); @@ -821,7 +842,8 @@ void CharacterController::update(float duration) } // advance acrobatics - cls.skillUsageSucceeded(mPtr, ESM::Skill::Acrobatics, 0); + if (mPtr.getRefData().getHandle() == "player") + cls.skillUsageSucceeded(mPtr, ESM::Skill::Acrobatics, 0); // decrease fatigue const MWWorld::Store &gmst = world->getStore().get(); @@ -835,8 +857,6 @@ void CharacterController::update(float duration) } else if(mJumpState == JumpState_Falling) { - // The player is landing. - forcestateupdate = true; mJumpState = JumpState_Landing; vec.z = 0.0f; @@ -853,7 +873,8 @@ void CharacterController::update(float duration) cls.getCreatureStats(mPtr).setHealth(health); // report acrobatics progression - cls.skillUsageSucceeded(mPtr, ESM::Skill::Acrobatics, 1); + if (mPtr.getRefData().getHandle() == "player") + cls.skillUsageSucceeded(mPtr, ESM::Skill::Acrobatics, 1); const float acrobaticsSkill = cls.getNpcStats(mPtr).getSkill(ESM::Skill::Acrobatics).getModified(); if (healthLost > (acrobaticsSkill * fatigueTerm)) @@ -1091,8 +1112,46 @@ void CharacterController::resurrect() if(mAnimation) mAnimation->disable(mCurrentDeath); - mCurrentDeath.empty(); + mCurrentDeath.clear(); mDeathState = CharState_None; } +void CharacterController::updateContinuousVfx() +{ + // Keeping track of when to stop a continuous VFX seems to be very difficult to do inside the spells code, + // as it's extremely spread out (ActiveSpells, Spells, InventoryStore effects, etc...) so we do it here. + + // Stop any effects that are no longer active + std::vector effects; + mAnimation->getLoopingEffects(effects); + + for (std::vector::iterator it = effects.begin(); it != effects.end(); ++it) + { + if (mPtr.getClass().getCreatureStats(mPtr).isDead() + || mPtr.getClass().getCreatureStats(mPtr).getMagicEffects().get(MWMechanics::EffectKey(*it)).mMagnitude <= 0) + mAnimation->removeEffect(*it); + } +} + +void CharacterController::updateVisibility() +{ + if (!mPtr.getClass().isActor()) + return; + float alpha = 1.f; + if (mPtr.getClass().getCreatureStats(mPtr).getMagicEffects().get(ESM::MagicEffect::Invisibility).mMagnitude) + { + if (mPtr.getRefData().getHandle() == "player") + alpha = 0.4f; + else + alpha = 0.f; + } + float chameleon = mPtr.getClass().getCreatureStats(mPtr).getMagicEffects().get(ESM::MagicEffect::Chameleon).mMagnitude; + if (chameleon) + { + alpha *= std::max(0.2f, (100.f - chameleon)/100.f); + } + + mAnimation->setAlpha(alpha); +} + } diff --git a/apps/openmw/mwmechanics/character.hpp b/apps/openmw/mwmechanics/character.hpp index 8670b385e..9e07fca7d 100644 --- a/apps/openmw/mwmechanics/character.hpp +++ b/apps/openmw/mwmechanics/character.hpp @@ -173,10 +173,15 @@ class CharacterController bool updateNpcState(bool onground, bool inwater, bool isrunning, bool sneak); + void updateVisibility(); + public: CharacterController(const MWWorld::Ptr &ptr, MWRender::Animation *anim); virtual ~CharacterController(); + // Be careful when to call this, see comment in Actors + void updateContinuousVfx(); + void updatePtr(const MWWorld::Ptr &ptr); void update(float duration); diff --git a/apps/openmw/mwmechanics/creaturestats.cpp b/apps/openmw/mwmechanics/creaturestats.cpp index 52ed43be3..345b5a156 100644 --- a/apps/openmw/mwmechanics/creaturestats.cpp +++ b/apps/openmw/mwmechanics/creaturestats.cpp @@ -342,4 +342,18 @@ namespace MWMechanics { return mLastHitObject; } + + bool CreatureStats::canUsePower(const std::string &power) const + { + std::map::const_iterator it = mUsedPowers.find(power); + if (it == mUsedPowers.end() || it->second + 24 <= MWBase::Environment::get().getWorld()->getTimeStamp()) + return true; + else + return false; + } + + void CreatureStats::usePower(const std::string &power) + { + mUsedPowers[power] = MWBase::Environment::get().getWorld()->getTimeStamp(); + } } diff --git a/apps/openmw/mwmechanics/creaturestats.hpp b/apps/openmw/mwmechanics/creaturestats.hpp index 1a7cb5d69..f28f50fc6 100644 --- a/apps/openmw/mwmechanics/creaturestats.hpp +++ b/apps/openmw/mwmechanics/creaturestats.hpp @@ -40,6 +40,8 @@ namespace MWMechanics std::string mLastHitObject; // The last object to hit this actor + std::map mUsedPowers; + protected: bool mIsWerewolf; Stat mWerewolfAttributes[8]; @@ -47,6 +49,9 @@ namespace MWMechanics public: CreatureStats(); + bool canUsePower (const std::string& power) const; + void usePower (const std::string& power); + const Stat & getAttribute(int index) const; const DynamicStat & getHealth() const; @@ -166,6 +171,11 @@ namespace MWMechanics void setLastHitObject(const std::string &objectid); const std::string &getLastHitObject() const; + + // Note, this is just a cache to avoid checking the whole container store every frame TODO: Put it somewhere else? + std::set mBoundItems; + // Same as above + std::map mSummonedCreatures; }; } diff --git a/apps/openmw/mwmechanics/enchanting.cpp b/apps/openmw/mwmechanics/enchanting.cpp index 4e26b5027..7e11acdb0 100644 --- a/apps/openmw/mwmechanics/enchanting.cpp +++ b/apps/openmw/mwmechanics/enchanting.cpp @@ -14,7 +14,6 @@ namespace MWMechanics Enchanting::Enchanting() : mCastStyle(ESM::Enchantment::CastOnce) , mSelfEnchanting(false) - , mOldItemCount(0) {} void Enchanting::setOldItem(MWWorld::Ptr oldItem) @@ -24,7 +23,6 @@ namespace MWMechanics { mObjectType = mOldItemPtr.getTypeName(); mOldItemId = mOldItemPtr.getCellRef().mRefID; - mOldItemCount = mOldItemPtr.getRefData().getCount(); } else { @@ -55,25 +53,23 @@ namespace MWMechanics bool Enchanting::create() { - MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + const MWWorld::Ptr& player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + MWWorld::ContainerStore& store = MWWorld::Class::get(player).getContainerStore(player); ESM::Enchantment enchantment; enchantment.mData.mCharge = getGemCharge(); - mSoulGemPtr.getRefData().setCount (mSoulGemPtr.getRefData().getCount()-1); + store.remove(mSoulGemPtr, 1, player); //Exception for Azura Star, new one will be added after enchanting if(boost::iequals(mSoulGemPtr.get()->mBase->mId, "Misc_SoulGem_Azura")) - { - MWWorld::ManualRef azura (MWBase::Environment::get().getWorld()->getStore(), "Misc_SoulGem_Azura"); - MWWorld::Class::get (player).getContainerStore (player).add (azura.getPtr(), player); - } + store.add("Misc_SoulGem_Azura", 1, player); if(mSelfEnchanting) { if(getEnchantChance() (RAND_MAX)*100) return false; - MWWorld::Class::get (mEnchanter).skillUsageSucceeded (mEnchanter, ESM::Skill::Enchant, 1); + MWWorld::Class::get (mEnchanter).skillUsageSucceeded (mEnchanter, ESM::Skill::Enchant, 2); } if(mCastStyle==ESM::Enchantment::ConstantEffect) @@ -84,16 +80,18 @@ namespace MWMechanics enchantment.mData.mCost = getEnchantPoints(); enchantment.mEffects = mEffectList; + // Create a new item + MWWorld::ManualRef ref (MWBase::Environment::get().getWorld()->getStore(), mOldItemId, 1); + const MWWorld::Ptr& newItemPtr = ref.getPtr(); + + // Apply the enchantment const ESM::Enchantment *enchantmentPtr = MWBase::Environment::get().getWorld()->createRecord (enchantment); + MWWorld::Class::get(newItemPtr).applyEnchantment(newItemPtr, enchantmentPtr->mId, getGemCharge(), mNewItemName); - MWWorld::Class::get(mOldItemPtr).applyEnchantment(mOldItemPtr, enchantmentPtr->mId, getGemCharge(), mNewItemName); + // Add the new item to player inventory and remove the old one + store.remove(mOldItemPtr, 1, player); + store.add(newItemPtr, player); - mOldItemPtr.getRefData().setCount(1); - - MWWorld::ManualRef ref (MWBase::Environment::get().getWorld()->getStore(), mOldItemId); - ref.getPtr().getRefData().setCount (mOldItemCount-1); - - MWWorld::Class::get (player).getContainerStore (player).add (ref.getPtr(), player); if(!mSelfEnchanting) payForEnchantment(); @@ -299,20 +297,9 @@ namespace MWMechanics void Enchanting::payForEnchantment() const { - MWWorld::Ptr gold; - - MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + const MWWorld::Ptr& player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); MWWorld::ContainerStore& store = MWWorld::Class::get(player).getContainerStore(player); - for (MWWorld::ContainerStoreIterator it = store.begin(); - it != store.end(); ++it) - { - if (Misc::StringUtils::ciEqual(it->getCellRef().mRefID, "gold_001")) - { - gold = *it; - } - } - - gold.getRefData().setCount(gold.getRefData().getCount() - getEnchantPrice()); + store.remove("gold_001", getEnchantPrice(), player); } } diff --git a/apps/openmw/mwmechanics/enchanting.hpp b/apps/openmw/mwmechanics/enchanting.hpp index a25fd43ab..988ce41fc 100644 --- a/apps/openmw/mwmechanics/enchanting.hpp +++ b/apps/openmw/mwmechanics/enchanting.hpp @@ -22,7 +22,6 @@ namespace MWMechanics std::string mNewItemName; std::string mObjectType; std::string mOldItemId; - int mOldItemCount; public: Enchanting(); diff --git a/apps/openmw/mwmechanics/magiceffects.cpp b/apps/openmw/mwmechanics/magiceffects.cpp index 3ed458c3f..5be0854ab 100644 --- a/apps/openmw/mwmechanics/magiceffects.cpp +++ b/apps/openmw/mwmechanics/magiceffects.cpp @@ -68,28 +68,6 @@ namespace MWMechanics } } - void MagicEffects::add (const ESM::EffectList& list, float magnitude) - { - for (std::vector::const_iterator iter (list.mList.begin()); iter!=list.mList.end(); - ++iter) - { - EffectParam param; - - if (iter->mMagnMin>=iter->mMagnMax) - param.mMagnitude = iter->mMagnMin; - else - { - if (magnitude==-1) - magnitude = static_cast (std::rand()) / RAND_MAX; - - param.mMagnitude = static_cast ( - (iter->mMagnMax-iter->mMagnMin+1)*magnitude + iter->mMagnMin); - } - - add (*iter, param); - } - } - MagicEffects& MagicEffects::operator+= (const MagicEffects& effects) { if (this==&effects) diff --git a/apps/openmw/mwmechanics/magiceffects.hpp b/apps/openmw/mwmechanics/magiceffects.hpp index b80b5a863..2c1b363b7 100644 --- a/apps/openmw/mwmechanics/magiceffects.hpp +++ b/apps/openmw/mwmechanics/magiceffects.hpp @@ -2,6 +2,7 @@ #define GAME_MWMECHANICS_MAGICEFFECTS_H #include +#include namespace ESM { @@ -27,10 +28,13 @@ namespace MWMechanics struct EffectParam { - int mMagnitude; + // Note usually this would be int, but applying partial resistance might introduce decimal point. + float mMagnitude; EffectParam(); + EffectParam(float magnitude) : mMagnitude(magnitude) {} + EffectParam& operator+= (const EffectParam& param); EffectParam& operator-= (const EffectParam& param); @@ -48,6 +52,13 @@ namespace MWMechanics return param -= right; } + // Used by effect management classes (ActiveSpells, InventoryStore, Spells) to list active effect sources for GUI display + struct EffectSourceVisitor + { + virtual void visit (MWMechanics::EffectKey key, + const std::string& sourceName, float magnitude, float remainingTime = -1) = 0; + }; + /// \brief Effects currently affecting a NPC or creature class MagicEffects { @@ -67,9 +78,6 @@ namespace MWMechanics void add (const EffectKey& key, const EffectParam& param); - void add (const ESM::EffectList& list, float magnitude = -1); - ///< \param magnitude normalised magnitude (-1: random) - MagicEffects& operator+= (const MagicEffects& effects); EffectParam get (const EffectKey& key) const; diff --git a/apps/openmw/mwmechanics/mechanicsmanagerimp.cpp b/apps/openmw/mwmechanics/mechanicsmanagerimp.cpp index 8c13db790..1316baaeb 100644 --- a/apps/openmw/mwmechanics/mechanicsmanagerimp.cpp +++ b/apps/openmw/mwmechanics/mechanicsmanagerimp.cpp @@ -159,15 +159,15 @@ namespace MWMechanics // auto-equip again. we need this for when the race is changed to a beast race MWWorld::InventoryStore& invStore = MWWorld::Class::get(ptr).getInventoryStore(ptr); for (int i=0; igetTimeScaleFactor(); + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + player.getClass().getInventoryStore(player).rechargeItems(duration); + } + void MechanicsManager::update(float duration, bool paused) { if(!mWatched.isEmpty()) @@ -411,7 +416,7 @@ namespace MWMechanics MWWorld::LiveCellRef* player = playerPtr.get(); const MWMechanics::NpcStats &playerStats = MWWorld::Class::get(playerPtr).getNpcStats(playerPtr); - if (Misc::StringUtils::lowerCase(npc->mBase->mRace) == Misc::StringUtils::lowerCase(player->mBase->mRace)) + if (Misc::StringUtils::ciEqual(npc->mBase->mRace, player->mBase->mRace)) x += MWBase::Environment::get().getWorld()->getStore().get().find("fDispRaceMod")->getFloat(); x += MWBase::Environment::get().getWorld()->getStore().get().find("fDispPersonalityMult")->getFloat() @@ -427,7 +432,9 @@ namespace MWMechanics for(std::vector::const_iterator it = MWBase::Environment::get().getWorld()->getStore().get().find(Misc::StringUtils::lowerCase(npcFaction))->mReactions.begin(); it != MWBase::Environment::get().getWorld()->getStore().get().find(Misc::StringUtils::lowerCase(npcFaction))->mReactions.end(); ++it) { - if(Misc::StringUtils::lowerCase(it->mFaction) == Misc::StringUtils::lowerCase(npcFaction)) reaction = it->mReaction; + if(Misc::StringUtils::lowerCase(it->mFaction) == Misc::StringUtils::lowerCase(npcFaction) + && playerStats.getExpelled().find(Misc::StringUtils::lowerCase(it->mFaction)) == playerStats.getExpelled().end()) + reaction = it->mReaction; } rank = playerStats.getFactionRanks().find(Misc::StringUtils::lowerCase(npcFaction))->second; } @@ -438,7 +445,8 @@ namespace MWMechanics { if(playerStats.getFactionRanks().find(Misc::StringUtils::lowerCase(it->mFaction)) != playerStats.getFactionRanks().end() ) { - if(it->mReactionmReaction; + if(it->mReaction < reaction) + reaction = it->mReaction; } } rank = 0; @@ -679,4 +687,18 @@ namespace MWMechanics return false; } + void MechanicsManager::updateMagicEffects(const MWWorld::Ptr &ptr) + { + mActors.updateMagicEffects(ptr); + } + + void MechanicsManager::toggleAI() + { + mAI = !mAI; + } + + bool MechanicsManager::isAIActive() + { + return mAI; + } } diff --git a/apps/openmw/mwmechanics/mechanicsmanagerimp.hpp b/apps/openmw/mwmechanics/mechanicsmanagerimp.hpp index ad07562c7..ec03b457b 100644 --- a/apps/openmw/mwmechanics/mechanicsmanagerimp.hpp +++ b/apps/openmw/mwmechanics/mechanicsmanagerimp.hpp @@ -29,16 +29,17 @@ namespace MWMechanics bool mUpdatePlayer; bool mClassSelected; bool mRaceSelected; + bool mAI;///< is AI active? Objects mObjects; Actors mActors; + public: + void buildPlayer(); ///< build player according to stored class/race/birthsign information. Will /// default to the values of the ESM::NPC object, if no explicit information is given. - public: - MechanicsManager(); virtual void add (const MWWorld::Ptr& ptr); @@ -63,6 +64,8 @@ namespace MWMechanics /// \param paused In game type does not currently advance (this usually means some GUI /// component is up). + virtual void advanceTime (float duration); + virtual void setPlayerName (const std::string& name); ///< Set player name. @@ -89,7 +92,7 @@ namespace MWMechanics virtual int countDeaths (const std::string& id) const; ///< Return the number of deaths for actors with the given ID. - + virtual void getPersuasionDispositionChange (const MWWorld::Ptr& npc, PersuasionType type, float currentTemporaryDispositionDelta, bool& success, float& tempChange, float& permChange); void toLower(std::string npcFaction); @@ -100,6 +103,13 @@ namespace MWMechanics virtual void playAnimationGroup(const MWWorld::Ptr& ptr, const std::string& groupName, int mode, int number); virtual void skipAnimation(const MWWorld::Ptr& ptr); virtual bool checkAnimationPlaying(const MWWorld::Ptr& ptr, const std::string &groupName); + + /// Update magic effects for an actor. Usually done automatically once per frame, but if we're currently + /// paused we may want to do it manually (after equipping permanent enchantment) + virtual void updateMagicEffects (const MWWorld::Ptr& ptr); + + virtual void toggleAI(); + virtual bool isAIActive(); }; } diff --git a/apps/openmw/mwmechanics/npcstats.cpp b/apps/openmw/mwmechanics/npcstats.cpp index 0b3698289..1fdefc84f 100644 --- a/apps/openmw/mwmechanics/npcstats.cpp +++ b/apps/openmw/mwmechanics/npcstats.cpp @@ -86,7 +86,7 @@ void MWMechanics::NpcStats::setMovementFlag (Flag flag, bool state) const MWMechanics::Stat& MWMechanics::NpcStats::getSkill (int index) const { - if (index<0 || index>=27) + if (index<0 || index>=ESM::Skill::Length) throw std::runtime_error ("skill index out of range"); return (!mIsWerewolf ? mSkill[index] : mWerewolfSkill[index]); @@ -94,7 +94,7 @@ const MWMechanics::Stat& MWMechanics::NpcStats::getSkill (int index) cons MWMechanics::Stat& MWMechanics::NpcStats::getSkill (int index) { - if (index<0 || index>=27) + if (index<0 || index>=ESM::Skill::Length) throw std::runtime_error ("skill index out of range"); return (!mIsWerewolf ? mSkill[index] : mWerewolfSkill[index]); diff --git a/apps/openmw/mwmechanics/pathfinding.cpp b/apps/openmw/mwmechanics/pathfinding.cpp index 8ef0edab8..ff266f9ae 100644 --- a/apps/openmw/mwmechanics/pathfinding.cpp +++ b/apps/openmw/mwmechanics/pathfinding.cpp @@ -189,7 +189,7 @@ namespace MWMechanics // This should never happen (programmers should have an if statement checking mIsPathConstructed that prevents this call // if otherwise). if(mPath.empty()) - return 0; + return 0.; const ESM::Pathgrid::Point &nextPoint = *mPath.begin(); float directionX = nextPoint.mX - x; @@ -199,6 +199,21 @@ namespace MWMechanics return Ogre::Radian(acos(directionY / directionResult) * sgn(asin(directionX / directionResult))).valueDegrees(); } + bool PathFinder::checkWaypoint(float x, float y, float z) + { + if(mPath.empty()) + return true; + + ESM::Pathgrid::Point nextPoint = *mPath.begin(); + if(distanceZCorrected(nextPoint, x, y, z) < 64) + { + mPath.pop_front(); + if(mPath.empty()) mIsPathConstructed = false; + return true; + } + return false; + } + bool PathFinder::checkPathCompleted(float x, float y, float z) { if(mPath.empty()) diff --git a/apps/openmw/mwmechanics/pathfinding.hpp b/apps/openmw/mwmechanics/pathfinding.hpp index 35e0fa908..916df850b 100644 --- a/apps/openmw/mwmechanics/pathfinding.hpp +++ b/apps/openmw/mwmechanics/pathfinding.hpp @@ -18,6 +18,8 @@ namespace MWMechanics bool checkPathCompleted(float x, float y, float z); ///< \Returns true if the last point of the path has been reached. + bool checkWaypoint(float x, float y, float z); + ///< \Returns true if a way point was reached float getZAngleToNext(float x, float y) const; bool isPathConstructed() const @@ -25,6 +27,16 @@ namespace MWMechanics return mIsPathConstructed; } + int getPathSize() const + { + return mPath.size(); + } + + std::list getPath() const + { + return mPath; + } + private: std::list mPath; bool mIsPathConstructed; diff --git a/apps/openmw/mwmechanics/repair.cpp b/apps/openmw/mwmechanics/repair.cpp index 66c492bf8..38b2a48d7 100644 --- a/apps/openmw/mwmechanics/repair.cpp +++ b/apps/openmw/mwmechanics/repair.cpp @@ -85,7 +85,10 @@ void Repair::repair(const MWWorld::Ptr &itemToRepair) // tool used up? if (mTool.getCellRef().mCharge == 0) { - mTool.getRefData().setCount(0); + MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); + MWWorld::ContainerStore& store = MWWorld::Class::get(player).getContainerStore(player); + + store.remove(mTool, 1, player); std::string message = MWBase::Environment::get().getWorld()->getStore().get() .find("sNotifyMessage51")->getString(); @@ -93,8 +96,6 @@ void Repair::repair(const MWWorld::Ptr &itemToRepair) MWBase::Environment::get().getWindowManager()->messageBox((boost::format(message) % MWWorld::Class::get(mTool).getName(mTool)).str()); // try to find a new tool of the same ID - MWWorld::Ptr player = MWBase::Environment::get().getWorld()->getPlayer().getPlayer(); - MWWorld::ContainerStore& store = MWWorld::Class::get(player).getContainerStore(player); for (MWWorld::ContainerStoreIterator iter (store.begin()); iter!=store.end(); ++iter) { diff --git a/apps/openmw/mwmechanics/security.cpp b/apps/openmw/mwmechanics/security.cpp index d19da6e2a..c373e83f5 100644 --- a/apps/openmw/mwmechanics/security.cpp +++ b/apps/openmw/mwmechanics/security.cpp @@ -2,6 +2,7 @@ #include "../mwworld/class.hpp" #include "../mwworld/player.hpp" +#include "../mwworld/containerstore.hpp" #include "../mwbase/world.hpp" #include "../mwbase/environment.hpp" @@ -61,7 +62,7 @@ namespace MWMechanics lockpick.getCellRef().mCharge = lockpick.get()->mBase->mData.mUses; --lockpick.getCellRef().mCharge; if (!lockpick.getCellRef().mCharge) - lockpick.getRefData().setCount(0); + lockpick.getContainerStore()->remove(lockpick, 1, mActor); } void Security::probeTrap(const MWWorld::Ptr &trap, const MWWorld::Ptr &probe, @@ -103,7 +104,7 @@ namespace MWMechanics probe.getCellRef().mCharge = probe.get()->mBase->mData.mUses; --probe.getCellRef().mCharge; if (!probe.getCellRef().mCharge) - probe.getRefData().setCount(0); + probe.getContainerStore()->remove(probe, 1, mActor); } } diff --git a/apps/openmw/mwmechanics/spellcasting.cpp b/apps/openmw/mwmechanics/spellcasting.cpp new file mode 100644 index 000000000..74816d12e --- /dev/null +++ b/apps/openmw/mwmechanics/spellcasting.cpp @@ -0,0 +1,505 @@ +#include "spellcasting.hpp" + +#include + +#include "../mwbase/windowmanager.hpp" +#include "../mwbase/soundmanager.hpp" + + +#include "../mwworld/containerstore.hpp" + +#include "../mwrender/animation.hpp" + +namespace MWMechanics +{ + + CastSpell::CastSpell(const MWWorld::Ptr &caster, const MWWorld::Ptr &target) + : mCaster(caster) + , mTarget(target) + , mStack(false) + { + } + + void CastSpell::inflict(const MWWorld::Ptr &target, const MWWorld::Ptr &caster, + const ESM::EffectList &effects, ESM::RangeType range, bool reflected) + { + // If none of the effects need to apply, we can early-out + bool found = false; + for (std::vector::const_iterator iter (effects.mList.begin()); + iter!=effects.mList.end(); ++iter) + { + if (iter->mRange != range) + continue; + found = true; + } + if (!found) + return; + + const ESM::Spell* spell = MWBase::Environment::get().getWorld()->getStore().get().search (mId); + if (spell && (spell->mData.mType == ESM::Spell::ST_Disease || spell->mData.mType == ESM::Spell::ST_Blight)) + { + float x = (spell->mData.mType == ESM::Spell::ST_Disease) ? + target.getClass().getCreatureStats(target).getMagicEffects().get(ESM::MagicEffect::ResistCommonDisease).mMagnitude + : target.getClass().getCreatureStats(target).getMagicEffects().get(ESM::MagicEffect::ResistBlightDisease).mMagnitude; + + int roll = std::rand()/ (static_cast (RAND_MAX) + 1) * 100; // [0, 99] + if (roll <= x) + { + // Fully resisted, show message + if (target.getRefData().getHandle() == "player") + MWBase::Environment::get().getWindowManager()->messageBox("#{sMagicPCResisted}"); + return; + } + } + + ESM::EffectList reflectedEffects; + std::vector appliedLastingEffects; + bool firstAppliedEffect = true; + + for (std::vector::const_iterator effectIt (effects.mList.begin()); + effectIt!=effects.mList.end(); ++effectIt) + { + if (effectIt->mRange != range) + continue; + + const ESM::MagicEffect *magicEffect = + MWBase::Environment::get().getWorld()->getStore().get().find ( + effectIt->mEffectID); + + float magnitudeMult = 1; + if (magicEffect->mData.mFlags & ESM::MagicEffect::Harmful && target.getClass().isActor()) + { + // If player is attempting to cast a harmful spell, show the target's HP bar + if (caster.getRefData().getHandle() == "player" && target != caster) + MWBase::Environment::get().getWindowManager()->setEnemy(target); + + // Try absorbing if it's a spell + // NOTE: Vanilla does this once per effect source instead of adding the % from all sources together, not sure + // if that is worth replicating. + if (spell && caster != target) + { + int absorb = target.getClass().getCreatureStats(target).getMagicEffects().get(ESM::MagicEffect::SpellAbsorption).mMagnitude; + int roll = std::rand()/ (static_cast (RAND_MAX) + 1) * 100; // [0, 99] + bool isAbsorbed = (roll < absorb); + if (isAbsorbed) + { + const ESM::Static* absorbStatic = MWBase::Environment::get().getWorld()->getStore().get().find ("VFX_Absorb"); + MWBase::Environment::get().getWorld()->getAnimation(target)->addEffect( + "meshes\\" + absorbStatic->mModel, ESM::MagicEffect::Reflect, false, ""); + // Magicka is increased by cost of spell + DynamicStat magicka = target.getClass().getCreatureStats(target).getMagicka(); + magicka.setCurrent(magicka.getCurrent() + spell->mData.mCost); + target.getClass().getCreatureStats(target).setMagicka(magicka); + magnitudeMult = 0; + } + } + + // Try reflecting + if (!reflected && magnitudeMult > 0 && caster != target && !(magicEffect->mData.mFlags & ESM::MagicEffect::Unreflectable)) + { + int reflect = target.getClass().getCreatureStats(target).getMagicEffects().get(ESM::MagicEffect::Reflect).mMagnitude; + int roll = std::rand()/ (static_cast (RAND_MAX) + 1) * 100; // [0, 99] + bool isReflected = (roll < reflect); + if (isReflected) + { + const ESM::Static* reflectStatic = MWBase::Environment::get().getWorld()->getStore().get().find ("VFX_Reflect"); + MWBase::Environment::get().getWorld()->getAnimation(target)->addEffect( + "meshes\\" + reflectStatic->mModel, ESM::MagicEffect::Reflect, false, ""); + reflectedEffects.mList.push_back(*effectIt); + magnitudeMult = 0; + } + } + + // Try resisting + if (magnitudeMult > 0 && target.getClass().isActor()) + { + + magnitudeMult = MWMechanics::getEffectMultiplier(effectIt->mEffectID, target, caster, spell); + if (magnitudeMult == 0) + { + // Fully resisted, show message + if (target.getRefData().getHandle() == "player") + MWBase::Environment::get().getWindowManager()->messageBox("#{sMagicPCResisted}"); + else + MWBase::Environment::get().getWindowManager()->messageBox("#{sMagicTargetResisted}"); + } + } + } + + + if (magnitudeMult > 0) + { + float random = std::rand() / static_cast(RAND_MAX); + float magnitude = effectIt->mMagnMin + (effectIt->mMagnMax - effectIt->mMagnMin) * random; + magnitude *= magnitudeMult; + + if (target.getClass().isActor() && !(magicEffect->mData.mFlags & ESM::MagicEffect::NoDuration)) + { + ActiveSpells::Effect effect; + effect.mKey = MWMechanics::EffectKey(*effectIt); + effect.mDuration = effectIt->mDuration; + effect.mMagnitude = magnitude; + + appliedLastingEffects.push_back(effect); + + // For absorb effects, also apply the effect to the caster - but with a negative + // magnitude, since we're transfering stats from the target to the caster + for (int i=0; i<5; ++i) + { + if (effectIt->mEffectID == ESM::MagicEffect::AbsorbAttribute+i) + { + std::vector effects; + ActiveSpells::Effect effect_ = effect; + effect_.mMagnitude *= -1; + effects.push_back(effect_); + caster.getClass().getCreatureStats(caster).getActiveSpells().addSpell("", true, effects, mSourceName); + } + } + } + else + applyInstantEffect(target, effectIt->mEffectID, magnitude); + + if (target.getClass().isActor() || magicEffect->mData.mFlags & ESM::MagicEffect::NoDuration) + { + // Play sound, only for the first effect + if (firstAppliedEffect) + { + static const std::string schools[] = { + "alteration", "conjuration", "destruction", "illusion", "mysticism", "restoration" + }; + + MWBase::SoundManager *sndMgr = MWBase::Environment::get().getSoundManager(); + if(!magicEffect->mHitSound.empty()) + sndMgr->playSound3D(target, magicEffect->mHitSound, 1.0f, 1.0f); + else + sndMgr->playSound3D(target, schools[magicEffect->mData.mSchool]+" hit", 1.0f, 1.0f); + firstAppliedEffect = false; + } + + // Add VFX + if (!magicEffect->mHit.empty()) + { + const ESM::Static* castStatic = MWBase::Environment::get().getWorld()->getStore().get().find (magicEffect->mHit); + bool loop = magicEffect->mData.mFlags & ESM::MagicEffect::ContinuousVfx; + // Note: in case of non actor, a free effect should be fine as well + MWRender::Animation* anim = MWBase::Environment::get().getWorld()->getAnimation(target); + if (anim) + anim->addEffect("meshes\\" + castStatic->mModel, magicEffect->mIndex, loop, ""); + } + } + + // TODO: For Area effects, launch a growing particle effect that applies the effect to more actors as it hits them. Best managed in World. + } + } + + if (reflectedEffects.mList.size()) + inflict(caster, target, reflectedEffects, range, true); + + if (appliedLastingEffects.size()) + target.getClass().getCreatureStats(target).getActiveSpells().addSpell(mId, mStack, appliedLastingEffects, mSourceName); + } + + void CastSpell::applyInstantEffect(const MWWorld::Ptr &target, short effectId, float magnitude) + { + if (!target.getClass().isActor()) + { + if (effectId == ESM::MagicEffect::Lock) + { + if (target.getCellRef().mLockLevel < magnitude) + target.getCellRef().mLockLevel = magnitude; + } + else if (effectId == ESM::MagicEffect::Open) + { + // TODO: This is a crime + if (target.getCellRef().mLockLevel <= magnitude) + { + if (target.getCellRef().mLockLevel > 0) + MWBase::Environment::get().getSoundManager()->playSound3D(target, "Open Lock", 1.f, 1.f); + target.getCellRef().mLockLevel = 0; + } + else + MWBase::Environment::get().getSoundManager()->playSound3D(target, "Open Lock Fail", 1.f, 1.f); + } + } + else + { + if (effectId == ESM::MagicEffect::CurePoison) + target.getClass().getCreatureStats(target).getActiveSpells().purgeEffect(ESM::MagicEffect::Poison); + else if (effectId == ESM::MagicEffect::CureParalyzation) + target.getClass().getCreatureStats(target).getActiveSpells().purgeEffect(ESM::MagicEffect::Paralyze); + else if (effectId == ESM::MagicEffect::CureCommonDisease) + target.getClass().getCreatureStats(target).getSpells().purgeCommonDisease(); + else if (effectId == ESM::MagicEffect::CureBlightDisease) + target.getClass().getCreatureStats(target).getSpells().purgeBlightDisease(); + else if (effectId == ESM::MagicEffect::CureCorprusDisease) + target.getClass().getCreatureStats(target).getSpells().purgeCorprusDisease(); + else if (effectId == ESM::MagicEffect::Dispel) + target.getClass().getCreatureStats(target).getActiveSpells().purgeAll(); + else if (effectId == ESM::MagicEffect::RemoveCurse) + target.getClass().getCreatureStats(target).getSpells().purgeCurses(); + + else if (effectId == ESM::MagicEffect::DivineIntervention) + { + // We need to be able to get the world location of an interior cell before implementing this + // or alternatively, the last known exterior location of the player, which is how vanilla does it. + } + else if (effectId == ESM::MagicEffect::AlmsiviIntervention) + { + // Same as above + } + + else if (effectId == ESM::MagicEffect::Mark) + { + // TODO + } + else if (effectId == ESM::MagicEffect::Recall) + { + // TODO + } + } + } + + bool CastSpell::cast(const std::string &id) + { + if (const ESM::Spell *spell = + MWBase::Environment::get().getWorld()->getStore().get().search (id)) + return cast(spell); + + if (const ESM::Potion *potion = + MWBase::Environment::get().getWorld()->getStore().get().search (id)) + return cast(potion); + + if (const ESM::Ingredient *ingredient = + MWBase::Environment::get().getWorld()->getStore().get().search (id)) + return cast(ingredient); + + throw std::runtime_error("ID type cannot be casted"); + } + + bool CastSpell::cast(const MWWorld::Ptr &item) + { + std::string enchantmentName = item.getClass().getEnchantment(item); + if (enchantmentName.empty()) + throw std::runtime_error("can't cast an item without an enchantment"); + + mSourceName = item.getClass().getName(item); + mId = item.getCellRef().mRefID; + + const ESM::Enchantment* enchantment = MWBase::Environment::get().getWorld()->getStore().get().find(enchantmentName); + + mStack = (enchantment->mData.mType == ESM::Enchantment::CastOnce); + + if (enchantment->mData.mType == ESM::Enchantment::WhenUsed) + { + // Check if there's enough charge left + const float enchantCost = enchantment->mData.mCost; + MWMechanics::NpcStats &stats = MWWorld::Class::get(mCaster).getNpcStats(mCaster); + int eSkill = stats.getSkill(ESM::Skill::Enchant).getModified(); + const int castCost = std::max(1.f, enchantCost - (enchantCost / 100) * (eSkill - 10)); + + if (item.getCellRef().mEnchantmentCharge == -1) + item.getCellRef().mEnchantmentCharge = enchantment->mData.mCharge; + + if (mCaster.getRefData().getHandle() == "player" && item.getCellRef().mEnchantmentCharge < castCost) + { + // TODO: Should there be a sound here? + MWBase::Environment::get().getWindowManager()->messageBox("#{sMagicInsufficientCharge}"); + return false; + } + + // Reduce charge + item.getCellRef().mEnchantmentCharge -= castCost; + } + if (enchantment->mData.mType == ESM::Enchantment::CastOnce) + item.getContainerStore()->remove(item, 1, mCaster); + else if (enchantment->mData.mType != ESM::Enchantment::WhenStrikes) + { + if (mCaster.getRefData().getHandle() == "player") + MWBase::Environment::get().getWindowManager()->setSelectedEnchantItem(item); // Set again to show the modified charge + } + + if (mCaster.getRefData().getHandle() == "player") + mCaster.getClass().skillUsageSucceeded (mCaster, ESM::Skill::Enchant, 1); + + inflict(mCaster, mCaster, enchantment->mEffects, ESM::RT_Self); + + if (!mTarget.isEmpty()) + { + if (!mTarget.getClass().isActor() || !mTarget.getClass().getCreatureStats(mTarget).isDead()) + inflict(mTarget, mCaster, enchantment->mEffects, ESM::RT_Touch); + } + + MWBase::Environment::get().getWorld()->launchProjectile(mId, false, enchantment->mEffects, mCaster, mSourceName); + + return true; + } + + bool CastSpell::cast(const ESM::Potion* potion) + { + mSourceName = potion->mName; + mId = potion->mId; + mStack = true; + + inflict(mCaster, mCaster, potion->mEffects, ESM::RT_Self); + + return true; + } + + bool CastSpell::cast(const ESM::Spell* spell) + { + mSourceName = spell->mName; + mId = spell->mId; + mStack = false; + + const MWWorld::ESMStore& store = MWBase::Environment::get().getWorld()->getStore(); + + int school = 0; + + if (mCaster.getClass().isActor()) + { + school = getSpellSchool(spell, mCaster); + + CreatureStats& stats = mCaster.getClass().getCreatureStats(mCaster); + + // Reduce fatigue (note that in the vanilla game, both GMSTs are 0, and there's no fatigue loss) + static const float fFatigueSpellBase = store.get().find("fFatigueSpellBase")->getFloat(); + static const float fFatigueSpellMult = store.get().find("fFatigueSpellMult")->getFloat(); + DynamicStat fatigue = stats.getFatigue(); + const float normalizedEncumbrance = mCaster.getClass().getEncumbrance(mCaster) / mCaster.getClass().getCapacity(mCaster); + float fatigueLoss = spell->mData.mCost * (fFatigueSpellBase + normalizedEncumbrance * fFatigueSpellMult); + fatigue.setCurrent(std::max(0.f, fatigue.getCurrent() - fatigueLoss)); + stats.setFatigue(fatigue); + + // Check mana + bool fail = false; + DynamicStat magicka = stats.getMagicka(); + if (magicka.getCurrent() < spell->mData.mCost) + { + MWBase::Environment::get().getWindowManager()->messageBox("#{sMagicInsufficientSP}"); + fail = true; + } + + // Reduce mana + if (!fail) + { + magicka.setCurrent(magicka.getCurrent() - spell->mData.mCost); + stats.setMagicka(magicka); + } + + // If this is a power, check if it was already used in last 24h + if (!fail && spell->mData.mType & ESM::Spell::ST_Power) + { + if (stats.canUsePower(spell->mId)) + stats.usePower(spell->mId); + else + { + MWBase::Environment::get().getWindowManager()->messageBox("#{sPowerAlreadyUsed}"); + fail = true; + } + } + + // Check success + int successChance = getSpellSuccessChance(spell, mCaster); + int roll = std::rand()/ (static_cast (RAND_MAX) + 1) * 100; // [0, 99] + if (!fail && roll >= successChance) + { + MWBase::Environment::get().getWindowManager()->messageBox("#{sMagicSkillFail}"); + fail = true; + } + + if (fail) + { + // Failure sound + static const std::string schools[] = { + "alteration", "conjuration", "destruction", "illusion", "mysticism", "restoration" + }; + + MWBase::SoundManager *sndMgr = MWBase::Environment::get().getSoundManager(); + sndMgr->playSound3D(mCaster, "Spell Failure " + schools[school], 1.0f, 1.0f); + return false; + } + } + + if (mCaster.getRefData().getHandle() == "player" && spell->mData.mType == ESM::Spell::ST_Spell) + mCaster.getClass().skillUsageSucceeded(mCaster, + spellSchoolToSkill(school), 0); + + inflict(mCaster, mCaster, spell->mEffects, ESM::RT_Self); + + if (!mTarget.isEmpty()) + { + if (!mTarget.getClass().isActor() || !mTarget.getClass().getCreatureStats(mTarget).isDead()) + { + inflict(mTarget, mCaster, spell->mEffects, ESM::RT_Touch); + } + } + + MWBase::Environment::get().getWorld()->launchProjectile(mId, false, spell->mEffects, mCaster, mSourceName); + return true; + } + + bool CastSpell::cast (const ESM::Ingredient* ingredient) + { + mId = ingredient->mId; + mStack = true; + mSourceName = ingredient->mName; + + ESM::ENAMstruct effect; + effect.mEffectID = ingredient->mData.mEffectID[0]; + effect.mSkill = ingredient->mData.mSkills[0]; + effect.mAttribute = ingredient->mData.mAttributes[0]; + effect.mRange = ESM::RT_Self; + effect.mArea = 0; + + const ESM::MagicEffect *magicEffect = + MWBase::Environment::get().getWorld()->getStore().get().find ( + effect.mEffectID); + + const MWMechanics::NpcStats& npcStats = mCaster.getClass().getNpcStats(mCaster); + const MWMechanics::CreatureStats& creatureStats = mCaster.getClass().getCreatureStats(mCaster); + + float x = (npcStats.getSkill (ESM::Skill::Alchemy).getModified() + + 0.2 * creatureStats.getAttribute (ESM::Attribute::Intelligence).getModified() + + 0.1 * creatureStats.getAttribute (ESM::Attribute::Luck).getModified()) + * creatureStats.getFatigueTerm(); + + int roll = std::rand()/ (static_cast (RAND_MAX) + 1) * 100; // [0, 99] + if (roll > x) + { + // "X has no effect on you" + std::string message = MWBase::Environment::get().getWorld()->getStore().get().find("sNotifyMessage50")->getString(); + message = boost::str(boost::format(message) % ingredient->mName); + MWBase::Environment::get().getWindowManager()->messageBox(message); + return false; + } + + float magnitude = 0; + float y = roll / std::min(x, 100.f); + y *= 0.25 * x; + if (magicEffect->mData.mFlags & ESM::MagicEffect::NoDuration) + effect.mDuration = int(y); + else + effect.mDuration = 1; + if (!(magicEffect->mData.mFlags & ESM::MagicEffect::NoMagnitude)) + { + if (!magicEffect->mData.mFlags & ESM::MagicEffect::NoDuration) + magnitude = int((0.05 * y) / (0.1 * magicEffect->mData.mBaseCost)); + else + magnitude = int(y / (0.1 * magicEffect->mData.mBaseCost)); + magnitude = std::max(1.f, magnitude); + } + else + magnitude = 1; + + effect.mMagnMax = magnitude; + effect.mMagnMin = magnitude; + + ESM::EffectList effects; + effects.mList.push_back(effect); + + inflict(mCaster, mCaster, effects, ESM::RT_Self); + + return true; + } + +} diff --git a/apps/openmw/mwmechanics/spellcasting.hpp b/apps/openmw/mwmechanics/spellcasting.hpp new file mode 100644 index 000000000..e2efaa140 --- /dev/null +++ b/apps/openmw/mwmechanics/spellcasting.hpp @@ -0,0 +1,211 @@ +#ifndef MWMECHANICS_SPELLSUCCESS_H +#define MWMECHANICS_SPELLSUCCESS_H + +#include + +#include "../mwbase/world.hpp" +#include "../mwbase/environment.hpp" + +#include "../mwworld/ptr.hpp" +#include "../mwworld/class.hpp" +#include "../mwmechanics/creaturestats.hpp" + +#include "../mwworld/esmstore.hpp" + +#include "npcstats.hpp" + +namespace MWMechanics +{ + inline int spellSchoolToSkill(int school) + { + std::map schoolSkillMap; // maps spell school to skill id + schoolSkillMap[0] = 11; // alteration + schoolSkillMap[1] = 13; // conjuration + schoolSkillMap[3] = 12; // illusion + schoolSkillMap[2] = 10; // destruction + schoolSkillMap[4] = 14; // mysticism + schoolSkillMap[5] = 15; // restoration + assert(schoolSkillMap.find(school) != schoolSkillMap.end()); + return schoolSkillMap[school]; + } + + /** + * @param spell spell to cast + * @param actor calculate spell success chance for this actor (depends on actor's skills) + * @param effectiveSchool the spell's effective school (relevant for skill progress) will be written here + * @attention actor has to be an NPC and not a creature! + * @return success chance from 0 to 100 (in percent) + */ + inline float getSpellSuccessChance (const ESM::Spell* spell, const MWWorld::Ptr& actor, int* effectiveSchool = NULL) + { + NpcStats& stats = MWWorld::Class::get(actor).getNpcStats(actor); + CreatureStats& creatureStats = MWWorld::Class::get(actor).getCreatureStats(actor); + + if (creatureStats.getMagicEffects().get(ESM::MagicEffect::Silence).mMagnitude) + return 0; + + float y = FLT_MAX; + float lowestSkill = 0; + + for (std::vector::const_iterator it = spell->mEffects.mList.begin(); it != spell->mEffects.mList.end(); ++it) + { + float x = it->mDuration; + const ESM::MagicEffect* magicEffect = MWBase::Environment::get().getWorld()->getStore().get().find( + it->mEffectID); + if (!(magicEffect->mData.mFlags & ESM::MagicEffect::UncappedDamage)) + x = std::max(1.f, x); + x *= 0.1 * magicEffect->mData.mBaseCost; + x *= 0.5 * (it->mMagnMin + it->mMagnMax); + x *= it->mArea * 0.05 * magicEffect->mData.mBaseCost; + if (magicEffect->mData.mFlags & ESM::MagicEffect::CastTarget) + x *= 1.5; + static const float fEffectCostMult = MWBase::Environment::get().getWorld()->getStore().get().find( + "fEffectCostMult")->getFloat(); + x *= fEffectCostMult; + + float s = 2 * stats.getSkill(spellSchoolToSkill(magicEffect->mData.mSchool)).getModified(); + if (s - x < y) + { + y = s - x; + if (effectiveSchool) + *effectiveSchool = magicEffect->mData.mSchool; + lowestSkill = s; + } + } + + if (spell->mData.mType != ESM::Spell::ST_Spell) + return 100; + + if (spell->mData.mFlags & ESM::Spell::F_Always) + return 100; + + int castBonus = -stats.getMagicEffects().get(ESM::MagicEffect::Sound).mMagnitude; + + int actorWillpower = stats.getAttribute(ESM::Attribute::Willpower).getModified(); + int actorLuck = stats.getAttribute(ESM::Attribute::Luck).getModified(); + + float castChance = (lowestSkill - spell->mData.mCost + castBonus + 0.2 * actorWillpower + 0.1 * actorLuck) * stats.getFatigueTerm(); + if (MWBase::Environment::get().getWorld()->getGodModeState() && actor.getRefData().getHandle() == "player") + castChance = 100; + + return std::max(0.f, std::min(100.f, castChance)); + } + + inline float getSpellSuccessChance (const std::string& spellId, const MWWorld::Ptr& actor, int* effectiveSchool = NULL) + { + const ESM::Spell* spell = + MWBase::Environment::get().getWorld()->getStore().get().find(spellId); + return getSpellSuccessChance(spell, actor, effectiveSchool); + } + + inline int getSpellSchool(const std::string& spellId, const MWWorld::Ptr& actor) + { + int school = 0; + getSpellSuccessChance(spellId, actor, &school); + return school; + } + + inline int getSpellSchool(const ESM::Spell* spell, const MWWorld::Ptr& actor) + { + int school = 0; + getSpellSuccessChance(spell, actor, &school); + return school; + } + + /// @return >=100 for fully resisted. can also return negative value for damage amplification. + inline float getEffectResistance (short effectId, const MWWorld::Ptr& actor, const MWWorld::Ptr& caster, const ESM::Spell* spell = NULL) + { + const ESM::MagicEffect *magicEffect = + MWBase::Environment::get().getWorld()->getStore().get().find ( + effectId); + + const MWMechanics::CreatureStats& stats = actor.getClass().getCreatureStats(actor); + + float resisted = 0; + if (magicEffect->mData.mFlags & ESM::MagicEffect::Harmful) + { + + short resistanceEffect = ESM::MagicEffect::getResistanceEffect(effectId); + short weaknessEffect = ESM::MagicEffect::getWeaknessEffect(effectId); + + float resistance = 0; + if (resistanceEffect != -1) + resistance += stats.getMagicEffects().get(resistanceEffect).mMagnitude; + if (weaknessEffect != -1) + resistance -= stats.getMagicEffects().get(weaknessEffect).mMagnitude; + + + float willpower = stats.getAttribute(ESM::Attribute::Willpower).getModified(); + float luck = stats.getAttribute(ESM::Attribute::Luck).getModified(); + float x = (willpower + 0.1 * luck) * stats.getFatigueTerm(); + + // This makes spells that are easy to cast harder to resist and vice versa + if (spell != NULL && caster.getClass().isActor()) + { + float castChance = getSpellSuccessChance(spell, caster); + if (castChance > 0) + x *= 50 / castChance; + } + + float roll = static_cast(std::rand()) / RAND_MAX * 100; + if (magicEffect->mData.mFlags & ESM::MagicEffect::NoMagnitude) + roll -= resistance; + + if (x <= roll) + x = 0; + else + { + if (magicEffect->mData.mFlags & ESM::MagicEffect::NoMagnitude) + x = 100; + else + x = roll / std::min(x, 100.f); + } + + x = std::min(x + resistance, 100.f); + + resisted = x; + } + + return resisted; + } + + inline float getEffectMultiplier(short effectId, const MWWorld::Ptr& actor, const MWWorld::Ptr& caster, const ESM::Spell* spell = NULL) + { + float resistance = getEffectResistance(effectId, actor, caster, spell); + if (resistance >= 0) + return 1 - resistance / 100.f; + else + return -(resistance-100) / 100.f; + } + + + class CastSpell + { + private: + MWWorld::Ptr mCaster; + MWWorld::Ptr mTarget; + public: + bool mStack; + std::string mId; // ID of spell, potion, item etc + std::string mSourceName; // Display name for spell, potion, etc + + public: + CastSpell(const MWWorld::Ptr& caster, const MWWorld::Ptr& target); + + bool cast (const ESM::Spell* spell); + bool cast (const MWWorld::Ptr& item); + bool cast (const ESM::Ingredient* ingredient); + bool cast (const ESM::Potion* potion); + + /// @note Auto detects if spell, ingredient or potion + bool cast (const std::string& id); + + void inflict (const MWWorld::Ptr& target, const MWWorld::Ptr& caster, + const ESM::EffectList& effects, ESM::RangeType range, bool reflected=false); + + void applyInstantEffect (const MWWorld::Ptr& target, short effectId, float magnitude); + }; + +} + +#endif diff --git a/apps/openmw/mwmechanics/spells.cpp b/apps/openmw/mwmechanics/spells.cpp index e10dcdc93..6e7ac6f31 100644 --- a/apps/openmw/mwmechanics/spells.cpp +++ b/apps/openmw/mwmechanics/spells.cpp @@ -27,7 +27,15 @@ namespace MWMechanics void Spells::add (const std::string& spellId) { if (mSpells.find (spellId)==mSpells.end()) - mSpells.insert (std::make_pair (spellId, static_cast (std::rand()) / RAND_MAX)); + { + const ESM::Spell* spell = MWBase::Environment::get().getWorld()->getStore().get().find(spellId); + + std::vector random; + random.resize(spell->mEffects.mList.size()); + for (unsigned int i=0; i (std::rand()) / RAND_MAX; + mSpells.insert (std::make_pair (spellId, random)); + } } void Spells::remove (const std::string& spellId) @@ -43,6 +51,8 @@ namespace MWMechanics MagicEffects Spells::getMagicEffects() const { + // TODO: These are recalculated every frame, no need to do that + MagicEffects effects; for (TIterator iter = mSpells.begin(); iter!=mSpells.end(); ++iter) @@ -52,7 +62,14 @@ namespace MWMechanics if (spell->mData.mType==ESM::Spell::ST_Ability || spell->mData.mType==ESM::Spell::ST_Blight || spell->mData.mType==ESM::Spell::ST_Disease || spell->mData.mType==ESM::Spell::ST_Curse) - effects.add (spell->mEffects, iter->second); + { + int i=0; + for (std::vector::const_iterator it = spell->mEffects.mList.begin(); it != spell->mEffects.mList.end(); ++it) + { + effects.add (*it, it->mMagnMin + (it->mMagnMax - it->mMagnMin) * iter->second[i]); + ++i; + } + } } return effects; @@ -100,4 +117,83 @@ namespace MWMechanics return false; } + + void Spells::purgeCommonDisease() + { + for (TContainer::iterator iter = mSpells.begin(); iter!=mSpells.end();) + { + const ESM::Spell *spell = + MWBase::Environment::get().getWorld()->getStore().get().find (iter->first); + + if (spell->mData.mType & ESM::Spell::ST_Disease) + mSpells.erase(iter++); + else + iter++; + } + } + + void Spells::purgeBlightDisease() + { + for (TContainer::iterator iter = mSpells.begin(); iter!=mSpells.end();) + { + const ESM::Spell *spell = + MWBase::Environment::get().getWorld()->getStore().get().find (iter->first); + + if (spell->mData.mType & ESM::Spell::ST_Blight) + mSpells.erase(iter++); + else + iter++; + } + } + + void Spells::purgeCorprusDisease() + { + for (TContainer::iterator iter = mSpells.begin(); iter!=mSpells.end();) + { + const ESM::Spell *spell = + MWBase::Environment::get().getWorld()->getStore().get().find (iter->first); + + if (Misc::StringUtils::ciEqual(spell->mId, "corprus")) + mSpells.erase(iter++); + else + iter++; + } + } + + void Spells::purgeCurses() + { + for (TContainer::iterator iter = mSpells.begin(); iter!=mSpells.end();) + { + const ESM::Spell *spell = + MWBase::Environment::get().getWorld()->getStore().get().find (iter->first); + + if (spell->mData.mType == ESM::Spell::ST_Curse) + mSpells.erase(iter++); + else + iter++; + } + } + + void Spells::visitEffectSources(EffectSourceVisitor &visitor) const + { + for (TIterator it = begin(); it != end(); ++it) + { + const ESM::Spell* spell = MWBase::Environment::get().getWorld()->getStore().get().find(it->first); + + // these are the spell types that are permanently in effect + if (!(spell->mData.mType == ESM::Spell::ST_Ability) + && !(spell->mData.mType == ESM::Spell::ST_Disease) + && !(spell->mData.mType == ESM::Spell::ST_Curse) + && !(spell->mData.mType == ESM::Spell::ST_Blight)) + continue; + const ESM::EffectList& list = spell->mEffects; + int i=0; + for (std::vector::const_iterator effectIt = list.mList.begin(); + effectIt != list.mList.end(); ++effectIt, ++i) + { + float magnitude = effectIt->mMagnMin + (effectIt->mMagnMax - effectIt->mMagnMin) * it->second[i]; + visitor.visit(MWMechanics::EffectKey(*effectIt), spell->mName, magnitude); + } + } + } } diff --git a/apps/openmw/mwmechanics/spells.hpp b/apps/openmw/mwmechanics/spells.hpp index e00ac259f..cf9b66091 100644 --- a/apps/openmw/mwmechanics/spells.hpp +++ b/apps/openmw/mwmechanics/spells.hpp @@ -4,6 +4,10 @@ #include #include +#include "../mwworld/ptr.hpp" + +#include "magiceffects.hpp" + namespace ESM { struct Spell; @@ -21,7 +25,7 @@ namespace MWMechanics { public: - typedef std::map TContainer; // ID, normalised magnitude + typedef std::map > TContainer; // ID, normalised magnitudes typedef TContainer::const_iterator TIterator; private: @@ -31,6 +35,11 @@ namespace MWMechanics public: + void purgeCommonDisease(); + void purgeBlightDisease(); + void purgeCorprusDisease(); + void purgeCurses(); + TIterator begin() const; TIterator end() const; @@ -57,6 +66,8 @@ namespace MWMechanics bool hasCommonDisease() const; bool hasBlightDisease() const; + + void visitEffectSources (MWMechanics::EffectSourceVisitor& visitor) const; }; } diff --git a/apps/openmw/mwmechanics/spellsuccess.hpp b/apps/openmw/mwmechanics/spellsuccess.hpp deleted file mode 100644 index 57c600df5..000000000 --- a/apps/openmw/mwmechanics/spellsuccess.hpp +++ /dev/null @@ -1,118 +0,0 @@ -#ifndef MWMECHANICS_SPELLSUCCESS_H -#define MWMECHANICS_SPELLSUCCESS_H - -#include "../mwbase/world.hpp" -#include "../mwbase/environment.hpp" - -#include "../mwworld/ptr.hpp" -#include "../mwworld/class.hpp" -#include "../mwmechanics/creaturestats.hpp" - -#include "../mwworld/esmstore.hpp" - -#include "npcstats.hpp" - -namespace MWMechanics -{ - inline int spellSchoolToSkill(int school) - { - std::map schoolSkillMap; // maps spell school to skill id - schoolSkillMap[0] = 11; // alteration - schoolSkillMap[1] = 13; // conjuration - schoolSkillMap[3] = 12; // illusion - schoolSkillMap[2] = 10; // destruction - schoolSkillMap[4] = 14; // mysticism - schoolSkillMap[5] = 15; // restoration - assert(schoolSkillMap.find(school) != schoolSkillMap.end()); - return schoolSkillMap[school]; - } - - inline int getSpellSchool(const ESM::Spell* spell, const MWWorld::Ptr& actor) - { - NpcStats& stats = MWWorld::Class::get(actor).getNpcStats(actor); - - // determine the spell's school - // this is always the school where the player's respective skill is the least advanced - // out of all the magic effects' schools - const std::vector& effects = spell->mEffects.mList; - int school = -1; - int skillLevel = -1; - for (std::vector::const_iterator it = effects.begin(); - it != effects.end(); ++it) - { - const ESM::MagicEffect* effect = - MWBase::Environment::get().getWorld()->getStore().get().find(it->mEffectID); - int _school = effect->mData.mSchool; - int _skillLevel = stats.getSkill (spellSchoolToSkill(_school)).getModified(); - - if (school == -1) - { - school = _school; - skillLevel = _skillLevel; - } - else if (_skillLevel < skillLevel) - { - school = _school; - skillLevel = _skillLevel; - } - } - - return school; - } - - inline int getSpellSchool(const std::string& spellId, const MWWorld::Ptr& actor) - { - const ESM::Spell* spell = - MWBase::Environment::get().getWorld()->getStore().get().find(spellId); - return getSpellSchool(spell, actor); - } - - - // UESP wiki / Morrowind/Spells: - // Chance of success is (Spell's skill * 2 + Willpower / 5 + Luck / 10 - Spell cost - Sound magnitude) * (Current fatigue + Maximum Fatigue * 1.5) / Maximum fatigue * 2 - /** - * @param spell spell to cast - * @param actor calculate spell success chance for this actor (depends on actor's skills) - * @attention actor has to be an NPC and not a creature! - * @return success chance from 0 to 100 (in percent) - */ - inline float getSpellSuccessChance (const ESM::Spell* spell, const MWWorld::Ptr& actor) - { - if (spell->mData.mFlags & ESM::Spell::F_Always // spells with this flag always succeed (usually birthsign spells) - || spell->mData.mType == ESM::Spell::ST_Power) // powers always succeed, but can be cast only once per day - return 100.0; - - if (spell->mEffects.mList.size() == 0) - return 0.0; - - NpcStats& stats = MWWorld::Class::get(actor).getNpcStats(actor); - CreatureStats& creatureStats = MWWorld::Class::get(actor).getCreatureStats(actor); - - int skillLevel = stats.getSkill (getSpellSchool(spell, actor)).getModified(); - - // Sound magic effect (reduces spell casting chance) - int soundMagnitude = creatureStats.getMagicEffects().get (MWMechanics::EffectKey (48)).mMagnitude; - - int willpower = creatureStats.getAttribute(ESM::Attribute::Willpower).getModified(); - int luck = creatureStats.getAttribute(ESM::Attribute::Luck).getModified(); - int currentFatigue = creatureStats.getFatigue().getCurrent(); - int maxFatigue = creatureStats.getFatigue().getModified(); - int spellCost = spell->mData.mCost; - - // There we go, all needed variables are there, lets go - float chance = (float(skillLevel * 2) + float(willpower)/5.0 + float(luck)/ 10.0 - spellCost - soundMagnitude) * (float(currentFatigue + maxFatigue * 1.5)) / float(maxFatigue * 2.0); - - chance = std::max(0.0f, std::min(100.0f, chance)); // clamp to 0 .. 100 - - return chance; - } - - inline float getSpellSuccessChance (const std::string& spellId, const MWWorld::Ptr& actor) - { - const ESM::Spell* spell = - MWBase::Environment::get().getWorld()->getStore().get().find(spellId); - return getSpellSuccessChance(spell, actor); - } -} - -#endif diff --git a/apps/openmw/mwmechanics/stat.hpp b/apps/openmw/mwmechanics/stat.hpp index 65d47c9c0..cb6c09014 100644 --- a/apps/openmw/mwmechanics/stat.hpp +++ b/apps/openmw/mwmechanics/stat.hpp @@ -162,14 +162,26 @@ namespace MWMechanics setCurrent (getCurrent()+diff); } - void setCurrent (const T& value) + void setCurrent (const T& value, bool allowDecreaseBelowZero = false) { - mCurrent = value; + if (value > mCurrent) + { + // increase + mCurrent = value; - if (mCurrent<0) + if (mCurrent > getModified()) + mCurrent = getModified(); + } + else if (value > 0 || allowDecreaseBelowZero) + { + // allowed decrease + mCurrent = value; + } + else if (mCurrent > 0) + { + // capped decrease mCurrent = 0; - else if (mCurrent>getModified()) - mCurrent = getModified(); + } } void setModifier (const T& modifier) diff --git a/apps/openmw/mwrender/actors.cpp b/apps/openmw/mwrender/actors.cpp index 566b6fa81..1bdec6e19 100644 --- a/apps/openmw/mwrender/actors.cpp +++ b/apps/openmw/mwrender/actors.cpp @@ -68,13 +68,16 @@ void Actors::insertBegin(const MWWorld::Ptr &ptr) ptr.getRefData().setBaseNode(insert); } -void Actors::insertNPC(const MWWorld::Ptr& ptr, MWWorld::InventoryStore& inv) +void Actors::insertNPC(const MWWorld::Ptr& ptr) { insertBegin(ptr); - NpcAnimation* anim = new NpcAnimation(ptr, ptr.getRefData().getBaseNode(), inv, RV_Actors); + NpcAnimation* anim = new NpcAnimation(ptr, ptr.getRefData().getBaseNode(), RV_Actors); delete mAllActors[ptr]; mAllActors[ptr] = anim; mRendering->addWaterRippleEmitter (ptr); + + // Create CustomData, will do autoEquip and trigger animation parts update + ptr.getClass().getInventoryStore(ptr); } void Actors::insertCreature (const MWWorld::Ptr& ptr) { diff --git a/apps/openmw/mwrender/actors.hpp b/apps/openmw/mwrender/actors.hpp index 4547db9ad..61a0808f5 100644 --- a/apps/openmw/mwrender/actors.hpp +++ b/apps/openmw/mwrender/actors.hpp @@ -39,7 +39,7 @@ namespace MWRender void setRootNode(Ogre::SceneNode* root); - void insertNPC(const MWWorld::Ptr& ptr, MWWorld::InventoryStore& inv); + void insertNPC(const MWWorld::Ptr& ptr); void insertCreature (const MWWorld::Ptr& ptr); void insertActivator (const MWWorld::Ptr& ptr); bool deleteObject (const MWWorld::Ptr& ptr); diff --git a/apps/openmw/mwrender/animation.cpp b/apps/openmw/mwrender/animation.cpp index 545060fe3..42d11aa6d 100644 --- a/apps/openmw/mwrender/animation.cpp +++ b/apps/openmw/mwrender/animation.cpp @@ -17,6 +17,8 @@ #include "../mwbase/soundmanager.hpp" #include "../mwbase/world.hpp" +#include + #include "../mwmechanics/character.hpp" #include "../mwmechanics/creaturestats.hpp" #include "../mwworld/class.hpp" @@ -24,6 +26,7 @@ #include "renderconst.hpp" + namespace MWRender { @@ -39,26 +42,13 @@ void Animation::AnimationValue::setValue(Ogre::Real) { } - -void Animation::destroyObjectList(Ogre::SceneManager *sceneMgr, NifOgre::ObjectList &objects) +Ogre::Real Animation::EffectAnimationValue::getValue() const +{ + return mTime; +} + +void Animation::EffectAnimationValue::setValue(Ogre::Real) { - for(size_t i = 0;i < objects.mLights.size();i++) - { - Ogre::Light *light = objects.mLights[i]; - // If parent is a scene node, it was created specifically for this light. Destroy it now. - if(light->isAttached() && !light->isParentTagPoint()) - sceneMgr->destroySceneNode(light->getParentSceneNode()); - sceneMgr->destroyLight(light); - } - for(size_t i = 0;i < objects.mParticles.size();i++) - sceneMgr->destroyParticleSystem(objects.mParticles[i]); - for(size_t i = 0;i < objects.mEntities.size();i++) - sceneMgr->destroyEntity(objects.mEntities[i]); - objects.mControllers.clear(); - objects.mLights.clear(); - objects.mParticles.clear(); - objects.mEntities.clear(); - objects.mSkelBase = NULL; } Animation::Animation(const MWWorld::Ptr &ptr, Ogre::SceneNode *node) @@ -78,10 +68,9 @@ Animation::Animation(const MWWorld::Ptr &ptr, Ogre::SceneNode *node) Animation::~Animation() { - mAnimSources.clear(); + mEffects.clear(); - Ogre::SceneManager *sceneMgr = mInsert->getCreator(); - destroyObjectList(sceneMgr, mObjectRoot); + mAnimSources.clear(); } @@ -90,7 +79,7 @@ void Animation::setObjectRoot(const std::string &model, bool baseonly) OgreAssert(mAnimSources.empty(), "Setting object root while animation sources are set!"); mSkelBase = NULL; - destroyObjectList(mInsert->getCreator(), mObjectRoot); + mObjectRoot.setNull(); if(model.empty()) return; @@ -111,11 +100,11 @@ void Animation::setObjectRoot(const std::string &model, bool baseonly) mObjectRoot = (!baseonly ? NifOgre::Loader::createObjects(mInsert, mdlname) : NifOgre::Loader::createObjectBase(mInsert, mdlname)); - if(mObjectRoot.mSkelBase) + if(mObjectRoot->mSkelBase) { - mSkelBase = mObjectRoot.mSkelBase; + mSkelBase = mObjectRoot->mSkelBase; - Ogre::AnimationStateSet *aset = mObjectRoot.mSkelBase->getAllAnimationStates(); + Ogre::AnimationStateSet *aset = mObjectRoot->mSkelBase->getAllAnimationStates(); Ogre::AnimationStateIterator asiter = aset->getAnimationStateIterator(); while(asiter.hasMoreElements()) { @@ -126,7 +115,7 @@ void Animation::setObjectRoot(const std::string &model, bool baseonly) // Set the bones as manually controlled since we're applying the // transformations manually - Ogre::SkeletonInstance *skelinst = mObjectRoot.mSkelBase->getSkeleton(); + Ogre::SkeletonInstance *skelinst = mObjectRoot->mSkelBase->getSkeleton(); Ogre::Skeleton::BoneIterator boneiter = skelinst->getBoneIterator(); while(boneiter.hasMoreElements()) boneiter.getNext()->setManuallyControlled(true); @@ -147,15 +136,44 @@ void Animation::setObjectRoot(const std::string &model, bool baseonly) else mAttachedObjects.clear(); - for(size_t i = 0;i < mObjectRoot.mControllers.size();i++) + for(size_t i = 0;i < mObjectRoot->mControllers.size();i++) { - if(mObjectRoot.mControllers[i].getSource().isNull()) - mObjectRoot.mControllers[i].setSource(mAnimationValuePtr[0]); + if(mObjectRoot->mControllers[i].getSource().isNull()) + mObjectRoot->mControllers[i].setSource(mAnimationValuePtr[0]); } } +struct AddGlow +{ + Ogre::Vector3* mColor; + AddGlow(Ogre::Vector3* col) : mColor(col) {} -class VisQueueSet { + // TODO: integrate this with material controllers? + void operator()(Ogre::Entity* entity) const + { + unsigned int numsubs = entity->getNumSubEntities(); + for(unsigned int i = 0;i < numsubs;++i) + { + unsigned int numsubs = entity->getNumSubEntities(); + for(unsigned int i = 0;i < numsubs;++i) + { + Ogre::SubEntity* subEnt = entity->getSubEntity(i); + std::string newName = subEnt->getMaterialName() + "@fx"; + if (sh::Factory::getInstance().searchInstance(newName) == NULL) + { + sh::MaterialInstance* instance = + sh::Factory::getInstance().createMaterialInstance(newName, subEnt->getMaterialName()); + instance->setProperty("env_map", sh::makeProperty(new sh::BooleanValue(true))); + instance->setProperty("env_map_color", sh::makeProperty(new sh::Vector3(mColor->x, mColor->y, mColor->z))); + } + subEnt->setMaterialName(newName); + } + } + } +}; + +class VisQueueSet +{ Ogre::uint32 mVisFlags; Ogre::uint8 mSolidQueue, mTransQueue; Ogre::Real mDist; @@ -189,12 +207,16 @@ public: } }; -void Animation::setRenderProperties(const NifOgre::ObjectList &objlist, Ogre::uint32 visflags, Ogre::uint8 solidqueue, Ogre::uint8 transqueue, Ogre::Real dist) +void Animation::setRenderProperties(NifOgre::ObjectScenePtr objlist, Ogre::uint32 visflags, Ogre::uint8 solidqueue, Ogre::uint8 transqueue, Ogre::Real dist, bool enchantedGlow, Ogre::Vector3* glowColor) { - std::for_each(objlist.mEntities.begin(), objlist.mEntities.end(), + std::for_each(objlist->mEntities.begin(), objlist->mEntities.end(), VisQueueSet(visflags, solidqueue, transqueue, dist)); - std::for_each(objlist.mParticles.begin(), objlist.mParticles.end(), + std::for_each(objlist->mParticles.begin(), objlist->mParticles.end(), VisQueueSet(visflags, solidqueue, transqueue, dist)); + + if (enchantedGlow) + std::for_each(objlist->mEntities.begin(), objlist->mEntities.end(), + AddGlow(glowColor)); } @@ -292,7 +314,7 @@ void Animation::clearAnimSources() } -void Animation::addExtraLight(Ogre::SceneManager *sceneMgr, NifOgre::ObjectList &objlist, const ESM::Light *light) +void Animation::addExtraLight(Ogre::SceneManager *sceneMgr, NifOgre::ObjectScenePtr objlist, const ESM::Light *light) { const MWWorld::Fallback *fallback = MWBase::Environment::get().getWorld()->getFallback(); @@ -305,8 +327,8 @@ void Animation::addExtraLight(Ogre::SceneManager *sceneMgr, NifOgre::ObjectList if((light->mData.mFlags&ESM::Light::Negative)) color *= -1; - objlist.mLights.push_back(sceneMgr->createLight()); - Ogre::Light *olight = objlist.mLights.back(); + objlist->mLights.push_back(sceneMgr->createLight()); + Ogre::Light *olight = objlist->mLights.back(); olight->setDiffuseColour(color); Ogre::ControllerValueRealPtr src(Ogre::ControllerManager::getSingleton().getFrameTimeSource()); @@ -318,7 +340,7 @@ void Animation::addExtraLight(Ogre::SceneManager *sceneMgr, NifOgre::ObjectList (light->mData.mFlags&ESM::Light::PulseSlow) ? OEngine::Render::LT_PulseSlow : OEngine::Render::LT_Normal )); - objlist.mControllers.push_back(Ogre::Controller(src, dest, func)); + objlist->mControllers.push_back(Ogre::Controller(src, dest, func)); bool interior = !(mPtr.isInCell() && mPtr.getCell()->mCell->isExterior()); bool quadratic = fallback->getFallbackBool("LightAttenuation_OutQuadInLin") ? @@ -344,14 +366,14 @@ void Animation::addExtraLight(Ogre::SceneManager *sceneMgr, NifOgre::ObjectList } // If there's an AttachLight bone, attach the light to that, otherwise put it in the center, - if(objlist.mSkelBase && objlist.mSkelBase->getSkeleton()->hasBone("AttachLight")) - objlist.mSkelBase->attachObjectToBone("AttachLight", olight); + if(objlist->mSkelBase && objlist->mSkelBase->getSkeleton()->hasBone("AttachLight")) + objlist->mSkelBase->attachObjectToBone("AttachLight", olight); else { Ogre::AxisAlignedBox bounds = Ogre::AxisAlignedBox::BOX_NULL; - for(size_t i = 0;i < objlist.mEntities.size();i++) + for(size_t i = 0;i < objlist->mEntities.size();i++) { - Ogre::Entity *ent = objlist.mEntities[i]; + Ogre::Entity *ent = objlist->mEntities[i]; bounds.merge(ent->getBoundingBox()); } @@ -653,6 +675,9 @@ void Animation::handleTextKey(AnimState &state, const std::string &groupname, co MWWorld::Class::get(mPtr).hit(mPtr, MWMechanics::CreatureStats::AT_Thrust); else if(evt.compare(off, len, "hit") == 0) MWWorld::Class::get(mPtr).hit(mPtr); + + else if (groupname == "spellcast" && evt.substr(evt.size()-7, 7) == "release") + MWBase::Environment::get().getWorld()->castSpell(mPtr); } @@ -891,8 +916,8 @@ Ogre::Vector3 Animation::runAnimation(float duration) ++stateiter; } - for(size_t i = 0;i < mObjectRoot.mControllers.size();i++) - mObjectRoot.mControllers[i].update(); + for(size_t i = 0;i < mObjectRoot->mControllers.size();i++) + mObjectRoot->mControllers[i].update(); // Apply group controllers for(size_t grp = 0;grp < sNumGroups;grp++) @@ -913,6 +938,8 @@ Ogre::Vector3 Animation::runAnimation(float duration) mSkelBase->getAllAnimationStates()->_notifyDirty(); } + updateEffects(duration); + return movement; } @@ -933,7 +960,7 @@ public: void Animation::enableLights(bool enable) { - std::for_each(mObjectRoot.mLights.begin(), mObjectRoot.mLights.end(), ToggleLight(enable)); + std::for_each(mObjectRoot->mLights.begin(), mObjectRoot->mLights.end(), ToggleLight(enable)); } @@ -952,7 +979,7 @@ public: Ogre::AxisAlignedBox Animation::getWorldBounds() { Ogre::AxisAlignedBox bounds = Ogre::AxisAlignedBox::BOX_NULL; - std::for_each(mObjectRoot.mEntities.begin(), mObjectRoot.mEntities.end(), MergeBounds(&bounds)); + std::for_each(mObjectRoot->mEntities.begin(), mObjectRoot->mEntities.end(), MergeBounds(&bounds)); return bounds; } @@ -977,6 +1004,144 @@ void Animation::detachObjectFromBone(Ogre::MovableObject *obj) mSkelBase->detachObjectFromBone(obj); } +void Animation::addEffect(const std::string &model, int effectId, bool loop, const std::string &bonename, std::string texture) +{ + // Early out if we already have this effect + for (std::vector::iterator it = mEffects.begin(); it != mEffects.end(); ++it) + if (it->mLoop && loop && it->mEffectId == effectId && it->mBoneName == bonename) + return; + + // fix texture extension to .dds + if (texture.size() > 4) + { + texture[texture.size()-3] = 'd'; + texture[texture.size()-2] = 'd'; + texture[texture.size()-1] = 's'; + } + + EffectParams params; + params.mModelName = model; + if (bonename.empty()) + params.mObjects = NifOgre::Loader::createObjects(mInsert, model); + else + params.mObjects = NifOgre::Loader::createObjects(mSkelBase, bonename, mInsert, model); + params.mLoop = loop; + params.mEffectId = effectId; + params.mBoneName = bonename; + + for(size_t i = 0;i < params.mObjects->mControllers.size();i++) + { + if(params.mObjects->mControllers[i].getSource().isNull()) + params.mObjects->mControllers[i].setSource(Ogre::SharedPtr (new EffectAnimationValue())); + } + + if (!texture.empty()) + { + for(size_t i = 0;i < params.mObjects->mParticles.size(); ++i) + { + Ogre::ParticleSystem* partSys = params.mObjects->mParticles[i]; + sh::Factory::getInstance()._ensureMaterial(partSys->getMaterialName(), "Default"); + Ogre::MaterialPtr mat = Ogre::MaterialManager::getSingleton().getByName(partSys->getMaterialName()); + static int count = 0; + Ogre::String materialName = "openmw/" + Ogre::StringConverter::toString(count++); + // TODO: destroy when effect is removed + Ogre::MaterialPtr newMat = mat->clone(materialName); + partSys->setMaterialName(materialName); + + for (int t=0; tgetNumTechniques(); ++t) + { + Ogre::Technique* tech = newMat->getTechnique(t); + for (int p=0; pgetNumPasses(); ++p) + { + Ogre::Pass* pass = tech->getPass(p); + for (int tex=0; texgetNumTextureUnitStates(); ++tex) + { + Ogre::TextureUnitState* tus = pass->getTextureUnitState(tex); + tus->setTextureName("textures\\" + texture); + } + } + } + } + } + + mEffects.push_back(params); +} + +void Animation::removeEffect(int effectId) +{ + for (std::vector::iterator it = mEffects.begin(); it != mEffects.end(); ++it) + { + if (it->mEffectId == effectId) + { + mEffects.erase(it); + return; + } + } +} + +void Animation::getLoopingEffects(std::vector &out) +{ + for (std::vector::iterator it = mEffects.begin(); it != mEffects.end(); ++it) + { + if (it->mLoop) + out.push_back(it->mEffectId); + } +} + +void Animation::updateEffects(float duration) +{ + for (std::vector::iterator it = mEffects.begin(); it != mEffects.end(); ) + { + NifOgre::ObjectScenePtr objects = it->mObjects; + for(size_t i = 0; i < objects->mControllers.size() ;i++) + { + EffectAnimationValue* value = dynamic_cast(objects->mControllers[i].getSource().get()); + if (value) + value->addTime(duration); + + objects->mControllers[i].update(); + } + + if (objects->mControllers[0].getSource()->getValue() >= objects->mMaxControllerLength) + { + if (it->mLoop) + { + // Start from the beginning again; carry over the remainder + float remainder = objects->mControllers[0].getSource()->getValue() - objects->mMaxControllerLength; + for(size_t i = 0; i < objects->mControllers.size() ;i++) + { + EffectAnimationValue* value = dynamic_cast(objects->mControllers[i].getSource().get()); + if (value) + value->resetTime(remainder); + } + } + else + { + it = mEffects.erase(it); + continue; + } + } + ++it; + } +} + +// TODO: Should not be here +Ogre::Vector3 Animation::getEnchantmentColor(MWWorld::Ptr item) +{ + Ogre::Vector3 result(1,1,1); + std::string enchantmentName = item.getClass().getEnchantment(item); + if (enchantmentName.empty()) + return result; + const ESM::Enchantment* enchantment = MWBase::Environment::get().getWorld()->getStore().get().find(enchantmentName); + assert (enchantment->mEffects.mList.size()); + const ESM::MagicEffect* magicEffect = MWBase::Environment::get().getWorld()->getStore().get().find( + enchantment->mEffects.mList.front().mEffectID); + result.x = magicEffect->mData.mRed / 255.f; + result.y = magicEffect->mData.mGreen / 255.f; + result.z = magicEffect->mData.mBlue / 255.f; + return result; +} + ObjectAnimation::ObjectAnimation(const MWWorld::Ptr& ptr, const std::string &model) : Animation(ptr, ptr.getRefData().getBaseNode()) @@ -993,9 +1158,10 @@ ObjectAnimation::ObjectAnimation(const MWWorld::Ptr& ptr, const std::string &mod small = false; float dist = small ? Settings::Manager::getInt("small object distance", "Viewing distance") : 0.0f; + Ogre::Vector3 col = getEnchantmentColor(ptr); setRenderProperties(mObjectRoot, (mPtr.getTypeName() == typeid(ESM::Static).name()) ? (small ? RV_StaticsSmall : RV_Statics) : RV_Misc, - RQG_Main, RQG_Alpha, dist); + RQG_Main, RQG_Alpha, dist, !ptr.getClass().getEnchantment(ptr).empty(), &col); } void ObjectAnimation::addLight(const ESM::Light *light) @@ -1020,16 +1186,16 @@ public: bool ObjectAnimation::canBatch() const { - if(!mObjectRoot.mParticles.empty() || !mObjectRoot.mLights.empty() || !mObjectRoot.mControllers.empty()) + if(!mObjectRoot->mParticles.empty() || !mObjectRoot->mLights.empty() || !mObjectRoot->mControllers.empty()) return false; - return std::find_if(mObjectRoot.mEntities.begin(), mObjectRoot.mEntities.end(), - FindEntityTransparency()) == mObjectRoot.mEntities.end(); + return std::find_if(mObjectRoot->mEntities.begin(), mObjectRoot->mEntities.end(), + FindEntityTransparency()) == mObjectRoot->mEntities.end(); } void ObjectAnimation::fillBatch(Ogre::StaticGeometry *sg) { - std::vector::reverse_iterator iter = mObjectRoot.mEntities.rbegin(); - for(;iter != mObjectRoot.mEntities.rend();++iter) + std::vector::reverse_iterator iter = mObjectRoot->mEntities.rbegin(); + for(;iter != mObjectRoot->mEntities.rend();++iter) { Ogre::Node *node = (*iter)->getParentNode(); sg->addEntity(*iter, node->_getDerivedPosition(), node->_getDerivedOrientation(), node->_getDerivedScale()); diff --git a/apps/openmw/mwrender/animation.hpp b/apps/openmw/mwrender/animation.hpp index 2215fc582..aa04e39e2 100644 --- a/apps/openmw/mwrender/animation.hpp +++ b/apps/openmw/mwrender/animation.hpp @@ -52,6 +52,20 @@ protected: virtual void setValue(Ogre::Real value); }; + class EffectAnimationValue : public Ogre::ControllerValue + { + private: + float mTime; + public: + EffectAnimationValue() : mTime(0) { } + void addTime(float time) { mTime += time; } + void resetTime(float value) { mTime = value; } + + virtual Ogre::Real getValue() const; + virtual void setValue(Ogre::Real value); + }; + + class NullAnimationValue : public Ogre::ControllerValue { @@ -95,12 +109,23 @@ protected: typedef std::map ObjectAttachMap; + struct EffectParams + { + std::string mModelName; // Just here so we don't add the same effect twice + NifOgre::ObjectScenePtr mObjects; + int mEffectId; + bool mLoop; + std::string mBoneName; + }; + + std::vector mEffects; + MWWorld::Ptr mPtr; Camera *mCamera; Ogre::SceneNode *mInsert; Ogre::Entity *mSkelBase; - NifOgre::ObjectList mObjectRoot; + NifOgre::ObjectScenePtr mObjectRoot; AnimSourceList mAnimSources; Ogre::Node *mAccumRoot; Ogre::Node *mNonAccumRoot; @@ -114,6 +139,7 @@ protected: ObjectAttachMap mAttachedObjects; + /* Sets the appropriate animations on the bone groups based on priority. */ void resetActiveGroups(); @@ -161,18 +187,41 @@ protected: void addAnimSource(const std::string &model); /** Adds an additional light to the given object list using the specified ESM record. */ - void addExtraLight(Ogre::SceneManager *sceneMgr, NifOgre::ObjectList &objlist, const ESM::Light *light); + void addExtraLight(Ogre::SceneManager *sceneMgr, NifOgre::ObjectScenePtr objlist, const ESM::Light *light); - static void destroyObjectList(Ogre::SceneManager *sceneMgr, NifOgre::ObjectList &objects); - - static void setRenderProperties(const NifOgre::ObjectList &objlist, Ogre::uint32 visflags, Ogre::uint8 solidqueue, Ogre::uint8 transqueue, Ogre::Real dist=0.0f); + static void setRenderProperties(NifOgre::ObjectScenePtr objlist, Ogre::uint32 visflags, Ogre::uint8 solidqueue, + Ogre::uint8 transqueue, Ogre::Real dist=0.0f, + bool enchantedGlow=false, Ogre::Vector3* glowColor=NULL); void clearAnimSources(); + // TODO: Should not be here + Ogre::Vector3 getEnchantmentColor(MWWorld::Ptr item); + public: Animation(const MWWorld::Ptr &ptr, Ogre::SceneNode *node); virtual ~Animation(); + /** + * @brief Add an effect mesh attached to a bone or the insert scene node + * @param model + * @param effectId An ID for this effect. Note that adding the same ID again won't add another effect. + * @param loop Loop the effect. If false, it is removed automatically after it finishes playing. If true, + * you need to remove it manually using removeEffect when the effect should end. + * @param bonename Bone to attach to, or empty string to use the scene node instead + * @param texture override the texture specified in the model's materials + * @note Will not add an effect twice. + */ + void addEffect (const std::string& model, int effectId, bool loop = false, const std::string& bonename = "", std::string texture = ""); + void removeEffect (int effectId); + void getLoopingEffects (std::vector& out); + + virtual void setAlpha(float alpha) {} +private: + void updateEffects(float duration); + + +public: void updatePtr(const MWWorld::Ptr &ptr); bool hasAnimation(const std::string &anim); @@ -225,6 +274,7 @@ public: virtual Ogre::Vector3 runAnimation(float duration); virtual void showWeapons(bool showWeapon); + virtual void showShield(bool show) {} void enableLights(bool enable); diff --git a/apps/openmw/mwrender/characterpreview.cpp b/apps/openmw/mwrender/characterpreview.cpp index e42218bc2..5e659ca1d 100644 --- a/apps/openmw/mwrender/characterpreview.cpp +++ b/apps/openmw/mwrender/characterpreview.cpp @@ -35,7 +35,7 @@ namespace MWRender , mCamera(NULL) , mNode(NULL) { - + mCharacter.mCell = NULL; } void CharacterPreview::onSetup() @@ -70,8 +70,8 @@ namespace MWRender mNode = renderRoot->createChildSceneNode(); - mAnimation = new NpcAnimation(mCharacter, mNode, MWWorld::Class::get(mCharacter).getInventoryStore(mCharacter), - 0, (renderHeadOnly() ? NpcAnimation::VM_HeadOnly : NpcAnimation::VM_Normal)); + mAnimation = new NpcAnimation(mCharacter, mNode, + 0, true, (renderHeadOnly() ? NpcAnimation::VM_HeadOnly : NpcAnimation::VM_Normal)); Ogre::Vector3 scale = mNode->getScale(); mCamera->setPosition(mPosition * scale); @@ -101,7 +101,6 @@ namespace MWRender { if (mSceneMgr) { - //Ogre::TextureManager::getSingleton().remove(mName); mSceneMgr->destroyAllCameras(); delete mAnimation; Ogre::Root::getSingleton().destroySceneManager(mSceneMgr); @@ -112,10 +111,8 @@ namespace MWRender { assert(mAnimation); delete mAnimation; - mAnimation = 0; - - mAnimation = new NpcAnimation(mCharacter, mNode, MWWorld::Class::get(mCharacter).getInventoryStore(mCharacter), - 0, (renderHeadOnly() ? NpcAnimation::VM_HeadOnly : NpcAnimation::VM_Normal)); + mAnimation = new NpcAnimation(mCharacter, mNode, + 0, true, (renderHeadOnly() ? NpcAnimation::VM_HeadOnly : NpcAnimation::VM_Normal)); float scale=1.f; MWWorld::Class::get(mCharacter).adjustScale(mCharacter, scale); @@ -143,6 +140,9 @@ namespace MWRender void InventoryPreview::update(int sizeX, int sizeY) { + // TODO: can we avoid this. Vampire state needs to be updated. + mAnimation->rebuild(); + MWWorld::InventoryStore &inv = MWWorld::Class::get(mCharacter).getInventoryStore(mCharacter); MWWorld::ContainerStoreIterator iter = inv.getSlot(MWWorld::InventoryStore::Slot_CarriedRight); std::string groupname; @@ -177,11 +177,12 @@ namespace MWRender groupname = "inventoryhandtohand"; } - if(groupname != mCurrentAnimGroup) - { + // TODO see above + //if(groupname != mCurrentAnimGroup) + //{ mCurrentAnimGroup = groupname; mAnimation->play(mCurrentAnimGroup, 1, Animation::Group_All, false, 1.0f, "start", "stop", 0.0f, 0); - } + //} MWWorld::ContainerStoreIterator torch = inv.getSlot(MWWorld::InventoryStore::Slot_CarriedLeft); if(torch != inv.end() && torch->getTypeName() == typeid(ESM::Light).name()) @@ -193,7 +194,7 @@ namespace MWRender else if(mAnimation->getInfo("torch")) mAnimation->disable("torch"); - mAnimation->updateParts(true); + mAnimation->updateParts(); mAnimation->runAnimation(0.0f); mViewport->setDimensions (0, 0, std::min(1.f, float(sizeX) / float(512)), std::min(1.f, float(sizeY) / float(1024))); @@ -229,7 +230,7 @@ namespace MWRender , mRef(&mBase) { mBase = *mCharacter.get()->mBase; - mCharacter = MWWorld::Ptr(&mRef, mCharacter.getCell()); + mCharacter = MWWorld::Ptr(&mRef, NULL); } void RaceSelectionPreview::update(float angle) diff --git a/apps/openmw/mwrender/compositors.cpp b/apps/openmw/mwrender/compositors.cpp deleted file mode 100644 index b1c98a306..000000000 --- a/apps/openmw/mwrender/compositors.cpp +++ /dev/null @@ -1,108 +0,0 @@ -#include "compositors.hpp" - -#include -#include -#include -#include - -using namespace MWRender; - -Compositors::Compositors(Ogre::Viewport* vp) : - mViewport(vp) - , mEnabled(true) -{ -} - -Compositors::~Compositors() -{ - Ogre::CompositorManager::getSingleton().removeCompositorChain(mViewport); -} - -void Compositors::setEnabled (const bool enabled) -{ - for (CompositorMap::iterator it=mCompositors.begin(); - it != mCompositors.end(); ++it) - { - Ogre::CompositorManager::getSingleton().setCompositorEnabled(mViewport, it->first, enabled && it->second.first); - } - mEnabled = enabled; -} - -void Compositors::recreate() -{ - Ogre::CompositorManager::getSingleton().removeCompositorChain(mViewport); - - CompositorMap temp = mCompositors; - mCompositors.clear(); - - for (CompositorMap::iterator it=temp.begin(); - it != temp.end(); ++it) - { - addCompositor(it->first, it->second.second); - setCompositorEnabled(it->first, mEnabled && it->second.first); - } -} - -void Compositors::addCompositor (const std::string& name, const int priority) -{ - int id = 0; - - for (CompositorMap::iterator it=mCompositors.begin(); - it != mCompositors.end(); ++it) - { - if (it->second.second > priority) - break; - ++id; - } - Ogre::CompositorManager::getSingleton().addCompositor (mViewport, name, id); - - mCompositors[name] = std::make_pair(false, priority); -} - -void Compositors::setCompositorEnabled (const std::string& name, const bool enabled) -{ - mCompositors[name].first = enabled; - Ogre::CompositorManager::getSingleton().setCompositorEnabled (mViewport, name, enabled && mEnabled); -} - -void Compositors::removeAll() -{ - Ogre::CompositorManager::getSingleton().removeCompositorChain(mViewport); - - mCompositors.clear(); -} - -bool Compositors::anyCompositorEnabled() -{ - for (CompositorMap::iterator it=mCompositors.begin(); - it != mCompositors.end(); ++it) - { - if (it->second.first && mEnabled) - return true; - } - return false; -} - -void Compositors::countTrianglesBatches(unsigned int &triangles, unsigned int &batches) -{ - triangles = 0; - batches = 0; - - Ogre::CompositorInstance* c = NULL; - Ogre::CompositorChain* chain = Ogre::CompositorManager::getSingleton().getCompositorChain (mViewport); - // accumulate tris & batches from all compositors with all their render targets - for (unsigned int i=0; i < chain->getNumCompositors(); ++i) - { - if (chain->getCompositor(i)->getEnabled()) - { - c = chain->getCompositor(i); - for (unsigned int j = 0; j < c->getTechnique()->getNumTargetPasses(); ++j) - { - std::string textureName = c->getTechnique()->getTargetPass(j)->getOutputName(); - Ogre::RenderTarget* rt = c->getRenderTarget(textureName); - triangles += rt->getTriangleCount(); - batches += rt->getBatchCount(); - } - } - } -} diff --git a/apps/openmw/mwrender/compositors.hpp b/apps/openmw/mwrender/compositors.hpp deleted file mode 100644 index e5dd7503c..000000000 --- a/apps/openmw/mwrender/compositors.hpp +++ /dev/null @@ -1,64 +0,0 @@ -#ifndef GAME_MWRENDER_COMPOSITORS_H -#define GAME_MWRENDER_COMPOSITORS_H - -#include -#include - -namespace Ogre -{ - class Viewport; -} - -namespace MWRender -{ - typedef std::map < std::string, std::pair > CompositorMap; - - /// \brief Manages a set of compositors for one viewport - class Compositors - { - public: - Compositors(Ogre::Viewport* vp); - virtual ~Compositors(); - - /** - * enable or disable all compositors globally - */ - void setEnabled (const bool enabled); - - void setViewport(Ogre::Viewport* vp) { mViewport = vp; } - - /// recreate compositors (call this after viewport size changes) - void recreate(); - - bool toggle() { setEnabled(!mEnabled); return mEnabled; } - - /** - * enable or disable a specific compositor - * @note enable has no effect if all compositors are globally disabled - */ - void setCompositorEnabled (const std::string& name, const bool enabled); - - /** - * @param name of compositor - * @param priority, lower number will be first in the chain - */ - void addCompositor (const std::string& name, const int priority); - - bool anyCompositorEnabled(); - - void countTrianglesBatches(unsigned int &triangles, unsigned int &batches); - - void removeAll (); - - protected: - /// maps compositor name to its "enabled" state - CompositorMap mCompositors; - - bool mEnabled; - - Ogre::Viewport* mViewport; - }; - -} - -#endif diff --git a/apps/openmw/mwrender/npcanimation.cpp b/apps/openmw/mwrender/npcanimation.cpp index 9ffe53eab..eb0c5dfbc 100644 --- a/apps/openmw/mwrender/npcanimation.cpp +++ b/apps/openmw/mwrender/npcanimation.cpp @@ -5,6 +5,8 @@ #include #include +#include + #include "../mwworld/esmstore.hpp" #include "../mwworld/inventorystore.hpp" #include "../mwworld/class.hpp" @@ -14,14 +16,60 @@ #include "../mwbase/environment.hpp" #include "../mwbase/world.hpp" #include "../mwbase/mechanicsmanager.hpp" +#include "../mwbase/soundmanager.hpp" #include "renderconst.hpp" #include "camera.hpp" +namespace +{ + +std::string getVampireHead(const std::string& race, bool female) +{ + static std::map , const ESM::BodyPart* > sVampireMapping; + + std::pair thisCombination = std::make_pair(race, int(female)); + + if (sVampireMapping.find(thisCombination) == sVampireMapping.end()) + { + const MWWorld::ESMStore &store = MWBase::Environment::get().getWorld()->getStore(); + const MWWorld::Store &partStore = store.get(); + for(MWWorld::Store::iterator it = partStore.begin(); it != partStore.end(); ++it) + { + const ESM::BodyPart& bodypart = *it; + if (!bodypart.mData.mVampire) + continue; + if (bodypart.mData.mType != ESM::BodyPart::MT_Skin) + continue; + if (bodypart.mData.mPart != ESM::BodyPart::MP_Head) + continue; + if (female != (bodypart.mData.mFlags & ESM::BodyPart::BPF_Female)) + continue; + if (!Misc::StringUtils::ciEqual(bodypart.mRace, race)) + continue; + sVampireMapping[thisCombination] = &*it; + } + } + + assert(sVampireMapping[thisCombination]); + return "meshes\\" + sVampireMapping[thisCombination]->mModel; +} + +} + namespace MWRender { +float SayAnimationValue::getValue() const +{ + if (MWBase::Environment::get().getSoundManager()->sayDone(mReference)) + return 0; + else + // TODO: Use the loudness of the currently playing sound + return 1; +} + static NpcAnimation::PartBoneMap createPartListMap() { NpcAnimation::PartBoneMap result; @@ -58,43 +106,34 @@ const NpcAnimation::PartBoneMap NpcAnimation::sPartList = createPartListMap(); NpcAnimation::~NpcAnimation() { - Ogre::SceneManager *sceneMgr = mInsert->getCreator(); - for(size_t i = 0;i < ESM::PRT_Count;i++) - destroyObjectList(sceneMgr, mObjectParts[i]); + if (!mListenerDisabled) + mPtr.getClass().getInventoryStore(mPtr).setListener(NULL, mPtr); } -NpcAnimation::NpcAnimation(const MWWorld::Ptr& ptr, Ogre::SceneNode* node, MWWorld::InventoryStore& inv, int visibilityFlags, ViewMode viewMode) +NpcAnimation::NpcAnimation(const MWWorld::Ptr& ptr, Ogre::SceneNode* node, int visibilityFlags, bool disableListener, ViewMode viewMode) : Animation(ptr, node), - mStateID(-1), - mTimeToChange(0), mVisibilityFlags(visibilityFlags), - mRobe(inv.end()), - mHelmet(inv.end()), - mShirt(inv.end()), - mCuirass(inv.end()), - mGreaves(inv.end()), - mPauldronL(inv.end()), - mPauldronR(inv.end()), - mBoots(inv.end()), - mPants(inv.end()), - mGloveL(inv.end()), - mGloveR(inv.end()), - mSkirtIter(inv.end()), - mWeapon(inv.end()), - mShield(inv.end()), + mListenerDisabled(disableListener), mViewMode(viewMode), mShowWeapons(false), - mFirstPersonOffset(0.f, 0.f, 0.f) + mShowShield(true), + mFirstPersonOffset(0.f, 0.f, 0.f), + mAlpha(1.f) { mNpc = mPtr.get()->mBase; + mSayAnimationValue = Ogre::SharedPtr(new SayAnimationValue(mPtr)); + for(size_t i = 0;i < ESM::PRT_Count;i++) { mPartslots[i] = -1; //each slot is empty mPartPriorities[i] = 0; } + if (!disableListener) + mPtr.getClass().getInventoryStore(mPtr).setListener(this, mPtr); + updateNpcBase(); } @@ -118,18 +157,23 @@ void NpcAnimation::updateNpcBase() const MWWorld::ESMStore &store = MWBase::Environment::get().getWorld()->getStore(); const ESM::Race *race = store.get().find(mNpc->mRace); - bool isWerewolf = MWWorld::Class::get(mPtr).getNpcStats(mPtr).isWerewolf(); + bool isWerewolf = mPtr.getClass().getNpcStats(mPtr).isWerewolf(); + bool vampire = mPtr.getClass().getCreatureStats(mPtr).getMagicEffects().get(ESM::MagicEffect::Vampirism).mMagnitude; - if(!isWerewolf) - { - mHeadModel = "meshes\\" + store.get().find(mNpc->mHead)->mModel; - mHairModel = "meshes\\" + store.get().find(mNpc->mHair)->mModel; - } - else + if (isWerewolf) { mHeadModel = "meshes\\" + store.get().find("WerewolfHead")->mModel; mHairModel = "meshes\\" + store.get().find("WerewolfHair")->mModel; } + else + { + if (vampire) + mHeadModel = getVampireHead(mNpc->mRace, mNpc->mFlags & ESM::NPC::Female); + else + mHeadModel = "meshes\\" + store.get().find(mNpc->mHead)->mModel; + + mHairModel = "meshes\\" + store.get().find(mNpc->mHair)->mModel; + } bool isBeast = (race->mData.mFlags & ESM::Race::Beast) != 0; std::string smodel = (mViewMode != VM_FirstPerson) ? @@ -173,73 +217,63 @@ void NpcAnimation::updateNpcBase() for(size_t i = 0;i < ESM::PRT_Count;i++) removeIndividualPart((ESM::PartReferenceType)i); - updateParts(true); + updateParts(); } -void NpcAnimation::updateParts(bool forceupdate) +void NpcAnimation::updateParts() { + mAlpha = 1.f; + const MWWorld::Class &cls = MWWorld::Class::get(mPtr); + MWWorld::InventoryStore &inv = cls.getInventoryStore(mPtr); + static const struct { - MWWorld::ContainerStoreIterator NpcAnimation::*mPart; int mSlot; int mBasePriority; } slotlist[] = { // FIXME: Priority is based on the number of reserved slots. There should be a better way. - { &NpcAnimation::mRobe, MWWorld::InventoryStore::Slot_Robe, 12 }, - { &NpcAnimation::mSkirtIter, MWWorld::InventoryStore::Slot_Skirt, 3 }, - { &NpcAnimation::mHelmet, MWWorld::InventoryStore::Slot_Helmet, 0 }, - { &NpcAnimation::mCuirass, MWWorld::InventoryStore::Slot_Cuirass, 0 }, - { &NpcAnimation::mGreaves, MWWorld::InventoryStore::Slot_Greaves, 0 }, - { &NpcAnimation::mPauldronL, MWWorld::InventoryStore::Slot_LeftPauldron, 0 }, - { &NpcAnimation::mPauldronR, MWWorld::InventoryStore::Slot_RightPauldron, 0 }, - { &NpcAnimation::mBoots, MWWorld::InventoryStore::Slot_Boots, 0 }, - { &NpcAnimation::mGloveL, MWWorld::InventoryStore::Slot_LeftGauntlet, 0 }, - { &NpcAnimation::mGloveR, MWWorld::InventoryStore::Slot_RightGauntlet, 0 }, - { &NpcAnimation::mShirt, MWWorld::InventoryStore::Slot_Shirt, 0 }, - { &NpcAnimation::mPants, MWWorld::InventoryStore::Slot_Pants, 0 }, - { &NpcAnimation::mShield, MWWorld::InventoryStore::Slot_CarriedLeft, 0 }, - { &NpcAnimation::mWeapon, MWWorld::InventoryStore::Slot_CarriedRight, 0 } + { MWWorld::InventoryStore::Slot_Robe, 12 }, + { MWWorld::InventoryStore::Slot_Skirt, 3 }, + { MWWorld::InventoryStore::Slot_Helmet, 0 }, + { MWWorld::InventoryStore::Slot_Cuirass, 0 }, + { MWWorld::InventoryStore::Slot_Greaves, 0 }, + { MWWorld::InventoryStore::Slot_LeftPauldron, 0 }, + { MWWorld::InventoryStore::Slot_RightPauldron, 0 }, + { MWWorld::InventoryStore::Slot_Boots, 0 }, + { MWWorld::InventoryStore::Slot_LeftGauntlet, 0 }, + { MWWorld::InventoryStore::Slot_RightGauntlet, 0 }, + { MWWorld::InventoryStore::Slot_Shirt, 0 }, + { MWWorld::InventoryStore::Slot_Pants, 0 }, + { MWWorld::InventoryStore::Slot_CarriedLeft, 0 }, + { MWWorld::InventoryStore::Slot_CarriedRight, 0 } }; static const size_t slotlistsize = sizeof(slotlist)/sizeof(slotlist[0]); - const MWWorld::Class &cls = MWWorld::Class::get(mPtr); - MWWorld::InventoryStore &inv = cls.getInventoryStore(mPtr); - for(size_t i = 0;!forceupdate && i < slotlistsize;i++) - { - MWWorld::ContainerStoreIterator iter = inv.getSlot(slotlist[i].mSlot); - if(this->*slotlist[i].mPart != iter) - { - forceupdate = true; - break; - } - } - if(!forceupdate) - return; - for(size_t i = 0;i < slotlistsize && mViewMode != VM_HeadOnly;i++) { MWWorld::ContainerStoreIterator store = inv.getSlot(slotlist[i].mSlot); - this->*slotlist[i].mPart = store; removePartGroup(slotlist[i].mSlot); - if(this->*slotlist[i].mPart == inv.end()) + if(store == inv.end()) continue; if(slotlist[i].mSlot == MWWorld::InventoryStore::Slot_Helmet) removeIndividualPart(ESM::PRT_Hair); int prio = 1; + bool enchantedGlow = !store->getClass().getEnchantment(*store).empty(); + Ogre::Vector3 glowColor = getEnchantmentColor(*store); if(store->getTypeName() == typeid(ESM::Clothing).name()) { prio = ((slotlist[i].mBasePriority+1)<<1) + 0; const ESM::Clothing *clothes = store->get()->mBase; - addPartGroup(slotlist[i].mSlot, prio, clothes->mParts.mParts); + addPartGroup(slotlist[i].mSlot, prio, clothes->mParts.mParts, enchantedGlow, &glowColor); } else if(store->getTypeName() == typeid(ESM::Armor).name()) { prio = ((slotlist[i].mBasePriority+1)<<1) + 1; const ESM::Armor *armor = store->get()->mBase; - addPartGroup(slotlist[i].mSlot, prio, armor->mParts.mParts); + addPartGroup(slotlist[i].mSlot, prio, armor->mParts.mParts, enchantedGlow, &glowColor); } if(slotlist[i].mSlot == MWWorld::InventoryStore::Slot_Robe) @@ -285,10 +319,13 @@ void NpcAnimation::updateParts(bool forceupdate) } showWeapons(mShowWeapons); + showShield(mShowShield); // Remember body parts so we only have to search through the store once for each race/gender/viewmode combination static std::map< std::pair,std::vector > sRaceMapping; + static std::map , std::vector > sVampireMapping; + static const int Flag_Female = 1<<0; static const int Flag_FirstPerson = 1<<1; @@ -410,17 +447,18 @@ public: } }; -NifOgre::ObjectList NpcAnimation::insertBoundedPart(const std::string &model, int group, const std::string &bonename) +NifOgre::ObjectScenePtr NpcAnimation::insertBoundedPart(const std::string &model, int group, const std::string &bonename, bool enchantedGlow, Ogre::Vector3* glowColor) { - NifOgre::ObjectList objects = NifOgre::Loader::createObjects(mSkelBase, bonename, mInsert, model); - setRenderProperties(objects, (mViewMode == VM_FirstPerson) ? RV_FirstPerson : mVisibilityFlags, RQG_Main, RQG_Alpha); + NifOgre::ObjectScenePtr objects = NifOgre::Loader::createObjects(mSkelBase, bonename, mInsert, model); + setRenderProperties(objects, (mViewMode == VM_FirstPerson) ? RV_FirstPerson : mVisibilityFlags, RQG_Main, RQG_Alpha, 0, + enchantedGlow, glowColor); - std::for_each(objects.mEntities.begin(), objects.mEntities.end(), SetObjectGroup(group)); - std::for_each(objects.mParticles.begin(), objects.mParticles.end(), SetObjectGroup(group)); + std::for_each(objects->mEntities.begin(), objects->mEntities.end(), SetObjectGroup(group)); + std::for_each(objects->mParticles.begin(), objects->mParticles.end(), SetObjectGroup(group)); - if(objects.mSkelBase) + if(objects->mSkelBase) { - Ogre::AnimationStateSet *aset = objects.mSkelBase->getAllAnimationStates(); + Ogre::AnimationStateSet *aset = objects->mSkelBase->getAllAnimationStates(); Ogre::AnimationStateIterator asiter = aset->getAnimationStateIterator(); while(asiter.hasMoreElements()) { @@ -428,7 +466,7 @@ NifOgre::ObjectList NpcAnimation::insertBoundedPart(const std::string &model, in state->setEnabled(false); state->setLoop(false); } - Ogre::SkeletonInstance *skelinst = objects.mSkelBase->getSkeleton(); + Ogre::SkeletonInstance *skelinst = objects->mSkelBase->getSkeleton(); Ogre::Skeleton::BoneIterator boneiter = skelinst->getBoneIterator(); while(boneiter.hasMoreElements()) boneiter.getNext()->setManuallyControlled(true); @@ -439,13 +477,6 @@ NifOgre::ObjectList NpcAnimation::insertBoundedPart(const std::string &model, in Ogre::Vector3 NpcAnimation::runAnimation(float timepassed) { - if(mTimeToChange <= 0.0f) - { - mTimeToChange = 0.2f; - updateParts(); - } - mTimeToChange -= timepassed; - Ogre::Vector3 ret = Animation::runAnimation(timepassed); Ogre::SkeletonInstance *baseinst = mSkelBase->getSkeleton(); @@ -463,11 +494,13 @@ Ogre::Vector3 NpcAnimation::runAnimation(float timepassed) for(size_t i = 0;i < ESM::PRT_Count;i++) { - std::vector >::iterator ctrl(mObjectParts[i].mControllers.begin()); - for(;ctrl != mObjectParts[i].mControllers.end();ctrl++) + if (mObjectParts[i].isNull()) + continue; + std::vector >::iterator ctrl(mObjectParts[i]->mControllers.begin()); + for(;ctrl != mObjectParts[i]->mControllers.end();ctrl++) ctrl->update(); - Ogre::Entity *ent = mObjectParts[i].mSkelBase; + Ogre::Entity *ent = mObjectParts[i]->mSkelBase; if(!ent) continue; updateSkeletonInstance(baseinst, ent->getSkeleton()); ent->getAllAnimationStates()->_notifyDirty(); @@ -481,7 +514,7 @@ void NpcAnimation::removeIndividualPart(ESM::PartReferenceType type) mPartPriorities[type] = 0; mPartslots[type] = -1; - destroyObjectList(mInsert->getCreator(), mObjectParts[type]); + mObjectParts[type].setNull(); } void NpcAnimation::reserveIndividualPart(ESM::PartReferenceType type, int group, int priority) @@ -503,7 +536,7 @@ void NpcAnimation::removePartGroup(int group) } } -bool NpcAnimation::addOrReplaceIndividualPart(ESM::PartReferenceType type, int group, int priority, const std::string &mesh) +bool NpcAnimation::addOrReplaceIndividualPart(ESM::PartReferenceType type, int group, int priority, const std::string &mesh, bool enchantedGlow, Ogre::Vector3* glowColor) { if(priority <= mPartPriorities[type]) return false; @@ -512,20 +545,23 @@ bool NpcAnimation::addOrReplaceIndividualPart(ESM::PartReferenceType type, int g mPartslots[type] = group; mPartPriorities[type] = priority; - mObjectParts[type] = insertBoundedPart(mesh, group, sPartList.at(type)); - if(mObjectParts[type].mSkelBase) + mObjectParts[type] = insertBoundedPart(mesh, group, sPartList.at(type), enchantedGlow, glowColor); + if(mObjectParts[type]->mSkelBase) { - Ogre::SkeletonInstance *skel = mObjectParts[type].mSkelBase->getSkeleton(); - if(mObjectParts[type].mSkelBase->isParentTagPoint()) + Ogre::SkeletonInstance *skel = mObjectParts[type]->mSkelBase->getSkeleton(); + if(mObjectParts[type]->mSkelBase->isParentTagPoint()) { - Ogre::Node *root = mObjectParts[type].mSkelBase->getParentNode(); + Ogre::Node *root = mObjectParts[type]->mSkelBase->getParentNode(); if(skel->hasBone("BoneOffset")) { Ogre::Bone *offset = skel->getBone("BoneOffset"); + root->translate(offset->getPosition()); - root->rotate(offset->getOrientation()); - // HACK: Why an extra -90 degree rotation? + + // It appears that the BoneOffset rotation is completely bogus, at least for light models. + //root->rotate(offset->getOrientation()); root->pitch(Ogre::Degree(-90.0f)); + root->scale(offset->getScale()); root->setInitialState(); } @@ -535,21 +571,24 @@ bool NpcAnimation::addOrReplaceIndividualPart(ESM::PartReferenceType type, int g } // TODO: - // type == ESM::PRT_Head should get an animation source based on the current output of - // the actor's 'say' sound (0 = silent, 1 = loud?). // type == ESM::PRT_Weapon should get an animation source based on the current offset // of the weapon attack animation (from its beginning, or start marker?) - std::vector >::iterator ctrl(mObjectParts[type].mControllers.begin()); - for(;ctrl != mObjectParts[type].mControllers.end();ctrl++) + std::vector >::iterator ctrl(mObjectParts[type]->mControllers.begin()); + for(;ctrl != mObjectParts[type]->mControllers.end();ctrl++) { if(ctrl->getSource().isNull()) + { ctrl->setSource(mNullAnimationValuePtr); + + if (type == ESM::PRT_Head) + ctrl->setSource(mSayAnimationValue); + } } return true; } -void NpcAnimation::addPartGroup(int group, int priority, const std::vector &parts) +void NpcAnimation::addPartGroup(int group, int priority, const std::vector &parts, bool enchantedGlow, Ogre::Vector3* glowColor) { const MWWorld::ESMStore &store = MWBase::Environment::get().getWorld()->getStore(); const MWWorld::Store &partStore = store.get(); @@ -587,7 +626,7 @@ void NpcAnimation::addPartGroup(int group, int priority, const std::vectormPart, group, priority, "meshes\\"+bodypart->mModel); + addOrReplaceIndividualPart((ESM::PartReferenceType)part->mPart, group, priority, "meshes\\"+bodypart->mModel, enchantedGlow, glowColor); else reserveIndividualPart((ESM::PartReferenceType)part->mPart, group, priority); } @@ -599,18 +638,128 @@ void NpcAnimation::showWeapons(bool showWeapon) if(showWeapon) { MWWorld::InventoryStore &inv = MWWorld::Class::get(mPtr).getInventoryStore(mPtr); - mWeapon = inv.getSlot(MWWorld::InventoryStore::Slot_CarriedRight); - if(mWeapon != inv.end()) // special case for weapons + MWWorld::ContainerStoreIterator weapon = inv.getSlot(MWWorld::InventoryStore::Slot_CarriedRight); + if(weapon != inv.end()) // special case for weapons { - MWWorld::Ptr weapon = *mWeapon; - std::string mesh = MWWorld::Class::get(weapon).getModel(weapon); - addOrReplaceIndividualPart(ESM::PRT_Weapon, MWWorld::InventoryStore::Slot_CarriedRight, 1, mesh); + Ogre::Vector3 glowColor = getEnchantmentColor(*weapon); + std::string mesh = MWWorld::Class::get(*weapon).getModel(*weapon); + addOrReplaceIndividualPart(ESM::PRT_Weapon, MWWorld::InventoryStore::Slot_CarriedRight, 1, + mesh, !weapon->getClass().getEnchantment(*weapon).empty(), &glowColor); } } else { removeIndividualPart(ESM::PRT_Weapon); } + mAlpha = 1.f; +} + +void NpcAnimation::showShield(bool show) +{ + mShowShield = show; + MWWorld::InventoryStore &inv = MWWorld::Class::get(mPtr).getInventoryStore(mPtr); + MWWorld::ContainerStoreIterator shield = inv.getSlot(MWWorld::InventoryStore::Slot_CarriedLeft); + + if (shield != inv.end() && shield->getTypeName() == typeid(ESM::Light).name()) + { + // ... Except for lights, which are still shown during spellcasting since they + // have their own (one-handed) casting animations + show = true; + } + if(show && shield != inv.end()) + { + Ogre::Vector3 glowColor = getEnchantmentColor(*shield); + std::string mesh = MWWorld::Class::get(*shield).getModel(*shield); + addOrReplaceIndividualPart(ESM::PRT_Shield, MWWorld::InventoryStore::Slot_CarriedLeft, 1, + mesh, !shield->getClass().getEnchantment(*shield).empty(), &glowColor); + + if (shield->getTypeName() == typeid(ESM::Light).name()) + addExtraLight(mInsert->getCreator(), mObjectParts[ESM::PRT_Shield], shield->get()->mBase); + } + else + { + removeIndividualPart(ESM::PRT_Shield); + } +} + +void NpcAnimation::permanentEffectAdded(const ESM::MagicEffect *magicEffect, bool isNew, bool playSound) +{ + // During first auto equip, we don't play any sounds. + // Basically we don't want sounds when the actor is first loaded, + // the items should appear as if they'd always been equipped. + if (playSound) + { + static const std::string schools[] = { + "alteration", "conjuration", "destruction", "illusion", "mysticism", "restoration" + }; + + MWBase::SoundManager *sndMgr = MWBase::Environment::get().getSoundManager(); + if(!magicEffect->mHitSound.empty()) + sndMgr->playSound3D(mPtr, magicEffect->mHitSound, 1.0f, 1.0f); + else + sndMgr->playSound3D(mPtr, schools[magicEffect->mData.mSchool]+" hit", 1.0f, 1.0f); + } + + if (!magicEffect->mHit.empty()) + { + const ESM::Static* castStatic = MWBase::Environment::get().getWorld()->getStore().get().find (magicEffect->mHit); + bool loop = magicEffect->mData.mFlags & ESM::MagicEffect::ContinuousVfx; + // Don't play particle VFX unless the effect is new or it should be looping. + if (isNew || loop) + addEffect("meshes\\" + castStatic->mModel, magicEffect->mIndex, loop, ""); + } +} + +void NpcAnimation::setAlpha(float alpha) +{ + if (alpha == mAlpha) + return; + mAlpha = alpha; + + for (int i=0; imEntities.size(); ++j) + { + Ogre::Entity* ent = mObjectParts[i]->mEntities[j]; + if (ent != mObjectParts[i]->mSkelBase) + applyAlpha(alpha, ent, mObjectParts[i]); + } + } +} + +void NpcAnimation::applyAlpha(float alpha, Ogre::Entity *ent, NifOgre::ObjectScenePtr scene) +{ + ent->getSubEntity(0)->setRenderQueueGroup(alpha != 1.f || ent->getSubEntity(0)->getMaterial()->isTransparent() + ? RQG_Alpha : RQG_Main); + + + Ogre::MaterialPtr mat = scene->mMaterialControllerMgr.getWritableMaterial(ent); + if (mAlpha == 1.f) + { + // Don't bother remembering what the original values were. Just remove the techniques and let the factory restore them. + mat->removeAllTechniques(); + sh::Factory::getInstance()._ensureMaterial(mat->getName(), "Default"); + return; + } + + Ogre::Material::TechniqueIterator techs = mat->getTechniqueIterator(); + while(techs.hasMoreElements()) + { + Ogre::Technique *tech = techs.getNext(); + Ogre::Technique::PassIterator passes = tech->getPassIterator(); + while(passes.hasMoreElements()) + { + Ogre::Pass *pass = passes.getNext(); + pass->setSceneBlending(Ogre::SBT_TRANSPARENT_ALPHA); + Ogre::ColourValue diffuse = pass->getDiffuse(); + diffuse.a = alpha; + pass->setDiffuse(diffuse); + pass->setVertexColourTracking(pass->getVertexColourTracking() &~Ogre::TVC_DIFFUSE); + } + } } } diff --git a/apps/openmw/mwrender/npcanimation.hpp b/apps/openmw/mwrender/npcanimation.hpp index b1abf97af..04dde87c7 100644 --- a/apps/openmw/mwrender/npcanimation.hpp +++ b/apps/openmw/mwrender/npcanimation.hpp @@ -3,23 +3,34 @@ #include "animation.hpp" -#include "../mwworld/containerstore.hpp" +#include "../mwworld/inventorystore.hpp" namespace ESM { struct NPC; } -namespace MWWorld -{ - class InventoryStore; -} - namespace MWRender { -class NpcAnimation : public Animation +class SayAnimationValue : public Ogre::ControllerValue { +private: + MWWorld::Ptr mReference; +public: + SayAnimationValue(MWWorld::Ptr reference) : mReference(reference) {} + + virtual Ogre::Real getValue() const; + virtual void setValue(Ogre::Real value) + { } +}; + +class NpcAnimation : public Animation, public MWWorld::InventoryStoreListener +{ +public: + virtual void equipmentChanged() { updateParts(); } + virtual void permanentEffectAdded(const ESM::MagicEffect *magicEffect, bool isNew, bool playSound); + public: typedef std::map PartBoneMap; @@ -32,32 +43,17 @@ public: private: static const PartBoneMap sPartList; - int mStateID; + bool mListenerDisabled; // Bounded Parts - NifOgre::ObjectList mObjectParts[ESM::PRT_Count]; + NifOgre::ObjectScenePtr mObjectParts[ESM::PRT_Count]; const ESM::NPC *mNpc; std::string mHeadModel; std::string mHairModel; ViewMode mViewMode; bool mShowWeapons; - - float mTimeToChange; - MWWorld::ContainerStoreIterator mRobe; - MWWorld::ContainerStoreIterator mHelmet; - MWWorld::ContainerStoreIterator mShirt; - MWWorld::ContainerStoreIterator mCuirass; - MWWorld::ContainerStoreIterator mGreaves; - MWWorld::ContainerStoreIterator mPauldronL; - MWWorld::ContainerStoreIterator mPauldronR; - MWWorld::ContainerStoreIterator mBoots; - MWWorld::ContainerStoreIterator mPants; - MWWorld::ContainerStoreIterator mGloveL; - MWWorld::ContainerStoreIterator mGloveR; - MWWorld::ContainerStoreIterator mSkirtIter; - MWWorld::ContainerStoreIterator mWeapon; - MWWorld::ContainerStoreIterator mShield; + bool mShowShield; int mVisibilityFlags; @@ -66,30 +62,49 @@ private: Ogre::Vector3 mFirstPersonOffset; + Ogre::SharedPtr mSayAnimationValue; + + float mAlpha; + void updateNpcBase(); - NifOgre::ObjectList insertBoundedPart(const std::string &model, int group, const std::string &bonename); + NifOgre::ObjectScenePtr insertBoundedPart(const std::string &model, int group, const std::string &bonename, + bool enchantedGlow, Ogre::Vector3* glowColor=NULL); void removeIndividualPart(ESM::PartReferenceType type); void reserveIndividualPart(ESM::PartReferenceType type, int group, int priority); - bool addOrReplaceIndividualPart(ESM::PartReferenceType type, int group, int priority, const std::string &mesh); + bool addOrReplaceIndividualPart(ESM::PartReferenceType type, int group, int priority, const std::string &mesh, + bool enchantedGlow=false, Ogre::Vector3* glowColor=NULL); void removePartGroup(int group); - void addPartGroup(int group, int priority, const std::vector &parts); + void addPartGroup(int group, int priority, const std::vector &parts, + bool enchantedGlow=false, Ogre::Vector3* glowColor=NULL); + + void applyAlpha(float alpha, Ogre::Entity* ent, NifOgre::ObjectScenePtr scene); public: - NpcAnimation(const MWWorld::Ptr& ptr, Ogre::SceneNode* node, - MWWorld::InventoryStore& inv, int visibilityFlags, + /** + * @param ptr + * @param node + * @param visibilityFlags + * @param disableListener Don't listen for equipment changes and magic effects. InventoryStore only supports + * one listener at a time, so you shouldn't do this if creating several NpcAnimations + * for the same Ptr, eg preview dolls for the player. + * Those need to be manually rendered anyway. + * @param viewMode + */ + NpcAnimation(const MWWorld::Ptr& ptr, Ogre::SceneNode* node, int visibilityFlags, bool disableListener = false, ViewMode viewMode=VM_Normal); virtual ~NpcAnimation(); virtual Ogre::Vector3 runAnimation(float timepassed); virtual void showWeapons(bool showWeapon); + virtual void showShield(bool showShield); void setViewMode(ViewMode viewMode); - void updateParts(bool forceupdate = false); + void updateParts(); /// \brief Applies a translation to the arms and hands. /// This may be called multiple times before the animation @@ -98,6 +113,9 @@ public: /// Rebuilds the NPC, updating their root model, animation sources, and equipment. void rebuild(); + + /// Make the NPC only partially visible + virtual void setAlpha(float alpha); }; } diff --git a/apps/openmw/mwrender/objects.cpp b/apps/openmw/mwrender/objects.cpp index fd81baf6e..827b9b52a 100644 --- a/apps/openmw/mwrender/objects.cpp +++ b/apps/openmw/mwrender/objects.cpp @@ -278,6 +278,24 @@ void Objects::updateObjectCell(const MWWorld::Ptr &old, const MWWorld::Ptr &cur) } else { node = mCellSceneNodes[newCell]; } + node->addChild(cur.getRefData().getBaseNode()); + + PtrAnimationMap::iterator iter = mObjects.find(old); + if(iter != mObjects.end()) + { + ObjectAnimation *anim = iter->second; + mObjects.erase(iter); + anim->updatePtr(cur); + mObjects[cur] = anim; + } +} + +ObjectAnimation* Objects::getAnimation(const MWWorld::Ptr &ptr) +{ + PtrAnimationMap::const_iterator iter = mObjects.find(ptr); + if(iter != mObjects.end()) + return iter->second; + return NULL; } diff --git a/apps/openmw/mwrender/objects.hpp b/apps/openmw/mwrender/objects.hpp index 22dd1e4f5..022752fae 100644 --- a/apps/openmw/mwrender/objects.hpp +++ b/apps/openmw/mwrender/objects.hpp @@ -33,6 +33,8 @@ class Objects{ void insertBegin(const MWWorld::Ptr& ptr); + + public: Objects(OEngine::Render::OgreRenderer &renderer) : mRenderer(renderer) @@ -41,6 +43,8 @@ public: ~Objects(){} void insertModel(const MWWorld::Ptr& ptr, const std::string &model); + ObjectAnimation* getAnimation(const MWWorld::Ptr &ptr); + void enableLights(); void disableLights(); diff --git a/apps/openmw/mwrender/renderingmanager.cpp b/apps/openmw/mwrender/renderingmanager.cpp index 93425191d..0b10791b8 100644 --- a/apps/openmw/mwrender/renderingmanager.cpp +++ b/apps/openmw/mwrender/renderingmanager.cpp @@ -8,10 +8,6 @@ #include #include #include -#include -#include -#include -#include #include #include #include @@ -43,7 +39,6 @@ #include "shadows.hpp" #include "localmap.hpp" #include "water.hpp" -#include "compositors.hpp" #include "npcanimation.hpp" #include "externalrendering.hpp" #include "globalmap.hpp" @@ -60,14 +55,14 @@ RenderingManager::RenderingManager(OEngine::Render::OgreRenderer& _rend, const b MWWorld::Fallback* fallback) : mRendering(_rend) , mFallback(fallback) - , mObjects(mRendering) - , mActors(mRendering, this) , mPlayerAnimation(NULL) , mAmbientMode(0) , mSunEnabled(0) , mPhysicsEngine(engine) , mTerrain(NULL) { + mActors = new MWRender::Actors(mRendering, this); + mObjects = new MWRender::Objects(mRendering); // select best shader mode bool openGL = (Ogre::Root::getSingleton ().getRenderSystem ()->getName().find("OpenGL") != std::string::npos); bool glES = (Ogre::Root::getSingleton ().getRenderSystem ()->getName().find("OpenGL ES") != std::string::npos); @@ -87,8 +82,6 @@ RenderingManager::RenderingManager(OEngine::Render::OgreRenderer& _rend, const b mRendering.getWindow()->addListener(this); mRendering.setWindowListener(this); - mCompositors = new Compositors(mRendering.getViewport()); - mWater = 0; // material system @@ -157,13 +150,11 @@ RenderingManager::RenderingManager(OEngine::Render::OgreRenderer& _rend, const b sh::Factory::getInstance ().setGlobalSetting ("viewproj_fix", "false"); sh::Factory::getInstance ().setSharedParameter ("vpRow2Fix", sh::makeProperty (new sh::Vector4(0,0,0,0))); - applyCompositors(); - mRootNode = mRendering.getScene()->getRootSceneNode(); mRootNode->createChildSceneNode("player"); - mObjects.setRootNode(mRootNode); - mActors.setRootNode(mRootNode); + mObjects->setRootNode(mRootNode); + mActors->setRootNode(mRootNode); mCamera = new MWRender::Camera(mRendering.getCamera()); @@ -198,9 +189,10 @@ RenderingManager::~RenderingManager () delete mTerrain; delete mLocalMap; delete mOcclusionQuery; - delete mCompositors; delete mWater; delete mVideoPlayer; + delete mActors; + delete mObjects; delete mFactory; } @@ -210,10 +202,10 @@ MWRender::SkyManager* RenderingManager::getSkyManager() } MWRender::Objects& RenderingManager::getObjects(){ - return mObjects; + return *mObjects; } MWRender::Actors& RenderingManager::getActors(){ - return mActors; + return *mActors; } OEngine::Render::Fader* RenderingManager::getFader() @@ -223,8 +215,8 @@ OEngine::Render::Fader* RenderingManager::getFader() void RenderingManager::removeCell (MWWorld::Ptr::CellStore *store) { - mObjects.removeCell(store); - mActors.removeCell(store); + mObjects->removeCell(store); + mActors->removeCell(store); mDebugging->cellRemoved(store); } @@ -240,7 +232,7 @@ void RenderingManager::toggleWater() void RenderingManager::cellAdded (MWWorld::Ptr::CellStore *store) { - mObjects.buildStaticGeometry (*store); + mObjects->buildStaticGeometry (*store); sh::Factory::getInstance().unloadUnreferencedMaterials(); mDebugging->cellAdded(store); waterAdded(store); @@ -254,8 +246,8 @@ void RenderingManager::addObject (const MWWorld::Ptr& ptr){ void RenderingManager::removeObject (const MWWorld::Ptr& ptr) { - if (!mObjects.deleteObject (ptr)) - mActors.deleteObject (ptr); + if (!mObjects->deleteObject (ptr)) + mActors->deleteObject (ptr); } void RenderingManager::moveObject (const MWWorld::Ptr& ptr, const Ogre::Vector3& position) @@ -295,9 +287,9 @@ RenderingManager::updateObjectCell(const MWWorld::Ptr &old, const MWWorld::Ptr & parent->removeChild(child); if (MWWorld::Class::get(old).isActor()) { - mActors.updateObjectCell(old, cur); + mActors->updateObjectCell(old, cur); } else { - mObjects.updateObjectCell(old, cur); + mObjects->updateObjectCell(old, cur); } } @@ -315,7 +307,7 @@ void RenderingManager::rebuildPtr(const MWWorld::Ptr &ptr) if(ptr.getRefData().getHandle() == "player") anim = mPlayerAnimation; else if(MWWorld::Class::get(ptr).isActor()) - anim = dynamic_cast(mActors.getAnimation(ptr)); + anim = dynamic_cast(mActors->getAnimation(ptr)); if(anim) { anim->rebuild(); @@ -380,8 +372,8 @@ void RenderingManager::update (float duration, bool paused) if(paused) return; - mActors.update (duration); - mObjects.update (duration); + mActors->update (duration); + mObjects->update (duration); mSkyManager->update(duration); @@ -476,29 +468,21 @@ bool RenderingManager::toggleRenderMode(int mode) { if (mRendering.getCamera()->getPolygonMode() == PM_SOLID) { - mCompositors->setEnabled(false); - mRendering.getCamera()->setPolygonMode(PM_WIREFRAME); return true; } else { - mCompositors->setEnabled(true); - mRendering.getCamera()->setPolygonMode(PM_SOLID); return false; } } - else if (mode == MWBase::World::Render_BoundingBoxes) + else //if (mode == MWBase::World::Render_BoundingBoxes) { bool show = !mRendering.getScene()->getShowBoundingBoxes(); mRendering.getScene()->showBoundingBoxes(show); return show; } - else //if (mode == MWBase::World::Render_Compositors) - { - return mCompositors->toggle(); - } } void RenderingManager::configureFog(MWWorld::Ptr::CellStore &mCell) @@ -657,7 +641,7 @@ void RenderingManager::requestMap(MWWorld::Ptr::CellStore* cell) { assert(mTerrain); - Ogre::AxisAlignedBox dims = mObjects.getDimensions(cell); + Ogre::AxisAlignedBox dims = mObjects->getDimensions(cell); Ogre::Vector2 center(cell->mCell->getGridX() + 0.5, cell->mCell->getGridY() + 0.5); dims.merge(mTerrain->getWorldBoundingBox(center)); @@ -667,7 +651,7 @@ void RenderingManager::requestMap(MWWorld::Ptr::CellStore* cell) mLocalMap->requestMap(cell, dims.getMinimum().z, dims.getMaximum().z); } else - mLocalMap->requestMap(cell, mObjects.getDimensions(cell)); + mLocalMap->requestMap(cell, mObjects->getDimensions(cell)); } void RenderingManager::preCellChange(MWWorld::Ptr::CellStore* cell) @@ -677,13 +661,13 @@ void RenderingManager::preCellChange(MWWorld::Ptr::CellStore* cell) void RenderingManager::disableLights(bool sun) { - mObjects.disableLights(); + mObjects->disableLights(); sunDisable(sun); } void RenderingManager::enableLights(bool sun) { - mObjects.enableLights(); + mObjects->enableLights(); sunEnable(sun); } @@ -743,11 +727,6 @@ Ogre::Vector4 RenderingManager::boundingBoxToScreen(Ogre::AxisAlignedBox bounds) return Vector4(min_x, min_y, max_x, max_y); } -Compositors* RenderingManager::getCompositors() -{ - return mCompositors; -} - void RenderingManager::processChangedSettings(const Settings::CategorySettingVector& settings) { bool changeRes = false; @@ -793,7 +772,6 @@ void RenderingManager::processChangedSettings(const Settings::CategorySettingVec } else if (it->second == "shader" && it->first == "Water") { - applyCompositors(); sh::Factory::getInstance ().setGlobalSetting ("simple_water", Settings::Manager::getBool("shader", "Water") ? "false" : "true"); rebuild = true; mRendering.getViewport ()->setClearEveryFrame (true); @@ -859,7 +837,7 @@ void RenderingManager::processChangedSettings(const Settings::CategorySettingVec if (rebuild) { - mObjects.rebuildStaticGeometry(); + mObjects->rebuildStaticGeometry(); if (mTerrain) mTerrain->applyMaterials(Settings::Manager::getBool("enabled", "Shadows"), Settings::Manager::getBool("split", "Shadows")); @@ -878,29 +856,19 @@ void RenderingManager::setMenuTransparency(float val) void RenderingManager::windowResized(int x, int y) { + Settings::Manager::setInt("resolution x", "Video", x); + Settings::Manager::setInt("resolution y", "Video", y); mRendering.adjustViewport(); - mCompositors->recreate(); mVideoPlayer->setResolution (x, y); MWBase::Environment::get().getWindowManager()->windowResized(x,y); } -void RenderingManager::applyCompositors() -{ -} - void RenderingManager::getTriangleBatchCount(unsigned int &triangles, unsigned int &batches) { - if (mCompositors->anyCompositorEnabled()) - { - mCompositors->countTrianglesBatches(triangles, batches); - } - else - { - triangles = mRendering.getWindow()->getTriangleCount(); - batches = mRendering.getWindow()->getBatchCount(); - } + batches = mRendering.getWindow()->getBatchCount(); + triangles = mRendering.getWindow()->getTriangleCount(); } void RenderingManager::setupPlayer(const MWWorld::Ptr &ptr) @@ -913,18 +881,17 @@ void RenderingManager::renderPlayer(const MWWorld::Ptr &ptr) { if(!mPlayerAnimation) { - mPlayerAnimation = new NpcAnimation(ptr, ptr.getRefData().getBaseNode(), - MWWorld::Class::get(ptr).getInventoryStore(ptr), - RV_Actors); + mPlayerAnimation = new NpcAnimation(ptr, ptr.getRefData().getBaseNode(), RV_Actors); } else { // Reconstruct the NpcAnimation in-place mPlayerAnimation->~NpcAnimation(); - new(mPlayerAnimation) NpcAnimation(ptr, ptr.getRefData().getBaseNode(), - MWWorld::Class::get(ptr).getInventoryStore(ptr), - RV_Actors); + new(mPlayerAnimation) NpcAnimation(ptr, ptr.getRefData().getBaseNode(), RV_Actors); } + // Ensure CustomData -> autoEquip -> animation update + ptr.getClass().getInventoryStore(ptr); + mCamera->setAnimation(mPlayerAnimation); mWater->removeEmitter(ptr); mWater->addEmitter(ptr); @@ -975,9 +942,14 @@ void RenderingManager::setupExternalRendering (MWRender::ExternalRendering& rend Animation* RenderingManager::getAnimation(const MWWorld::Ptr &ptr) { - Animation *anim = mActors.getAnimation(ptr); + Animation *anim = mActors->getAnimation(ptr); + if(!anim && ptr.getRefData().getHandle() == "player") anim = mPlayerAnimation; + + if (!anim) + anim = mObjects->getAnimation(ptr); + return anim; } diff --git a/apps/openmw/mwrender/renderingmanager.hpp b/apps/openmw/mwrender/renderingmanager.hpp index 2d0813912..abc8fd71a 100644 --- a/apps/openmw/mwrender/renderingmanager.hpp +++ b/apps/openmw/mwrender/renderingmanager.hpp @@ -48,7 +48,6 @@ namespace MWRender class Shadows; class LocalMap; class Water; - class Compositors; class ExternalRendering; class GlobalMap; class VideoPlayer; @@ -96,7 +95,6 @@ public: void renderPlayer(const MWWorld::Ptr &ptr); SkyManager* getSkyManager(); - Compositors* getCompositors(); void toggleLight(); bool toggleRenderMode(int mode); @@ -224,8 +222,6 @@ private: void setMenuTransparency(float val); - void applyCompositors(); - bool mSunEnabled; MWWorld::Fallback* mFallback; @@ -242,8 +238,8 @@ private: OEngine::Render::OgreRenderer &mRendering; - MWRender::Objects mObjects; - MWRender::Actors mActors; + MWRender::Objects* mObjects; + MWRender::Actors* mActors; MWRender::NpcAnimation *mPlayerAnimation; @@ -269,8 +265,6 @@ private: MWRender::Shadows* mShadows; - MWRender::Compositors* mCompositors; - VideoPlayer* mVideoPlayer; }; diff --git a/apps/openmw/mwrender/sky.cpp b/apps/openmw/mwrender/sky.cpp index 03e14dc07..39f7ccc85 100644 --- a/apps/openmw/mwrender/sky.cpp +++ b/apps/openmw/mwrender/sky.cpp @@ -285,10 +285,10 @@ void SkyManager::create() // Stars mAtmosphereNight = mRootNode->createChildSceneNode(); - NifOgre::ObjectList objects = NifOgre::Loader::createObjects(mAtmosphereNight, "meshes\\sky_night_01.nif"); - for(size_t i = 0, matidx = 0;i < objects.mEntities.size();i++) + NifOgre::ObjectScenePtr objects = NifOgre::Loader::createObjects(mAtmosphereNight, "meshes\\sky_night_01.nif"); + for(size_t i = 0, matidx = 0;i < objects->mEntities.size();i++) { - Entity* night1_ent = objects.mEntities[i]; + Entity* night1_ent = objects->mEntities[i]; night1_ent->setRenderQueueGroup(RQG_SkiesEarly+1); night1_ent->setVisibilityFlags(RV_Sky); night1_ent->setCastShadows(false); @@ -307,14 +307,14 @@ void SkyManager::create() night1_ent->getSubEntity(j)->setMaterialName(matName); } } - + mObjects.push_back(objects); // Atmosphere (day) mAtmosphereDay = mRootNode->createChildSceneNode(); objects = NifOgre::Loader::createObjects(mAtmosphereDay, "meshes\\sky_atmosphere.nif"); - for(size_t i = 0;i < objects.mEntities.size();i++) + for(size_t i = 0;i < objects->mEntities.size();i++) { - Entity* atmosphere_ent = objects.mEntities[i]; + Entity* atmosphere_ent = objects->mEntities[i]; atmosphere_ent->setCastShadows(false); atmosphere_ent->setRenderQueueGroup(RQG_SkiesEarly); atmosphere_ent->setVisibilityFlags(RV_Sky); @@ -325,14 +325,14 @@ void SkyManager::create() // Using infinite AAB here to prevent being clipped by the custom near clip plane used for reflections/refractions atmosphere_ent->getMesh()->_setBounds (aabInf); } - + mObjects.push_back(objects); // Clouds SceneNode* clouds_node = mRootNode->createChildSceneNode(); objects = NifOgre::Loader::createObjects(clouds_node, "meshes\\sky_clouds_01.nif"); - for(size_t i = 0;i < objects.mEntities.size();i++) + for(size_t i = 0;i < objects->mEntities.size();i++) { - Entity* clouds_ent = objects.mEntities[i]; + Entity* clouds_ent = objects->mEntities[i]; clouds_ent->setVisibilityFlags(RV_Sky); clouds_ent->setRenderQueueGroup(RQG_SkiesEarly+5); for(unsigned int j = 0;j < clouds_ent->getNumSubEntities();j++) @@ -341,6 +341,7 @@ void SkyManager::create() // Using infinite AAB here to prevent being clipped by the custom near clip plane used for reflections/refractions clouds_ent->getMesh()->_setBounds (aabInf); } + mObjects.push_back(objects); mCreated = true; } diff --git a/apps/openmw/mwrender/sky.hpp b/apps/openmw/mwrender/sky.hpp index 3df8846cd..965907a97 100644 --- a/apps/openmw/mwrender/sky.hpp +++ b/apps/openmw/mwrender/sky.hpp @@ -11,6 +11,8 @@ #include +#include + #include "../mwworld/weather.hpp" @@ -196,6 +198,8 @@ namespace MWRender Ogre::SceneNode* mAtmosphereDay; Ogre::SceneNode* mAtmosphereNight; + std::vector mObjects; + // remember some settings so we don't have to apply them again if they didnt change Ogre::String mClouds; Ogre::String mNextClouds; diff --git a/apps/openmw/mwrender/water.hpp b/apps/openmw/mwrender/water.hpp index bc15b4980..481a41297 100644 --- a/apps/openmw/mwrender/water.hpp +++ b/apps/openmw/mwrender/water.hpp @@ -133,8 +133,6 @@ namespace MWRender { RenderingManager* mRendering; SkyManager* mSky; - std::string mCompositorName; - Ogre::MaterialPtr mMaterial; bool mUnderwaterEffect; diff --git a/apps/openmw/mwscript/aiextensions.cpp b/apps/openmw/mwscript/aiextensions.cpp index fac44c08f..1cdbaa008 100644 --- a/apps/openmw/mwscript/aiextensions.cpp +++ b/apps/openmw/mwscript/aiextensions.cpp @@ -17,11 +17,16 @@ #include "../mwmechanics/aitravel.hpp" #include "../mwmechanics/aiwander.hpp" +#include "../mwbase/environment.hpp" +#include "../mwbase/world.hpp" + #include "interpretercontext.hpp" #include "ref.hpp" #include +#include "../mwbase/mechanicsmanager.hpp" + namespace MWScript { namespace Ai @@ -364,6 +369,39 @@ namespace MWScript } }; + template + class OpGetLineOfSight : public Interpreter::Opcode0 + { + public: + + virtual void execute (Interpreter::Runtime& runtime) + { + + MWWorld::Ptr source = R()(runtime); + + std::string actorID = runtime.getStringLiteral (runtime[0].mInteger); + runtime.pop(); + + MWWorld::Ptr dest = MWBase::Environment::get().getWorld()->getPtr(actorID,true); + bool value = false; + if(dest != MWWorld::Ptr() ) + { + value = MWBase::Environment::get().getWorld()->getLOS(source,dest); + } + runtime.push (value); + } + }; + + template + class OpToggleAI : public Interpreter::Opcode0 + { + public: + + virtual void execute (Interpreter::Runtime& runtime) + { + MWBase::Environment::get().getMechanicsManager()->toggleAI(); + } + }; void installOpcodes (Interpreter::Interpreter& interpreter) { @@ -389,6 +427,11 @@ namespace MWScript interpreter.installSegment5 (Compiler::Ai::opcodeGetCurrentAiPackageExplicit, new OpGetCurrentAIPackage); interpreter.installSegment3 (Compiler::Ai::opcodeGetDetected, new OpGetDetected); interpreter.installSegment3 (Compiler::Ai::opcodeGetDetectedExplicit, new OpGetDetected); + interpreter.installSegment5 (Compiler::Ai::opcodeGetLineOfSight, new OpGetLineOfSight); + interpreter.installSegment5 (Compiler::Ai::opcodeGetLineOfSightExplicit, new OpGetLineOfSight); + interpreter.installSegment5 (Compiler::Ai::opcodeToggleAI, new OpToggleAI); + interpreter.installSegment5 (Compiler::Ai::opcodeToggleAIExplicit, new OpToggleAI); + interpreter.installSegment5 (Compiler::Ai::opcodeSetHello, new OpSetAiSetting(0)); interpreter.installSegment5 (Compiler::Ai::opcodeSetHelloExplicit, new OpSetAiSetting(0)); interpreter.installSegment5 (Compiler::Ai::opcodeSetFight, new OpSetAiSetting(1)); diff --git a/apps/openmw/mwscript/containerextensions.cpp b/apps/openmw/mwscript/containerextensions.cpp index 2f3ef2d79..53f4c23c9 100644 --- a/apps/openmw/mwscript/containerextensions.cpp +++ b/apps/openmw/mwscript/containerextensions.cpp @@ -17,7 +17,6 @@ #include "../mwbase/environment.hpp" #include "../mwbase/windowmanager.hpp" -#include "../mwworld/manualref.hpp" #include "../mwworld/class.hpp" #include "../mwworld/containerstore.hpp" #include "../mwworld/actionequip.hpp" @@ -53,26 +52,14 @@ namespace MWScript if (count == 0) return; - MWWorld::ManualRef ref (MWBase::Environment::get().getWorld()->getStore(), item); - - ref.getPtr().getRefData().setCount (count); - - // Configure item's script variables - std::string script = MWWorld::Class::get(ref.getPtr()).getScript(ref.getPtr()); - if (script != "") - { - const ESM::Script *esmscript = MWBase::Environment::get().getWorld()->getStore().get().find (script); - ref.getPtr().getRefData().setLocals(*esmscript); - } - - MWWorld::Class::get (ptr).getContainerStore (ptr).add (ref.getPtr(), ptr); + MWWorld::Ptr itemPtr = *ptr.getClass().getContainerStore (ptr).add (item, count, ptr); // Spawn a messagebox (only for items added to player's inventory and if player is talking to someone) if (ptr == MWBase::Environment::get().getWorld ()->getPlayer ().getPlayer() ) { // The two GMST entries below expand to strings informing the player of what, and how many of it has been added to their inventory std::string msgBox; - std::string itemName = MWWorld::Class::get(ref.getPtr()).getName(ref.getPtr()); + std::string itemName = itemPtr.getClass().getName(itemPtr); if (count == 1) { msgBox = MyGUI::LanguageManager::getInstance().replaceTags("#{sNotifyMessage60}"); @@ -136,41 +123,21 @@ namespace MWScript return; MWWorld::ContainerStore& store = MWWorld::Class::get (ptr).getContainerStore (ptr); - - std::string itemName = ""; - // originalCount holds the total number of items to remove, count holds the remaining number of items to remove - Interpreter::Type_Integer originalCount = count; - - for (MWWorld::ContainerStoreIterator iter (store.begin()); iter!=store.end() && count; - ++iter) - { + std::string itemName; + for (MWWorld::ContainerStoreIterator iter(store.begin()); iter != store.end(); ++iter) if (Misc::StringUtils::ciEqual(iter->getCellRef().mRefID, item)) - { - itemName = MWWorld::Class::get(*iter).getName(*iter); - - if (iter->getRefData().getCount()<=count) - { - count -= iter->getRefData().getCount(); - iter->getRefData().setCount (0); - } - else - { - iter->getRefData().setCount (iter->getRefData().getCount()-count); - count = 0; - } - } - } - + itemName = iter->getClass().getName(*iter); + + int numRemoved = store.remove(item, count, ptr); + // Spawn a messagebox (only for items removed from player's inventory) - if (ptr == MWBase::Environment::get().getWorld ()->getPlayer ().getPlayer()) + if ((numRemoved > 0) + && (ptr == MWBase::Environment::get().getWorld()->getPlayer().getPlayer())) { // The two GMST entries below expand to strings informing the player of what, and how many of it has been removed from their inventory std::string msgBox; - int numRemoved = (originalCount - count); - if (numRemoved == 0) - return; - + if(numRemoved > 1) { msgBox = MyGUI::LanguageManager::getInstance().replaceTags("#{sNotifyMessage63}"); diff --git a/apps/openmw/mwscript/docs/vmformat.txt b/apps/openmw/mwscript/docs/vmformat.txt index 7bbb33699..9e024f872 100644 --- a/apps/openmw/mwscript/docs/vmformat.txt +++ b/apps/openmw/mwscript/docs/vmformat.txt @@ -354,5 +354,9 @@ op 0x200021e: ShowVarsExplicit op 0x200021f: ToggleGodMode op 0x2000220: DisableLevitation op 0x2000221: EnableLevitation +op 0x2000222: GetLineOfSight +op 0x2000223: GetLineOfSightExplicit +op 0x2000224: ToggleAI +op 0x2000225: ToggleAIExplicit -opcodes 0x2000222-0x3ffffff unused +opcodes 0x2000226-0x3ffffff unused diff --git a/apps/openmw/mwscript/miscextensions.cpp b/apps/openmw/mwscript/miscextensions.cpp index 4ae1136e2..8e2a8af8c 100644 --- a/apps/openmw/mwscript/miscextensions.cpp +++ b/apps/openmw/mwscript/miscextensions.cpp @@ -19,7 +19,6 @@ #include "../mwworld/class.hpp" #include "../mwworld/player.hpp" -#include "../mwworld/manualref.hpp" #include "../mwworld/containerstore.hpp" #include "../mwmechanics/npcstats.hpp" @@ -348,14 +347,8 @@ namespace MWScript const MWWorld::ESMStore& store = MWBase::Environment::get().getWorld()->getStore(); store.get().find(creature); // This line throws an exception if it can't find the creature - MWWorld::ManualRef ref (MWBase::Environment::get().getWorld()->getStore(), gem); - - ref.getPtr().getRefData().setCount (1); - - ref.getPtr().getCellRef().mSoul = creature; - - MWWorld::Class::get (ptr).getContainerStore (ptr).add (ref.getPtr(), ptr); - + MWWorld::Ptr item = *ptr.getClass().getContainerStore(ptr).add(gem, 1, ptr); + item.getCellRef().mSoul = creature; } }; @@ -374,18 +367,7 @@ namespace MWScript MWWorld::ContainerStore& store = MWWorld::Class::get (ptr).getContainerStore (ptr); - - for (MWWorld::ContainerStoreIterator iter (store.begin()); iter!=store.end(); ++iter) - { - if (::Misc::StringUtils::ciEqual(iter->getCellRef().mSoul, soul)) - { - if (iter->getRefData().getCount() <= 1) - iter->getRefData().setCount (0); - else - iter->getRefData().setCount (iter->getRefData().getCount() - 1); - break; - } - } + store.remove(soul, 1, ptr); } }; @@ -415,24 +397,18 @@ namespace MWScript MWWorld::ContainerStore& store = MWWorld::Class::get (ptr).getContainerStore (ptr); + int toRemove = amount; for (MWWorld::ContainerStoreIterator iter (store.begin()); iter!=store.end(); ++iter) { if (::Misc::StringUtils::ciEqual(iter->getCellRef().mRefID, item)) { - if(iter->getRefData().getCount() <= amount) - { - MWBase::Environment::get().getWorld()->dropObjectOnGround(ptr, *iter); - iter->getRefData().setCount(0); - } - else - { - int original = iter->getRefData().getCount(); - iter->getRefData().setCount(amount); - MWBase::Environment::get().getWorld()->dropObjectOnGround(ptr, *iter); - iter->getRefData().setCount(original - amount); - } + int removed = store.remove(*iter, toRemove, ptr); + MWBase::Environment::get().getWorld()->dropObjectOnGround(ptr, *iter, removed); - break; + toRemove -= removed; + + if (toRemove <= 0) + break; } } } @@ -458,20 +434,8 @@ namespace MWScript { if (::Misc::StringUtils::ciEqual(iter->getCellRef().mSoul, soul)) { - - if(iter->getRefData().getCount() <= 1) - { - MWBase::Environment::get().getWorld()->dropObjectOnGround(ptr, *iter); - iter->getRefData().setCount(0); - } - else - { - int original = iter->getRefData().getCount(); - iter->getRefData().setCount(1); - MWBase::Environment::get().getWorld()->dropObjectOnGround(ptr, *iter); - iter->getRefData().setCount(original - 1); - } - + MWBase::Environment::get().getWorld()->dropObjectOnGround(ptr, *iter, 1); + store.remove(*iter, 1, ptr); break; } } @@ -541,12 +505,7 @@ namespace MWScript runtime.pop(); if (parameter == 1) - { - if (ptr.isInCell()) - MWBase::Environment::get().getWorld()->deleteObject (ptr); - else - ptr.getRefData().setCount(0); - } + MWBase::Environment::get().getWorld()->deleteObject(ptr); } }; diff --git a/apps/openmw/mwscript/statsextensions.cpp b/apps/openmw/mwscript/statsextensions.cpp index 603515ff4..6cd483ae1 100644 --- a/apps/openmw/mwscript/statsextensions.cpp +++ b/apps/openmw/mwscript/statsextensions.cpp @@ -209,6 +209,7 @@ namespace MWScript .getDynamic (mIndex)); stat.setModified (value, 0); + stat.setCurrent(value); MWWorld::Class::get (ptr).getCreatureStats (ptr).setDynamic (mIndex, stat); } diff --git a/apps/openmw/mwscript/transformationextensions.cpp b/apps/openmw/mwscript/transformationextensions.cpp index 6246daee2..ae9ac041e 100644 --- a/apps/openmw/mwscript/transformationextensions.cpp +++ b/apps/openmw/mwscript/transformationextensions.cpp @@ -450,62 +450,16 @@ namespace MWScript } }; - template - class OpPlaceAtPc : public Interpreter::Opcode0 + template + class OpPlaceAt : public Interpreter::Opcode0 { public: virtual void execute (Interpreter::Runtime& runtime) { - std::string itemID = runtime.getStringLiteral (runtime[0].mInteger); - runtime.pop(); - - Interpreter::Type_Integer count = runtime[0].mInteger; - runtime.pop(); - Interpreter::Type_Float distance = runtime[0].mFloat; - runtime.pop(); - Interpreter::Type_Integer direction = runtime[0].mInteger; - runtime.pop(); - - if (count<0) - throw std::runtime_error ("count must be non-negative"); - - // no-op - if (count == 0) - return; - - ESM::Position ipos = MWBase::Environment::get().getWorld()->getPlayer().getPlayer().getRefData().getPosition(); - Ogre::Vector3 pos(ipos.pos[0],ipos.pos[1],ipos.pos[2]); - Ogre::Quaternion rot(Ogre::Radian(-ipos.rot[2]), Ogre::Vector3::UNIT_Z); - if(direction == 0) pos = pos + distance*rot.yAxis(); - else if(direction == 1) pos = pos - distance*rot.yAxis(); - else if(direction == 2) pos = pos - distance*rot.xAxis(); - else if(direction == 3) pos = pos + distance*rot.xAxis(); - else throw std::runtime_error ("direction must be 0,1,2 or 3"); - - ipos.pos[0] = pos.x; - ipos.pos[1] = pos.y; - ipos.pos[2] = pos.z; - ipos.rot[0] = 0; - ipos.rot[1] = 0; - ipos.rot[2] = 0; - - MWWorld::CellStore* store = MWBase::Environment::get().getWorld()->getPlayer().getPlayer().getCell(); - MWWorld::ManualRef ref(MWBase::Environment::get().getWorld()->getStore(),itemID); - ref.getPtr().getCellRef().mPos = ipos; - ref.getPtr().getRefData().setCount(count); - MWBase::Environment::get().getWorld()->safePlaceObject(ref.getPtr(),*store,ipos); - } - }; - - template - class OpPlaceAtMe : public Interpreter::Opcode0 - { - public: - - virtual void execute (Interpreter::Runtime& runtime) - { - MWWorld::Ptr me = R()(runtime); + MWWorld::Ptr actor = pc + ? MWBase::Environment::get().getWorld()->getPlayer().getPlayer() + : R()(runtime); std::string itemID = runtime.getStringLiteral (runtime[0].mInteger); runtime.pop(); @@ -524,7 +478,7 @@ namespace MWScript if (count == 0) return; - ESM::Position ipos = me.getRefData().getPosition(); + ESM::Position ipos = actor.getRefData().getPosition(); Ogre::Vector3 pos(ipos.pos[0],ipos.pos[1],ipos.pos[2]); Ogre::Quaternion rot(Ogre::Radian(-ipos.rot[2]), Ogre::Vector3::UNIT_Z); if(direction == 0) pos = pos + distance*rot.yAxis(); @@ -536,16 +490,26 @@ namespace MWScript ipos.pos[0] = pos.x; ipos.pos[1] = pos.y; ipos.pos[2] = pos.z; - ipos.rot[0] = 0; - ipos.rot[1] = 0; - ipos.rot[2] = 0; - MWWorld::CellStore* store = me.getCell(); - MWWorld::ManualRef ref(MWBase::Environment::get().getWorld()->getStore(),itemID); + if (actor.getClass().isActor()) + { + // TODO: should this depend on the 'direction' parameter? + ipos.rot[0] = 0; + ipos.rot[1] = 0; + ipos.rot[2] = 0; + } + else + { + ipos.rot[0] = actor.getRefData().getPosition().rot[0]; + ipos.rot[1] = actor.getRefData().getPosition().rot[1]; + ipos.rot[2] = actor.getRefData().getPosition().rot[2]; + } + // create item + MWWorld::CellStore* store = actor.getCell(); + MWWorld::ManualRef ref(MWBase::Environment::get().getWorld()->getStore(), itemID, count); ref.getPtr().getCellRef().mPos = ipos; - ref.getPtr().getRefData().setCount(count); - MWBase::Environment::get().getWorld()->safePlaceObject(ref.getPtr(),*store,ipos); + MWBase::Environment::get().getWorld()->safePlaceObject(ref.getPtr(),*store,ipos); } }; @@ -730,9 +694,9 @@ namespace MWScript interpreter.installSegment5(Compiler::Transformation::opcodePositionCellExplicit,new OpPositionCell); interpreter.installSegment5(Compiler::Transformation::opcodePlaceItemCell,new OpPlaceItemCell); interpreter.installSegment5(Compiler::Transformation::opcodePlaceItem,new OpPlaceItem); - interpreter.installSegment5(Compiler::Transformation::opcodePlaceAtPc,new OpPlaceAtPc); - interpreter.installSegment5(Compiler::Transformation::opcodePlaceAtMe,new OpPlaceAtMe); - interpreter.installSegment5(Compiler::Transformation::opcodePlaceAtMeExplicit,new OpPlaceAtMe); + interpreter.installSegment5(Compiler::Transformation::opcodePlaceAtPc,new OpPlaceAt); + interpreter.installSegment5(Compiler::Transformation::opcodePlaceAtMe,new OpPlaceAt); + interpreter.installSegment5(Compiler::Transformation::opcodePlaceAtMeExplicit,new OpPlaceAt); interpreter.installSegment5(Compiler::Transformation::opcodeModScale,new OpModScale); interpreter.installSegment5(Compiler::Transformation::opcodeModScaleExplicit,new OpModScale); interpreter.installSegment5(Compiler::Transformation::opcodeRotate,new OpRotate); diff --git a/apps/openmw/mwworld/actionapply.hpp b/apps/openmw/mwworld/actionapply.hpp index 3353ae0ee..669a19067 100644 --- a/apps/openmw/mwworld/actionapply.hpp +++ b/apps/openmw/mwworld/actionapply.hpp @@ -1,4 +1,3 @@ - #ifndef GAME_MWWORLD_ACTIONAPPLY_H #define GAME_MWWORLD_ACTIONAPPLY_H diff --git a/apps/openmw/mwworld/actioneat.cpp b/apps/openmw/mwworld/actioneat.cpp index 63efff738..f5d7e2636 100644 --- a/apps/openmw/mwworld/actioneat.cpp +++ b/apps/openmw/mwworld/actioneat.cpp @@ -3,45 +3,25 @@ #include -#include - #include "../mwbase/environment.hpp" #include "../mwbase/world.hpp" -#include "../mwmechanics/creaturestats.hpp" -#include "../mwmechanics/npcstats.hpp" +#include "../mwworld/containerstore.hpp" -#include "esmstore.hpp" #include "class.hpp" namespace MWWorld { void ActionEat::executeImp (const Ptr& actor) { - // remove used item - getTarget().getRefData().setCount (getTarget().getRefData().getCount()-1); + // remove used item (assume the item is present in inventory) + getTarget().getContainerStore()->remove(getTarget(), 1, actor); - // check for success - const MWMechanics::CreatureStats& creatureStats = MWWorld::Class::get (actor).getCreatureStats (actor); - MWMechanics::NpcStats& npcStats = MWWorld::Class::get (actor).getNpcStats (actor); - - float x = - (npcStats.getSkill (ESM::Skill::Alchemy).getModified() + - 0.2 * creatureStats.getAttribute (1).getModified() - + 0.1 * creatureStats.getAttribute (7).getModified()) - * creatureStats.getFatigueTerm(); - - if (x>=100*static_cast (std::rand()) / RAND_MAX) - { - // apply to actor - std::string id = Class::get (getTarget()).getId (getTarget()); + // apply to actor + std::string id = Class::get (getTarget()).getId (getTarget()); - Class::get (actor).apply (actor, id, actor); - // we ignore the result here. Skill increases no matter if the ingredient did something or not. - - // increase skill + if (Class::get (actor).apply (actor, id, actor)) Class::get (actor).skillUsageSucceeded (actor, ESM::Skill::Alchemy, 1); - } } ActionEat::ActionEat (const MWWorld::Ptr& object) : Action (false, object) {} diff --git a/apps/openmw/mwworld/actionequip.cpp b/apps/openmw/mwworld/actionequip.cpp index 0f1a85dda..0d091e742 100644 --- a/apps/openmw/mwworld/actionequip.cpp +++ b/apps/openmw/mwworld/actionequip.cpp @@ -32,15 +32,15 @@ namespace MWWorld case 0: return; case 2: - invStore.equip(MWWorld::InventoryStore::Slot_CarriedLeft, invStore.end()); + invStore.unequipSlot(MWWorld::InventoryStore::Slot_CarriedLeft, actor); break; case 3: - invStore.equip(MWWorld::InventoryStore::Slot_CarriedRight, invStore.end()); + invStore.unequipSlot(MWWorld::InventoryStore::Slot_CarriedRight, actor); break; } // slots that this item can be equipped in - std::pair, bool> slots = MWWorld::Class::get(getTarget()).getEquipmentSlots(getTarget()); + std::pair, bool> slots_ = MWWorld::Class::get(getTarget()).getEquipmentSlots(getTarget()); // retrieve ContainerStoreIterator to the item MWWorld::ContainerStoreIterator it = invStore.begin(); @@ -57,14 +57,17 @@ namespace MWWorld bool equipped = false; // equip the item in the first free slot - for (std::vector::const_iterator slot=slots.first.begin(); - slot!=slots.first.end(); ++slot) + for (std::vector::const_iterator slot=slots_.first.begin(); + slot!=slots_.first.end(); ++slot) { + // if the item is equipped already, nothing to do + if (invStore.getSlot(*slot) == it) + return; // if all slots are occupied, replace the last slot - if (slot == --slots.first.end()) + if (slot == --slots_.first.end()) { - invStore.equip(*slot, it); + invStore.equip(*slot, it, actor); equipped = true; break; } @@ -72,7 +75,7 @@ namespace MWWorld if (invStore.getSlot(*slot) == invStore.end()) { // slot is not occupied - invStore.equip(*slot, it); + invStore.equip(*slot, it, actor); equipped = true; break; } diff --git a/apps/openmw/mwworld/actiontrap.cpp b/apps/openmw/mwworld/actiontrap.cpp new file mode 100644 index 000000000..d723b9823 --- /dev/null +++ b/apps/openmw/mwworld/actiontrap.cpp @@ -0,0 +1,16 @@ +#include "actiontrap.hpp" + +#include "../mwmechanics/spellcasting.hpp" + +namespace MWWorld +{ + + void ActionTrap::executeImp(const Ptr &actor) + { + MWMechanics::CastSpell cast(mTrapSource, actor); + cast.cast(mSpellId); + + mTrapSource.getCellRef().mTrap = ""; + } + +} diff --git a/apps/openmw/mwworld/actiontrap.hpp b/apps/openmw/mwworld/actiontrap.hpp new file mode 100644 index 000000000..4c2f4139f --- /dev/null +++ b/apps/openmw/mwworld/actiontrap.hpp @@ -0,0 +1,29 @@ +#ifndef GAME_MWWORLD_ACTIONTRAP_H +#define GAME_MWWORLD_ACTIONTRAP_H + +#include + +#include "action.hpp" +#include "ptr.hpp" + +namespace MWWorld +{ + class ActionTrap : public Action + { + std::string mSpellId; + MWWorld::Ptr mTrapSource; + + virtual void executeImp (const Ptr& actor); + + public: + + /// @param spellId + /// @param actor Actor that activated the trap + /// @param trapSource + ActionTrap (const Ptr& actor, const std::string& spellId, const Ptr& trapSource) + : Action(false, actor), mSpellId(spellId), mTrapSource(trapSource) {} + }; +} + + +#endif diff --git a/apps/openmw/mwworld/cellstore.hpp b/apps/openmw/mwworld/cellstore.hpp index bcbc5e415..8a01caf18 100644 --- a/apps/openmw/mwworld/cellstore.hpp +++ b/apps/openmw/mwworld/cellstore.hpp @@ -140,9 +140,12 @@ namespace MWWorld { for (typename List::List::iterator iter (list.mList.begin()); iter!=list.mList.end(); ++iter) + { + if (!iter->mData.getCount()) + continue; if (!functor (iter->mRef, iter->mData)) return false; - + } return true; } diff --git a/apps/openmw/mwworld/class.cpp b/apps/openmw/mwworld/class.cpp index d3d1aff49..ffe81a4ac 100644 --- a/apps/openmw/mwworld/class.cpp +++ b/apps/openmw/mwworld/class.cpp @@ -139,7 +139,7 @@ namespace MWWorld float Class::getRemainingUsageTime (const Ptr& ptr) const { - throw std::runtime_error ("class does not support time-based uses"); + return -1; } std::string Class::getScript (const Ptr& ptr) const diff --git a/apps/openmw/mwworld/class.hpp b/apps/openmw/mwworld/class.hpp index 2db293e68..cb6690a46 100644 --- a/apps/openmw/mwworld/class.hpp +++ b/apps/openmw/mwworld/class.hpp @@ -162,7 +162,7 @@ namespace MWWorld virtual float getRemainingUsageTime (const Ptr& ptr) const; ///< Returns the remaining duration of the object, such as an equippable light - /// source. (default implementation: throw an exception) + /// source. (default implementation: -1, i.e. infinite) virtual std::string getScript (const Ptr& ptr) const; ///< Return name of the script attached to ptr (default implementation: return an empty diff --git a/apps/openmw/mwworld/containerstore.cpp b/apps/openmw/mwworld/containerstore.cpp index c6768f5fd..3797e6922 100644 --- a/apps/openmw/mwworld/containerstore.cpp +++ b/apps/openmw/mwworld/containerstore.cpp @@ -63,7 +63,7 @@ namespace } } -MWWorld::ContainerStore::ContainerStore() : mStateId (0), mCachedWeight (0), mWeightUpToDate (false) {} +MWWorld::ContainerStore::ContainerStore() : mCachedWeight (0), mWeightUpToDate (false) {} MWWorld::ContainerStore::~ContainerStore() {} @@ -77,22 +77,53 @@ MWWorld::ContainerStoreIterator MWWorld::ContainerStore::end() return ContainerStoreIterator (this); } +void MWWorld::ContainerStore::unstack(const Ptr &ptr, const Ptr& container) +{ + if (ptr.getRefData().getCount() <= 1) + return; + addNewStack(ptr)->getRefData().setCount(ptr.getRefData().getCount()-1); + remove(ptr, ptr.getRefData().getCount()-1, container); +} + bool MWWorld::ContainerStore::stacks(const Ptr& ptr1, const Ptr& ptr2) { - /// \todo add current enchantment charge here when it is implemented - if ( Misc::StringUtils::ciEqual(ptr1.getCellRef().mRefID, ptr2.getCellRef().mRefID) - && MWWorld::Class::get(ptr1).getScript(ptr1) == "" // item with a script never stacks - && MWWorld::Class::get(ptr1).getEnchantment(ptr1) == "" // item with enchantment never stacks (we could revisit this later, but for now it makes selecting items in the spell window much easier) + const MWWorld::Class& cls1 = MWWorld::Class::get(ptr1); + const MWWorld::Class& cls2 = MWWorld::Class::get(ptr2); + + if (!Misc::StringUtils::ciEqual(ptr1.getCellRef().mRefID, ptr2.getCellRef().mRefID)) + return false; + + // If it has an enchantment, don't stack when some of the charge is already used + if (!ptr1.getClass().getEnchantment(ptr1).empty()) + { + const ESM::Enchantment* enchantment = MWBase::Environment::get().getWorld()->getStore().get().find( + ptr1.getClass().getEnchantment(ptr1)); + float maxCharge = enchantment->mData.mCharge; + float enchantCharge1 = ptr1.getCellRef().mEnchantmentCharge == -1 ? maxCharge : ptr1.getCellRef().mEnchantmentCharge; + float enchantCharge2 = ptr2.getCellRef().mEnchantmentCharge == -1 ? maxCharge : ptr2.getCellRef().mEnchantmentCharge; + if (enchantCharge1 != maxCharge || enchantCharge2 != maxCharge) + return false; + } + + return ptr1 != ptr2 // an item never stacks onto itself && ptr1.getCellRef().mOwner == ptr2.getCellRef().mOwner && ptr1.getCellRef().mSoul == ptr2.getCellRef().mSoul - // item that is already partly used up never stacks - && (!MWWorld::Class::get(ptr1).hasItemHealth(ptr1) || ptr1.getCellRef().mCharge == -1 - || MWWorld::Class::get(ptr1).getItemMaxHealth(ptr1) == ptr1.getCellRef().mCharge) - && (!MWWorld::Class::get(ptr2).hasItemHealth(ptr2) || ptr2.getCellRef().mCharge == -1 - || MWWorld::Class::get(ptr2).getItemMaxHealth(ptr2) == ptr2.getCellRef().mCharge)) - return true; - return false; + && ptr1.getClass().getRemainingUsageTime(ptr1) == ptr2.getClass().getRemainingUsageTime(ptr2) + + && cls1.getScript(ptr1) == cls2.getScript(ptr2) + + // item that is already partly used up never stacks + && (!cls1.hasItemHealth(ptr1) || ptr1.getCellRef().mCharge == -1 + || cls1.getItemMaxHealth(ptr1) == ptr1.getCellRef().mCharge) + && (!cls2.hasItemHealth(ptr2) || ptr2.getCellRef().mCharge == -1 + || cls2.getItemMaxHealth(ptr2) == ptr2.getCellRef().mCharge); +} + +MWWorld::ContainerStoreIterator MWWorld::ContainerStore::add(const std::string &id, int count, const Ptr &actorPtr) +{ + MWWorld::ManualRef ref(MWBase::Environment::get().getWorld()->getStore(), id, count); + return add(ref.getPtr(), actorPtr); } MWWorld::ContainerStoreIterator MWWorld::ContainerStore::add (const Ptr& itemPtr, const Ptr& actorPtr) @@ -140,22 +171,20 @@ MWWorld::ContainerStoreIterator MWWorld::ContainerStore::addImp (const Ptr& ptr) || Misc::StringUtils::ciEqual(ptr.getCellRef().mRefID, "gold_025") || Misc::StringUtils::ciEqual(ptr.getCellRef().mRefID, "gold_100")) { - MWWorld::ManualRef ref(esmStore, "Gold_001"); - int count = MWWorld::Class::get(ptr).getValue(ptr) * ptr.getRefData().getCount(); - ref.getPtr().getRefData().setCount(count); for (MWWorld::ContainerStoreIterator iter (begin(type)); iter!=end(); ++iter) { if (Misc::StringUtils::ciEqual((*iter).get()->mRef.mRefID, "gold_001")) { - (*iter).getRefData().setCount( (*iter).getRefData().getCount() + count); + iter->getRefData().setCount(iter->getRefData().getCount() + count); flagAsModified(); return iter; } } - return addImpl(ref.getPtr()); + MWWorld::ManualRef ref(esmStore, "Gold_001", count); + return addNewStack(ref.getPtr()); } // determine whether to stack or not @@ -171,10 +200,10 @@ MWWorld::ContainerStoreIterator MWWorld::ContainerStore::addImp (const Ptr& ptr) } } // if we got here, this means no stacking - return addImpl(ptr); + return addNewStack(ptr); } -MWWorld::ContainerStoreIterator MWWorld::ContainerStore::addImpl (const Ptr& ptr) +MWWorld::ContainerStoreIterator MWWorld::ContainerStore::addNewStack (const Ptr& ptr) { ContainerStoreIterator it = begin(); @@ -198,6 +227,44 @@ MWWorld::ContainerStoreIterator MWWorld::ContainerStore::addImpl (const Ptr& ptr return it; } +int MWWorld::ContainerStore::remove(const std::string& itemId, int count, const Ptr& actor) +{ + int toRemove = count; + + for (ContainerStoreIterator iter(begin()); iter != end() && toRemove > 0; ++iter) + if (Misc::StringUtils::ciEqual(iter->getCellRef().mRefID, itemId)) + toRemove -= remove(*iter, toRemove, actor); + + flagAsModified(); + + // number of removed items + return count - toRemove; +} + +int MWWorld::ContainerStore::remove(const Ptr& item, int count, const Ptr& actor) +{ + assert(this == item.getContainerStore()); + + int toRemove = count; + RefData& itemRef = item.getRefData(); + + if (itemRef.getCount() <= toRemove) + { + toRemove -= itemRef.getCount(); + itemRef.setCount(0); + } + else + { + itemRef.setCount(itemRef.getCount() - toRemove); + toRemove = 0; + } + + flagAsModified(); + + // number of removed items + return count - toRemove; +} + void MWWorld::ContainerStore::fill (const ESM::InventoryList& items, const std::string& owner, const MWWorld::ESMStore& store) { for (std::vector::const_iterator iter (items.mList.begin()); iter!=items.mList.end(); @@ -216,7 +283,7 @@ void MWWorld::ContainerStore::addInitialItem (const std::string& id, const std:: try { - ManualRef ref (MWBase::Environment::get().getWorld()->getStore(), id); + ManualRef ref (MWBase::Environment::get().getWorld()->getStore(), id, count); if (ref.getPtr().getTypeName()==typeid (ESM::ItemLevList).name()) { @@ -266,7 +333,6 @@ void MWWorld::ContainerStore::addInitialItem (const std::string& id, const std:: } else { - ref.getPtr().getRefData().setCount (count); ref.getPtr().getCellRef().mOwner = owner; addImp (ref.getPtr()); } @@ -289,15 +355,9 @@ void MWWorld::ContainerStore::clear() void MWWorld::ContainerStore::flagAsModified() { - ++mStateId; mWeightUpToDate = false; } -int MWWorld::ContainerStore::getStateId() const -{ - return mStateId; -} - float MWWorld::ContainerStore::getWeight() const { if (!mWeightUpToDate) diff --git a/apps/openmw/mwworld/containerstore.hpp b/apps/openmw/mwworld/containerstore.hpp index 9a11f1603..df7168dfa 100644 --- a/apps/openmw/mwworld/containerstore.hpp +++ b/apps/openmw/mwworld/containerstore.hpp @@ -49,7 +49,6 @@ namespace MWWorld MWWorld::CellRefList probes; MWWorld::CellRefList repairs; MWWorld::CellRefList weapons; - int mStateId; mutable float mCachedWeight; mutable bool mWeightUpToDate; ContainerStoreIterator addImp (const Ptr& ptr); @@ -75,9 +74,25 @@ namespace MWWorld /// /// @return if stacking happened, return iterator to the item that was stacked against, otherwise iterator to the newly inserted item. + ContainerStoreIterator add(const std::string& id, int count, const Ptr& actorPtr); + ///< Utility to construct a ManualRef and call add(ptr, actorPtr) + + int remove(const std::string& itemId, int count, const Ptr& actor); + ///< Remove \a count item(s) designated by \a itemId from this container. + /// + /// @return the number of items actually removed + + virtual int remove(const Ptr& item, int count, const Ptr& actor); + ///< Remove \a count item(s) designated by \a item from this inventory. + /// + /// @return the number of items actually removed + + void unstack (const Ptr& ptr, const Ptr& container); + ///< Unstack an item in this container. The item's count will be set to 1, then a new stack will be added with (origCount-1). + protected: - ContainerStoreIterator addImpl (const Ptr& ptr); - ///< Add the item to this container (no stacking) + ContainerStoreIterator addNewStack (const Ptr& ptr); + ///< Add the item to this container (do not try to stack it onto existing items) public: @@ -94,11 +109,6 @@ namespace MWWorld ///< \attention This function is internal to the world model and should not be called from /// outside. - int getStateId() const; - ///< This ID is changed every time the container is modified or items in the container - /// are accessed in a way that may be used to modify the item. - /// \note This method of change-tracking will ocasionally yield false positives. - float getWeight() const; ///< Return total weight of the items contained in *this. diff --git a/apps/openmw/mwworld/contentloader.hpp b/apps/openmw/mwworld/contentloader.hpp new file mode 100644 index 000000000..46bd7d3f9 --- /dev/null +++ b/apps/openmw/mwworld/contentloader.hpp @@ -0,0 +1,36 @@ +#ifndef CONTENTLOADER_HPP +#define CONTENTLOADER_HPP + +#include +#include +#include + +#include "components/loadinglistener/loadinglistener.hpp" + +namespace MWWorld +{ + +struct ContentLoader +{ + ContentLoader(Loading::Listener& listener) + : mListener(listener) + { + } + + virtual ~ContentLoader() + { + } + + virtual void load(const boost::filesystem::path& filepath, int& index) + { + std::cout << "Loading content file " << filepath.string() << std::endl; + mListener.setLabel(filepath.string()); + } + + protected: + Loading::Listener& mListener; +}; + +} /* namespace MWWorld */ + +#endif /* CONTENTLOADER_HPP */ diff --git a/apps/openmw/mwworld/esmloader.cpp b/apps/openmw/mwworld/esmloader.cpp new file mode 100644 index 000000000..1b8880d37 --- /dev/null +++ b/apps/openmw/mwworld/esmloader.cpp @@ -0,0 +1,31 @@ +#include "esmloader.hpp" +#include "esmstore.hpp" + +#include "components/to_utf8/to_utf8.hpp" + +namespace MWWorld +{ + +EsmLoader::EsmLoader(MWWorld::ESMStore& store, std::vector& readers, + ToUTF8::Utf8Encoder* encoder, Loading::Listener& listener) + : ContentLoader(listener) + , mStore(store) + , mEsm(readers) + , mEncoder(encoder) +{ +} + +void EsmLoader::load(const boost::filesystem::path& filepath, int& index) +{ + ContentLoader::load(filepath.filename(), index); + + ESM::ESMReader lEsm; + lEsm.setEncoder(mEncoder); + lEsm.setIndex(index); + lEsm.setGlobalReaderList(&mEsm); + lEsm.open(filepath.string()); + mEsm[index] = lEsm; + mStore.load(mEsm[index], &mListener); +} + +} /* namespace MWWorld */ diff --git a/apps/openmw/mwworld/esmloader.hpp b/apps/openmw/mwworld/esmloader.hpp new file mode 100644 index 000000000..d799c3f15 --- /dev/null +++ b/apps/openmw/mwworld/esmloader.hpp @@ -0,0 +1,34 @@ +#ifndef ESMLOADER_HPP +#define ESMLOADER_HPP + +#include + +#include "contentloader.hpp" +#include "components/esm/esmreader.hpp" + +namespace ToUTF8 +{ + class Utf8Encoder; +} + +namespace MWWorld +{ + +class ESMStore; + +struct EsmLoader : public ContentLoader +{ + EsmLoader(MWWorld::ESMStore& store, std::vector& readers, + ToUTF8::Utf8Encoder* encoder, Loading::Listener& listener); + + void load(const boost::filesystem::path& filepath, int& index); + + private: + std::vector& mEsm; + MWWorld::ESMStore& mStore; + ToUTF8::Utf8Encoder* mEncoder; +}; + +} /* namespace MWWorld */ + +#endif // ESMLOADER_HPP diff --git a/apps/openmw/mwworld/esmstore.cpp b/apps/openmw/mwworld/esmstore.cpp index 7703f2d23..f1bff11a2 100644 --- a/apps/openmw/mwworld/esmstore.cpp +++ b/apps/openmw/mwworld/esmstore.cpp @@ -36,7 +36,7 @@ void ESMStore::load(ESM::ESMReader &esm, Loading::Listener* listener) // all files/readers used by the engine. This will greaty accelerate // refnumber mangling, as required for handling moved references. int index = ~0; - const std::vector &masters = esm.getMasters(); + const std::vector &masters = esm.getGameFiles(); std::vector *allPlugins = esm.getGlobalReaderList(); for (size_t j = 0; j < masters.size(); j++) { ESM::Header::MasterData &mast = const_cast(masters[j]); @@ -70,8 +70,10 @@ void ESMStore::load(ESM::ESMReader &esm, Loading::Listener* listener) if (it == mStores.end()) { if (n.val == ESM::REC_INFO) { + std::string id = esm.getHNOString("INAM"); if (dialogue) { dialogue->mInfo.push_back(ESM::DialInfo()); + dialogue->mInfo.back().mId = id; dialogue->mInfo.back().load(esm); } else { std::cerr << "error: info record without dialog" << std::endl; @@ -100,11 +102,7 @@ void ESMStore::load(ESM::ESMReader &esm, Loading::Listener* listener) it->second->load(esm, id); if (n.val==ESM::REC_DIAL) { - // dirty hack, but it is better than non-const search() - // or friends - //dialogue = &mDialogs.mStatic.back(); dialogue = const_cast(mDialogs.find(id)); - assert (dialogue->mId == id); } else { dialogue = 0; } diff --git a/apps/openmw/mwworld/inventorystore.cpp b/apps/openmw/mwworld/inventorystore.cpp index 98cb6d347..57e35adce 100644 --- a/apps/openmw/mwworld/inventorystore.cpp +++ b/apps/openmw/mwworld/inventorystore.cpp @@ -8,8 +8,12 @@ #include "../mwbase/environment.hpp" #include "../mwbase/world.hpp" +#include "../mwbase/windowmanager.hpp" +#include "../mwbase/mechanicsmanager.hpp" #include "../mwmechanics/npcstats.hpp" +#include "../mwmechanics/spellcasting.hpp" + #include "esmstore.hpp" #include "class.hpp" @@ -32,14 +36,17 @@ void MWWorld::InventoryStore::copySlots (const InventoryStore& store) } } -void MWWorld::InventoryStore::initSlots (TSlots& slots) +void MWWorld::InventoryStore::initSlots (TSlots& slots_) { for (int i=0; i=static_cast (mSlots.size())) throw std::runtime_error ("slot number out of range"); if (iterator.getContainerStore()!=this) throw std::runtime_error ("attempt to equip an item that is not in the inventory"); - std::pair, bool> slots; - if (iterator!=end()) - { - slots = Class::get (*iterator).getEquipmentSlots (*iterator); + std::pair, bool> slots_; - if (std::find (slots.first.begin(), slots.first.end(), slot)==slots.first.end()) - throw std::runtime_error ("invalid slot"); - } + slots_ = Class::get (*iterator).getEquipmentSlots (*iterator); + + if (std::find (slots_.first.begin(), slots_.first.end(), slot)==slots_.first.end()) + throw std::runtime_error ("invalid slot"); - // restack item previously in this slot (if required) if (mSlots[slot] != end()) - { - for (MWWorld::ContainerStoreIterator iter (begin()); iter!=end(); ++iter) - { - if (stacks(*iter, *mSlots[slot])) - { - iter->getRefData().setCount( iter->getRefData().getCount() + mSlots[slot]->getRefData().getCount() ); - mSlots[slot]->getRefData().setCount(0); - break; - } - } - } + unequipSlot(slot, actor); // unstack item pointed to by iterator if required - if (iterator!=end() && !slots.second && iterator->getRefData().getCount() > 1) // if slots.second is true, item can stay stacked when equipped + if (iterator!=end() && !slots_.second && iterator->getRefData().getCount() > 1) // if slots.second is true, item can stay stacked when equipped { // add the item again with a count of count-1, then set the count of the original (that will be equipped) to 1 int count = iterator->getRefData().getCount(); iterator->getRefData().setCount(count-1); - addImpl(*iterator); + addNewStack(*iterator); iterator->getRefData().setCount(1); } mSlots[slot] = iterator; flagAsModified(); + + fireEquipmentChangedEvent(); + updateMagicEffects(actor); + + // Update HUD icon for player weapon + if (slot == MWWorld::InventoryStore::Slot_CarriedRight) + MWBase::Environment::get().getWindowManager()->setSelectedWeapon(*getSlot(slot)); } void MWWorld::InventoryStore::unequipAll(const MWWorld::Ptr& actor) { for (int slot=0; slot < MWWorld::InventoryStore::Slots; ++slot) - { - MWWorld::ContainerStoreIterator it = getSlot(slot); - if (it != end()) - { - equip(slot, end()); - std::string script = MWWorld::Class::get(*it).getScript(*it); - - // Unset OnPCEquip Variable on item's script, if it has a script with that variable declared - if((actor.getRefData().getHandle() == "player") && (script != "")) - (*it).getRefData().getLocals().setVarByInt(script, "onpcequip", 0); - } - } + unequipSlot(slot, actor); } MWWorld::ContainerStoreIterator MWWorld::InventoryStore::getSlot (int slot) @@ -153,21 +153,24 @@ MWWorld::ContainerStoreIterator MWWorld::InventoryStore::getSlot (int slot) if (mSlots[slot]->getRefData().getCount()<1) { - // object has been deleted - mSlots[slot] = end(); - return end(); + // Object has been deleted + // This should no longer happen, since the new remove function will unequip first + throw std::runtime_error("Invalid slot, make sure you are not calling RefData::setCount for a container object"); } return mSlots[slot]; } -void MWWorld::InventoryStore::autoEquip (const MWWorld::Ptr& npc) +void MWWorld::InventoryStore::autoEquip (const MWWorld::Ptr& actor) { - const MWMechanics::NpcStats& stats = MWWorld::Class::get(npc).getNpcStats(npc); - MWWorld::InventoryStore& invStore = MWWorld::Class::get(npc).getInventoryStore(npc); + const MWMechanics::NpcStats& stats = MWWorld::Class::get(actor).getNpcStats(actor); + MWWorld::InventoryStore& invStore = MWWorld::Class::get(actor).getInventoryStore(actor); - TSlots slots; - initSlots (slots); + TSlots slots_; + initSlots (slots_); + + // Disable model update during auto-equip + mUpdatesEnabled = false; for (ContainerStoreIterator iter (begin()); iter!=end(); ++iter) { @@ -182,11 +185,11 @@ void MWWorld::InventoryStore::autoEquip (const MWWorld::Ptr& npc) { bool use = false; - if (slots.at (*iter2)==end()) + if (slots_.at (*iter2)==end()) use = true; // slot was empty before -> skip all further checks else { - Ptr old = *slots.at (*iter2); + Ptr old = *slots_.at (*iter2); if (!use) { @@ -219,15 +222,15 @@ void MWWorld::InventoryStore::autoEquip (const MWWorld::Ptr& npc) } } - switch(MWWorld::Class::get (test).canBeEquipped (test, npc).first) + switch(MWWorld::Class::get (test).canBeEquipped (test, actor).first) { case 0: continue; case 2: - invStore.equip(MWWorld::InventoryStore::Slot_CarriedLeft, invStore.end()); + invStore.unequipSlot(MWWorld::InventoryStore::Slot_CarriedLeft, actor); break; case 3: - invStore.equip(MWWorld::InventoryStore::Slot_CarriedRight, invStore.end()); + invStore.unequipSlot(MWWorld::InventoryStore::Slot_CarriedRight, actor); break; } @@ -239,62 +242,159 @@ void MWWorld::InventoryStore::autoEquip (const MWWorld::Ptr& npc) // add the item again with a count of count-1, then set the count of the original (that will be equipped) to 1 int count = iter->getRefData().getCount(); iter->getRefData().setCount(count-1); - addImpl(*iter); + addNewStack(*iter); iter->getRefData().setCount(1); } } - slots[*iter2] = iter; + slots_[*iter2] = iter; break; } } bool changed = false; - for (std::size_t i=0; igetStore().get().find (enchantmentId); + + if (enchantment.mData.mType != ESM::Enchantment::ConstantEffect) + continue; + + std::vector params; + + bool existed = (mPermanentMagicEffectMagnitudes.find((**iter).getCellRef().mRefID) != mPermanentMagicEffectMagnitudes.end()); + if (!existed) { - std::string enchantmentId = MWWorld::Class::get (**iter).getEnchantment (**iter); + // Roll some dice, one for each effect + params.resize(enchantment.mEffects.mList.size()); + for (unsigned int i=0; i (std::rand()) / RAND_MAX; - if (!enchantmentId.empty()) + // Try resisting each effect + int i=0; + for (std::vector::const_iterator effectIt (enchantment.mEffects.mList.begin()); + effectIt!=enchantment.mEffects.mList.end(); ++effectIt) { - const ESM::Enchantment& enchantment = - *MWBase::Environment::get().getWorld()->getStore().get().find (enchantmentId); - - if (enchantment.mData.mType==ESM::Enchantment::ConstantEffect) - mMagicEffects.add (enchantment.mEffects); + params[i].mMultiplier = MWMechanics::getEffectMultiplier(effectIt->mEffectID, actor, actor); + ++i; } - } - mMagicEffectsUpToDate = true; + // Note that using the RefID as a key here is not entirely correct. + // Consider equipping the same item twice (e.g. a ring) + // However, permanent enchantments with a random magnitude are kind of an exploit anyway, + // so it doesn't really matter if both items will get the same magnitude. *Extreme* edge case. + mPermanentMagicEffectMagnitudes[(**iter).getCellRef().mRefID] = params; + } + else + params = mPermanentMagicEffectMagnitudes[(**iter).getCellRef().mRefID]; + + int i=0; + for (std::vector::const_iterator effectIt (enchantment.mEffects.mList.begin()); + effectIt!=enchantment.mEffects.mList.end(); ++effectIt, ++i) + { + const ESM::MagicEffect *magicEffect = + MWBase::Environment::get().getWorld()->getStore().get().find ( + effectIt->mEffectID); + + // Fully resisted? + if (params[i].mMultiplier == 0) + continue; + + float magnitude = effectIt->mMagnMin + (effectIt->mMagnMax - effectIt->mMagnMin) * params[i].mRandom; + magnitude *= params[i].mMultiplier; + + if (!existed) + { + // During first auto equip, we don't play any sounds. + // Basically we don't want sounds when the actor is first loaded, + // the items should appear as if they'd always been equipped. + mListener->permanentEffectAdded(magicEffect, !mFirstAutoEquip, + !mFirstAutoEquip && effectIt == enchantment.mEffects.mList.begin()); + + // Apply instant effects + MWMechanics::CastSpell cast(actor, actor); + if (magnitude) + cast.applyInstantEffect(actor, effectIt->mEffectID, magnitude); + } + + if (magnitude) + mMagicEffects.add (*effectIt, magnitude); + } + } } - return mMagicEffects; + // Now drop expired effects + for (TEffectMagnitudes::iterator it = mPermanentMagicEffectMagnitudes.begin(); + it != mPermanentMagicEffectMagnitudes.end();) + { + bool found = false; + for (TSlots::const_iterator iter (mSlots.begin()); iter!=mSlots.end(); ++iter) + { + if (*iter == end()) + continue; + if ((**iter).getCellRef().mRefID == it->first) + { + found = true; + } + } + if (!found) + mPermanentMagicEffectMagnitudes.erase(it++); + else + ++it; + } + + // Magic effects are normally not updated when paused, but we need this to make resistances work immediately after equipping + MWBase::Environment::get().getMechanicsManager()->updateMagicEffects(actor); + + mFirstAutoEquip = false; } void MWWorld::InventoryStore::flagAsModified() { ContainerStore::flagAsModified(); - mMagicEffectsUpToDate = false; } bool MWWorld::InventoryStore::stacks(const Ptr& ptr1, const Ptr& ptr2) @@ -303,14 +403,16 @@ bool MWWorld::InventoryStore::stacks(const Ptr& ptr1, const Ptr& ptr2) if (!canStack) return false; - // don't stack if the item being checked against is currently equipped. + // don't stack if either item is currently equipped for (TSlots::const_iterator iter (mSlots.begin()); iter!=mSlots.end(); ++iter) { - if (*iter != end() && ptr1 == **iter) - return false; - if (*iter != end() && ptr2 == **iter) - return false; + if (*iter != end() && (ptr1 == **iter || ptr2 == **iter)) + { + bool stackWhenEquipped = MWWorld::Class::get(**iter).getEquipmentSlots(**iter).second; + if (!stackWhenEquipped) + return false; + } } return true; @@ -325,3 +427,196 @@ MWWorld::ContainerStoreIterator MWWorld::InventoryStore::getSelectedEnchantItem( { return mSelectedEnchantItem; } + +int MWWorld::InventoryStore::remove(const Ptr& item, int count, const Ptr& actor) +{ + for (int slot=0; slot < MWWorld::InventoryStore::Slots; ++slot) + { + if (mSlots[slot] == end()) + continue; + + if (*mSlots[slot] == item) + { + // restacking is disabled cause it may break removal + unequipSlot(slot, actor, false); + break; + } + } + + int retCount = ContainerStore::remove(item, count, actor); + + // If an armor/clothing item is removed, try to find a replacement, + // but not for the player nor werewolves. + if ((actor.getRefData().getHandle() != "player") + && !(MWWorld::Class::get(actor).getNpcStats(actor).isWerewolf())) + { + std::string type = item.getTypeName(); + if (((type == typeid(ESM::Armor).name()) || (type == typeid(ESM::Clothing).name())) + && !actor.getClass().getCreatureStats(actor).isDead()) + autoEquip(actor); + } + + if (item.getRefData().getCount() == 0 && mSelectedEnchantItem != end() + && *mSelectedEnchantItem == item && actor.getRefData().getHandle() == "player") + { + mSelectedEnchantItem = end(); + MWBase::Environment::get().getWindowManager()->unsetSelectedSpell(); + } + + updateRechargingItems(); + + return retCount; +} + +MWWorld::ContainerStoreIterator MWWorld::InventoryStore::unequipSlot(int slot, const MWWorld::Ptr& actor, bool restack) +{ + ContainerStoreIterator it = getSlot(slot); + + if (it != end()) + { + ContainerStoreIterator retval = it; + + // empty this slot + mSlots[slot] = end(); + + if (restack) { + // restack item previously in this slot + for (MWWorld::ContainerStoreIterator iter (begin()); iter != end(); ++iter) + { + if (stacks(*iter, *it)) + { + iter->getRefData().setCount(iter->getRefData().getCount() + it->getRefData().getCount()); + it->getRefData().setCount(0); + retval = iter; + break; + } + } + } + + if (actor.getRefData().getHandle() == "player") + { + // Unset OnPCEquip Variable on item's script, if it has a script with that variable declared + const std::string& script = Class::get(*it).getScript(*it); + if (script != "") + (*it).getRefData().getLocals().setVarByInt(script, "onpcequip", 0); + + // Update HUD icon when removing player weapon or selected enchanted item. + // We have to check for both as the weapon could also be the enchanted item. + if (slot == MWWorld::InventoryStore::Slot_CarriedRight) + { + // weapon + MWBase::Environment::get().getWindowManager()->unsetSelectedWeapon(); + } + if ((mSelectedEnchantItem != end()) && (mSelectedEnchantItem == it)) + { + // enchanted item + mSelectedEnchantItem = end(); + MWBase::Environment::get().getWindowManager()->unsetSelectedSpell(); + } + } + + fireEquipmentChangedEvent(); + updateMagicEffects(actor); + + return retval; + } + + return it; +} + +MWWorld::ContainerStoreIterator MWWorld::InventoryStore::unequipItem(const MWWorld::Ptr& item, const MWWorld::Ptr& actor) +{ + for (int slot=0; slotequipmentChanged(); +} + +void MWWorld::InventoryStore::visitEffectSources(MWMechanics::EffectSourceVisitor &visitor) +{ + for (TSlots::const_iterator iter (mSlots.begin()); iter!=mSlots.end(); ++iter) + { + if (*iter==end()) + continue; + + std::string enchantmentId = MWWorld::Class::get (**iter).getEnchantment (**iter); + if (enchantmentId.empty()) + continue; + + const ESM::Enchantment& enchantment = + *MWBase::Environment::get().getWorld()->getStore().get().find (enchantmentId); + + if (enchantment.mData.mType != ESM::Enchantment::ConstantEffect) + continue; + + if (mPermanentMagicEffectMagnitudes.find((**iter).getCellRef().mRefID) == mPermanentMagicEffectMagnitudes.end()) + continue; + + int i=0; + for (std::vector::const_iterator effectIt (enchantment.mEffects.mList.begin()); + effectIt!=enchantment.mEffects.mList.end(); ++effectIt) + { + const EffectParams& params = mPermanentMagicEffectMagnitudes[(**iter).getCellRef().mRefID][i]; + float magnitude = effectIt->mMagnMin + (effectIt->mMagnMax - effectIt->mMagnMin) * params.mRandom; + magnitude *= params.mMultiplier; + visitor.visit(MWMechanics::EffectKey(*effectIt), (**iter).getClass().getName(**iter), magnitude); + + ++i; + } + } +} + +void MWWorld::InventoryStore::updateRechargingItems() +{ + mRechargingItems.clear(); + for (ContainerStoreIterator it = begin(); it != end(); ++it) + { + if (it->getClass().getEnchantment(*it) != "") + { + const ESM::Enchantment* enchantment = MWBase::Environment::get().getWorld()->getStore().get().find( + it->getClass().getEnchantment(*it)); + if (enchantment->mData.mType == ESM::Enchantment::WhenUsed + || enchantment->mData.mType == ESM::Enchantment::WhenStrikes) + mRechargingItems.push_back(std::make_pair(it, enchantment->mData.mCharge)); + } + } +} + +void MWWorld::InventoryStore::rechargeItems(float duration) +{ + for (TRechargingItems::iterator it = mRechargingItems.begin(); it != mRechargingItems.end(); ++it) + { + if (it->first->getCellRef().mEnchantmentCharge == -1 + || it->first->getCellRef().mEnchantmentCharge == it->second) + continue; + + static float fMagicItemRechargePerSecond = MWBase::Environment::get().getWorld()->getStore().get().find( + "fMagicItemRechargePerSecond")->getFloat(); + + it->first->getCellRef().mEnchantmentCharge = std::min (it->first->getCellRef().mEnchantmentCharge + fMagicItemRechargePerSecond * duration, + it->second); + } +} + +void MWWorld::InventoryStore::purgeEffect(short effectId) +{ + mMagicEffects.add(MWMechanics::EffectKey(effectId), -mMagicEffects.get(MWMechanics::EffectKey(effectId)).mMagnitude); +} diff --git a/apps/openmw/mwworld/inventorystore.hpp b/apps/openmw/mwworld/inventorystore.hpp index f0cba0f9f..e764f64fb 100644 --- a/apps/openmw/mwworld/inventorystore.hpp +++ b/apps/openmw/mwworld/inventorystore.hpp @@ -12,6 +12,25 @@ namespace MWMechanics namespace MWWorld { + class InventoryStoreListener + { + public: + /** + * Fired when items are equipped or unequipped + */ + virtual void equipmentChanged () {} + + /** + * @param effect + * @param isNew Is this effect new (e.g. the item for it was just now manually equipped) + * or was it loaded from a savegame / initial game state? \n + * If it isn't new, non-looping VFX should not be played. + * @param playSound Play effect sound? + */ + virtual void permanentEffectAdded (const ESM::MagicEffect *magicEffect, bool isNew, bool playSound) {} + + }; + ///< \brief Variant of the ContainerStore for NPCs class InventoryStore : public ContainerStore { @@ -43,19 +62,48 @@ namespace MWWorld private: - mutable MWMechanics::MagicEffects mMagicEffects; - mutable bool mMagicEffectsUpToDate; + MWMechanics::MagicEffects mMagicEffects; + + InventoryStoreListener* mListener; + + // Enables updates of magic effects and actor model whenever items are equipped or unequipped. + // This is disabled during autoequip to avoid excessive updates + bool mUpdatesEnabled; + + bool mFirstAutoEquip; + + // Vanilla allows permanent effects with a random magnitude, so it needs to be stored here. + // We also need this to only play sounds and particle effects when the item is equipped, rather than on every update. + struct EffectParams + { + // Modifier to scale between min and max magnitude + float mRandom; + // Multiplier for when an effect was fully or partially resisted + float mMultiplier; + }; + + typedef std::map > TEffectMagnitudes; + TEffectMagnitudes mPermanentMagicEffectMagnitudes; typedef std::vector TSlots; - mutable TSlots mSlots; + TSlots mSlots; // selected magic item (for using enchantments of type "Cast once" or "Cast when used") ContainerStoreIterator mSelectedEnchantItem; + // (item, max charge) + typedef std::vector > TRechargingItems; + TRechargingItems mRechargingItems; + void copySlots (const InventoryStore& store); - void initSlots (TSlots& slots); + void initSlots (TSlots& slots_); + + void updateMagicEffects(const Ptr& actor); + void updateRechargingItems(); + + void fireEquipmentChangedEvent(); public: @@ -76,7 +124,7 @@ namespace MWWorld /// /// @return if stacking happened, return iterator to the item that was stacked against, otherwise iterator to the newly inserted item. - void equip (int slot, const ContainerStoreIterator& iterator); + void equip (int slot, const ContainerStoreIterator& iterator, const Ptr& actor); ///< \note \a iterator can be an end-iterator void setSelectedEnchantItem(const ContainerStoreIterator& iterator); @@ -92,13 +140,11 @@ namespace MWWorld void unequipAll(const MWWorld::Ptr& actor); ///< Unequip all currently equipped items. - void autoEquip (const MWWorld::Ptr& npc); + void autoEquip (const MWWorld::Ptr& actor); ///< Auto equip items according to stats and item value. - const MWMechanics::MagicEffects& getMagicEffects(); + const MWMechanics::MagicEffects& getMagicEffects() const; ///< Return magic effects from worn items. - /// - /// \todo make this const again, after the constness of Ptrs and iterators has been addressed. virtual void flagAsModified(); ///< \attention This function is internal to the world model and should not be called from @@ -106,8 +152,37 @@ namespace MWWorld virtual bool stacks (const Ptr& ptr1, const Ptr& ptr2); ///< @return true if the two specified objects can stack with each other - /// @note ptr1 is the item that is already in this container + virtual int remove(const Ptr& item, int count, const Ptr& actor); + ///< Remove \a count item(s) designated by \a item from this inventory. + /// + /// @return the number of items actually removed + + ContainerStoreIterator unequipSlot(int slot, const Ptr& actor, bool restack = true); + ///< Unequip \a slot. + /// + /// @return an iterator to the item that was previously in the slot + /// (if \a restack is true, the item can be re-stacked so its count + /// may differ from when it was equipped). + + ContainerStoreIterator unequipItem(const Ptr& item, const Ptr& actor); + ///< Unequip an item identified by its Ptr. An exception is thrown + /// if the item is not currently equipped. + /// + /// @return an iterator to the item that was previously in the slot + /// (it can be re-stacked so its count may be different than when it + /// was equipped). + + void setListener (InventoryStoreListener* listener, const Ptr& actor); + ///< Set a listener for various events, see \a InventoryStoreListener + + void visitEffectSources (MWMechanics::EffectSourceVisitor& visitor); + + void rechargeItems (float duration); + ///< Restore charge on enchanted items. Note this should only be done for the player. + + void purgeEffect (short effectId); + ///< Remove a magic effect }; } diff --git a/apps/openmw/mwworld/manualref.hpp b/apps/openmw/mwworld/manualref.hpp index 6616165fa..1cdcd8484 100644 --- a/apps/openmw/mwworld/manualref.hpp +++ b/apps/openmw/mwworld/manualref.hpp @@ -37,7 +37,7 @@ namespace MWWorld public: - ManualRef (const MWWorld::ESMStore& store, const std::string& name) + ManualRef (const MWWorld::ESMStore& store, const std::string& name, const int count=1) { // create if (!create (store.get(), name) && @@ -74,6 +74,7 @@ namespace MWWorld cellRef.mTeleport = false; cellRef.mLockLevel = 0; cellRef.mReferenceBlocked = 0; + mPtr.getRefData().setCount(count); } const Ptr& getPtr() const diff --git a/apps/openmw/mwworld/omwloader.cpp b/apps/openmw/mwworld/omwloader.cpp new file mode 100644 index 000000000..8562a4fe0 --- /dev/null +++ b/apps/openmw/mwworld/omwloader.cpp @@ -0,0 +1,17 @@ +#include "omwloader.hpp" + +namespace MWWorld +{ + +OmwLoader::OmwLoader(Loading::Listener& listener) + : ContentLoader(listener) +{ +} + +void OmwLoader::load(const boost::filesystem::path& filepath, int& index) +{ + ContentLoader::load(filepath.filename(), index); +} + +} /* namespace MWWorld */ + diff --git a/apps/openmw/mwworld/omwloader.hpp b/apps/openmw/mwworld/omwloader.hpp new file mode 100644 index 000000000..cb9faa430 --- /dev/null +++ b/apps/openmw/mwworld/omwloader.hpp @@ -0,0 +1,21 @@ +#ifndef OMWLOADER_HPP +#define OMWLOADER_HPP + +#include "contentloader.hpp" + +namespace MWWorld +{ + +/** + * @brief Placeholder for real OpenMW content loader + */ +struct OmwLoader : public ContentLoader +{ + OmwLoader(Loading::Listener& listener); + + void load(const boost::filesystem::path& filepath, int& index); +}; + +} /* namespace MWWorld */ + +#endif /* OMWLOADER_HPP */ diff --git a/apps/openmw/mwworld/refdata.hpp b/apps/openmw/mwworld/refdata.hpp index 642f5412c..d5701efc5 100644 --- a/apps/openmw/mwworld/refdata.hpp +++ b/apps/openmw/mwworld/refdata.hpp @@ -73,6 +73,11 @@ namespace MWWorld void setLocals (const ESM::Script& script); void setCount (int count); + /// Set object count (an object pile is a simple object with a count >1). + /// + /// \warning Do not call setCount() to add or remove objects from a + /// container or an actor's inventory. Call ContainerStore::add() or + /// ContainerStore::remove() instead. MWScript::Locals& getLocals(); diff --git a/apps/openmw/mwworld/scene.cpp b/apps/openmw/mwworld/scene.cpp index 0c98ca504..dab272f7c 100644 --- a/apps/openmw/mwworld/scene.cpp +++ b/apps/openmw/mwworld/scene.cpp @@ -111,15 +111,15 @@ namespace MWWorld mRendering.removeCell(*iter); MWBase::Environment::get().getWorld()->getLocalScripts().clearCell (*iter); + MWBase::Environment::get().getMechanicsManager()->drop (*iter); + MWBase::Environment::get().getSoundManager()->stopSound (*iter); mActiveCells.erase(*iter); } void Scene::loadCell (Ptr::CellStore *cell, Loading::Listener* loadingListener) { - // register local scripts - MWBase::Environment::get().getWorld()->getLocalScripts().addCell (cell); std::pair result = mActiveCells.insert(cell); if(result.second) @@ -157,11 +157,16 @@ namespace MWWorld mRendering.requestMap(cell); mRendering.configureAmbient(*cell); } + + // register local scripts + // ??? Should this go into the above if block ??? + MWBase::Environment::get().getWorld()->getLocalScripts().addCell (cell); } void Scene::playerCellChange(MWWorld::CellStore *cell, const ESM::Position& pos, bool adjustPlayerPos) { MWBase::World *world = MWBase::Environment::get().getWorld(); + MWWorld::Ptr old = world->getPlayer().getPlayer(); world->getPlayer().setCell(cell); MWWorld::Ptr player = world->getPlayer().getPlayer(); @@ -181,7 +186,7 @@ namespace MWWorld MWBase::MechanicsManager *mechMgr = MWBase::Environment::get().getMechanicsManager(); - mechMgr->add(player); + mechMgr->updateCell(old, player); mechMgr->watchActor(player); MWBase::Environment::get().getWindowManager()->changeCell(mCurrentCell); @@ -198,14 +203,12 @@ namespace MWWorld void Scene::changeCell (int X, int Y, const ESM::Position& position, bool adjustPlayerPos) { + mRendering.enableTerrain(true); Nif::NIFFile::CacheLock cachelock; Loading::Listener* loadingListener = MWBase::Environment::get().getWindowManager()->getLoadingScreen(); Loading::ScopedLoad load(loadingListener); - // remove active - MWBase::Environment::get().getMechanicsManager()->remove(MWBase::Environment::get().getWorld()->getPlayer().getPlayer()); - std::string loadingExteriorText = "#{sLoadingMessage3}"; loadingListener->setLabel(loadingExteriorText); @@ -434,8 +437,6 @@ namespace MWWorld MWBase::Environment::get().getWorld()->positionToIndex (position.pos[0], position.pos[1], x, y); - mRendering.enableTerrain(true); - changeCell (x, y, position, true); } diff --git a/apps/openmw/mwworld/scene.hpp b/apps/openmw/mwworld/scene.hpp index e3edad352..73c3c4b12 100644 --- a/apps/openmw/mwworld/scene.hpp +++ b/apps/openmw/mwworld/scene.hpp @@ -71,8 +71,6 @@ namespace MWWorld void loadCell (CellStore *cell, Loading::Listener* loadingListener); void changeCell (int X, int Y, const ESM::Position& position, bool adjustPlayerPos); - ///< Move from exterior to interior or from interior cell to a different - /// interior cell. CellStore* getCurrentCell (); diff --git a/apps/openmw/mwworld/store.hpp b/apps/openmw/mwworld/store.hpp index 90452f661..c25197319 100644 --- a/apps/openmw/mwworld/store.hpp +++ b/apps/openmw/mwworld/store.hpp @@ -258,7 +258,7 @@ namespace MWWorld typename std::vector::iterator sharedIter = mShared.begin(); typename std::vector::iterator end = sharedIter + mStatic.size(); - while (sharedIter != mShared.end() && sharedIter != end) { + while (sharedIter != mShared.end() && sharedIter != end) { if((*sharedIter)->mId == item.mId) { mShared.erase(sharedIter); break; diff --git a/apps/openmw/mwworld/weather.cpp b/apps/openmw/mwworld/weather.cpp index 6f5dbe23f..8b05d2256 100644 --- a/apps/openmw/mwworld/weather.cpp +++ b/apps/openmw/mwworld/weather.cpp @@ -473,7 +473,7 @@ void WeatherManager::update(float duration) { // pick a random sound int sound = rand() % 4; - std::string* soundName; + std::string* soundName = NULL; if (sound == 0) soundName = &mThunderSoundID0; else if (sound == 1) soundName = &mThunderSoundID1; else if (sound == 2) soundName = &mThunderSoundID2; diff --git a/apps/openmw/mwworld/worldimp.cpp b/apps/openmw/mwworld/worldimp.cpp index 9635feaf3..448211bc2 100644 --- a/apps/openmw/mwworld/worldimp.cpp +++ b/apps/openmw/mwworld/worldimp.cpp @@ -1,4 +1,11 @@ #include "worldimp.hpp" +#ifdef _WIN32 +#include +#elif defined HAVE_UNORDERED_MAP +#include +#else +#include +#endif #include @@ -19,6 +26,8 @@ #include "../mwmechanics/creaturestats.hpp" #include "../mwmechanics/movement.hpp" #include "../mwmechanics/npcstats.hpp" +#include "../mwmechanics/spellcasting.hpp" + #include "../mwrender/sky.hpp" #include "../mwrender/animation.hpp" @@ -31,6 +40,10 @@ #include "containerstore.hpp" #include "inventorystore.hpp" +#include "contentloader.hpp" +#include "esmloader.hpp" +#include "omwloader.hpp" + using namespace Ogre; namespace @@ -80,6 +93,38 @@ namespace namespace MWWorld { + struct GameContentLoader : public ContentLoader + { + GameContentLoader(Loading::Listener& listener) + : ContentLoader(listener) + { + } + + bool addLoader(const std::string& extension, ContentLoader* loader) + { + return mLoaders.insert(std::make_pair(extension, loader)).second; + } + + void load(const boost::filesystem::path& filepath, int& index) + { + LoadersContainer::iterator it(mLoaders.find(Misc::StringUtils::lowerCase(filepath.extension().string()))); + if (it != mLoaders.end()) + { + it->second->load(filepath, index); + } + else + { + std::string msg("Cannot load file: "); + msg += filepath.string(); + throw std::runtime_error(msg.c_str()); + } + } + + private: + typedef std::tr1::unordered_map LoadersContainer; + LoadersContainer mLoaders; + }; + Ptr World::getPtrViaHandle (const std::string& handle, Ptr::CellStore& cell) { if (MWWorld::LiveCellRef *ref = @@ -163,13 +208,13 @@ namespace MWWorld World::World (OEngine::Render::OgreRenderer& renderer, const Files::Collections& fileCollections, - const std::vector& master, const std::vector& plugins, + const std::vector& contentFiles, const boost::filesystem::path& resDir, const boost::filesystem::path& cacheDir, ToUTF8::Utf8Encoder* encoder, const std::map& fallbackMap, int mActivationDistanceOverride) : mPlayer (0), mLocalScripts (mStore), mGlobalVariables (0), mSky (true), mCells (mStore, mEsm), mActivationDistanceOverride (mActivationDistanceOverride), - mFallback(fallbackMap), mPlayIntro(0), mTeleportEnabled(true), + mFallback(fallbackMap), mPlayIntro(0), mTeleportEnabled(true), mLevitationEnabled(false), mFacedDistance(FLT_MAX), mGodMode(false) { mPhysics = new PhysicsSystem(renderer); @@ -181,44 +226,22 @@ namespace MWWorld mWeatherManager = new MWWorld::WeatherManager(mRendering,&mFallback); - int idx = 0; // NOTE: We might need to reserve one more for the running game / save. - mEsm.resize(master.size() + plugins.size()); + mEsm.resize(contentFiles.size()); Loading::Listener* listener = MWBase::Environment::get().getWindowManager()->getLoadingScreen(); listener->loadingOn(); - for (std::vector::size_type i = 0; i < master.size(); i++, idx++) - { - boost::filesystem::path masterPath (fileCollections.getCollection (".esm").getPath (master[i])); - std::cout << "Loading ESM " << masterPath.string() << "\n"; - listener->setLabel(masterPath.filename().string()); + GameContentLoader gameContentLoader(*listener); + EsmLoader esmLoader(mStore, mEsm, encoder, *listener); + OmwLoader omwLoader(*listener); - // This parses the ESM file - ESM::ESMReader lEsm; - lEsm.setEncoder(encoder); - lEsm.setIndex(idx); - lEsm.setGlobalReaderList(&mEsm); - lEsm.open (masterPath.string()); - mEsm[idx] = lEsm; - mStore.load (mEsm[idx], listener); - } + gameContentLoader.addLoader(".esm", &esmLoader); + gameContentLoader.addLoader(".esp", &esmLoader); + gameContentLoader.addLoader(".omwgame", &omwLoader); + gameContentLoader.addLoader(".omwaddon", &omwLoader); - for (std::vector::size_type i = 0; i < plugins.size(); i++, idx++) - { - boost::filesystem::path pluginPath (fileCollections.getCollection (".esp").getPath (plugins[i])); + loadContentFiles(fileCollections, contentFiles, gameContentLoader); - std::cout << "Loading ESP " << pluginPath.string() << "\n"; - listener->setLabel(pluginPath.filename().string()); - - // This parses the ESP file - ESM::ESMReader lEsm; - lEsm.setEncoder(encoder); - lEsm.setIndex(idx); - lEsm.setGlobalReaderList(&mEsm); - lEsm.open (pluginPath.string()); - mEsm[idx] = lEsm; - mStore.load (mEsm[idx], listener); - } listener->loadingOff(); // insert records that may not be present in all versions of MW @@ -244,6 +267,7 @@ namespace MWWorld // Rebuild player setupPlayer(); + mPlayer->setCell(NULL); MWWorld::Ptr player = mPlayer->getPlayer(); // removes NpcStats, ContainerStore etc @@ -584,6 +608,8 @@ namespace MWWorld void World::advanceTime (double hours) { + MWBase::Environment::get().getMechanicsManager()->advanceTime(hours*3600); + mWeatherManager->advanceTime (hours); hours += mGlobalVariables->getFloat ("gamehour"); @@ -724,12 +750,16 @@ namespace MWWorld void World::changeToInteriorCell (const std::string& cellName, const ESM::Position& position) { - return mWorldScene->changeToInteriorCell(cellName, position); + removeContainerScripts(getPlayer().getPlayer()); + mWorldScene->changeToInteriorCell(cellName, position); + addContainerScripts(getPlayer().getPlayer(), getPlayer().getPlayer().getCell()); } void World::changeToExteriorCell (const ESM::Position& position) { - return mWorldScene->changeToExteriorCell(position); + removeContainerScripts(getPlayer().getPlayer()); + mWorldScene->changeToExteriorCell(position); + addContainerScripts(getPlayer().getPlayer(), getPlayer().getPlayer().getCell()); } void World::markCellAsUnchanged() @@ -774,6 +804,8 @@ namespace MWWorld return MWWorld::Ptr (); MWWorld::Ptr object = searchPtrViaHandle (result.second); + if (object.isEmpty()) + return object; float ActivationDistance; if (MWBase::Environment::get().getWindowManager()->isConsoleMode()) @@ -814,12 +846,13 @@ namespace MWWorld void World::deleteObject (const Ptr& ptr) { - if (ptr.getRefData().getCount()>0) + if (ptr.getRefData().getCount() > 0) { - ptr.getRefData().setCount (0); + ptr.getRefData().setCount(0); - if (mWorldScene->getActiveCells().find (ptr.getCell())!=mWorldScene->getActiveCells().end() && - ptr.getRefData().isEnabled()) + if (ptr.isInCell() + && mWorldScene->getActiveCells().find(ptr.getCell()) != mWorldScene->getActiveCells().end() + && ptr.getRefData().isEnabled()) { mWorldScene->removeObjectFromScene (ptr); mLocalScripts.remove (ptr); @@ -856,6 +889,7 @@ namespace MWWorld int cellY = newCell.mCell->getGridY(); mWorldScene->changeCell(cellX, cellY, pos, false); } + addContainerScripts (getPlayer().getPlayer(), &newCell); } else { @@ -863,15 +897,16 @@ namespace MWWorld copyObjectToCell(ptr, newCell, pos); else if (!mWorldScene->isCellActive(newCell)) { - MWWorld::Class::get(ptr) - .copyToCell(ptr, newCell) - .getRefData() - .setBaseNode(0); - mWorldScene->removeObjectFromScene(ptr); mLocalScripts.remove(ptr); removeContainerScripts (ptr); haveToMove = false; + + MWWorld::Ptr newPtr = MWWorld::Class::get(ptr) + .copyToCell(ptr, newCell); + newPtr.getRefData().setBaseNode(0); + + objectLeftActiveCell(ptr, newPtr); } else { @@ -1058,9 +1093,9 @@ namespace MWWorld adjust); } - void World::safePlaceObject(const MWWorld::Ptr& ptr,MWWorld::CellStore &Cell,ESM::Position pos) + MWWorld::Ptr World::safePlaceObject(const MWWorld::Ptr& ptr,MWWorld::CellStore &Cell,ESM::Position pos) { - copyObjectToCell(ptr,Cell,pos); + return copyObjectToCell(ptr,Cell,pos,false); } void World::indexToPosition (int cellX, int cellY, float &x, float &y, bool centre) const @@ -1092,12 +1127,10 @@ namespace MWWorld void World::doPhysics(float duration) { - /* No duration? Shouldn't be any movement, then. */ - if(duration <= 0.0f) - return; - processDoors(duration); + moveProjectiles(duration); + const PtrVelocityList &results = mPhysics->applyQueuedMovement(duration); PtrVelocityList::const_iterator player(results.end()); for(PtrVelocityList::const_iterator iter(results.begin());iter != results.end();iter++) @@ -1258,7 +1291,8 @@ namespace MWWorld mWorldScene->update (duration, paused); - doPhysics (duration); + if (!paused) + doPhysics (duration); performUpdateSceneQueries (); @@ -1454,7 +1488,7 @@ namespace MWWorld item.getRefData().getLocals().setVarByInt(script, "onpcdrop", 1); } - bool World::placeObject (const Ptr& object, float cursorX, float cursorY) + bool World::placeObject (const MWWorld::Ptr& object, float cursorX, float cursorY, int amount) { std::pair result = mPhysics->castRay(cursorX, cursorY); @@ -1479,9 +1513,14 @@ namespace MWWorld pos.rot[0] = 0; pos.rot[1] = 0; - Ptr dropped = copyObjectToCell(object, *cell, pos); + // copy the object and set its count + int origCount = object.getRefData().getCount(); + object.getRefData().setCount(amount); + Ptr dropped = copyObjectToCell(object, *cell, pos, true); + object.getRefData().setCount(origCount); + + // only the player place items in the world, so no need to check actor PCDropped(dropped); - object.getRefData().setCount(0); return true; } @@ -1498,18 +1537,21 @@ namespace MWWorld } - Ptr World::copyObjectToCell(const Ptr &object, CellStore &cell, const ESM::Position &pos) + Ptr World::copyObjectToCell(const Ptr &object, CellStore &cell, const ESM::Position &pos, bool adjustPos) { /// \todo add searching correct cell for position specified MWWorld::Ptr dropped = MWWorld::Class::get(object).copyToCell(object, cell, pos); - Ogre::Vector3 min, max; - if (mPhysics->getObjectAABB(object, min, max)) { - float *pos = dropped.getRefData().getPosition().pos; - pos[0] -= (min.x + max.x) / 2; - pos[1] -= (min.y + max.y) / 2; - pos[2] -= min.z; + if (object.getClass().isActor() || adjustPos) + { + Ogre::Vector3 min, max; + if (mPhysics->getObjectAABB(object, min, max)) { + float *pos = dropped.getRefData().getPosition().pos; + pos[0] -= (min.x + max.x) / 2; + pos[1] -= (min.y + max.y) / 2; + pos[2] -= min.z; + } } if (mWorldScene->isCellActive(cell)) { @@ -1526,7 +1568,7 @@ namespace MWWorld return dropped; } - void World::dropObjectOnGround (const Ptr& actor, const Ptr& object) + void World::dropObjectOnGround (const Ptr& actor, const Ptr& object, int amount) { MWWorld::Ptr::CellStore* cell = actor.getCell(); @@ -1547,10 +1589,14 @@ namespace MWWorld mPhysics->castRay(orig, dir, len); pos.pos[2] = hit.second.z; + // copy the object and set its count + int origCount = object.getRefData().getCount(); + object.getRefData().setCount(amount); Ptr dropped = copyObjectToCell(object, *cell, pos); + object.getRefData().setCount(origCount); + if(actor == mPlayer->getPlayer()) // Only call if dropped by player PCDropped(dropped); - object.getRefData().setCount(0); } void World::processChangedSettings(const Settings::CategorySettingVector& settings) @@ -1797,6 +1843,28 @@ namespace MWWorld } } + bool World::getLOS(const MWWorld::Ptr& npc,const MWWorld::Ptr& targetNpc) + { + // This is a placeholder! Needs to go into an NPC awareness check function (see + // https://wiki.openmw.org/index.php?title=Research:NPC_AI_Behaviour#NPC_Awareness_Check ) + if (targetNpc.getClass().getCreatureStats(targetNpc).getMagicEffects().get(ESM::MagicEffect::Invisibility).mMagnitude) + return false; + if (targetNpc.getClass().getCreatureStats(targetNpc).getMagicEffects().get(ESM::MagicEffect::Chameleon).mMagnitude > 100) + return false; + + Ogre::Vector3 halfExt1 = mPhysEngine->getCharacter(npc.getRefData().getHandle())->getHalfExtents(); + float* pos1 = npc.getRefData().getPosition().pos; + Ogre::Vector3 halfExt2 = mPhysEngine->getCharacter(targetNpc.getRefData().getHandle())->getHalfExtents(); + float* pos2 = targetNpc.getRefData().getPosition().pos; + + btVector3 from(pos1[0],pos1[1],pos1[2]+halfExt1.z); + btVector3 to(pos2[0],pos2[1],pos2[2]+halfExt2.z); + + std::pair result = mPhysEngine->rayTest(from, to,false); + if(result.first == "") return true; + return false; + } + void World::enableActorCollision(const MWWorld::Ptr& actor, bool enable) { OEngine::Physic::PhysicActor *physicActor = mPhysEngine->getCharacter(actor.getRefData().getHandle()); @@ -1915,31 +1983,13 @@ namespace MWWorld if(werewolf) { - ManualRef ref(getStore(), "WerewolfRobe"); - ref.getPtr().getRefData().setCount(1); + InventoryStore &inv = actor.getClass().getInventoryStore(actor); - // Configure item's script variables - std::string script = Class::get(ref.getPtr()).getScript(ref.getPtr()); - if(script != "") - { - const ESM::Script *esmscript = getStore().get().find(script); - ref.getPtr().getRefData().setLocals(*esmscript); - } - - // Not sure this is right - InventoryStore &inv = Class::get(actor).getInventoryStore(actor); - inv.equip(InventoryStore::Slot_Robe, inv.add(ref.getPtr(), actor)); + inv.equip(InventoryStore::Slot_Robe, inv.ContainerStore::add("WerewolfRobe", 1, actor), actor); } else { - ContainerStore &store = Class::get(actor).getContainerStore(actor); - - const std::string item = "WerewolfRobe"; - for(ContainerStoreIterator iter(store.begin());iter != store.end();++iter) - { - if(Misc::StringUtils::ciEqual(iter->getCellRef().mRefID, item)) - iter->getRefData().setCount(0); - } + actor.getClass().getContainerStore(actor).remove("WerewolfRobe", 1, actor); } if(actor.getRefData().getHandle() == "player") @@ -1983,4 +2033,215 @@ namespace MWWorld return mGodMode; } + void World::loadContentFiles(const Files::Collections& fileCollections, + const std::vector& content, ContentLoader& contentLoader) + { + std::vector::const_iterator it(content.begin()); + std::vector::const_iterator end(content.end()); + for (int idx = 0; it != end; ++it, ++idx) + { + boost::filesystem::path filename(*it); + const Files::MultiDirCollection& col = fileCollections.getCollection(filename.extension().string()); + if (col.doesExist(*it)) + { + contentLoader.load(col.getPath(*it), idx); + } + } + } + + void World::castSpell(const Ptr &actor) + { + MWMechanics::CreatureStats& stats = actor.getClass().getCreatureStats(actor); + InventoryStore& inv = actor.getClass().getInventoryStore(actor); + + // Unset casting flag, otherwise pressing the mouse button down would continue casting every frame if using an enchantment + // (which casts instantly without an animation) + stats.setAttackingOrSpell(false); + + MWWorld::Ptr target = getFacedObject(); + + std::string selectedSpell = stats.getSpells().getSelectedSpell(); + + MWMechanics::CastSpell cast(actor, target); + + if (!selectedSpell.empty()) + { + const ESM::Spell* spell = getStore().get().search(selectedSpell); + + cast.cast(spell); + } + else if (inv.getSelectedEnchantItem() != inv.end()) + { + cast.cast(*inv.getSelectedEnchantItem()); + } + } + + void World::launchProjectile (const std::string& id, bool stack, const ESM::EffectList& effects, + const MWWorld::Ptr& actor, const std::string& sourceName) + { + std::string projectileModel; + std::string sound; + float speed = 0; + for (std::vector::const_iterator iter (effects.mList.begin()); + iter!=effects.mList.end(); ++iter) + { + if (iter->mRange != ESM::RT_Target) + continue; + + const ESM::MagicEffect *magicEffect = getStore().get().find ( + iter->mEffectID); + + projectileModel = magicEffect->mBolt; + if (projectileModel.empty()) + projectileModel = "VFX_DefaultBolt"; + + static const std::string schools[] = { + "alteration", "conjuration", "destruction", "illusion", "mysticism", "restoration" + }; + + if (!magicEffect->mBoltSound.empty()) + sound = magicEffect->mBoltSound; + else + sound = schools[magicEffect->mData.mSchool] + " bolt"; + + speed = magicEffect->mData.mSpeed; + break; + } + if (projectileModel.empty()) + return; + + // Spawn at 0.75 * ActorHeight + float height = mPhysEngine->getCharacter(actor.getRefData().getHandle())->getHalfExtents().z * 2 * 0.75; + + MWWorld::ManualRef ref(getStore(), projectileModel); + ESM::Position pos; + pos.pos[0] = actor.getRefData().getPosition().pos[0]; + pos.pos[1] = actor.getRefData().getPosition().pos[1]; + pos.pos[2] = actor.getRefData().getPosition().pos[2] + height; + pos.rot[0] = actor.getRefData().getPosition().rot[0]; + pos.rot[1] = actor.getRefData().getPosition().rot[1]; + pos.rot[2] = actor.getRefData().getPosition().rot[2]; + ref.getPtr().getCellRef().mPos = pos; + MWWorld::Ptr ptr = copyObjectToCell(ref.getPtr(), *actor.getCell(), pos); + + ProjectileState state; + state.mSourceName = sourceName; + state.mId = id; + state.mActorHandle = actor.getRefData().getHandle(); + state.mSpeed = speed; + state.mEffects = effects; + state.mStack = stack; + + MWBase::SoundManager *sndMgr = MWBase::Environment::get().getSoundManager(); + sndMgr->playSound3D(ptr, sound, 1.0f, 1.0f); + + mProjectiles[ptr] = state; + } + + void World::moveProjectiles(float duration) + { + std::map moved; + for (std::map::iterator it = mProjectiles.begin(); it != mProjectiles.end();) + { + if (!mWorldScene->isCellActive(*it->first.getCell())) + { + mProjectiles.erase(it++); + continue; + } + + MWWorld::Ptr ptr = it->first; + + Ogre::Vector3 rot(ptr.getRefData().getPosition().rot); + + // TODO: Why -rot.z, but not -rot.x? + Ogre::Quaternion orient = Ogre::Quaternion(Ogre::Radian(-rot.z), Ogre::Vector3::UNIT_Z); + orient = orient * Ogre::Quaternion(Ogre::Radian(rot.x), Ogre::Vector3::UNIT_X); + + // This is just a guess, probably wrong + static float fProjectileMinSpeed = getStore().get().find("fProjectileMinSpeed")->getFloat(); + static float fProjectileMaxSpeed = getStore().get().find("fProjectileMaxSpeed")->getFloat(); + float speed = fProjectileMinSpeed + (fProjectileMaxSpeed - fProjectileMinSpeed) * it->second.mSpeed; + + Ogre::Vector3 direction = orient.yAxis(); + direction.normalise(); + Ogre::Vector3 pos(ptr.getRefData().getPosition().pos); + Ogre::Vector3 newPos = pos + direction * duration * speed; + + // Check for impact + btVector3 from(pos.x, pos.y, pos.z); + btVector3 to(newPos.x, newPos.y, newPos.z); + std::vector > collisions = mPhysEngine->rayTest2(from, to); + bool explode = false; + for (std::vector >::iterator cIt = collisions.begin(); cIt != collisions.end() && !explode; ++cIt) + { + MWWorld::Ptr obstacle = searchPtrViaHandle(cIt->second); + if (obstacle == ptr) + continue; + + explode = true; + + MWWorld::Ptr caster = searchPtrViaHandle(it->second.mActorHandle); + if (caster.isEmpty()) + caster = obstacle; + if (obstacle.isEmpty()) + { + // Terrain + } + else + { + MWMechanics::CastSpell cast(caster, obstacle); + cast.mStack = it->second.mStack; + cast.mId = it->second.mId; + cast.mSourceName = it->second.mSourceName; + cast.inflict(obstacle, caster, it->second.mEffects, ESM::RT_Target, false); + } + + deleteObject(ptr); + mProjectiles.erase(it++); + } + + if (explode) + { + // TODO: Explode + continue; + } + + std::string handle = ptr.getRefData().getHandle(); + + moveObject(ptr, newPos.x, newPos.y, newPos.z); + + // HACK: Re-fetch Ptrs if necessary, since the cell might have changed + if (!ptr.getRefData().getCount()) + { + moved[handle] = it->second; + mProjectiles.erase(it++); + } + else + ++it; + } + + // HACK: Re-fetch Ptrs if necessary, since the cell might have changed + for (std::map::iterator it = moved.begin(); it != moved.end(); ++it) + { + MWWorld::Ptr newPtr = searchPtrViaHandle(it->first); + if (newPtr.isEmpty()) // The projectile went into an inactive cell and was deleted + continue; + mProjectiles[getPtrViaHandle(it->first)] = it->second; + } + } + + void World::objectLeftActiveCell(Ptr object, Ptr movedPtr) + { + // For now, projectiles moved to an inactive cell are just deleted, because there's no reliable way to hold on to the meta information + if (mProjectiles.find(object) != mProjectiles.end()) + { + deleteObject(movedPtr); + } + } + + void World::breakInvisibility(const Ptr &actor) + { + actor.getClass().getCreatureStats(actor).getActiveSpells().purgeEffect(ESM::MagicEffect::Invisibility); + actor.getClass().getInventoryStore(actor).purgeEffect(ESM::MagicEffect::Invisibility); + } } diff --git a/apps/openmw/mwworld/worldimp.hpp b/apps/openmw/mwworld/worldimp.hpp index e275756e8..5a51cb773 100644 --- a/apps/openmw/mwworld/worldimp.hpp +++ b/apps/openmw/mwworld/worldimp.hpp @@ -14,6 +14,8 @@ #include "../mwbase/world.hpp" +#include "contentloader.hpp" + namespace Ogre { class Vector3; @@ -41,6 +43,8 @@ namespace MWRender class Animation; } +struct ContentLoader; + namespace MWWorld { class WeatherManager; @@ -83,6 +87,26 @@ namespace MWWorld std::map mDoorStates; ///< only holds doors that are currently moving. 0 means closing, 1 opening + struct ProjectileState + { + // Id of spell or enchantment to apply when it hits + std::string mId; + + // Actor who casted this projectile + std::string mActorHandle; + + // Name of item to display as effect source in magic menu (in case we casted an enchantment) + std::string mSourceName; + + ESM::EffectList mEffects; + + float mSpeed; + + bool mStack; + }; + + std::map mProjectiles; + int getDaysPerMonth (int month) const; void rotateObjectImp (const Ptr& ptr, Ogre::Vector3 rot, bool adjust); @@ -90,8 +114,7 @@ namespace MWWorld bool moveObjectImp (const Ptr& ptr, float x, float y, float z); ///< @return true if the active cell (cell player is in) changed - - Ptr copyObjectToCell(const Ptr &ptr, CellStore &cell, const ESM::Position &pos); + Ptr copyObjectToCell(const Ptr &ptr, CellStore &cell, const ESM::Position &pos, bool adjustPos=true); void updateWindowManager (); void performUpdateSceneQueries (); @@ -108,21 +131,35 @@ namespace MWWorld void processDoors(float duration); ///< Run physics simulation and modify \a world accordingly. + void moveProjectiles(float duration); + void doPhysics(float duration); ///< Run physics simulation and modify \a world accordingly. void ensureNeededRecords(); + /** + * @brief loadContentFiles - Loads content files (esm,esp,omwgame,omwaddon) + * @param fileCollections- Container which holds content file names and their paths + * @param content - Container which holds content file names + * @param contentLoader - + */ + void loadContentFiles(const Files::Collections& fileCollections, + const std::vector& content, ContentLoader& contentLoader); + int mPlayIntro; bool mTeleportEnabled; bool mLevitationEnabled; + /// Called when \a object is moved to an inactive cell + void objectLeftActiveCell (MWWorld::Ptr object, MWWorld::Ptr movedPtr); + public: World (OEngine::Render::OgreRenderer& renderer, const Files::Collections& fileCollections, - const std::vector& master, const std::vector& plugins, + const std::vector& contentFiles, const boost::filesystem::path& resDir, const boost::filesystem::path& cacheDir, ToUTF8::Utf8Encoder* encoder, const std::map& fallbackMap, int mActivationDistanceOverride); @@ -273,7 +310,7 @@ namespace MWWorld virtual void localRotateObject (const Ptr& ptr, float x, float y, float z); - virtual void safePlaceObject(const MWWorld::Ptr& ptr,MWWorld::CellStore &Cell,ESM::Position pos); + virtual MWWorld::Ptr safePlaceObject(const MWWorld::Ptr& ptr,MWWorld::CellStore &Cell,ESM::Position pos); ///< place an object in a "safe" location (ie not in the void, etc). Makes a copy of the Ptr. virtual void indexToPosition (int cellX, int cellY, float &x, float &y, bool centre = false) @@ -341,14 +378,19 @@ namespace MWWorld virtual void update (float duration, bool paused); - virtual bool placeObject (const Ptr& object, float cursorX, float cursorY); - ///< place an object into the gameworld at the specified cursor position + virtual bool placeObject (const MWWorld::Ptr& object, float cursorX, float cursorY, int amount); + ///< copy and place an object into the gameworld at the specified cursor position /// @param object /// @param cursor X (relative 0-1) /// @param cursor Y (relative 0-1) + /// @param number of objects to place /// @return true if the object was placed, or false if it was rejected because the position is too far away - virtual void dropObjectOnGround (const Ptr& actor, const Ptr& object); + virtual void dropObjectOnGround (const MWWorld::Ptr& actor, const MWWorld::Ptr& object, int amount); + ///< copy and place an object into the gameworld at the given actor's position + /// @param actor giving the dropped object position + /// @param object + /// @param number of objects to place virtual bool canPlaceObject(float cursorX, float cursorY); ///< @return true if it is possible to place on object at specified cursor location @@ -407,6 +449,9 @@ namespace MWWorld virtual void getItemsOwnedBy (const MWWorld::Ptr& npc, std::vector& out); ///< get all items in active cells owned by this Npc + virtual bool getLOS(const MWWorld::Ptr& npc,const MWWorld::Ptr& targetNpc); + ///< get Line of Sight (morrowind stupid implementation) + virtual void enableActorCollision(const MWWorld::Ptr& actor, bool enable); virtual void setupExternalRendering (MWRender::ExternalRendering& rendering); @@ -453,6 +498,13 @@ namespace MWWorld virtual bool getGodModeState(); virtual bool toggleGodMode(); + + virtual void castSpell (const MWWorld::Ptr& actor); + + virtual void launchProjectile (const std::string& id, bool stack, const ESM::EffectList& effects, + const MWWorld::Ptr& actor, const std::string& sourceName); + + virtual void breakInvisibility (const MWWorld::Ptr& actor); }; } diff --git a/cmake/FindOGRE.cmake b/cmake/FindOGRE.cmake index fb4a090c6..96f93cf34 100644 --- a/cmake/FindOGRE.cmake +++ b/cmake/FindOGRE.cmake @@ -551,4 +551,3 @@ set(OGRE_MEDIA_SEARCH_SUFFIX clear_if_changed(OGRE_PREFIX_WATCH OGRE_MEDIA_DIR) find_path(OGRE_MEDIA_DIR NAMES packs/cubemapsJS.zip HINTS ${OGRE_MEDIA_SEARCH_PATH} PATHS ${OGRE_PREFIX_PATH} PATH_SUFFIXES ${OGRE_MEDIA_SEARCH_SUFFIX}) - diff --git a/components/CMakeLists.txt b/components/CMakeLists.txt index 04423dc6f..a037fd5fa 100644 --- a/components/CMakeLists.txt +++ b/components/CMakeLists.txt @@ -1,5 +1,5 @@ project (Components) - +set (CMAKE_BUILD_TYPE DEBUG) # source files add_component_dir (settings @@ -19,7 +19,7 @@ add_component_dir (nif ) add_component_dir (nifogre - ogrenifloader skeleton material mesh + ogrenifloader skeleton material mesh particles controller ) add_component_dir (nifbullet @@ -47,8 +47,8 @@ add_component_dir (misc ) add_component_dir (files - linuxpath windowspath macospath fixedpath multidircollection collections fileops configurationmanager - filelibrary ogreplugin constrainedfiledatastream lowlevelfile + linuxpath windowspath macospath fixedpath multidircollection collections configurationmanager + constrainedfiledatastream lowlevelfile ) add_component_dir (compiler @@ -65,30 +65,39 @@ add_component_dir (interpreter add_component_dir (translation translation ) - + add_component_dir (terrain quadtreenode chunk world storage material ) - + add_component_dir (loadinglistener loadinglistener ) +add_component_dir (ogreinit + ogreinit ogreplugin + ) + +set (ESM_UI ${CMAKE_SOURCE_DIR}/files/ui/contentselector.ui + ) + find_package(Qt4 COMPONENTS QtCore QtGui) if(QT_QTGUI_LIBRARY AND QT_QTCORE_LIBRARY) - add_component_qt_dir (fileorderlist - model/modelitem model/datafilesmodel model/pluginsproxymodel model/esm/esmfile - utils/profilescombobox utils/comboboxlineedit utils/lineedit utils/naturalsort + add_component_qt_dir (contentselector + model/modelitem model/esmfile + model/naturalsort model/contentmodel + view/combobox view/contentselector ) include(${QT_USE_FILE}) + QT4_WRAP_UI(ESM_UI_HDR ${ESM_UI}) QT4_WRAP_CPP(MOC_SRCS ${COMPONENT_MOC_FILES}) endif(QT_QTGUI_LIBRARY AND QT_QTCORE_LIBRARY) -include_directories(${BULLET_INCLUDE_DIRS}) +include_directories(${BULLET_INCLUDE_DIRS} ${CMAKE_CURRENT_BINARY_DIR}) -add_library(components STATIC ${COMPONENT_FILES} ${MOC_SRCS}) +add_library(components STATIC ${COMPONENT_FILES} ${MOC_SRCS} ${ESM_UI_HDR}) target_link_libraries(components ${Boost_LIBRARIES} ${OGRE_LIBRARIES}) diff --git a/components/compiler/extensions0.cpp b/components/compiler/extensions0.cpp index 65f6e112a..e95f6f698 100644 --- a/components/compiler/extensions0.cpp +++ b/components/compiler/extensions0.cpp @@ -59,10 +59,14 @@ namespace Compiler extensions.registerInstruction ("modfight", "l", opcodeModFight, opcodeModFightExplicit); extensions.registerInstruction ("modflee", "l", opcodeModFlee, opcodeModFleeExplicit); extensions.registerInstruction ("modalarm", "l", opcodeModAlarm, opcodeModAlarmExplicit); + extensions.registerInstruction ("toggleai", "", opcodeToggleAI, opcodeToggleAI); + extensions.registerInstruction ("tai", "", opcodeToggleAI, opcodeToggleAI); extensions.registerFunction ("gethello", 'l', "", opcodeGetHello, opcodeGetHelloExplicit); extensions.registerFunction ("getfight", 'l', "", opcodeGetFight, opcodeGetFightExplicit); extensions.registerFunction ("getflee", 'l', "", opcodeGetFlee, opcodeGetFleeExplicit); extensions.registerFunction ("getalarm", 'l', "", opcodeGetAlarm, opcodeGetAlarmExplicit); + extensions.registerFunction ("getlineofsight", 'l', "c", opcodeGetLineOfSight, opcodeGetLineOfSightExplicit); + extensions.registerFunction ("getlos", 'l', "c", opcodeGetLineOfSight, opcodeGetLineOfSightExplicit); } } diff --git a/components/compiler/opcodes.hpp b/components/compiler/opcodes.hpp index aca24e0d3..a885a373d 100644 --- a/components/compiler/opcodes.hpp +++ b/components/compiler/opcodes.hpp @@ -49,6 +49,10 @@ namespace Compiler const int opcodeGetFleeExplicit = 0x20001c4; const int opcodeGetAlarm = 0x20001c5; const int opcodeGetAlarmExplicit = 0x20001c6; + const int opcodeGetLineOfSight = 0x2000222; + const int opcodeGetLineOfSightExplicit = 0x2000223; + const int opcodeToggleAI = 0x2000224; + const int opcodeToggleAIExplicit = 0x2000225; } namespace Animation diff --git a/components/contentselector/model/contentmodel.cpp b/components/contentselector/model/contentmodel.cpp new file mode 100644 index 000000000..0d274474c --- /dev/null +++ b/components/contentselector/model/contentmodel.cpp @@ -0,0 +1,621 @@ +#include "contentmodel.hpp" +#include "esmfile.hpp" + +#include + +#include +#include +#include + +#include "components/esm/esmreader.hpp" + +ContentSelectorModel::ContentModel::ContentModel(QObject *parent) : + QAbstractTableModel(parent), + mMimeType ("application/omwcontent"), + mMimeTypes (QStringList() << mMimeType), + mColumnCount (1), + mDragDropFlags (Qt::ItemIsDragEnabled | Qt::ItemIsDropEnabled), + mDropActions (Qt::CopyAction | Qt::MoveAction) +{ + setEncoding ("win1252"); + uncheckAll(); +} + +void ContentSelectorModel::ContentModel::setEncoding(const QString &encoding) +{ + if (encoding == QLatin1String("win1252")) + mCodec = QTextCodec::codecForName("windows-1252"); + + else if (encoding == QLatin1String("win1251")) + mCodec = QTextCodec::codecForName("windows-1251"); + + else if (encoding == QLatin1String("win1250")) + mCodec = QTextCodec::codecForName("windows-1250"); + + else + return; // This should never happen; +} + +int ContentSelectorModel::ContentModel::columnCount(const QModelIndex &parent) const +{ + if (parent.isValid()) + return 0; + + return mColumnCount; +} + +int ContentSelectorModel::ContentModel::rowCount(const QModelIndex &parent) const +{ + if(parent.isValid()) + return 0; + + return mFiles.size(); +} + +const ContentSelectorModel::EsmFile *ContentSelectorModel::ContentModel::item(int row) const +{ + if (row >= 0 && row < mFiles.size()) + return mFiles.at(row); + + return 0; +} + +ContentSelectorModel::EsmFile *ContentSelectorModel::ContentModel::item(int row) +{ + if (row >= 0 && row < mFiles.count()) + return mFiles.at(row); + + return 0; +} +const ContentSelectorModel::EsmFile *ContentSelectorModel::ContentModel::item(const QString &name) const +{ + EsmFile::FileProperty fp = EsmFile::FileProperty_FileName; + + if (name.contains ('/')) + fp = EsmFile::FileProperty_FilePath; + + foreach (const EsmFile *file, mFiles) + { + if (name == file->fileProperty (fp).toString()) + return file; + } + return 0; +} + +QModelIndex ContentSelectorModel::ContentModel::indexFromItem(const EsmFile *item) const +{ + //workaround: non-const pointer cast for calls from outside contentmodel/contentselector + EsmFile *non_const_file_ptr = const_cast(item); + + if (item) + return index(mFiles.indexOf(non_const_file_ptr),0); + + return QModelIndex(); +} + +Qt::ItemFlags ContentSelectorModel::ContentModel::flags(const QModelIndex &index) const +{ + if (!index.isValid()) + return Qt::NoItemFlags; + + const EsmFile *file = item(index.row()); + + if (!file) + return Qt::NoItemFlags; + + //game files can always be checked + if (file->isGameFile()) + return Qt::ItemIsEnabled | Qt::ItemIsSelectable; + + Qt::ItemFlags returnFlags; + bool allDependenciesFound = true; + bool gamefileChecked = false; + + //addon can be checked if its gamefile is and all other dependencies exist + foreach (const QString &fileName, file->gameFiles()) + { + bool depFound = false; + foreach (EsmFile *dependency, mFiles) + { + //compare filenames only. Multiple instances + //of the filename (with different paths) is not relevant here. + depFound = (dependency->fileName() == fileName); + + if (!depFound) + continue; + + if (!gamefileChecked) + { + if (isChecked (dependency->filePath())) + gamefileChecked = (dependency->isGameFile()); + } + + // force it to iterate all files in cases where the current + // dependency is a game file to ensure that a later duplicate + // game file is / is not checked. + // (i.e., break only if it's not a gamefile or the game file has been checked previously) + if (gamefileChecked || !(dependency->isGameFile())) + break; + } + + allDependenciesFound = allDependenciesFound && depFound; + } + + if (gamefileChecked) + { + if (allDependenciesFound) + returnFlags = returnFlags | Qt::ItemIsEnabled | Qt::ItemIsSelectable | mDragDropFlags; + else + returnFlags = Qt::ItemIsSelectable; + } + + return returnFlags; +} + +QVariant ContentSelectorModel::ContentModel::data(const QModelIndex &index, int role) const +{ + if (!index.isValid()) + return QVariant(); + + if (index.row() >= mFiles.size()) + return QVariant(); + + const EsmFile *file = item(index.row()); + + if (!file) + return QVariant(); + + const int column = index.column(); + + switch (role) + { + case Qt::EditRole: + case Qt::DisplayRole: + { + if (column >=0 && column <=EsmFile::FileProperty_GameFile) + return file->fileProperty(static_cast(column)); + + return QVariant(); + break; + } + + case Qt::TextAlignmentRole: + { + switch (column) + { + case 0: + case 1: + return Qt::AlignLeft + Qt::AlignVCenter; + case 2: + case 3: + return Qt::AlignRight + Qt::AlignVCenter; + default: + return Qt::AlignLeft + Qt::AlignVCenter; + } + return QVariant(); + break; + } + + case Qt::ToolTipRole: + { + if (column != 0) + return QVariant(); + + return file->toolTip(); + break; + } + + case Qt::CheckStateRole: + { + if (file->isGameFile()) + return QVariant(); + + return mCheckStates[file->filePath()]; + + break; + } + + case Qt::UserRole: + { + if (file->isGameFile()) + return ContentType_GameFile; + else + if (flags(index)) + return ContentType_Addon; + + break; + } + + case Qt::UserRole + 1: + return isChecked(file->filePath()); + break; + } + return QVariant(); +} + +bool ContentSelectorModel::ContentModel::setData(const QModelIndex &index, const QVariant &value, int role) +{ + if(!index.isValid()) + return false; + + EsmFile *file = item(index.row()); + QString fileName = file->filePath(); + bool success = false; + + switch(role) + { + case Qt::EditRole: + { + QStringList list = value.toStringList(); + + for (int i = 0; i < EsmFile::FileProperty_GameFile; i++) + file->setFileProperty(static_cast(i), list.at(i)); + + for (int i = EsmFile::FileProperty_GameFile; i < list.size(); i++) + file->setFileProperty (EsmFile::FileProperty_GameFile, list.at(i)); + + emit dataChanged(index, index); + + success = true; + } + break; + + case Qt::UserRole+1: + { + success = (flags (index) & Qt::ItemIsEnabled); + + if (success) + { + success = setCheckState(fileName, value.toBool()); + emit dataChanged(index, index); + } + } + break; + + case Qt::CheckStateRole: + { + int checkValue = value.toInt(); + bool success = false; + bool setState = false; + if ((checkValue==Qt::Checked) && !isChecked(fileName)) + { + setState = true; + success = true; + } + else if ((checkValue == Qt::Checked) && isChecked (fileName)) + setState = true; + else if (checkValue == Qt::Unchecked) + setState = true; + + if (setState) + { + setCheckState(fileName, success); + emit dataChanged(index, index); + + } + else + return success; + + + foreach (EsmFile *file, mFiles) + { + if (file->gameFiles().contains(fileName)) + { + QModelIndex idx = indexFromItem(file); + emit dataChanged(idx, idx); + } + } + + success = true; + } + break; + } + + return success; +} + +bool ContentSelectorModel::ContentModel::insertRows(int position, int rows, const QModelIndex &parent) +{ + if (parent.isValid()) + return false; + + beginInsertRows(parent, position, position+rows-1); + { + for (int row = 0; row < rows; ++row) + mFiles.insert(position, new EsmFile); + + } endInsertRows(); + + return true; +} + +bool ContentSelectorModel::ContentModel::removeRows(int position, int rows, const QModelIndex &parent) +{ + if (parent.isValid()) + return false; + + beginRemoveRows(parent, position, position+rows-1); + { + for (int row = 0; row < rows; ++row) + delete mFiles.takeAt(position); + + } endRemoveRows(); + + return true; +} + +Qt::DropActions ContentSelectorModel::ContentModel::supportedDropActions() const +{ + return mDropActions; +} + +QStringList ContentSelectorModel::ContentModel::mimeTypes() const +{ + return mMimeTypes; +} + +QMimeData *ContentSelectorModel::ContentModel::mimeData(const QModelIndexList &indexes) const +{ + QByteArray encodedData; + + foreach (const QModelIndex &index, indexes) + { + if (!index.isValid()) + continue; + + encodedData.append(item(index.row())->encodedData()); + } + + QMimeData *mimeData = new QMimeData(); + mimeData->setData(mMimeType, encodedData); + + return mimeData; +} + +bool ContentSelectorModel::ContentModel::dropMimeData(const QMimeData *data, Qt::DropAction action, int row, int column, const QModelIndex &parent) +{ + if (action == Qt::IgnoreAction) + return true; + + if (column > 0) + return false; + + if (!data->hasFormat(mMimeType)) + return false; + + int beginRow = rowCount(); + + if (row != -1) + beginRow = row; + + else if (parent.isValid()) + beginRow = parent.row(); + + QByteArray encodedData = data->data(mMimeType); + QDataStream stream(&encodedData, QIODevice::ReadOnly); + + while (!stream.atEnd()) + { + + QString value; + QStringList values; + QStringList gamefiles; + + for (int i = 0; i < EsmFile::FileProperty_GameFile; ++i) + { + stream >> value; + values << value; + } + + stream >> gamefiles; + + insertRows(beginRow, 1); + + QModelIndex idx = index(beginRow++, 0, QModelIndex()); + setData(idx, QStringList() << values << gamefiles, Qt::EditRole); + } + + return true; +} + +void ContentSelectorModel::ContentModel::addFile(EsmFile *file) +{ + beginInsertRows(QModelIndex(), mFiles.count(), mFiles.count()); + mFiles.append(file); + endInsertRows(); + + QModelIndex idx = index (mFiles.size() - 2, 0, QModelIndex()); + + emit dataChanged (idx, idx); +} + +void ContentSelectorModel::ContentModel::addFiles(const QString &path) +{ + QDir dir(path); + QStringList filters; + filters << "*.esp" << "*.esm" << "*.omwgame" << "*.omwaddon"; + dir.setNameFilters(filters); + + QTextCodec *codec = QTextCodec::codecForName("UTF8"); + + // Create a decoder for non-latin characters in esx metadata + QTextDecoder *decoder = codec->makeDecoder(); + + foreach (const QString &path, dir.entryList()) + { + QFileInfo info(dir.absoluteFilePath(path)); + EsmFile *file = new EsmFile(path); + + try { + ESM::ESMReader fileReader; + ToUTF8::Utf8Encoder encoder = + ToUTF8::calculateEncoding(QString(mCodec->name()).toStdString()); + fileReader.setEncoder(&encoder); + fileReader.open(dir.absoluteFilePath(path).toStdString()); + + foreach (const ESM::Header::MasterData &item, fileReader.getGameFiles()) + file->addGameFile(QString::fromStdString(item.name)); + + file->setAuthor (decoder->toUnicode(fileReader.getAuthor().c_str())); + file->setDate (info.lastModified()); + file->setFormat (fileReader.getFormat()); + file->setFilePath (info.absoluteFilePath()); + file->setDescription(decoder->toUnicode(fileReader.getDesc().c_str())); + + + // Put the file in the table + if (item(file->filePath()) == 0) + addFile(file); + + } catch(std::runtime_error &e) { + // An error occurred while reading the .esp + qWarning() << "Error reading addon file: " << e.what(); + continue; + } + + } + + delete decoder; + + sortFiles(); +} + +void ContentSelectorModel::ContentModel::sortFiles() +{ + //first, sort the model such that all dependencies are ordered upstream (gamefile) first. + bool movedFiles = true; + int fileCount = mFiles.size(); + + //Dependency sort + //iterate until no sorting of files occurs + while (movedFiles) + { + movedFiles = false; + //iterate each file, obtaining a reference to it's gamefiles list + for (int i = 0; i < fileCount; i++) + { + QModelIndex idx1 = index (i, 0, QModelIndex()); + const QStringList &gamefiles = mFiles.at(i)->gameFiles(); + //iterate each file after the current file, verifying that none of it's + //dependencies appear. + for (int j = i + 1; j < fileCount; j++) + { + if (gamefiles.contains(mFiles.at(j)->fileName())) + { + mFiles.move(j, i); + + QModelIndex idx2 = index (j, 0, QModelIndex()); + + emit dataChanged (idx1, idx2); + + movedFiles = true; + } + } + if (movedFiles) + break; + } + } +} + +bool ContentSelectorModel::ContentModel::isChecked(const QString& name) const +{ + if (mCheckStates.contains(name)) + return (mCheckStates[name] == Qt::Checked); + + return false; +} + +bool ContentSelectorModel::ContentModel::isEnabled (QModelIndex index) const +{ + return (flags(index) & Qt::ItemIsEnabled); +} + +void ContentSelectorModel::ContentModel::setCheckStates (const QStringList &fileList, bool isChecked) +{ + foreach (const QString &file, fileList) + { + setCheckState (file, isChecked); + } +} + +void ContentSelectorModel::ContentModel::refreshModel() +{ + emit dataChanged (index(0,0), index(rowCount()-1,0)); +} + +bool ContentSelectorModel::ContentModel::setCheckState(const QString &name, bool checkState) +{ + if (name.isEmpty()) + return false; + + const EsmFile *file = item(name); + + if (!file) + return false; + + Qt::CheckState state = Qt::Unchecked; + + if (checkState) + state = Qt::Checked; + + mCheckStates[name] = state; + emit dataChanged(indexFromItem(item(name)), indexFromItem(item(name))); + + if (file->isGameFile()) + refreshModel(); + + //if we're checking an item, ensure all "upstream" files (dependencies) are checked as well. + if (state == Qt::Checked) + { + foreach (QString upstreamName, file->gameFiles()) + { + const EsmFile *upstreamFile = item(upstreamName); + + if (!upstreamFile) + continue; + + if (!isChecked(upstreamFile->filePath())) + mCheckStates[upstreamFile->filePath()] = Qt::Checked; + + emit dataChanged(indexFromItem(upstreamFile), indexFromItem(upstreamFile)); + + } + } + //otherwise, if we're unchecking an item (or the file is a game file) ensure all downstream files are unchecked. + if (state == Qt::Unchecked) + { + foreach (const EsmFile *downstreamFile, mFiles) + { + if (downstreamFile->gameFiles().contains(name)) + { + if (mCheckStates.contains(downstreamFile->filePath())) + mCheckStates[downstreamFile->filePath()] = Qt::Unchecked; + + emit dataChanged(indexFromItem(downstreamFile), indexFromItem(downstreamFile)); + } + } + } + + return true; +} + +ContentSelectorModel::ContentFileList ContentSelectorModel::ContentModel::checkedItems() const +{ + ContentFileList list; + + // TODO: + // First search for game files and next addons, + // so we get more or less correct game files vs addons order. + foreach (EsmFile *file, mFiles) + if (isChecked(file->filePath())) + list << file; + + return list; +} + +void ContentSelectorModel::ContentModel::uncheckAll() +{ + emit layoutAboutToBeChanged(); + mCheckStates.clear(); + emit layoutChanged(); +} diff --git a/components/contentselector/model/contentmodel.hpp b/components/contentselector/model/contentmodel.hpp new file mode 100644 index 000000000..8c8c2124b --- /dev/null +++ b/components/contentselector/model/contentmodel.hpp @@ -0,0 +1,77 @@ +#ifndef CONTENTMODEL_HPP +#define CONTENTMODEL_HPP + +#include +#include + +namespace ContentSelectorModel +{ + class EsmFile; + + typedef QList ContentFileList; + + enum ContentType + { + ContentType_GameFile, + ContentType_Addon + }; + + class ContentModel : public QAbstractTableModel + { + Q_OBJECT + public: + explicit ContentModel(QObject *parent = 0); + + void setEncoding(const QString &encoding); + + int rowCount(const QModelIndex &parent = QModelIndex()) const; + int columnCount(const QModelIndex &parent = QModelIndex()) const; + + QVariant data(const QModelIndex &index, int role) const; + Qt::ItemFlags flags(const QModelIndex &index) const; + bool setData(const QModelIndex &index, const QVariant &value, int role = Qt::EditRole); + + bool insertRows(int position, int rows, const QModelIndex &index = QModelIndex()); + bool removeRows(int position, int rows, const QModelIndex &index = QModelIndex()); + + Qt::DropActions supportedDropActions() const; + QStringList mimeTypes() const; + QMimeData *mimeData(const QModelIndexList &indexes) const; + bool dropMimeData(const QMimeData *data, Qt::DropAction action, int row, int column, const QModelIndex &parent); + + void addFiles(const QString &path); + + QModelIndex indexFromItem(const EsmFile *item) const; + const EsmFile *item(const QString &name) const; + + bool isEnabled (QModelIndex index) const; + bool isChecked(const QString &name) const; + bool setCheckState(const QString &name, bool isChecked); + void setCheckStates (const QStringList &fileList, bool isChecked); + ContentFileList checkedItems() const; + void uncheckAll(); + + void refreshModel(); + + private: + + void addFile(EsmFile *file); + const EsmFile *item(int row) const; + EsmFile *item(int row); + + void sortFiles(); + + ContentFileList mFiles; + QHash mCheckStates; + QTextCodec *mCodec; + + public: + + QString mMimeType; + QStringList mMimeTypes; + int mColumnCount; + Qt::ItemFlags mDragDropFlags; + Qt::DropActions mDropActions; + }; +} +#endif // CONTENTMODEL_HPP diff --git a/components/contentselector/model/esmfile.cpp b/components/contentselector/model/esmfile.cpp new file mode 100644 index 000000000..a0a09105a --- /dev/null +++ b/components/contentselector/model/esmfile.cpp @@ -0,0 +1,137 @@ +#include "esmfile.hpp" + +#include +#include + +int ContentSelectorModel::EsmFile::sPropertyCount = 7; +QString ContentSelectorModel::EsmFile::sToolTip = QString("Author: %1
\ + Version: %2
\ + Path:
%3
\ +
Description:
%4
\ +
Dependencies: %5
"); + + +ContentSelectorModel::EsmFile::EsmFile(QString fileName, ModelItem *parent) + : ModelItem(parent), mFileName(fileName), mFormat(0) +{} + +void ContentSelectorModel::EsmFile::setFileName(const QString &fileName) +{ + mFileName = fileName; +} + +void ContentSelectorModel::EsmFile::setAuthor(const QString &author) +{ + mAuthor = author; +} + +void ContentSelectorModel::EsmFile::setDate(const QDateTime &modified) +{ + mModified = modified; +} + +void ContentSelectorModel::EsmFile::setFormat(int format) +{ + mFormat = format; +} + +void ContentSelectorModel::EsmFile::setFilePath(const QString &path) +{ + mPath = path; +} + +void ContentSelectorModel::EsmFile::setGameFiles(const QStringList &gamefiles) +{ + mGameFiles = gamefiles; +} + +void ContentSelectorModel::EsmFile::setDescription(const QString &description) +{ + mDescription = description; +} + +QByteArray ContentSelectorModel::EsmFile::encodedData() const +{ + QByteArray encodedData; + QDataStream stream(&encodedData, QIODevice::WriteOnly); + + stream << mFileName << mAuthor << QString::number(mFormat) + << mModified.toString() << mPath << mDescription + << mGameFiles; + + return encodedData; +} + +QVariant ContentSelectorModel::EsmFile::fileProperty(const FileProperty prop) const +{ + switch (prop) + { + case FileProperty_FileName: + return mFileName; + break; + + case FileProperty_Author: + return mAuthor; + break; + + case FileProperty_Format: + return mFormat; + break; + + case FileProperty_DateModified: + return mModified.toString(Qt::ISODate); + break; + + case FileProperty_FilePath: + return mPath; + break; + + case FileProperty_Description: + return mDescription; + break; + + case FileProperty_GameFile: + return mGameFiles; + break; + + default: + break; + } + return QVariant(); +} +void ContentSelectorModel::EsmFile::setFileProperty (const FileProperty prop, const QString &value) +{ + switch (prop) + { + case FileProperty_FileName: + mFileName = value; + break; + + case FileProperty_Author: + mAuthor = value; + break; + + case FileProperty_Format: + mFormat = value.toInt(); + break; + + case FileProperty_DateModified: + mModified = QDateTime::fromString(value); + break; + + case FileProperty_FilePath: + mPath = value; + break; + + case FileProperty_Description: + mDescription = value; + break; + + case FileProperty_GameFile: + mGameFiles << value; + break; + + default: + break; + } +} diff --git a/components/contentselector/model/esmfile.hpp b/components/contentselector/model/esmfile.hpp new file mode 100644 index 000000000..ca24b52d1 --- /dev/null +++ b/components/contentselector/model/esmfile.hpp @@ -0,0 +1,86 @@ +#ifndef ESMFILE_HPP +#define ESMFILE_HPP + +#include +#include + +#include "modelitem.hpp" + +class QMimeData; + +namespace ContentSelectorModel +{ + class EsmFile : public ModelItem + { + Q_OBJECT + Q_PROPERTY(QString filename READ fileName) + + public: + + enum FileProperty + { + FileProperty_FileName = 0, + FileProperty_Author = 1, + FileProperty_Format = 2, + FileProperty_DateModified = 3, + FileProperty_FilePath = 4, + FileProperty_Description = 5, + FileProperty_GameFile = 6 + }; + + EsmFile(QString fileName = QString(), ModelItem *parent = 0); + // EsmFile(const EsmFile &); + + ~EsmFile() + {} + + void setFileProperty (const FileProperty prop, const QString &value); + + void setFileName(const QString &fileName); + void setAuthor(const QString &author); + void setSize(const int size); + void setDate(const QDateTime &modified); + void setFormat(const int format); + void setFilePath(const QString &path); + void setGameFiles(const QStringList &gameFiles); + void setDescription(const QString &description); + + inline void addGameFile (const QString &name) {mGameFiles.append(name); } + QVariant fileProperty (const FileProperty prop) const; + + inline QString fileName() const { return mFileName; } + inline QString author() const { return mAuthor; } + inline QDateTime modified() const { return mModified; } + inline float format() const { return mFormat; } + inline QString filePath() const { return mPath; } + inline const QStringList &gameFiles() const { return mGameFiles; } + inline QString description() const { return mDescription; } + inline QString toolTip() const { return sToolTip.arg(mAuthor) + .arg(mFormat) + .arg(mPath) + .arg(mDescription) + .arg(mGameFiles.join(", ")); + } + + inline bool isGameFile() const { return (mGameFiles.size() == 0); } + QByteArray encodedData() const; + + public: + static int sPropertyCount; + static QString sToolTip; + + private: + + QString mFileName; + QString mAuthor; + QDateTime mModified; + int mFormat; + QString mPath; + QStringList mGameFiles; + QString mDescription; + QString mToolTip; + + }; +} + +#endif diff --git a/components/contentselector/model/modelitem.cpp b/components/contentselector/model/modelitem.cpp new file mode 100644 index 000000000..e1d737c2d --- /dev/null +++ b/components/contentselector/model/modelitem.cpp @@ -0,0 +1,69 @@ +#include "modelitem.hpp" + +ContentSelectorModel::ModelItem::ModelItem(ModelItem *parent) + : mParentItem(parent) +{ +} +/* +ContentSelectorModel::ModelItem::ModelItem(const ModelItem *parent) + // : mParentItem(parent) +{ +} +*/ + +ContentSelectorModel::ModelItem::~ModelItem() +{ + qDeleteAll(mChildItems); +} + + +ContentSelectorModel::ModelItem *ContentSelectorModel::ModelItem::parent() const +{ + return mParentItem; +} + +bool ContentSelectorModel::ModelItem::hasFormat(const QString &mimetype) const +{ + if (mimetype == "application/omwcontent") + return true; + + return QMimeData::hasFormat(mimetype); +} +int ContentSelectorModel::ModelItem::row() const +{ + if (mParentItem) + return 1; + //return mParentItem->childRow(const_cast(this)); + //return mParentItem->mChildItems.indexOf(const_cast(this)); + + return -1; +} + + +int ContentSelectorModel::ModelItem::childCount() const +{ + return mChildItems.count(); +} + +int ContentSelectorModel::ModelItem::childRow(ModelItem *child) const +{ + Q_ASSERT(child); + + return mChildItems.indexOf(child); +} + +ContentSelectorModel::ModelItem *ContentSelectorModel::ModelItem::child(int row) +{ + return mChildItems.value(row); +} + + +void ContentSelectorModel::ModelItem::appendChild(ModelItem *item) +{ + mChildItems.append(item); +} + +void ContentSelectorModel::ModelItem::removeChild(int row) +{ + mChildItems.removeAt(row); +} diff --git a/components/contentselector/model/modelitem.hpp b/components/contentselector/model/modelitem.hpp new file mode 100644 index 000000000..57214b09c --- /dev/null +++ b/components/contentselector/model/modelitem.hpp @@ -0,0 +1,39 @@ +#ifndef MODELITEM_HPP +#define MODELITEM_HPP + +#include +#include + +namespace ContentSelectorModel +{ + class ModelItem : public QMimeData + { + Q_OBJECT + + public: + ModelItem(ModelItem *parent = 0); + //ModelItem(const ModelItem *parent = 0); + + ~ModelItem(); + + ModelItem *parent() const; + int row() const; + + int childCount() const; + int childRow(ModelItem *child) const; + ModelItem *child(int row); + + void appendChild(ModelItem *child); + void removeChild(int row); + + bool hasFormat(const QString &mimetype) const; + + //virtual bool acceptChild(ModelItem *child); + + protected: + ModelItem *mParentItem; + QList mChildItems; + }; +} + +#endif diff --git a/components/fileorderlist/utils/naturalsort.cpp b/components/contentselector/model/naturalsort.cpp similarity index 100% rename from components/fileorderlist/utils/naturalsort.cpp rename to components/contentselector/model/naturalsort.cpp diff --git a/components/contentselector/model/naturalsort.hpp b/components/contentselector/model/naturalsort.hpp new file mode 100644 index 000000000..8386e4e9f --- /dev/null +++ b/components/contentselector/model/naturalsort.hpp @@ -0,0 +1,11 @@ +#ifndef NATURALSORT_H +#define NATURALSORT_H + +#include + + bool naturalSortLessThanCS( const QString &left, const QString &right ); + bool naturalSortLessThanCI( const QString &left, const QString &right ); + bool naturalSortGreaterThanCS( const QString &left, const QString &right ); + bool naturalSortGreaterThanCI( const QString &left, const QString &right ); + +#endif diff --git a/components/contentselector/view/combobox.cpp b/components/contentselector/view/combobox.cpp new file mode 100644 index 000000000..1d773b62d --- /dev/null +++ b/components/contentselector/view/combobox.cpp @@ -0,0 +1,39 @@ +#include +#include +#include +#include +#include + +#include "combobox.hpp" + +ContentSelectorView::ComboBox::ComboBox(QWidget *parent) : + QComboBox(parent) +{ + mValidator = new QRegExpValidator(QRegExp("^[a-zA-Z0-9_]*$"), this); // Alpha-numeric + underscore + setValidator(mValidator); + setCompleter(0); + setEnabled (true); + + setInsertPolicy(QComboBox::NoInsert); +} + +void ContentSelectorView::ComboBox::paintEvent(QPaintEvent *) +{ + QStylePainter painter(this); + painter.setPen(palette().color(QPalette::Text)); + + // draw the combobox frame, focusrect and selected etc. + QStyleOptionComboBox opt; + initStyleOption(&opt); + painter.drawComplexControl(QStyle::CC_ComboBox, opt); + + // draw the icon and text + if (!opt.editable && currentIndex() == -1) // <<< we adjust the text displayed when nothing is selected + opt.currentText = mPlaceholderText; + painter.drawControl(QStyle::CE_ComboBoxLabel, opt); +} + +void ContentSelectorView::ComboBox::setPlaceholderText(const QString &text) +{ + mPlaceholderText = text; +} diff --git a/components/contentselector/view/combobox.hpp b/components/contentselector/view/combobox.hpp new file mode 100644 index 000000000..e3888af2c --- /dev/null +++ b/components/contentselector/view/combobox.hpp @@ -0,0 +1,30 @@ +#ifndef COMBOBOX_HPP +#define COMBOBOX_HPP + +#include +#include + +class QString; +class QRegExpValidator; + +namespace ContentSelectorView +{ + class ComboBox : public QComboBox + { + Q_OBJECT + + public: + explicit ComboBox (QWidget *parent = 0); + + void setPlaceholderText(const QString &text); + + private: + QString mPlaceholderText; + + protected: + void paintEvent(QPaintEvent *); + QRegExpValidator *mValidator; + }; +} + +#endif // COMBOBOX_HPP diff --git a/components/contentselector/view/contentselector.cpp b/components/contentselector/view/contentselector.cpp new file mode 100644 index 000000000..e9599de49 --- /dev/null +++ b/components/contentselector/view/contentselector.cpp @@ -0,0 +1,203 @@ +#include "contentselector.hpp" + +#include "../model/esmfile.hpp" + +#include + +#include +#include + +#include +#include +#include +#include + +ContentSelectorView::ContentSelector::ContentSelector(QWidget *parent) : + QObject(parent) +{ + ui.setupUi (parent); + + buildContentModel(); + buildGameFileView(); + buildAddonView(); +} + +void ContentSelectorView::ContentSelector::buildContentModel() +{ + mContentModel = new ContentSelectorModel::ContentModel(); +} + +void ContentSelectorView::ContentSelector::buildGameFileView() +{ + ui.gameFileView->setVisible (true); + + mGameFileProxyModel = new QSortFilterProxyModel(this); + mGameFileProxyModel->setFilterRegExp(QString::number((int)ContentSelectorModel::ContentType_GameFile)); + mGameFileProxyModel->setFilterRole (Qt::UserRole); + mGameFileProxyModel->setSourceModel (mContentModel); + + ui.gameFileView->setPlaceholderText(QString("Select a game file...")); + ui.gameFileView->setModel(mGameFileProxyModel); + + connect (ui.gameFileView, SIGNAL (currentIndexChanged(int)), + this, SLOT (slotCurrentGameFileIndexChanged(int))); + + ui.gameFileView->setCurrentIndex(-1); + ui.gameFileView->setCurrentIndex(0); +} + +void ContentSelectorView::ContentSelector::buildAddonView() +{ + ui.addonView->setVisible (true); + + mAddonProxyModel = new QSortFilterProxyModel(this); + mAddonProxyModel->setFilterRegExp (QString::number((int)ContentSelectorModel::ContentType_Addon)); + mAddonProxyModel->setFilterRole (Qt::UserRole); + mAddonProxyModel->setDynamicSortFilter (true); + mAddonProxyModel->setSourceModel (mContentModel); + + ui.addonView->setModel(mAddonProxyModel); + + connect(ui.addonView, SIGNAL(clicked(const QModelIndex &)), this, SLOT(slotAddonTableItemClicked(const QModelIndex &))); +} + +void ContentSelectorView::ContentSelector::setProfileContent(const QStringList &fileList) +{ + clearCheckStates(); + bool foundGamefile = false; + + foreach (const QString &filepath, fileList) + { + if (!foundGamefile) + { + const ContentSelectorModel::EsmFile *file = mContentModel->item(filepath); + + foundGamefile = (file->isGameFile()); + + if (foundGamefile) + { + setGameFile (filepath); + break; + } + } + } + +/* if (!foundGameFile) + { + //throw gamefile error here. + }*/ + + setCheckStates (fileList); +} + +void ContentSelectorView::ContentSelector::setGameFile(const QString &filename) +{ + int index = -1; + + if (!filename.isEmpty()) + { + const ContentSelectorModel::EsmFile *file = mContentModel->item (filename); + index = ui.gameFileView->findText (file->fileName()); + + //verify that the current index is also checked in the model + if (!mContentModel->setCheckState(filename, true)) + { + //throw error in case file not found? + return; + } + } + + ui.gameFileView->setCurrentIndex(index); +} + +void ContentSelectorView::ContentSelector::clearCheckStates() +{ + mContentModel->uncheckAll(); +} + +void ContentSelectorView::ContentSelector::setCheckStates(const QStringList &list) +{ + if (list.isEmpty()) + { + slotCurrentGameFileIndexChanged (ui.gameFileView->currentIndex()); + } + else + mContentModel->setCheckStates (list, true); +} + +ContentSelectorModel::ContentFileList + ContentSelectorView::ContentSelector::selectedFiles() const +{ + if (!mContentModel) + return ContentSelectorModel::ContentFileList(); + + return mContentModel->checkedItems(); +} + +void ContentSelectorView::ContentSelector::addFiles(const QString &path) +{ + mContentModel->addFiles(path); + + if (ui.gameFileView->currentIndex() != -1) + ui.gameFileView->setCurrentIndex(-1); + + mContentModel->uncheckAll(); +} + +QString ContentSelectorView::ContentSelector::currentFile() const +{ + QModelIndex currentIdx = ui.addonView->currentIndex(); + + if (!currentIdx.isValid()) + return ui.gameFileView->currentText(); + + QModelIndex idx = mContentModel->index(mAddonProxyModel->mapToSource(currentIdx).row(), 0, QModelIndex()); + return mContentModel->data(idx, Qt::DisplayRole).toString(); +} + +void ContentSelectorView::ContentSelector::slotCurrentGameFileIndexChanged(int index) +{ + static int oldIndex = -1; + + QAbstractItemModel *const model = ui.gameFileView->model(); + QSortFilterProxyModel *proxy = dynamic_cast(model); + + if (proxy) + proxy->setDynamicSortFilter(false); + + if (index != oldIndex) + { + if (oldIndex > -1) + model->setData(model->index(oldIndex, 0), false, Qt::UserRole + 1); + + oldIndex = index; + + model->setData(model->index(index, 0), true, Qt::UserRole + 1); + } + + if (proxy) + proxy->setDynamicSortFilter(true); + + emit signalCurrentGamefileIndexChanged (index); +} + +void ContentSelectorView::ContentSelector::slotAddonTableItemClicked(const QModelIndex &index) +{ + QModelIndex sourceIndex = mAddonProxyModel->mapToSource (index); + + if (!mContentModel->isEnabled (sourceIndex)) + return; + + Qt::CheckState checkState = Qt::Unchecked; + + if (mContentModel->data(sourceIndex, Qt::CheckStateRole).toInt() == Qt::Unchecked) + checkState = Qt::Checked; + + mContentModel->setData(sourceIndex, checkState, Qt::CheckStateRole); + + if (checkState == Qt::Checked) + emit signalAddonFileSelected (index.row()); + else + emit signalAddonFileUnselected (index.row()); + +} diff --git a/components/contentselector/view/contentselector.hpp b/components/contentselector/view/contentselector.hpp new file mode 100644 index 000000000..a25eb20ae --- /dev/null +++ b/components/contentselector/view/contentselector.hpp @@ -0,0 +1,68 @@ +#ifndef CONTENTSELECTOR_HPP +#define CONTENTSELECTOR_HPP + +#include + +#include "ui_contentselector.h" +#include "../model/contentmodel.hpp" + +class QSortFilterProxyModel; + +namespace ContentSelectorView +{ + class ContentSelector : public QObject + { + Q_OBJECT + + QStringList mFilePaths; + + protected: + + ContentSelectorModel::ContentModel *mContentModel; + QSortFilterProxyModel *mGameFileProxyModel; + QSortFilterProxyModel *mAddonProxyModel; + + public: + + explicit ContentSelector(QWidget *parent = 0); + + QString currentFile() const; + + void addFiles(const QString &path); + void setProfileContent (const QStringList &fileList); + + void clearCheckStates(); + void setCheckStates (const QStringList &list); + + ContentSelectorModel::ContentFileList selectedFiles() const; + + void setGameFile (const QString &filename = QString("")); + + bool isGamefileSelected() const + { return ui.gameFileView->currentIndex() != -1; } + + QWidget *uiWidget() const + { return ui.contentGroupBox; } + + + private: + + Ui::ContentSelector ui; + + void buildContentModel(); + void buildGameFileView(); + void buildAddonView(); + + signals: + void signalCurrentGamefileIndexChanged (int); + void signalAddonFileSelected (int); + void signalAddonFileUnselected (int); + + private slots: + + void slotCurrentGameFileIndexChanged(int index); + void slotAddonTableItemClicked(const QModelIndex &index); + }; +} + +#endif // CONTENTSELECTOR_HPP diff --git a/components/esm/aipackage.cpp b/components/esm/aipackage.cpp index 1440dbd13..cf4951de7 100644 --- a/components/esm/aipackage.cpp +++ b/components/esm/aipackage.cpp @@ -44,9 +44,9 @@ namespace ESM } } - void AIPackageList::save(ESMWriter &esm) + void AIPackageList::save(ESMWriter &esm) const { - typedef std::vector::iterator PackageIter; + typedef std::vector::const_iterator PackageIter; for (PackageIter it = mList.begin(); it != mList.end(); ++it) { switch (it->mType) { case AI_Wander: diff --git a/components/esm/aipackage.hpp b/components/esm/aipackage.hpp index 38499b2dd..b06cb529a 100644 --- a/components/esm/aipackage.hpp +++ b/components/esm/aipackage.hpp @@ -93,7 +93,7 @@ namespace ESM /// it needs to use retSubName() if needed. But, hey, there /// is only one field left (XSCL) and only two records uses AI void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; } diff --git a/components/esm/cellref.cpp b/components/esm/cellref.cpp index 95cf24d33..e91059b26 100644 --- a/components/esm/cellref.cpp +++ b/components/esm/cellref.cpp @@ -3,7 +3,7 @@ #include "esmwriter.hpp" -void ESM::CellRef::save(ESMWriter &esm) +void ESM::CellRef::save(ESMWriter &esm) const { esm.writeHNT("FRMR", mRefnum); esm.writeHNCString("NAME", mRefID); diff --git a/components/esm/cellref.hpp b/components/esm/cellref.hpp index 31889914c..47cb0b99e 100644 --- a/components/esm/cellref.hpp +++ b/components/esm/cellref.hpp @@ -83,7 +83,7 @@ namespace ESM // Position and rotation of this object within the cell Position mPos; - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); }; diff --git a/components/esm/defs.hpp b/components/esm/defs.hpp index bd86f9ba0..dd7ebfe93 100644 --- a/components/esm/defs.hpp +++ b/components/esm/defs.hpp @@ -36,6 +36,7 @@ struct Position enum RecNameInts { + // format 0 / legacy REC_ACTI = 0x49544341, REC_ALCH = 0x48434c41, REC_APPA = 0x41505041, @@ -80,7 +81,10 @@ enum RecNameInts REC_SPEL = 0x4c455053, REC_SSCR = 0x52435353, REC_STAT = 0x54415453, - REC_WEAP = 0x50414557 + REC_WEAP = 0x50414557, + + // format 1 + REC_FILT = 0x544C4946 }; } diff --git a/components/esm/effectlist.cpp b/components/esm/effectlist.cpp index 88f87d6e2..bc126846b 100644 --- a/components/esm/effectlist.cpp +++ b/components/esm/effectlist.cpp @@ -14,9 +14,9 @@ void EffectList::load(ESMReader &esm) } } -void EffectList::save(ESMWriter &esm) +void EffectList::save(ESMWriter &esm) const { - for (std::vector::iterator it = mList.begin(); it != mList.end(); ++it) { + for (std::vector::const_iterator it = mList.begin(); it != mList.end(); ++it) { esm.writeHNT("ENAM", *it, 24); } } diff --git a/components/esm/effectlist.hpp b/components/esm/effectlist.hpp index 9f5b87aed..04adcc5cd 100644 --- a/components/esm/effectlist.hpp +++ b/components/esm/effectlist.hpp @@ -35,9 +35,9 @@ namespace ESM std::vector mList; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; - + } #endif diff --git a/components/esm/esmreader.hpp b/components/esm/esmreader.hpp index edc724cd2..3bf194c4e 100644 --- a/components/esm/esmreader.hpp +++ b/components/esm/esmreader.hpp @@ -34,7 +34,7 @@ public: float getFVer() const { if(mHeader.mData.version == VER_12) return 1.2; else return 1.3; } const std::string getAuthor() const { return mHeader.mData.author.toString(); } const std::string getDesc() const { return mHeader.mData.desc.toString(); } - const std::vector &getMasters() const { return mHeader.mMaster; } + const std::vector &getGameFiles() const { return mHeader.mMaster; } int getFormat() const; const NAME &retSubName() const { return mCtx.subName; } uint32_t getSubSize() const { return mCtx.leftSub; } diff --git a/components/esm/esmwriter.cpp b/components/esm/esmwriter.cpp index 3ea6bd350..f39aa2b89 100644 --- a/components/esm/esmwriter.cpp +++ b/components/esm/esmwriter.cpp @@ -2,185 +2,188 @@ #include #include -#include - -bool count = true; +#include namespace ESM { + ESMWriter::ESMWriter() : mRecordCount (0), mCounting (true) {} -int ESMWriter::getVersion() -{ - return mHeader.mData.version; -} - -void ESMWriter::setVersion(int ver) -{ - mHeader.mData.version = ver; -} - -void ESMWriter::setAuthor(const std::string& auth) -{ - mHeader.mData.author.assign (auth); -} - -void ESMWriter::setDescription(const std::string& desc) -{ - mHeader.mData.desc.assign (desc); -} - -void ESMWriter::setRecordCount (int count) -{ - mHeader.mData.records = count; -} - -void ESMWriter::setFormat (int format) -{ - mHeader.mFormat = format; -} - -void ESMWriter::addMaster(const std::string& name, uint64_t size) -{ - Header::MasterData d; - d.name = name; - d.size = size; - mHeader.mMaster.push_back(d); -} - -void ESMWriter::save(const std::string& file) -{ - std::ofstream fs(file.c_str(), std::ios_base::out | std::ios_base::trunc); - save(fs); -} - -void ESMWriter::save(std::ostream& file) -{ - m_recordCount = 0; - m_stream = &file; - - startRecord("TES3", 0); - - mHeader.save (*this); - - endRecord("TES3"); -} - -void ESMWriter::close() -{ - m_stream->flush(); - - if (!m_records.empty()) - throw "Unclosed record remaining"; -} - -void ESMWriter::startRecord(const std::string& name, uint32_t flags) -{ - m_recordCount++; - - writeName(name); - RecordData rec; - rec.name = name; - rec.position = m_stream->tellp(); - rec.size = 0; - writeT(0); // Size goes here - writeT(0); // Unused header? - writeT(flags); - m_records.push_back(rec); - - assert(m_records.back().size == 0); -} - -void ESMWriter::startSubRecord(const std::string& name) -{ - writeName(name); - RecordData rec; - rec.name = name; - rec.position = m_stream->tellp(); - rec.size = 0; - writeT(0); // Size goes here - m_records.push_back(rec); - - assert(m_records.back().size == 0); -} - -void ESMWriter::endRecord(const std::string& name) -{ - RecordData rec = m_records.back(); - assert(rec.name == name); - m_records.pop_back(); - - m_stream->seekp(rec.position); - - count = false; - write((char*)&rec.size, sizeof(int)); - count = true; - - m_stream->seekp(0, std::ios::end); - -} - -void ESMWriter::writeHNString(const std::string& name, const std::string& data) -{ - startSubRecord(name); - writeHString(data); - endRecord(name); -} - -void ESMWriter::writeHNString(const std::string& name, const std::string& data, size_t size) -{ - assert(data.size() <= size); - startSubRecord(name); - writeHString(data); - - if (data.size() < size) + unsigned int ESMWriter::getVersion() const { - for (size_t i = data.size(); i < size; ++i) - write("\0",1); + return mHeader.mData.version; } - endRecord(name); -} - -void ESMWriter::writeHString(const std::string& data) -{ - if (data.size() == 0) - write("\0", 1); - else + void ESMWriter::setVersion(unsigned int ver) { - // Convert to UTF8 and return - std::string ascii = m_encoder->getLegacyEnc(data); - - write(ascii.c_str(), ascii.size()); - } -} - -void ESMWriter::writeHCString(const std::string& data) -{ - writeHString(data); - if (data.size() > 0 && data[data.size()-1] != '\0') - write("\0", 1); -} - -void ESMWriter::writeName(const std::string& name) -{ - assert((name.size() == 4 && name[3] != '\0')); - write(name.c_str(), name.size()); -} - -void ESMWriter::write(const char* data, size_t size) -{ - if (count && !m_records.empty()) - { - for (std::list::iterator it = m_records.begin(); it != m_records.end(); ++it) - it->size += size; + mHeader.mData.version = ver; } - m_stream->write(data, size); -} + void ESMWriter::setAuthor(const std::string& auth) + { + mHeader.mData.author.assign (auth); + } -void ESMWriter::setEncoder(ToUTF8::Utf8Encoder* encoder) -{ - m_encoder = encoder; -} + void ESMWriter::setDescription(const std::string& desc) + { + mHeader.mData.desc.assign (desc); + } + void ESMWriter::setRecordCount (int count) + { + mHeader.mData.records = count; + } + + void ESMWriter::setFormat (int format) + { + mHeader.mFormat = format; + } + + void ESMWriter::clearMaster() + { + mHeader.mMaster.clear(); + } + + void ESMWriter::addMaster(const std::string& name, uint64_t size) + { + Header::MasterData d; + d.name = name; + d.size = size; + mHeader.mMaster.push_back(d); + } + + void ESMWriter::save(const std::string& file) + { + std::ofstream fs(file.c_str(), std::ios_base::out | std::ios_base::trunc); + save(fs); + } + + void ESMWriter::save(std::ostream& file) + { + mRecordCount = 0; + mRecords.clear(); + mCounting = true; + mStream = &file; + + startRecord("TES3", 0); + + mHeader.save (*this); + + endRecord("TES3"); + } + + void ESMWriter::close() + { + if (!mRecords.empty()) + throw std::runtime_error ("Unclosed record remaining"); + } + + void ESMWriter::startRecord(const std::string& name, uint32_t flags) + { + mRecordCount++; + + writeName(name); + RecordData rec; + rec.name = name; + rec.position = mStream->tellp(); + rec.size = 0; + writeT(0); // Size goes here + writeT(0); // Unused header? + writeT(flags); + mRecords.push_back(rec); + + assert(mRecords.back().size == 0); + } + + void ESMWriter::startSubRecord(const std::string& name) + { + writeName(name); + RecordData rec; + rec.name = name; + rec.position = mStream->tellp(); + rec.size = 0; + writeT(0); // Size goes here + mRecords.push_back(rec); + + assert(mRecords.back().size == 0); + } + + void ESMWriter::endRecord(const std::string& name) + { + RecordData rec = mRecords.back(); + assert(rec.name == name); + mRecords.pop_back(); + + mStream->seekp(rec.position); + + mCounting = false; + write (reinterpret_cast (&rec.size), sizeof(int)); + mCounting = true; + + mStream->seekp(0, std::ios::end); + + } + + void ESMWriter::writeHNString(const std::string& name, const std::string& data) + { + startSubRecord(name); + writeHString(data); + endRecord(name); + } + + void ESMWriter::writeHNString(const std::string& name, const std::string& data, size_t size) + { + assert(data.size() <= size); + startSubRecord(name); + writeHString(data); + + if (data.size() < size) + { + for (size_t i = data.size(); i < size; ++i) + write("\0",1); + } + + endRecord(name); + } + + void ESMWriter::writeHString(const std::string& data) + { + if (data.size() == 0) + write("\0", 1); + else + { + // Convert to UTF8 and return + std::string ascii = mEncoder->getLegacyEnc(data); + + write(ascii.c_str(), ascii.size()); + } + } + + void ESMWriter::writeHCString(const std::string& data) + { + writeHString(data); + if (data.size() > 0 && data[data.size()-1] != '\0') + write("\0", 1); + } + + void ESMWriter::writeName(const std::string& name) + { + assert((name.size() == 4 && name[3] != '\0')); + write(name.c_str(), name.size()); + } + + void ESMWriter::write(const char* data, size_t size) + { + if (mCounting && !mRecords.empty()) + { + for (std::list::iterator it = mRecords.begin(); it != mRecords.end(); ++it) + it->size += size; + } + + mStream->write(data, size); + } + + void ESMWriter::setEncoder(ToUTF8::Utf8Encoder* encoder) + { + mEncoder = encoder; + } } diff --git a/components/esm/esmwriter.hpp b/components/esm/esmwriter.hpp index be3ae33ab..104f97f90 100644 --- a/components/esm/esmwriter.hpp +++ b/components/esm/esmwriter.hpp @@ -13,92 +13,103 @@ namespace ESM { class ESMWriter { - struct RecordData - { - std::string name; - std::streampos position; - size_t size; + struct RecordData + { + std::string name; + std::streampos position; + size_t size; + }; + + public: + + ESMWriter(); + + unsigned int getVersion() const; + void setVersion(unsigned int ver = 0x3fa66666); + void setEncoder(ToUTF8::Utf8Encoder *encoding); + void setAuthor(const std::string& author); + void setDescription(const std::string& desc); + void setRecordCount (int count); + void setFormat (int format); + + void clearMaster(); + + void addMaster(const std::string& name, uint64_t size); + + void save(const std::string& file); + ///< Start saving a file by writing the TES3 header. + + void save(std::ostream& file); + ///< Start saving a file by writing the TES3 header. + + void close(); + ///< \note Does not close the stream. + + void writeHNString(const std::string& name, const std::string& data); + void writeHNString(const std::string& name, const std::string& data, size_t size); + void writeHNCString(const std::string& name, const std::string& data) + { + startSubRecord(name); + writeHCString(data); + endRecord(name); + } + void writeHNOString(const std::string& name, const std::string& data) + { + if (!data.empty()) + writeHNString(name, data); + } + void writeHNOCString(const std::string& name, const std::string& data) + { + if (!data.empty()) + writeHNCString(name, data); + } + + template + void writeHNT(const std::string& name, const T& data) + { + startSubRecord(name); + writeT(data); + endRecord(name); + } + + template + void writeHNT(const std::string& name, const T& data, int size) + { + startSubRecord(name); + writeT(data, size); + endRecord(name); + } + + template + void writeT(const T& data) + { + write((char*)&data, sizeof(T)); + } + + template + void writeT(const T& data, size_t size) + { + write((char*)&data, size); + } + + void startRecord(const std::string& name, uint32_t flags = 0); + void startSubRecord(const std::string& name); + void endRecord(const std::string& name); + void writeHString(const std::string& data); + void writeHCString(const std::string& data); + void writeName(const std::string& data); + void write(const char* data, size_t size); + + private: + std::list mRecords; + std::ostream* mStream; + std::streampos mHeaderPos; + ToUTF8::Utf8Encoder* mEncoder; + int mRecordCount; + bool mCounting; + + Header mHeader; }; - -public: - int getVersion(); - void setVersion(int ver); - void setEncoder(ToUTF8::Utf8Encoder *encoding); // Write strings as UTF-8? - void setAuthor(const std::string& author); - void setDescription(const std::string& desc); - void setRecordCount (int count); - void setFormat (int format); - - void addMaster(const std::string& name, uint64_t size); - - void save(const std::string& file); - void save(std::ostream& file); - void close(); - - void writeHNString(const std::string& name, const std::string& data); - void writeHNString(const std::string& name, const std::string& data, size_t size); - void writeHNCString(const std::string& name, const std::string& data) - { - startSubRecord(name); - writeHCString(data); - endRecord(name); - } - void writeHNOString(const std::string& name, const std::string& data) - { - if (!data.empty()) - writeHNString(name, data); - } - void writeHNOCString(const std::string& name, const std::string& data) - { - if (!data.empty()) - writeHNCString(name, data); - } - - template - void writeHNT(const std::string& name, const T& data) - { - startSubRecord(name); - writeT(data); - endRecord(name); - } - - template - void writeHNT(const std::string& name, const T& data, int size) - { - startSubRecord(name); - writeT(data, size); - endRecord(name); - } - - template - void writeT(const T& data) - { - write((char*)&data, sizeof(T)); - } - - template - void writeT(const T& data, size_t size) - { - write((char*)&data, size); - } - - void startRecord(const std::string& name, uint32_t flags); - void startSubRecord(const std::string& name); - void endRecord(const std::string& name); - void writeHString(const std::string& data); - void writeHCString(const std::string& data); - void writeName(const std::string& data); - void write(const char* data, size_t size); - -private: - std::list m_records; - std::ostream* m_stream; - std::streampos m_headerPos; - ToUTF8::Utf8Encoder* m_encoder; - int m_recordCount; - - Header mHeader; -}; - } + #endif diff --git a/components/esm/filter.cpp b/components/esm/filter.cpp index 7d4851a5f..a80427bbe 100644 --- a/components/esm/filter.cpp +++ b/components/esm/filter.cpp @@ -3,6 +3,9 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" + +unsigned int ESM::Filter::sRecordId = REC_FILT; void ESM::Filter::load (ESMReader& esm) { @@ -10,7 +13,7 @@ void ESM::Filter::load (ESMReader& esm) mDescription = esm.getHNString ("DESC"); } -void ESM::Filter::save (ESMWriter& esm) +void ESM::Filter::save (ESMWriter& esm) const { esm.writeHNCString ("FILT", mFilter); esm.writeHNCString ("DESC", mDescription); diff --git a/components/esm/filter.hpp b/components/esm/filter.hpp index 0fd564361..bc3dd7bdc 100644 --- a/components/esm/filter.hpp +++ b/components/esm/filter.hpp @@ -10,6 +10,8 @@ namespace ESM struct Filter { + static unsigned int sRecordId; + std::string mId; std::string mDescription; @@ -17,7 +19,7 @@ namespace ESM std::string mFilter; void load (ESMReader& esm); - void save (ESMWriter& esm); + void save (ESMWriter& esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadacti.cpp b/components/esm/loadacti.cpp index fd022af7e..6ba0df0b3 100644 --- a/components/esm/loadacti.cpp +++ b/components/esm/loadacti.cpp @@ -2,16 +2,19 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Activator::sRecordId = REC_ACTI; + void Activator::load(ESMReader &esm) { mModel = esm.getHNString("MODL"); mName = esm.getHNString("FNAM"); mScript = esm.getHNOString("SCRI"); } -void Activator::save(ESMWriter &esm) +void Activator::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNCString("FNAM", mName); diff --git a/components/esm/loadacti.hpp b/components/esm/loadacti.hpp index a62990590..88f27de27 100644 --- a/components/esm/loadacti.hpp +++ b/components/esm/loadacti.hpp @@ -11,10 +11,12 @@ class ESMWriter; struct Activator { + static unsigned int sRecordId; + std::string mId, mName, mScript, mModel; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadalch.cpp b/components/esm/loadalch.cpp index dbb69c066..f6bfc6a11 100644 --- a/components/esm/loadalch.cpp +++ b/components/esm/loadalch.cpp @@ -2,9 +2,12 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Potion::sRecordId = REC_ALCH; + void Potion::load(ESMReader &esm) { mModel = esm.getHNString("MODL"); @@ -14,7 +17,7 @@ void Potion::load(ESMReader &esm) esm.getHNT(mData, "ALDT", 12); mEffects.load(esm); } -void Potion::save(ESMWriter &esm) +void Potion::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("TEXT", mIcon); diff --git a/components/esm/loadalch.hpp b/components/esm/loadalch.hpp index 3ede85342..141765aa8 100644 --- a/components/esm/loadalch.hpp +++ b/components/esm/loadalch.hpp @@ -17,6 +17,8 @@ class ESMWriter; struct Potion { + static unsigned int sRecordId; + struct ALDTstruct { float mWeight; @@ -29,7 +31,7 @@ struct Potion EffectList mEffects; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadappa.cpp b/components/esm/loadappa.cpp index 4b8d2b763..29ea78acc 100644 --- a/components/esm/loadappa.cpp +++ b/components/esm/loadappa.cpp @@ -2,9 +2,12 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Apparatus::sRecordId = REC_APPA; + void Apparatus::load(ESMReader &esm) { // we will not treat duplicated subrecords as errors here @@ -28,7 +31,7 @@ void Apparatus::load(ESMReader &esm) } } -void Apparatus::save(ESMWriter &esm) +void Apparatus::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNCString("FNAM", mName); diff --git a/components/esm/loadappa.hpp b/components/esm/loadappa.hpp index ed9d335be..adc8e071f 100644 --- a/components/esm/loadappa.hpp +++ b/components/esm/loadappa.hpp @@ -15,6 +15,8 @@ class ESMWriter; struct Apparatus { + static unsigned int sRecordId; + enum AppaType { MortarPestle = 0, @@ -35,7 +37,7 @@ struct Apparatus std::string mId, mModel, mIcon, mScript, mName; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadarmo.cpp b/components/esm/loadarmo.cpp index e64c8705d..ec8ff4f20 100644 --- a/components/esm/loadarmo.cpp +++ b/components/esm/loadarmo.cpp @@ -2,6 +2,7 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { @@ -18,9 +19,9 @@ void PartReferenceList::load(ESMReader &esm) } } -void PartReferenceList::save(ESMWriter &esm) +void PartReferenceList::save(ESMWriter &esm) const { - for (std::vector::iterator it = mParts.begin(); it != mParts.end(); ++it) + for (std::vector::const_iterator it = mParts.begin(); it != mParts.end(); ++it) { esm.writeHNT("INDX", it->mPart); esm.writeHNOString("BNAM", it->mMale); @@ -28,6 +29,8 @@ void PartReferenceList::save(ESMWriter &esm) } } +unsigned int Armor::sRecordId = REC_ARMO; + void Armor::load(ESMReader &esm) { mModel = esm.getHNString("MODL"); @@ -39,7 +42,7 @@ void Armor::load(ESMReader &esm) mEnchant = esm.getHNOString("ENAM"); } -void Armor::save(ESMWriter &esm) +void Armor::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNCString("FNAM", mName); diff --git a/components/esm/loadarmo.hpp b/components/esm/loadarmo.hpp index eaef42be8..991f4e185 100644 --- a/components/esm/loadarmo.hpp +++ b/components/esm/loadarmo.hpp @@ -56,11 +56,13 @@ struct PartReferenceList std::vector mParts; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; struct Armor { + static unsigned int sRecordId; + enum Type { Helmet = 0, @@ -89,7 +91,7 @@ struct Armor std::string mId, mName, mModel, mIcon, mScript, mEnchant; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadbody.cpp b/components/esm/loadbody.cpp index e95a8a860..4015e6c91 100644 --- a/components/esm/loadbody.cpp +++ b/components/esm/loadbody.cpp @@ -2,9 +2,12 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int BodyPart::sRecordId = REC_BODY; + void BodyPart::load(ESMReader &esm) { @@ -12,7 +15,7 @@ void BodyPart::load(ESMReader &esm) mRace = esm.getHNString("FNAM"); esm.getHNT(mData, "BYDT", 4); } -void BodyPart::save(ESMWriter &esm) +void BodyPart::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNCString("FNAM", mRace); diff --git a/components/esm/loadbody.hpp b/components/esm/loadbody.hpp index 3ad9b1b95..9623caa31 100644 --- a/components/esm/loadbody.hpp +++ b/components/esm/loadbody.hpp @@ -11,6 +11,8 @@ class ESMWriter; struct BodyPart { + static unsigned int sRecordId; + enum MeshPart { MP_Head = 0, @@ -57,7 +59,7 @@ struct BodyPart std::string mId, mModel, mRace; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; } #endif diff --git a/components/esm/loadbook.cpp b/components/esm/loadbook.cpp index 3a70ac786..c8b7e9478 100644 --- a/components/esm/loadbook.cpp +++ b/components/esm/loadbook.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Book::sRecordId = REC_BOOK; void Book::load(ESMReader &esm) { @@ -16,7 +18,7 @@ void Book::load(ESMReader &esm) mText = esm.getHNOString("TEXT"); mEnchant = esm.getHNOString("ENAM"); } -void Book::save(ESMWriter &esm) +void Book::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("FNAM", mName); diff --git a/components/esm/loadbook.hpp b/components/esm/loadbook.hpp index 68042e246..f96fbd709 100644 --- a/components/esm/loadbook.hpp +++ b/components/esm/loadbook.hpp @@ -14,6 +14,8 @@ class ESMWriter; struct Book { + static unsigned int sRecordId; + struct BKDTstruct { float mWeight; @@ -25,7 +27,7 @@ struct Book std::string mId; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadbsgn.cpp b/components/esm/loadbsgn.cpp index cb500f674..55e1e7f65 100644 --- a/components/esm/loadbsgn.cpp +++ b/components/esm/loadbsgn.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int BirthSign::sRecordId = REC_BSGN; void BirthSign::load(ESMReader &esm) { @@ -15,7 +17,7 @@ void BirthSign::load(ESMReader &esm) mPowers.load(esm); } -void BirthSign::save(ESMWriter &esm) +void BirthSign::save(ESMWriter &esm) const { esm.writeHNCString("FNAM", mName); esm.writeHNOCString("TNAM", mTexture); diff --git a/components/esm/loadbsgn.hpp b/components/esm/loadbsgn.hpp index 434ddf68e..9f9435c8f 100644 --- a/components/esm/loadbsgn.hpp +++ b/components/esm/loadbsgn.hpp @@ -13,13 +13,15 @@ class ESMWriter; struct BirthSign { + static unsigned int sRecordId; + std::string mId, mName, mDescription, mTexture; // List of powers and abilities that come with this birth sign. SpellList mPowers; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadcell.cpp b/components/esm/loadcell.cpp index d8d0c1291..c22c1b22b 100644 --- a/components/esm/loadcell.cpp +++ b/components/esm/loadcell.cpp @@ -7,9 +7,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Cell::sRecordId = REC_CELL; /// Some overloaded compare operators. bool operator==(const MovedCellRef& ref, int pRefnum) @@ -89,7 +91,7 @@ void Cell::postLoad(ESMReader &esm) esm.skipRecord(); } -void Cell::save(ESMWriter &esm) +void Cell::save(ESMWriter &esm) const { esm.writeHNT("DATA", mData, 12); if (mData.mFlags & Interior) @@ -172,7 +174,7 @@ bool Cell::getNextRef(ESMReader &esm, CellRef &ref) // If the most significant 8 bits are used, then this reference already exists. // In this case, do not spawn a new reference, but overwrite the old one. ref.mRefnum &= 0x00ffffff; // delete old plugin ID - const std::vector &masters = esm.getMasters(); + const std::vector &masters = esm.getGameFiles(); global = masters[local-1].index + 1; ref.mRefnum |= global << 24; // insert global plugin ID } @@ -276,7 +278,7 @@ bool Cell::getNextMVRF(ESMReader &esm, MovedCellRef &mref) int local = (mref.mRefnum & 0xff000000) >> 24; size_t global = esm.getIndex() + 1; mref.mRefnum &= 0x00ffffff; // delete old plugin ID - const std::vector &masters = esm.getMasters(); + const std::vector &masters = esm.getGameFiles(); global = masters[local-1].index + 1; mref.mRefnum |= global << 24; // insert global plugin ID diff --git a/components/esm/loadcell.hpp b/components/esm/loadcell.hpp index 51288b291..61d586b9d 100644 --- a/components/esm/loadcell.hpp +++ b/components/esm/loadcell.hpp @@ -16,7 +16,6 @@ namespace MWWorld namespace ESM { - class ESMReader; class ESMWriter; @@ -55,6 +54,8 @@ typedef std::list CellRefTracker; */ struct Cell { + static unsigned int sRecordId; + enum Flags { Interior = 0x01, // Interior cell @@ -102,7 +103,7 @@ struct Cell // This method is left in for compatibility with esmtool. Parsing moved references currently requires // passing ESMStore, bit it does not know about this parameter, so we do it this way. void load(ESMReader &esm, bool saveContext = true); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; bool isExterior() const { diff --git a/components/esm/loadclas.cpp b/components/esm/loadclas.cpp index bdc461462..33489eec4 100644 --- a/components/esm/loadclas.cpp +++ b/components/esm/loadclas.cpp @@ -4,9 +4,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Class::sRecordId = REC_CLAS; const Class::Specialization Class::sSpecializationIds[3] = { Class::Combat, @@ -47,7 +49,7 @@ void Class::load(ESMReader &esm) mDescription = esm.getHNOString("DESC"); } -void Class::save(ESMWriter &esm) +void Class::save(ESMWriter &esm) const { esm.writeHNCString("FNAM", mName); esm.writeHNT("CLDT", mData, 60); diff --git a/components/esm/loadclas.hpp b/components/esm/loadclas.hpp index 4f85e6ee8..3e489bb58 100644 --- a/components/esm/loadclas.hpp +++ b/components/esm/loadclas.hpp @@ -17,6 +17,8 @@ class ESMWriter; // class struct Class { + static unsigned int sRecordId; + enum AutoCalc { Weapon = 0x00001, @@ -70,7 +72,7 @@ struct Class CLDTstruct mData; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadclot.cpp b/components/esm/loadclot.cpp index 10b00970f..d64564d77 100644 --- a/components/esm/loadclot.cpp +++ b/components/esm/loadclot.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Clothing::sRecordId = REC_CLOT; void Clothing::load(ESMReader &esm) { @@ -20,7 +22,7 @@ void Clothing::load(ESMReader &esm) mEnchant = esm.getHNOString("ENAM"); } -void Clothing::save(ESMWriter &esm) +void Clothing::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("FNAM", mName); diff --git a/components/esm/loadclot.hpp b/components/esm/loadclot.hpp index 816d03cb2..50896622a 100644 --- a/components/esm/loadclot.hpp +++ b/components/esm/loadclot.hpp @@ -17,6 +17,8 @@ class ESMWriter; struct Clothing { + static unsigned int sRecordId; + enum Type { Pants = 0, @@ -45,7 +47,7 @@ struct Clothing std::string mId, mName, mModel, mIcon, mEnchant, mScript; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadcont.cpp b/components/esm/loadcont.cpp index 853c8bd50..7bdf9f05b 100644 --- a/components/esm/loadcont.cpp +++ b/components/esm/loadcont.cpp @@ -2,6 +2,7 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { @@ -16,14 +17,16 @@ void InventoryList::load(ESMReader &esm) } } -void InventoryList::save(ESMWriter &esm) +void InventoryList::save(ESMWriter &esm) const { - for (std::vector::iterator it = mList.begin(); it != mList.end(); ++it) + for (std::vector::const_iterator it = mList.begin(); it != mList.end(); ++it) { esm.writeHNT("NPCO", *it, 36); } } + unsigned int Container::sRecordId = REC_CONT; + void Container::load(ESMReader &esm) { mModel = esm.getHNString("MODL"); @@ -41,7 +44,7 @@ void Container::load(ESMReader &esm) mInventory.load(esm); } -void Container::save(ESMWriter &esm) +void Container::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("FNAM", mName); diff --git a/components/esm/loadcont.hpp b/components/esm/loadcont.hpp index b2bbab73d..2808b67b5 100644 --- a/components/esm/loadcont.hpp +++ b/components/esm/loadcont.hpp @@ -27,11 +27,13 @@ struct InventoryList std::vector mList; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; struct Container { + static unsigned int sRecordId; + enum Flags { Organic = 1, // Objects cannot be placed in this container @@ -46,7 +48,7 @@ struct Container InventoryList mInventory; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadcrea.cpp b/components/esm/loadcrea.cpp index 86d05b8a5..650de0801 100644 --- a/components/esm/loadcrea.cpp +++ b/components/esm/loadcrea.cpp @@ -2,9 +2,12 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Creature::sRecordId = REC_CREA; + void Creature::load(ESMReader &esm) { mPersistent = esm.getRecordFlags() & 0x0400; @@ -35,7 +38,7 @@ void Creature::load(ESMReader &esm) esm.skipRecord(); } -void Creature::save(ESMWriter &esm) +void Creature::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("CNAM", mOriginal); diff --git a/components/esm/loadcrea.hpp b/components/esm/loadcrea.hpp index 279e2ea3f..99c4f5225 100644 --- a/components/esm/loadcrea.hpp +++ b/components/esm/loadcrea.hpp @@ -20,6 +20,8 @@ class ESMWriter; struct Creature { + static unsigned int sRecordId; + // Default is 0x48? enum Flags { @@ -86,7 +88,7 @@ struct Creature AIPackageList mAiPackage; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadcrec.hpp b/components/esm/loadcrec.hpp index 6904df15a..280739aca 100644 --- a/components/esm/loadcrec.hpp +++ b/components/esm/loadcrec.hpp @@ -17,6 +17,8 @@ class ESMWriter; /// Changes a creature struct LoadCREC { + static unsigned int sRecordId; + std::string mId; void load(ESMReader &esm) @@ -24,7 +26,7 @@ struct LoadCREC esm.skipRecord(); } - void save(ESMWriter &esm) + void save(ESMWriter &esm) const { } }; @@ -39,7 +41,7 @@ struct LoadCNTC esm.skipRecord(); } - void save(ESMWriter &esm) + void save(ESMWriter &esm) const { } }; diff --git a/components/esm/loaddial.cpp b/components/esm/loaddial.cpp index fb50d5e9f..fb43ee858 100644 --- a/components/esm/loaddial.cpp +++ b/components/esm/loaddial.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Dialogue::sRecordId = REC_DIAL; void Dialogue::load(ESMReader &esm) { @@ -25,7 +27,7 @@ void Dialogue::load(ESMReader &esm) esm.fail("Unknown sub record size"); } -void Dialogue::save(ESMWriter &esm) +void Dialogue::save(ESMWriter &esm) const { if (mType != Deleted) esm.writeHNT("DATA", mType); @@ -36,4 +38,9 @@ void Dialogue::save(ESMWriter &esm) } } + void Dialogue::blank() + { + mInfo.clear(); + } + } diff --git a/components/esm/loaddial.hpp b/components/esm/loaddial.hpp index 61f3f763d..63d78833e 100644 --- a/components/esm/loaddial.hpp +++ b/components/esm/loaddial.hpp @@ -19,6 +19,8 @@ class ESMWriter; struct Dialogue { + static unsigned int sRecordId; + enum Type { Topic = 0, @@ -34,7 +36,10 @@ struct Dialogue std::vector mInfo; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; + + void blank(); + ///< Set record to default state (does not touch the ID and does not change the type). }; } #endif diff --git a/components/esm/loaddoor.cpp b/components/esm/loaddoor.cpp index a4c7b7d58..c56b06337 100644 --- a/components/esm/loaddoor.cpp +++ b/components/esm/loaddoor.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Door::sRecordId = REC_DOOR; void Door::load(ESMReader &esm) { @@ -15,7 +17,7 @@ void Door::load(ESMReader &esm) mCloseSound = esm.getHNOString("ANAM"); } -void Door::save(ESMWriter &esm) +void Door::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("FNAM", mName); diff --git a/components/esm/loaddoor.hpp b/components/esm/loaddoor.hpp index 77ffc6489..ee2b7f7ac 100644 --- a/components/esm/loaddoor.hpp +++ b/components/esm/loaddoor.hpp @@ -11,10 +11,12 @@ class ESMWriter; struct Door { + static unsigned int sRecordId; + std::string mId, mName, mModel, mScript, mOpenSound, mCloseSound; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadench.cpp b/components/esm/loadench.cpp index c4e278368..a1e885f23 100644 --- a/components/esm/loadench.cpp +++ b/components/esm/loadench.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Enchantment::sRecordId = REC_ENCH; void Enchantment::load(ESMReader &esm) { @@ -12,7 +14,7 @@ void Enchantment::load(ESMReader &esm) mEffects.load(esm); } -void Enchantment::save(ESMWriter &esm) +void Enchantment::save(ESMWriter &esm) const { esm.writeHNT("ENDT", mData, 16); mEffects.save(esm); diff --git a/components/esm/loadench.hpp b/components/esm/loadench.hpp index 999f93ad9..f6ba8c6ab 100644 --- a/components/esm/loadench.hpp +++ b/components/esm/loadench.hpp @@ -17,6 +17,8 @@ class ESMWriter; struct Enchantment { + static unsigned int sRecordId; + enum Type { CastOnce = 0, @@ -39,7 +41,7 @@ struct Enchantment EffectList mEffects; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; } #endif diff --git a/components/esm/loadfact.cpp b/components/esm/loadfact.cpp index e2712d462..61fa90263 100644 --- a/components/esm/loadfact.cpp +++ b/components/esm/loadfact.cpp @@ -4,9 +4,12 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Faction::sRecordId = REC_FACT; + int& Faction::FADTstruct::getSkill (int index, bool ignored) { if (index<0 || index>=6) @@ -47,7 +50,7 @@ void Faction::load(ESMReader &esm) mReactions.push_back(r); } } -void Faction::save(ESMWriter &esm) +void Faction::save(ESMWriter &esm) const { esm.writeHNCString("FNAM", mName); @@ -61,7 +64,7 @@ void Faction::save(ESMWriter &esm) esm.writeHNT("FADT", mData, 240); - for (std::vector::iterator it = mReactions.begin(); it != mReactions.end(); ++it) + for (std::vector::const_iterator it = mReactions.begin(); it != mReactions.end(); ++it) { esm.writeHNString("ANAM", it->mFaction); esm.writeHNT("INTV", it->mReaction); diff --git a/components/esm/loadfact.hpp b/components/esm/loadfact.hpp index 891b99647..9c257e068 100644 --- a/components/esm/loadfact.hpp +++ b/components/esm/loadfact.hpp @@ -29,6 +29,8 @@ struct RankData struct Faction { + static unsigned int sRecordId; + std::string mId, mName; struct FADTstruct @@ -63,7 +65,7 @@ struct Faction std::string mRanks[10]; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadglob.cpp b/components/esm/loadglob.cpp index ccb519acd..a78ed1a1b 100644 --- a/components/esm/loadglob.cpp +++ b/components/esm/loadglob.cpp @@ -1,13 +1,17 @@ #include "loadglob.hpp" +#include "defs.hpp" + namespace ESM { + unsigned int Global::sRecordId = REC_GLOB; + void Global::load (ESMReader &esm) { mValue.read (esm, ESM::Variant::Format_Global); } - void Global::save (ESMWriter &esm) + void Global::save (ESMWriter &esm) const { mValue.write (esm, ESM::Variant::Format_Global); } diff --git a/components/esm/loadglob.hpp b/components/esm/loadglob.hpp index 72e16c0ce..51b2e2dc9 100644 --- a/components/esm/loadglob.hpp +++ b/components/esm/loadglob.hpp @@ -17,11 +17,13 @@ class ESMWriter; struct Global { + static unsigned int sRecordId; + std::string mId; Variant mValue; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadgmst.cpp b/components/esm/loadgmst.cpp index fe1cc1b04..21d66339a 100644 --- a/components/esm/loadgmst.cpp +++ b/components/esm/loadgmst.cpp @@ -1,13 +1,17 @@ #include "loadgmst.hpp" +#include "defs.hpp" + namespace ESM { + unsigned int GameSetting::sRecordId = REC_GMST; + void GameSetting::load (ESMReader &esm) { mValue.read (esm, ESM::Variant::Format_Gmst); } - void GameSetting::save (ESMWriter &esm) + void GameSetting::save (ESMWriter &esm) const { mValue.write (esm, ESM::Variant::Format_Gmst); } diff --git a/components/esm/loadgmst.hpp b/components/esm/loadgmst.hpp index a6e0c2ecb..6b66ac832 100644 --- a/components/esm/loadgmst.hpp +++ b/components/esm/loadgmst.hpp @@ -18,13 +18,15 @@ class ESMWriter; struct GameSetting { + static unsigned int sRecordId; + std::string mId; Variant mValue; void load(ESMReader &esm); - /// \todo remove the get* functions (redundant, since mValue as equivalent functions now). + /// \todo remove the get* functions (redundant, since mValue has equivalent functions now). int getInt() const; ///< Throws an exception if GMST is not of type int or float. @@ -35,7 +37,7 @@ struct GameSetting std::string getString() const; ///< Throwns an exception if GMST is not of type string. - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadinfo.cpp b/components/esm/loadinfo.cpp index 90f8fcf35..f86ad3b51 100644 --- a/components/esm/loadinfo.cpp +++ b/components/esm/loadinfo.cpp @@ -2,13 +2,14 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int DialInfo::sRecordId = REC_INFO; void DialInfo::load(ESMReader &esm) { - mId = esm.getHNString("INAM"); mPrev = esm.getHNString("PNAM"); mNext = esm.getHNString("NNAM"); @@ -48,8 +49,8 @@ void DialInfo::load(ESMReader &esm) mFactionLess = false; if (subName.val == REC_FNAM) { - mNpcFaction = esm.getHString(); - if (mNpcFaction == "FFFF") + mFaction = esm.getHString(); + if (mFaction == "FFFF") mFactionLess = true; if (esm.isEmptyOrGetName()) return; @@ -120,22 +121,21 @@ void DialInfo::load(ESMReader &esm) esm.skipRecord(); } -void DialInfo::save(ESMWriter &esm) +void DialInfo::save(ESMWriter &esm) const { - esm.writeHNCString("INAM", mId); esm.writeHNCString("PNAM", mPrev); esm.writeHNCString("NNAM", mNext); esm.writeHNT("DATA", mData, 12); esm.writeHNOCString("ONAM", mActor); esm.writeHNOCString("RNAM", mRace); esm.writeHNOCString("CNAM", mClass); - esm.writeHNOCString("FNAM", mNpcFaction); + esm.writeHNOCString("FNAM", mFaction); esm.writeHNOCString("ANAM", mCell); esm.writeHNOCString("DNAM", mPcFaction); esm.writeHNOCString("SNAM", mSound); esm.writeHNOString("NAME", mResponse); - for (std::vector::iterator it = mSelects.begin(); it != mSelects.end(); ++it) + for (std::vector::const_iterator it = mSelects.begin(); it != mSelects.end(); ++it) { esm.writeHNString("SCVR", it->mSelectRule); it->mValue.write (esm, Variant::Format_Info); @@ -153,4 +153,28 @@ void DialInfo::save(ESMWriter &esm) } } + void DialInfo::blank() + { + mData.mUnknown1 = 0; + mData.mDisposition = 0; + mData.mRank = 0; + mData.mGender = 0; + mData.mPCrank = 0; + mData.mUnknown2 = 0; + + mSelects.clear(); + mPrev.clear(); + mNext.clear(); + mActor.clear(); + mRace.clear(); + mClass.clear(); + mFaction.clear(); + mPcFaction.clear(); + mCell.clear(); + mSound.clear(); + mResponse.clear(); + mResultScript.clear(); + mFactionLess = false; + mQuestStatus = QS_None; + } } diff --git a/components/esm/loadinfo.hpp b/components/esm/loadinfo.hpp index 2361ed9eb..737494f6c 100644 --- a/components/esm/loadinfo.hpp +++ b/components/esm/loadinfo.hpp @@ -20,6 +20,8 @@ class ESMWriter; struct DialInfo { + static unsigned int sRecordId; + enum Gender { Male = 0, @@ -48,10 +50,10 @@ struct DialInfo // Journal quest indices (introduced with the quest system in Tribunal) enum QuestStatus { - QS_None, - QS_Name, - QS_Finished, - QS_Restart, + QS_None = 0, + QS_Name = 1, + QS_Finished = 2, + QS_Restart = 3, QS_Deleted }; @@ -63,7 +65,7 @@ struct DialInfo std::string mId, mPrev, mNext; // Various references used in determining when to select this item. - std::string mActor, mRace, mClass, mNpcFaction, mPcFaction, mCell; + std::string mActor, mRace, mClass, mFaction, mPcFaction, mCell; // Sound and text associated with this item std::string mSound, mResponse; @@ -99,7 +101,10 @@ struct DialInfo }; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; + + void blank(); + ///< Set record to default state (does not touch the ID). }; } diff --git a/components/esm/loadingr.cpp b/components/esm/loadingr.cpp index 7e31a4116..0e0243362 100644 --- a/components/esm/loadingr.cpp +++ b/components/esm/loadingr.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Ingredient::sRecordId = REC_INGR; void Ingredient::load(ESMReader &esm) { @@ -37,7 +39,7 @@ void Ingredient::load(ESMReader &esm) } } -void Ingredient::save(ESMWriter &esm) +void Ingredient::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNCString("FNAM", mName); diff --git a/components/esm/loadingr.hpp b/components/esm/loadingr.hpp index 5e286535f..85f2d5e7d 100644 --- a/components/esm/loadingr.hpp +++ b/components/esm/loadingr.hpp @@ -15,6 +15,8 @@ class ESMWriter; struct Ingredient { + static unsigned int sRecordId; + struct IRDTstruct { float mWeight; @@ -28,7 +30,7 @@ struct Ingredient std::string mId, mName, mModel, mIcon, mScript; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadland.cpp b/components/esm/loadland.cpp index 60c475040..9c97eaa4d 100644 --- a/components/esm/loadland.cpp +++ b/components/esm/loadland.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Land::sRecordId = REC_LAND; void Land::LandData::save(ESMWriter &esm) { @@ -16,14 +18,14 @@ void Land::LandData::save(ESMWriter &esm) offsets.mHeightOffset = mHeights[0] / HEIGHT_SCALE; offsets.mUnk1 = mUnk1; offsets.mUnk2 = mUnk2; - + float prevY = mHeights[0], prevX; int number = 0; // avoid multiplication for (int i = 0; i < LAND_SIZE; ++i) { float diff = (mHeights[number] - prevY) / HEIGHT_SCALE; offsets.mHeightData[number] = (diff >= 0) ? (int8_t) (diff + 0.5) : (int8_t) (diff - 0.5); - + prevX = prevY = mHeights[number]; ++number; @@ -132,7 +134,7 @@ void Land::load(ESMReader &esm) mLandData = NULL; } -void Land::save(ESMWriter &esm) +void Land::save(ESMWriter &esm) const { esm.startSubRecord("INTV"); esm.writeT(mX); @@ -140,18 +142,6 @@ void Land::save(ESMWriter &esm) esm.endRecord("INTV"); esm.writeHNT("DATA", mFlags); - - // TODO: Land! - bool wasLoaded = mDataLoaded; - if (mDataTypes) { - // Try to load all available data before saving - loadData(mDataTypes); - } - if (mDataLoaded) - mLandData->save(esm); - - if (!wasLoaded) - unloadData(); // Don't need to keep the data loaded if it wasn't already } /// \todo remove memory allocation when only defaults needed @@ -170,10 +160,10 @@ void Land::loadData(int flags) } mEsm->restoreContext(mContext); - memset(mLandData->mNormals, 0, LAND_NUM_VERTS * 3); + memset(mLandData->mNormals, 0, sizeof(mLandData->mNormals)); if (mEsm->isNextSub("VNML")) { - condLoad(actual, DATA_VNML, mLandData->mNormals, sizeof(VNML)); + condLoad(actual, DATA_VNML, mLandData->mNormals, sizeof(mLandData->mNormals)); } if (mEsm->isNextSub("VHGT")) { diff --git a/components/esm/loadland.hpp b/components/esm/loadland.hpp index 9c1fd1f5c..32abb7799 100644 --- a/components/esm/loadland.hpp +++ b/components/esm/loadland.hpp @@ -17,6 +17,8 @@ class ESMWriter; struct Land { + static unsigned int sRecordId; + Land(); ~Land(); @@ -70,13 +72,13 @@ struct Land }; #pragma pack(pop) - typedef signed char VNML[LAND_NUM_VERTS * 3]; + typedef signed char VNML; struct LandData { float mHeightOffset; float mHeights[LAND_NUM_VERTS]; - VNML mNormals; + VNML mNormals[LAND_NUM_VERTS * 3]; uint16_t mTextures[LAND_NUM_TEXTURES]; bool mUsingColours; @@ -94,7 +96,7 @@ struct Land LandData *mLandData; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; /** * Actually loads data diff --git a/components/esm/loadlevlist.cpp b/components/esm/loadlevlist.cpp index b54a91276..6385b9a71 100644 --- a/components/esm/loadlevlist.cpp +++ b/components/esm/loadlevlist.cpp @@ -2,6 +2,7 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { @@ -33,13 +34,13 @@ void LeveledListBase::load(ESMReader &esm) esm.getHNT(li.mLevel, "INTV"); } } -void LeveledListBase::save(ESMWriter &esm) +void LeveledListBase::save(ESMWriter &esm) const { esm.writeHNT("DATA", mFlags); esm.writeHNT("NNAM", mChanceNone); esm.writeHNT("INDX", mList.size()); - for (std::vector::iterator it = mList.begin(); it != mList.end(); ++it) + for (std::vector::const_iterator it = mList.begin(); it != mList.end(); ++it) { esm.writeHNCString(mRecName, it->mId); esm.writeHNT("INTV", it->mLevel); @@ -52,4 +53,8 @@ void LeveledListBase::save(ESMWriter &esm) mChanceNone = 0; mList.clear(); } + + unsigned int CreatureLevList::sRecordId = REC_LEVC; + + unsigned int ItemLevList::sRecordId = REC_LEVI; } diff --git a/components/esm/loadlevlist.hpp b/components/esm/loadlevlist.hpp index 7339cac56..9dcc6177a 100644 --- a/components/esm/loadlevlist.hpp +++ b/components/esm/loadlevlist.hpp @@ -51,7 +51,7 @@ struct LeveledListBase std::vector mList; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). @@ -59,6 +59,8 @@ struct LeveledListBase struct CreatureLevList: LeveledListBase { + static unsigned int sRecordId; + CreatureLevList() { mRecName = "CNAM"; @@ -67,6 +69,8 @@ struct CreatureLevList: LeveledListBase struct ItemLevList: LeveledListBase { + static unsigned int sRecordId; + ItemLevList() { mRecName = "INAM"; diff --git a/components/esm/loadligh.cpp b/components/esm/loadligh.cpp index 89a2b8c65..c02bb46b6 100644 --- a/components/esm/loadligh.cpp +++ b/components/esm/loadligh.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Light::sRecordId = REC_LIGH; void Light::load(ESMReader &esm) { @@ -16,7 +18,7 @@ void Light::load(ESMReader &esm) mScript = esm.getHNOString("SCRI"); mSound = esm.getHNOString("SNAM"); } -void Light::save(ESMWriter &esm) +void Light::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("FNAM", mName); diff --git a/components/esm/loadligh.hpp b/components/esm/loadligh.hpp index 3f0b76d6e..74eb37197 100644 --- a/components/esm/loadligh.hpp +++ b/components/esm/loadligh.hpp @@ -16,6 +16,8 @@ class ESMWriter; struct Light { + static unsigned int sRecordId; + enum Flags { Dynamic = 0x001, @@ -44,7 +46,7 @@ struct Light std::string mSound, mScript, mModel, mIcon, mName, mId; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadlock.cpp b/components/esm/loadlock.cpp index 03eac52bd..9ffce78a7 100644 --- a/components/esm/loadlock.cpp +++ b/components/esm/loadlock.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Lockpick::sRecordId = REC_LOCK; void Lockpick::load(ESMReader &esm) { @@ -17,7 +19,7 @@ void Lockpick::load(ESMReader &esm) mIcon = esm.getHNOString("ITEX"); } -void Lockpick::save(ESMWriter &esm) +void Lockpick::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNCString("FNAM", mName); diff --git a/components/esm/loadlock.hpp b/components/esm/loadlock.hpp index 953066cb2..c44e2b006 100644 --- a/components/esm/loadlock.hpp +++ b/components/esm/loadlock.hpp @@ -11,6 +11,8 @@ class ESMWriter; struct Lockpick { + static unsigned int sRecordId; + struct Data { float mWeight; @@ -24,7 +26,7 @@ struct Lockpick std::string mId, mName, mModel, mIcon, mScript; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadltex.cpp b/components/esm/loadltex.cpp index e523e9fa7..bd28c8488 100644 --- a/components/esm/loadltex.cpp +++ b/components/esm/loadltex.cpp @@ -2,16 +2,18 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int LandTexture::sRecordId = REC_LTEX; void LandTexture::load(ESMReader &esm) { esm.getHNT(mIndex, "INTV"); mTexture = esm.getHNString("DATA"); } -void LandTexture::save(ESMWriter &esm) +void LandTexture::save(ESMWriter &esm) const { esm.writeHNT("INTV", mIndex); esm.writeHNCString("DATA", mTexture); diff --git a/components/esm/loadltex.hpp b/components/esm/loadltex.hpp index 6e6d987d4..5e84428b2 100644 --- a/components/esm/loadltex.hpp +++ b/components/esm/loadltex.hpp @@ -27,11 +27,13 @@ class ESMWriter; struct LandTexture { + static unsigned int sRecordId; + std::string mId, mTexture; int mIndex; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; } #endif diff --git a/components/esm/loadmgef.cpp b/components/esm/loadmgef.cpp index 19d535600..f60191539 100644 --- a/components/esm/loadmgef.cpp +++ b/components/esm/loadmgef.cpp @@ -6,6 +6,7 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace { @@ -34,6 +35,7 @@ namespace namespace ESM { + unsigned int MagicEffect::sRecordId = REC_MGEF; void MagicEffect::load(ESMReader &esm) { @@ -58,15 +60,11 @@ void MagicEffect::load(ESMReader &esm) mDescription = esm.getHNOString("DESC"); } -void MagicEffect::save(ESMWriter &esm) +void MagicEffect::save(ESMWriter &esm) const { esm.writeHNT("INDX", mIndex); - mData.mFlags &= 0xe00; esm.writeHNT("MEDT", mData, 36); - if (mIndex>=0 && mIndex + std::map effects; + effects[DisintegrateArmor] = Sanctuary; + effects[DisintegrateWeapon] = Sanctuary; + + for (int i=0; i<5; ++i) + effects[DrainAttribute+i] = ResistMagicka; + for (int i=0; i<5; ++i) + effects[DamageAttribute+i] = ResistMagicka; + for (int i=0; i<5; ++i) + effects[AbsorbAttribute+i] = ResistMagicka; + for (int i=0; i<10; ++i) + effects[WeaknessToFire+i] = ResistMagicka; + + effects[Burden] = ResistMagicka; + effects[Charm] = ResistMagicka; + effects[Silence] = ResistMagicka; + effects[Blind] = ResistMagicka; + effects[Sound] = ResistMagicka; + + for (int i=0; i<2; ++i) + { + effects[CalmHumanoid] = ResistMagicka; + effects[FrenzyHumanoid] = ResistMagicka; + effects[DemoralizeHumanoid] = ResistMagicka; + effects[RallyHumanoid] = ResistMagicka; + } + + effects[TurnUndead] = ResistMagicka; + + effects[FireDamage] = ResistFire; + effects[FrostDamage] = ResistFrost; + effects[ShockDamage] = ResistShock; + effects[Vampirism] = ResistCommonDisease; + effects[Corprus] = ResistCorprusDisease; + effects[Poison] = ResistPoison; + effects[Paralyze] = ResistParalysis; + + if (effects.find(effect) != effects.end()) + return effects[effect]; + else + return -1; +} + +short MagicEffect::getWeaknessEffect(short effect) +{ + std::map effects; + + for (int i=0; i<5; ++i) + effects[DrainAttribute+i] = WeaknessToMagicka; + for (int i=0; i<5; ++i) + effects[DamageAttribute+i] = WeaknessToMagicka; + for (int i=0; i<5; ++i) + effects[AbsorbAttribute+i] = WeaknessToMagicka; + for (int i=0; i<10; ++i) + effects[WeaknessToFire+i] = WeaknessToMagicka; + + effects[Burden] = WeaknessToMagicka; + effects[Charm] = WeaknessToMagicka; + effects[Silence] = WeaknessToMagicka; + effects[Blind] = WeaknessToMagicka; + effects[Sound] = WeaknessToMagicka; + + for (int i=0; i<2; ++i) + { + effects[CalmHumanoid] = WeaknessToMagicka; + effects[FrenzyHumanoid] = WeaknessToMagicka; + effects[DemoralizeHumanoid] = WeaknessToMagicka; + effects[RallyHumanoid] = WeaknessToMagicka; + } + + effects[TurnUndead] = WeaknessToMagicka; + + effects[FireDamage] = WeaknessToFire; + effects[FrostDamage] = WeaknessToFrost; + effects[ShockDamage] = WeaknessToShock; + effects[Vampirism] = WeaknessToCommonDisease; + effects[Corprus] = WeaknessToCorprusDisease; + effects[Poison] = WeaknessToPoison; + + // Weakness to magicka or -1 ? + effects[Paralyze] = WeaknessToMagicka; + + if (effects.find(effect) != effects.end()) + return effects[effect]; + else + return -1; +} static std::map genNameMap() { diff --git a/components/esm/loadmgef.hpp b/components/esm/loadmgef.hpp index f139fa32c..77056b9ec 100644 --- a/components/esm/loadmgef.hpp +++ b/components/esm/loadmgef.hpp @@ -12,6 +12,8 @@ class ESMWriter; struct MagicEffect { + static unsigned int sRecordId; + enum Flags { TargetSkill = 0x1, // Affects a specific skill, which is specified elsewhere in the effect structure. @@ -47,8 +49,9 @@ struct MagicEffect int mSchool; // SpellSchool, see defs.hpp float mBaseCost; int mFlags; - // Properties of the fired magic 'ball' I think - int mRed, mBlue, mGreen; + // Glow color for enchanted items with this effect + int mRed, mGreen, mBlue; + // Properties of the fired magic 'ball' float mSpeed, mSize, mSizeCap; }; // 36 bytes @@ -56,14 +59,20 @@ struct MagicEffect static const std::string &effectIdToString(short effectID); static short effectStringToId(const std::string &effect); + + /// Returns the effect that provides resistance against \a effect (or -1 if there's none) + static short getResistanceEffect(short effect); + /// Returns the effect that induces weakness against \a effect (or -1 if there's none) + static short getWeaknessEffect(short effect); + MagnitudeDisplayType getMagnitudeDisplayType() const; MEDTstruct mData; std::string mIcon, mParticle; // Textures - std::string mCasting, mHit, mArea; // Statics - std::string mBolt; // Weapon + std::string mCasting, mHit, mArea; // ESM::Static + std::string mBolt; // ESM::Weapon std::string mCastSound, mBoltSound, mHitSound, mAreaSound; // Sounds std::string mDescription; @@ -79,7 +88,7 @@ struct MagicEffect int mIndex; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; enum Effects @@ -230,7 +239,9 @@ struct MagicEffect SummonBear = 139, SummonBonewolf = 140, SummonCreature04 = 141, - SummonCreature05 = 142 + SummonCreature05 = 142, + + Length }; }; } diff --git a/components/esm/loadmisc.cpp b/components/esm/loadmisc.cpp index 6006334ea..2ca09e8ae 100644 --- a/components/esm/loadmisc.cpp +++ b/components/esm/loadmisc.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Miscellaneous::sRecordId = REC_MISC; void Miscellaneous::load(ESMReader &esm) { @@ -14,7 +16,7 @@ void Miscellaneous::load(ESMReader &esm) mScript = esm.getHNOString("SCRI"); mIcon = esm.getHNOString("ITEX"); } -void Miscellaneous::save(ESMWriter &esm) +void Miscellaneous::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("FNAM", mName); diff --git a/components/esm/loadmisc.hpp b/components/esm/loadmisc.hpp index 25a9c5865..576bd18c0 100644 --- a/components/esm/loadmisc.hpp +++ b/components/esm/loadmisc.hpp @@ -16,6 +16,8 @@ class ESMWriter; struct Miscellaneous { + static unsigned int sRecordId; + struct MCDTstruct { float mWeight; @@ -29,7 +31,7 @@ struct Miscellaneous std::string mId, mName, mModel, mIcon, mScript; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadnpc.cpp b/components/esm/loadnpc.cpp index 7e17a93dc..e5b851bf0 100644 --- a/components/esm/loadnpc.cpp +++ b/components/esm/loadnpc.cpp @@ -2,13 +2,15 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int NPC::sRecordId = REC_NPC_; void NPC::load(ESMReader &esm) { - mNpdt52.mGold = -10; + //mNpdt52.mGold = -10; mPersistent = esm.getRecordFlags() & 0x0400; @@ -27,12 +29,12 @@ void NPC::load(ESMReader &esm) esm.getSubHeader(); if (esm.getSubSize() == 52) { - mNpdtType = 52; + mNpdtType = NPC_DEFAULT; esm.getExact(&mNpdt52, 52); } else if (esm.getSubSize() == 12) { - mNpdtType = 12; + mNpdtType = NPC_WITH_AUTOCALCULATED_STATS; esm.getExact(&mNpdt12, 12); } else @@ -63,7 +65,7 @@ void NPC::load(ESMReader &esm) mAiPackage.load(esm); esm.skipRecord(); } -void NPC::save(ESMWriter &esm) +void NPC::save(ESMWriter &esm) const { esm.writeHNOCString("MODL", mModel); esm.writeHNOCString("FNAM", mName); @@ -74,9 +76,9 @@ void NPC::save(ESMWriter &esm) esm.writeHNCString("KNAM", mHair); esm.writeHNOCString("SCRI", mScript); - if (mNpdtType == 52) + if (mNpdtType == NPC_DEFAULT) esm.writeHNT("NPDT", mNpdt52, 52); - else if (mNpdtType == 12) + else if (mNpdtType == NPC_WITH_AUTOCALCULATED_STATS) esm.writeHNT("NPDT", mNpdt12, 12); esm.writeHNT("FLAG", mFlags); @@ -87,7 +89,7 @@ void NPC::save(ESMWriter &esm) esm.writeHNT("AIDT", mAiData, sizeof(mAiData)); } - typedef std::vector::iterator DestIter; + typedef std::vector::const_iterator DestIter; for (DestIter it = mTransport.begin(); it != mTransport.end(); ++it) { esm.writeHNT("DODT", it->mPos, sizeof(it->mPos)); esm.writeHNOCString("DNAM", it->mCellName); @@ -112,7 +114,7 @@ void NPC::save(ESMWriter &esm) mNpdt52.mLevel = 0; mNpdt52.mStrength = mNpdt52.mIntelligence = mNpdt52.mWillpower = mNpdt52.mAgility = mNpdt52.mSpeed = mNpdt52.mEndurance = mNpdt52.mPersonality = mNpdt52.mLuck = 0; - for (int i=0; i<27; ++i) mNpdt52.mSkills[i] = 0; + for (int i=0; i< Skill::Length; ++i) mNpdt52.mSkills[i] = 0; mNpdt52.mReputation = 0; mNpdt52.mHealth = mNpdt52.mMana = mNpdt52.mFatigue = 0; mNpdt52.mDisposition = 0; diff --git a/components/esm/loadnpc.hpp b/components/esm/loadnpc.hpp index 009bc5ef3..1eac8d64f 100644 --- a/components/esm/loadnpc.hpp +++ b/components/esm/loadnpc.hpp @@ -8,6 +8,7 @@ #include "loadcont.hpp" #include "aipackage.hpp" #include "spelllist.hpp" +#include "loadskil.hpp" namespace ESM { @@ -20,6 +21,8 @@ class ESMWriter; struct NPC { + static unsigned int sRecordId; + // Services enum Services { @@ -56,6 +59,12 @@ struct NPC Metal = 0x0800 // Metal blood effect (golden?) }; + enum NpcType + { + NPC_WITH_AUTOCALCULATED_STATS = 12, + NPC_DEFAULT = 52 + }; + #pragma pack(push) #pragma pack(1) @@ -71,7 +80,7 @@ struct NPC mPersonality, mLuck; - char mSkills[27]; + char mSkills[Skill::Length]; char mReputation; short mHealth, mMana, mFatigue; char mDisposition, mFactionID, mRank; @@ -117,7 +126,7 @@ struct NPC std::string mHair, mHead; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; bool isMale() const; diff --git a/components/esm/loadnpcc.hpp b/components/esm/loadnpcc.hpp index 79d92397f..c87c2545f 100644 --- a/components/esm/loadnpcc.hpp +++ b/components/esm/loadnpcc.hpp @@ -78,13 +78,15 @@ class ESMWriter; struct LoadNPCC { + static unsigned int sRecordId; + std::string mId; void load(ESMReader &esm) { esm.skipRecord(); } - void save(ESMWriter &esm) + void save(ESMWriter &esm) const { } }; diff --git a/components/esm/loadpgrd.cpp b/components/esm/loadpgrd.cpp index 882addcb9..3b5330e9f 100644 --- a/components/esm/loadpgrd.cpp +++ b/components/esm/loadpgrd.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Pathgrid::sRecordId = REC_PGRD; void Pathgrid::load(ESMReader &esm) { @@ -70,25 +72,25 @@ void Pathgrid::load(ESMReader &esm) } } } -void Pathgrid::save(ESMWriter &esm) +void Pathgrid::save(ESMWriter &esm) const { esm.writeHNT("DATA", mData, 12); esm.writeHNCString("NAME", mCell); - + if (!mPoints.empty()) { esm.startSubRecord("PGRP"); - for (PointList::iterator it = mPoints.begin(); it != mPoints.end(); ++it) + for (PointList::const_iterator it = mPoints.begin(); it != mPoints.end(); ++it) { esm.writeT(*it); } esm.endRecord("PGRP"); } - + if (!mEdges.empty()) { esm.startSubRecord("PGRC"); - for (std::vector::iterator it = mEdges.begin(); it != mEdges.end(); ++it) + for (std::vector::const_iterator it = mEdges.begin(); it != mEdges.end(); ++it) { esm.writeT(it->mV1); } diff --git a/components/esm/loadpgrd.hpp b/components/esm/loadpgrd.hpp index c3f50fc4d..9ee49552d 100644 --- a/components/esm/loadpgrd.hpp +++ b/components/esm/loadpgrd.hpp @@ -15,6 +15,8 @@ class ESMWriter; */ struct Pathgrid { + static unsigned int sRecordId; + struct DATAstruct { int mX, mY; // Grid location, matches cell for exterior cells @@ -46,7 +48,7 @@ struct Pathgrid EdgeList mEdges; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; } #endif diff --git a/components/esm/loadprob.cpp b/components/esm/loadprob.cpp index 729f8404e..caa3d7e0e 100644 --- a/components/esm/loadprob.cpp +++ b/components/esm/loadprob.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Probe::sRecordId = REC_PROB; void Probe::load(ESMReader &esm) { @@ -17,7 +19,7 @@ void Probe::load(ESMReader &esm) mIcon = esm.getHNOString("ITEX"); } -void Probe::save(ESMWriter &esm) +void Probe::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNCString("FNAM", mName); diff --git a/components/esm/loadprob.hpp b/components/esm/loadprob.hpp index 55b896bcd..b89b2ddeb 100644 --- a/components/esm/loadprob.hpp +++ b/components/esm/loadprob.hpp @@ -11,6 +11,8 @@ class ESMWriter; struct Probe { + static unsigned int sRecordId; + struct Data { float mWeight; @@ -24,7 +26,7 @@ struct Probe std::string mId, mName, mModel, mIcon, mScript; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadrace.cpp b/components/esm/loadrace.cpp index 955424e2b..e50e43a74 100644 --- a/components/esm/loadrace.cpp +++ b/components/esm/loadrace.cpp @@ -2,9 +2,12 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Race::sRecordId = REC_RACE; + int Race::MaleFemale::getValue (bool male) const { return male ? mMale : mFemale; @@ -22,7 +25,7 @@ void Race::load(ESMReader &esm) mPowers.load(esm); mDescription = esm.getHNOString("DESC"); } -void Race::save(ESMWriter &esm) +void Race::save(ESMWriter &esm) const { esm.writeHNCString("FNAM", mName); esm.writeHNT("RADT", mData, 140); diff --git a/components/esm/loadrace.hpp b/components/esm/loadrace.hpp index 6ecec8ebb..7d5736d9b 100644 --- a/components/esm/loadrace.hpp +++ b/components/esm/loadrace.hpp @@ -17,6 +17,8 @@ class ESMWriter; struct Race { + static unsigned int sRecordId; + struct SkillBonus { int mSkill; // SkillEnum @@ -65,7 +67,7 @@ struct Race SpellList mPowers; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadregn.cpp b/components/esm/loadregn.cpp index 41c7f507a..fa4271e26 100644 --- a/components/esm/loadregn.cpp +++ b/components/esm/loadregn.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Region::sRecordId = REC_REGN; void Region::load(ESMReader &esm) { @@ -28,7 +30,7 @@ void Region::load(ESMReader &esm) mSoundList.push_back(sr); } } -void Region::save(ESMWriter &esm) +void Region::save(ESMWriter &esm) const { esm.writeHNCString("FNAM", mName); @@ -40,7 +42,7 @@ void Region::save(ESMWriter &esm) esm.writeHNOCString("BNAM", mSleepList); esm.writeHNT("CNAM", mMapColor); - for (std::vector::iterator it = mSoundList.begin(); it != mSoundList.end(); ++it) + for (std::vector::const_iterator it = mSoundList.begin(); it != mSoundList.end(); ++it) { esm.writeHNT("SNAM", *it); } diff --git a/components/esm/loadregn.hpp b/components/esm/loadregn.hpp index f2a3d9a10..1992c951b 100644 --- a/components/esm/loadregn.hpp +++ b/components/esm/loadregn.hpp @@ -18,6 +18,8 @@ class ESMWriter; struct Region { + static unsigned int sRecordId; + #pragma pack(push) #pragma pack(1) struct WEATstruct @@ -47,7 +49,7 @@ struct Region std::vector mSoundList; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadrepa.cpp b/components/esm/loadrepa.cpp index ced6daa2e..a7132828d 100644 --- a/components/esm/loadrepa.cpp +++ b/components/esm/loadrepa.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Repair::sRecordId = REC_REPA; void Repair::load(ESMReader &esm) { @@ -17,7 +19,7 @@ void Repair::load(ESMReader &esm) mIcon = esm.getHNOString("ITEX"); } -void Repair::save(ESMWriter &esm) +void Repair::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNCString("FNAM", mName); diff --git a/components/esm/loadrepa.hpp b/components/esm/loadrepa.hpp index 83812bad9..5b404b0e4 100644 --- a/components/esm/loadrepa.hpp +++ b/components/esm/loadrepa.hpp @@ -11,6 +11,8 @@ class ESMWriter; struct Repair { + static unsigned int sRecordId; + struct Data { float mWeight; @@ -24,7 +26,7 @@ struct Repair std::string mId, mName, mModel, mIcon, mScript; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadscpt.cpp b/components/esm/loadscpt.cpp index 2c1b018d9..30460c17a 100644 --- a/components/esm/loadscpt.cpp +++ b/components/esm/loadscpt.cpp @@ -2,6 +2,7 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { @@ -12,6 +13,8 @@ struct SCHD Script::SCHDstruct mData; }; + unsigned int Script::sRecordId = REC_SCPT; + void Script::load(ESMReader &esm) { SCHD data; @@ -50,11 +53,11 @@ void Script::load(ESMReader &esm) // Script text mScriptText = esm.getHNOString("SCTX"); } -void Script::save(ESMWriter &esm) +void Script::save(ESMWriter &esm) const { std::string varNameString; if (!mVarNames.empty()) - for (std::vector::iterator it = mVarNames.begin(); it != mVarNames.end(); ++it) + for (std::vector::const_iterator it = mVarNames.begin(); it != mVarNames.end(); ++it) varNameString.append(*it); SCHD data; @@ -68,7 +71,7 @@ void Script::save(ESMWriter &esm) if (!mVarNames.empty()) { esm.startSubRecord("SCVR"); - for (std::vector::iterator it = mVarNames.begin(); it != mVarNames.end(); ++it) + for (std::vector::const_iterator it = mVarNames.begin(); it != mVarNames.end(); ++it) { esm.writeHCString(*it); } diff --git a/components/esm/loadscpt.hpp b/components/esm/loadscpt.hpp index be7e83900..d5200d4c1 100644 --- a/components/esm/loadscpt.hpp +++ b/components/esm/loadscpt.hpp @@ -19,6 +19,8 @@ class ESMWriter; class Script { public: + static unsigned int sRecordId; + struct SCHDstruct { /* Script name. @@ -56,7 +58,7 @@ public: std::string mScriptText; // Uncompiled script void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadskil.cpp b/components/esm/loadskil.cpp index 676a835c3..b6724e938 100644 --- a/components/esm/loadskil.cpp +++ b/components/esm/loadskil.cpp @@ -6,6 +6,7 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { @@ -126,6 +127,8 @@ namespace ESM HandToHand }}; + unsigned int Skill::sRecordId = REC_SKIL; + void Skill::load(ESMReader &esm) { esm.getHNT(mIndex, "INDX"); @@ -137,7 +140,7 @@ void Skill::load(ESMReader &esm) mId = indexToId (mIndex); } -void Skill::save(ESMWriter &esm) +void Skill::save(ESMWriter &esm) const { esm.writeHNT("INDX", mIndex); esm.writeHNT("SKDT", mData, 24); diff --git a/components/esm/loadskil.hpp b/components/esm/loadskil.hpp index 384f87454..1b9db5bcf 100644 --- a/components/esm/loadskil.hpp +++ b/components/esm/loadskil.hpp @@ -19,6 +19,8 @@ class ESMWriter; struct Skill { + static unsigned int sRecordId; + std::string mId; struct SKDTstruct @@ -75,7 +77,7 @@ struct Skill static const boost::array sSkillIds; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadsndg.cpp b/components/esm/loadsndg.cpp index 42d524226..1a8ca6335 100644 --- a/components/esm/loadsndg.cpp +++ b/components/esm/loadsndg.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int SoundGenerator::sRecordId = REC_SNDG; void SoundGenerator::load(ESMReader &esm) { @@ -13,7 +15,7 @@ void SoundGenerator::load(ESMReader &esm) mCreature = esm.getHNOString("CNAM"); mSound = esm.getHNOString("SNAM"); } -void SoundGenerator::save(ESMWriter &esm) +void SoundGenerator::save(ESMWriter &esm) const { esm.writeHNT("DATA", mType, 4); esm.writeHNOCString("CNAM", mCreature); diff --git a/components/esm/loadsndg.hpp b/components/esm/loadsndg.hpp index a6226c154..5509661c1 100644 --- a/components/esm/loadsndg.hpp +++ b/components/esm/loadsndg.hpp @@ -15,6 +15,8 @@ class ESMWriter; struct SoundGenerator { + static unsigned int sRecordId; + enum Type { LeftFoot = 0, @@ -33,7 +35,7 @@ struct SoundGenerator std::string mId, mCreature, mSound; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; } #endif diff --git a/components/esm/loadsoun.cpp b/components/esm/loadsoun.cpp index 07af2b5e9..49c9eb54e 100644 --- a/components/esm/loadsoun.cpp +++ b/components/esm/loadsoun.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Sound::sRecordId = REC_SOUN; void Sound::load(ESMReader &esm) { @@ -17,7 +19,7 @@ void Sound::load(ESMReader &esm) << endl; */ } -void Sound::save(ESMWriter &esm) +void Sound::save(ESMWriter &esm) const { esm.writeHNCString("FNAM", mSound); esm.writeHNT("DATA", mData, 3); diff --git a/components/esm/loadsoun.hpp b/components/esm/loadsoun.hpp index f8e38ac09..04a0984fd 100644 --- a/components/esm/loadsoun.hpp +++ b/components/esm/loadsoun.hpp @@ -16,11 +16,13 @@ struct SOUNstruct struct Sound { + static unsigned int sRecordId; + SOUNstruct mData; std::string mId, mSound; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadspel.cpp b/components/esm/loadspel.cpp index 8149fe4ce..2c98d796d 100644 --- a/components/esm/loadspel.cpp +++ b/components/esm/loadspel.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Spell::sRecordId = REC_SPEL; void Spell::load(ESMReader &esm) { @@ -13,7 +15,7 @@ void Spell::load(ESMReader &esm) mEffects.load(esm); } -void Spell::save(ESMWriter &esm) +void Spell::save(ESMWriter &esm) const { esm.writeHNOCString("FNAM", mName); esm.writeHNT("SPDT", mData, 12); diff --git a/components/esm/loadspel.hpp b/components/esm/loadspel.hpp index 3a620962d..cbf5366c4 100644 --- a/components/esm/loadspel.hpp +++ b/components/esm/loadspel.hpp @@ -13,6 +13,8 @@ class ESMWriter; struct Spell { + static unsigned int sRecordId; + enum SpellType { ST_Spell = 0, // Normal spell, must be cast and costs mana @@ -42,7 +44,7 @@ struct Spell EffectList mEffects; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID/index). diff --git a/components/esm/loadsscr.cpp b/components/esm/loadsscr.cpp index ae50de517..69b04bb23 100644 --- a/components/esm/loadsscr.cpp +++ b/components/esm/loadsscr.cpp @@ -2,16 +2,18 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int StartScript::sRecordId = REC_SSCR; void StartScript::load(ESMReader &esm) { mData = esm.getHNString("DATA"); mScript = esm.getHNString("NAME"); } -void StartScript::save(ESMWriter &esm) +void StartScript::save(ESMWriter &esm) const { esm.writeHNString("DATA", mData); esm.writeHNString("NAME", mScript); diff --git a/components/esm/loadsscr.hpp b/components/esm/loadsscr.hpp index 713fe96b5..d09ad883e 100644 --- a/components/esm/loadsscr.hpp +++ b/components/esm/loadsscr.hpp @@ -19,12 +19,14 @@ class ESMWriter; struct StartScript { + static unsigned int sRecordId; + std::string mData; std::string mId, mScript; // Load a record and add it to the list void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; } diff --git a/components/esm/loadstat.cpp b/components/esm/loadstat.cpp index c9346dafc..a71f22dc2 100644 --- a/components/esm/loadstat.cpp +++ b/components/esm/loadstat.cpp @@ -2,15 +2,17 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Static::sRecordId = REC_STAT; void Static::load(ESMReader &esm) { mModel = esm.getHNString("MODL"); } -void Static::save(ESMWriter &esm) +void Static::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); } diff --git a/components/esm/loadstat.hpp b/components/esm/loadstat.hpp index 1adb7d05b..d912d1058 100644 --- a/components/esm/loadstat.hpp +++ b/components/esm/loadstat.hpp @@ -22,10 +22,12 @@ class ESMWriter; struct Static { + static unsigned int sRecordId; + std::string mId, mModel; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/loadtes3.cpp b/components/esm/loadtes3.cpp index 74d578ba7..87a8d1d57 100644 --- a/components/esm/loadtes3.cpp +++ b/components/esm/loadtes3.cpp @@ -4,6 +4,7 @@ #include "esmcommon.hpp" #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" void ESM::Header::blank() { @@ -13,6 +14,7 @@ void ESM::Header::blank() mData.desc.assign (""); mData.records = 0; mFormat = CurrentFormat; + mMaster.clear(); } void ESM::Header::load (ESMReader &esm) diff --git a/components/esm/loadtes3.hpp b/components/esm/loadtes3.hpp index b73a4c31e..5614d295f 100644 --- a/components/esm/loadtes3.hpp +++ b/components/esm/loadtes3.hpp @@ -24,7 +24,7 @@ namespace ESM versions are 1.2 and 1.3. These correspond to: 1.2 = 0x3f99999a and 1.3 = 0x3fa66666 */ - int version; + unsigned int version; int type; // 0=esp, 1=esm, 32=ess (unused) NAME32 author; // Author's name NAME256 desc; // File description diff --git a/components/esm/loadweap.cpp b/components/esm/loadweap.cpp index 253712396..1d0b149df 100644 --- a/components/esm/loadweap.cpp +++ b/components/esm/loadweap.cpp @@ -2,9 +2,11 @@ #include "esmreader.hpp" #include "esmwriter.hpp" +#include "defs.hpp" namespace ESM { + unsigned int Weapon::sRecordId = REC_WEAP; void Weapon::load(ESMReader &esm) { @@ -15,7 +17,7 @@ void Weapon::load(ESMReader &esm) mIcon = esm.getHNOString("ITEX"); mEnchant = esm.getHNOString("ENAM"); } -void Weapon::save(ESMWriter &esm) +void Weapon::save(ESMWriter &esm) const { esm.writeHNCString("MODL", mModel); esm.writeHNOCString("FNAM", mName); diff --git a/components/esm/loadweap.hpp b/components/esm/loadweap.hpp index b62179ccb..fde716b91 100644 --- a/components/esm/loadweap.hpp +++ b/components/esm/loadweap.hpp @@ -15,6 +15,8 @@ class ESMWriter; struct Weapon { + static unsigned int sRecordId; + enum Type { ShortBladeOneHand = 0, @@ -59,7 +61,7 @@ struct Weapon std::string mId, mName, mModel, mIcon, mEnchant, mScript; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; void blank(); ///< Set record to default state (does not touch the ID). diff --git a/components/esm/spelllist.cpp b/components/esm/spelllist.cpp index dd886cf7f..24d3c3d0a 100644 --- a/components/esm/spelllist.cpp +++ b/components/esm/spelllist.cpp @@ -12,9 +12,9 @@ void SpellList::load(ESMReader &esm) } } -void SpellList::save(ESMWriter &esm) +void SpellList::save(ESMWriter &esm) const { - for (std::vector::iterator it = mList.begin(); it != mList.end(); ++it) { + for (std::vector::const_iterator it = mList.begin(); it != mList.end(); ++it) { esm.writeHNString("NPCS", *it, 32); } } diff --git a/components/esm/spelllist.hpp b/components/esm/spelllist.hpp index 52999270a..934bdda7a 100644 --- a/components/esm/spelllist.hpp +++ b/components/esm/spelllist.hpp @@ -17,7 +17,7 @@ namespace ESM std::vector mList; void load(ESMReader &esm); - void save(ESMWriter &esm); + void save(ESMWriter &esm) const; }; } diff --git a/components/esm/variantimp.cpp b/components/esm/variantimp.cpp index 160402aa4..1bacdc077 100644 --- a/components/esm/variantimp.cpp +++ b/components/esm/variantimp.cpp @@ -193,7 +193,7 @@ void ESM::VariantIntegerData::write (ESMWriter& esm, Variant::Format format, Var } else if (format==Variant::Format_Gmst || format==Variant::Format_Info) { - if (type==VT_Int) + if (type!=VT_Int) { std::ostringstream stream; stream diff --git a/components/fileorderlist/model/datafilesmodel.cpp b/components/fileorderlist/model/datafilesmodel.cpp deleted file mode 100644 index 02a6766b0..000000000 --- a/components/fileorderlist/model/datafilesmodel.cpp +++ /dev/null @@ -1,445 +0,0 @@ -#include -#include -#include -#include - -#include - -#include - -#include "esm/esmfile.hpp" - -#include "datafilesmodel.hpp" - -#include - -DataFilesModel::DataFilesModel(QObject *parent) : - QAbstractTableModel(parent) -{ - mEncoding = QString("win1252"); -} - -DataFilesModel::~DataFilesModel() -{ -} - -void DataFilesModel::setEncoding(const QString &encoding) -{ - mEncoding = encoding; -} - -void DataFilesModel::setCheckState(const QModelIndex &index, Qt::CheckState state) -{ - setData(index, state, Qt::CheckStateRole); -} - -Qt::CheckState DataFilesModel::checkState(const QModelIndex &index) -{ - EsmFile *file = item(index.row()); - return mCheckStates[file->fileName()]; -} - -int DataFilesModel::columnCount(const QModelIndex &parent) const -{ - return parent.isValid() ? 0 : 9; -} - -int DataFilesModel::rowCount(const QModelIndex &parent) const -{ - return parent.isValid() ? 0 : mFiles.count(); -} - - -bool DataFilesModel::moveRow(int oldrow, int row, const QModelIndex &parent) -{ - if (oldrow < 0 || row < 0 || oldrow == row) - return false; - - emit layoutAboutToBeChanged(); - //emit beginMoveRows(parent, oldrow, oldrow, parent, row); - mFiles.swap(oldrow, row); - //emit endInsertRows(); - emit layoutChanged(); - - return true; -} - -QVariant DataFilesModel::data(const QModelIndex &index, int role) const -{ - if (!index.isValid()) - return QVariant(); - - EsmFile *file = item(index.row()); - - if (!file) - return QVariant(); - - const int column = index.column(); - - switch (role) { - case Qt::DisplayRole: { - - switch (column) { - case 0: - return file->fileName(); - case 1: - return file->author(); - case 2: - return QString("%1 kB").arg(int((file->size() + 1023) / 1024)); - case 3: - //return file->modified().toString(Qt::TextDate); - return file->modified().toString(Qt::ISODate); - case 4: - return file->accessed().toString(Qt::TextDate); - case 5: - return file->version(); - case 6: - return file->path(); - case 7: - return file->masters().join(", "); - case 8: - return file->description(); - } - } - - case Qt::TextAlignmentRole: { - switch (column) { - case 0: - case 1: - return Qt::AlignLeft + Qt::AlignVCenter; - case 2: - case 3: - case 4: - case 5: - return Qt::AlignRight + Qt::AlignVCenter; - default: - return Qt::AlignLeft + Qt::AlignVCenter; - } - } - - case Qt::CheckStateRole: { - if (column != 0) - return QVariant(); - return mCheckStates[file->fileName()]; - } - case Qt::ToolTipRole: - { - if (column != 0) - return QVariant(); - - if (file->version() == 0.0f) - return QVariant(); // Data not set - - QString tooltip = - QString("Author: %1
\ - Version: %2
\ -
Description:
%3
\ -
Dependencies: %4
") - .arg(file->author()) - .arg(QString::number(file->version())) - .arg(file->description()) - .arg(file->masters().join(", ")); - - - return tooltip; - - } - default: - return QVariant(); - } - -} - -Qt::ItemFlags DataFilesModel::flags(const QModelIndex &index) const -{ - if (!index.isValid()) - return Qt::NoItemFlags; - - EsmFile *file = item(index.row()); - - if (!file) - return Qt::NoItemFlags; - - if (canBeChecked(file)) { - if (index.column() == 0) { - return Qt::ItemIsUserCheckable | Qt::ItemIsEnabled | Qt::ItemIsSelectable; - } else { - return Qt::ItemIsEnabled | Qt::ItemIsSelectable; - } - } else { - if (index.column() == 0) { - return Qt::ItemIsUserCheckable | Qt::ItemIsSelectable; - } else { - return Qt::NoItemFlags | Qt::ItemIsSelectable; - } - } - -} - -QVariant DataFilesModel::headerData(int section, Qt::Orientation orientation, int role) const -{ - if (role != Qt::DisplayRole) - return QVariant(); - - if (orientation == Qt::Horizontal) { - switch (section) { - case 0: return tr("Name"); - case 1: return tr("Author"); - case 2: return tr("Size"); - case 3: return tr("Modified"); - case 4: return tr("Accessed"); - case 5: return tr("Version"); - case 6: return tr("Path"); - case 7: return tr("Masters"); - case 8: return tr("Description"); - } - } else { - // Show row numbers - return ++section; - } - - return QVariant(); -} - -bool DataFilesModel::setData(const QModelIndex &index, const QVariant &value, int role) -{ - if (!index.isValid()) - return false; - - if (role == Qt::CheckStateRole) { - QString name = item(index.row())->fileName(); - mCheckStates[name] = static_cast(value.toInt()); - - // Force a redraw of the view since unchecking one item can affect another - QModelIndex firstIndex = indexFromItem(mFiles.first()); - QModelIndex lastIndex = indexFromItem(mFiles.last()); - - emit dataChanged(firstIndex, lastIndex); - emit checkedItemsChanged(checkedItems()); - return true; - } - - return false; -} - -bool lessThanEsmFile(const EsmFile *e1, const EsmFile *e2) -{ - //Masters first then alphabetically - if (e1->fileName().endsWith(".esm") && !e2->fileName().endsWith(".esm")) - return true; - if (!e1->fileName().endsWith(".esm") && e2->fileName().endsWith(".esm")) - return false; - - return e1->fileName().toLower() < e2->fileName().toLower(); -} - -bool lessThanDate(const EsmFile *e1, const EsmFile *e2) -{ - if (e1->modified().toString(Qt::ISODate) < e2->modified().toString(Qt::ISODate)) { - return true; - } else { - return false; - } -} - -void DataFilesModel::sort(int column, Qt::SortOrder order) -{ - emit layoutAboutToBeChanged(); - - if (column == 3) { - qSort(mFiles.begin(), mFiles.end(), lessThanDate); - } else { - qSort(mFiles.begin(), mFiles.end(), lessThanEsmFile); - } - - emit layoutChanged(); -} - -void DataFilesModel::addFile(EsmFile *file) -{ - emit beginInsertRows(QModelIndex(), mFiles.count(), mFiles.count()); - mFiles.append(file); - emit endInsertRows(); -} - -void DataFilesModel::addFiles(const QString &path) -{ - QDir dir(path); - QStringList filters; - filters << "*.esp" << "*.esm"; - dir.setNameFilters(filters); - - // Create a decoder for non-latin characters in esx metadata - QTextCodec *codec; - - if (mEncoding == QLatin1String("win1252")) { - codec = QTextCodec::codecForName("windows-1252"); - } else if (mEncoding == QLatin1String("win1251")) { - codec = QTextCodec::codecForName("windows-1251"); - } else if (mEncoding == QLatin1String("win1250")) { - codec = QTextCodec::codecForName("windows-1250"); - } else { - return; // This should never happen; - } - - QTextDecoder *decoder = codec->makeDecoder(); - - foreach (const QString &path, dir.entryList()) { - QFileInfo info(dir.absoluteFilePath(path)); - EsmFile *file = new EsmFile(path); - - try { - ESM::ESMReader fileReader; - ToUTF8::Utf8Encoder encoder(ToUTF8::calculateEncoding(mEncoding.toStdString())); - fileReader.setEncoder(&encoder); - fileReader.open(dir.absoluteFilePath(path).toStdString()); - - std::vector mlist = fileReader.getMasters(); - - QStringList masters; - - for (unsigned int i = 0; i < mlist.size(); ++i) { - QString master = QString::fromStdString(mlist[i].name); - masters.append(master); - } - - file->setAuthor(decoder->toUnicode(fileReader.getAuthor().c_str())); - file->setSize(info.size()); - file->setDates(info.lastModified(), info.lastRead()); - file->setVersion(fileReader.getFVer()); - file->setPath(info.absoluteFilePath()); - file->setMasters(masters); - file->setDescription(decoder->toUnicode(fileReader.getDesc().c_str())); - - - // Put the file in the table - if (findItem(path) == 0) - addFile(file); - } catch(std::runtime_error &e) { - // An error occurred while reading the .esp - qWarning() << "Error reading esp: " << e.what(); - continue; - } - - } - - delete decoder; -} - -QModelIndex DataFilesModel::indexFromItem(EsmFile *item) const -{ - if (item) - return createIndex(mFiles.indexOf(item), 0); - - return QModelIndex(); -} - -EsmFile* DataFilesModel::findItem(const QString &name) -{ - QList::ConstIterator it; - QList::ConstIterator itEnd = mFiles.constEnd(); - - int i = 0; - for (it = mFiles.constBegin(); it != itEnd; ++it) { - EsmFile *file = item(i); - ++i; - - if (name == file->fileName()) - return file; - } - - // Not found - return 0; -} - -EsmFile* DataFilesModel::item(int row) const -{ - if (row >= 0 && row < mFiles.count()) - return mFiles.at(row); - else - return 0; -} - -QStringList DataFilesModel::checkedItems() -{ - QStringList list; - - QList::ConstIterator it; - QList::ConstIterator itEnd = mFiles.constEnd(); - - int i = 0; - for (it = mFiles.constBegin(); it != itEnd; ++it) { - EsmFile *file = item(i); - ++i; - - QString name = file->fileName(); - - // Only add the items that are in the checked list and available - if (mCheckStates[name] == Qt::Checked && canBeChecked(file)) - list << name; - } - - return list; -} - -QStringList DataFilesModel::checkedItemsPaths() -{ - QStringList list; - - QList::ConstIterator it; - QList::ConstIterator itEnd = mFiles.constEnd(); - - int i = 0; - for (it = mFiles.constBegin(); it != itEnd; ++it) { - EsmFile *file = item(i); - ++i; - - if (mCheckStates[file->fileName()] == Qt::Checked && canBeChecked(file)) - list << file->path(); - } - - return list; -} - -void DataFilesModel::uncheckAll() -{ - emit layoutAboutToBeChanged(); - mCheckStates.clear(); - emit layoutChanged(); -} - -QStringList DataFilesModel::uncheckedItems() -{ - QStringList list; - QStringList checked = checkedItems(); - - QList::ConstIterator it; - QList::ConstIterator itEnd = mFiles.constEnd(); - - int i = 0; - for (it = mFiles.constBegin(); it != itEnd; ++it) { - EsmFile *file = item(i); - ++i; - - // Add the items that are not in the checked list - if (!checked.contains(file->fileName())) - list << file->fileName(); - } - - return list; -} - -bool DataFilesModel::canBeChecked(EsmFile *file) const -{ - //element can be checked if all its dependencies are - bool canBeChecked = true; - foreach (const QString &master, file->masters()) - { - if (!mCheckStates.contains(master) || mCheckStates[master] != Qt::Checked) - { - canBeChecked = false; - break; - } - } - return canBeChecked; -} diff --git a/components/fileorderlist/model/datafilesmodel.hpp b/components/fileorderlist/model/datafilesmodel.hpp deleted file mode 100644 index 0a07a536f..000000000 --- a/components/fileorderlist/model/datafilesmodel.hpp +++ /dev/null @@ -1,66 +0,0 @@ -#ifndef DATAFILESMODEL_HPP -#define DATAFILESMODEL_HPP - -#include -#include -#include -#include - - -class EsmFile; - -class DataFilesModel : public QAbstractTableModel -{ - Q_OBJECT - -public: - explicit DataFilesModel(QObject *parent = 0); - virtual ~DataFilesModel(); - virtual int columnCount(const QModelIndex &parent = QModelIndex()) const; - virtual int rowCount(const QModelIndex &parent = QModelIndex()) const; - - bool moveRow(int oldrow, int row, const QModelIndex &parent = QModelIndex()); - - virtual Qt::ItemFlags flags(const QModelIndex &index) const; - - virtual QVariant headerData(int section, Qt::Orientation orientation, int role = Qt::DisplayRole) const; - virtual QVariant data(const QModelIndex &index, int role = Qt::DisplayRole) const; - - virtual bool setData(const QModelIndex &index, const QVariant &value, int role = Qt::EditRole); - void sort(int column, Qt::SortOrder order = Qt::AscendingOrder); - - inline QModelIndex index(int row, int column, const QModelIndex &parent = QModelIndex()) const - { return QAbstractTableModel::index(row, column, parent); } - - void setEncoding(const QString &encoding); - - void addFiles(const QString &path); - - void uncheckAll(); - - QStringList checkedItems(); - QStringList uncheckedItems(); - QStringList checkedItemsPaths(); - - Qt::CheckState checkState(const QModelIndex &index); - void setCheckState(const QModelIndex &index, Qt::CheckState state); - - QModelIndex indexFromItem(EsmFile *item) const; - EsmFile* findItem(const QString &name); - EsmFile* item(int row) const; - -signals: - void checkedItemsChanged(const QStringList &items); - -private: - bool canBeChecked(EsmFile *file) const; - void addFile(EsmFile *file); - - QList mFiles; - QHash mCheckStates; - - QString mEncoding; - -}; - -#endif // DATAFILESMODEL_HPP diff --git a/components/fileorderlist/model/esm/esmfile.cpp b/components/fileorderlist/model/esm/esmfile.cpp deleted file mode 100644 index 93d83091e..000000000 --- a/components/fileorderlist/model/esm/esmfile.cpp +++ /dev/null @@ -1,50 +0,0 @@ -#include "esmfile.hpp" - -EsmFile::EsmFile(QString fileName, ModelItem *parent) - : ModelItem(parent) -{ - mFileName = fileName; - mSize = 0; - mVersion = 0.0f; -} - -void EsmFile::setFileName(const QString &fileName) -{ - mFileName = fileName; -} - -void EsmFile::setAuthor(const QString &author) -{ - mAuthor = author; -} - -void EsmFile::setSize(const int size) -{ - mSize = size; -} - -void EsmFile::setDates(const QDateTime &modified, const QDateTime &accessed) -{ - mModified = modified; - mAccessed = accessed; -} - -void EsmFile::setVersion(float version) -{ - mVersion = version; -} - -void EsmFile::setPath(const QString &path) -{ - mPath = path; -} - -void EsmFile::setMasters(const QStringList &masters) -{ - mMasters = masters; -} - -void EsmFile::setDescription(const QString &description) -{ - mDescription = description; -} diff --git a/components/fileorderlist/model/esm/esmfile.hpp b/components/fileorderlist/model/esm/esmfile.hpp deleted file mode 100644 index 52b3fbd00..000000000 --- a/components/fileorderlist/model/esm/esmfile.hpp +++ /dev/null @@ -1,54 +0,0 @@ -#ifndef ESMFILE_HPP -#define ESMFILE_HPP - -#include -#include - -#include "../modelitem.hpp" - -class EsmFile : public ModelItem -{ - Q_OBJECT - Q_PROPERTY(QString filename READ fileName) - -public: - EsmFile(QString fileName = QString(), ModelItem *parent = 0); - - ~EsmFile() - {} - - void setFileName(const QString &fileName); - void setAuthor(const QString &author); - void setSize(const int size); - void setDates(const QDateTime &modified, const QDateTime &accessed); - void setVersion(const float version); - void setPath(const QString &path); - void setMasters(const QStringList &masters); - void setDescription(const QString &description); - - inline QString fileName() const { return mFileName; } - inline QString author() const { return mAuthor; } - inline int size() const { return mSize; } - inline QDateTime modified() const { return mModified; } - inline QDateTime accessed() const { return mAccessed; } - inline float version() const { return mVersion; } - inline QString path() const { return mPath; } - inline QStringList masters() const { return mMasters; } - inline QString description() const { return mDescription; } - - -private: - QString mFileName; - QString mAuthor; - int mSize; - QDateTime mModified; - QDateTime mAccessed; - float mVersion; - QString mPath; - QStringList mMasters; - QString mDescription; - -}; - - -#endif diff --git a/components/fileorderlist/model/modelitem.cpp b/components/fileorderlist/model/modelitem.cpp deleted file mode 100644 index 0ff7e45cb..000000000 --- a/components/fileorderlist/model/modelitem.cpp +++ /dev/null @@ -1,57 +0,0 @@ -#include "modelitem.hpp" - -ModelItem::ModelItem(ModelItem *parent) - : mParentItem(parent) - , QObject(parent) -{ -} - -ModelItem::~ModelItem() -{ - qDeleteAll(mChildItems); -} - - -ModelItem *ModelItem::parent() -{ - return mParentItem; -} - -int ModelItem::row() const -{ - if (mParentItem) - return 1; - //return mParentItem->childRow(const_cast(this)); - //return mParentItem->mChildItems.indexOf(const_cast(this)); - - return -1; -} - - -int ModelItem::childCount() const -{ - return mChildItems.count(); -} - -int ModelItem::childRow(ModelItem *child) const -{ - Q_ASSERT(child); - - return mChildItems.indexOf(child); -} - -ModelItem *ModelItem::child(int row) -{ - return mChildItems.value(row); -} - - -void ModelItem::appendChild(ModelItem *item) -{ - mChildItems.append(item); -} - -void ModelItem::removeChild(int row) -{ - mChildItems.removeAt(row); -} diff --git a/components/fileorderlist/model/modelitem.hpp b/components/fileorderlist/model/modelitem.hpp deleted file mode 100644 index f4cb4322f..000000000 --- a/components/fileorderlist/model/modelitem.hpp +++ /dev/null @@ -1,32 +0,0 @@ -#ifndef MODELITEM_HPP -#define MODELITEM_HPP - -#include -#include - -class ModelItem : public QObject -{ - Q_OBJECT - -public: - ModelItem(ModelItem *parent = 0); - ~ModelItem(); - - ModelItem *parent(); - int row() const; - - int childCount() const; - int childRow(ModelItem *child) const; - ModelItem *child(int row); - - void appendChild(ModelItem *child); - void removeChild(int row); - - //virtual bool acceptChild(ModelItem *child); - -protected: - ModelItem *mParentItem; - QList mChildItems; -}; - -#endif diff --git a/components/fileorderlist/model/pluginsproxymodel.cpp b/components/fileorderlist/model/pluginsproxymodel.cpp deleted file mode 100644 index 6be152b55..000000000 --- a/components/fileorderlist/model/pluginsproxymodel.cpp +++ /dev/null @@ -1,17 +0,0 @@ -#include "pluginsproxymodel.hpp" - -PluginsProxyModel::PluginsProxyModel(QObject *parent) : - QSortFilterProxyModel(parent) -{ -} - -PluginsProxyModel::~PluginsProxyModel() -{ -} - -QVariant PluginsProxyModel::headerData(int section, Qt::Orientation orientation, int role) const -{ - if (orientation != Qt::Vertical || role != Qt::DisplayRole) - return QSortFilterProxyModel::headerData(section, orientation, role); - return section + 1; -} diff --git a/components/fileorderlist/model/pluginsproxymodel.hpp b/components/fileorderlist/model/pluginsproxymodel.hpp deleted file mode 100644 index 8fde73236..000000000 --- a/components/fileorderlist/model/pluginsproxymodel.hpp +++ /dev/null @@ -1,18 +0,0 @@ -#ifndef PLUGINSPROXYMODEL_HPP -#define PLUGINSPROXYMODEL_HPP - -#include - -class QVariant; - -class PluginsProxyModel : public QSortFilterProxyModel -{ - Q_OBJECT -public: - explicit PluginsProxyModel(QObject *parent = 0); - ~PluginsProxyModel(); - - QVariant headerData(int section, Qt::Orientation orientation, int role) const; -}; - -#endif // PLUGINSPROXYMODEL_HPP diff --git a/components/fileorderlist/utils/comboboxlineedit.cpp b/components/fileorderlist/utils/comboboxlineedit.cpp deleted file mode 100644 index 4d62e1399..000000000 --- a/components/fileorderlist/utils/comboboxlineedit.cpp +++ /dev/null @@ -1,35 +0,0 @@ -#include -#include - -#include "comboboxlineedit.hpp" - -ComboBoxLineEdit::ComboBoxLineEdit(QWidget *parent) - : QLineEdit(parent) -{ - mClearButton = new QToolButton(this); - QPixmap pixmap(":images/clear.png"); - mClearButton->setIcon(QIcon(pixmap)); - mClearButton->setIconSize(pixmap.size()); - mClearButton->setCursor(Qt::ArrowCursor); - mClearButton->setStyleSheet("QToolButton { border: none; padding: 0px; }"); - mClearButton->hide(); - connect(mClearButton, SIGNAL(clicked()), this, SLOT(clear())); - connect(this, SIGNAL(textChanged(const QString&)), this, SLOT(updateClearButton(const QString&))); - int frameWidth = style()->pixelMetric(QStyle::PM_DefaultFrameWidth); - - setObjectName(QString("ComboBoxLineEdit")); - setStyleSheet(QString("ComboBoxLineEdit { background-color: transparent; padding-right: %1px; } ").arg(mClearButton->sizeHint().width() + frameWidth + 1)); -} - -void ComboBoxLineEdit::resizeEvent(QResizeEvent *) -{ - QSize sz = mClearButton->sizeHint(); - int frameWidth = style()->pixelMetric(QStyle::PM_DefaultFrameWidth); - mClearButton->move(rect().right() - frameWidth - sz.width(), - (rect().bottom() + 1 - sz.height())/2); -} - -void ComboBoxLineEdit::updateClearButton(const QString& text) -{ - mClearButton->setVisible(!text.isEmpty()); -} diff --git a/components/fileorderlist/utils/comboboxlineedit.hpp b/components/fileorderlist/utils/comboboxlineedit.hpp deleted file mode 100644 index ba10731ae..000000000 --- a/components/fileorderlist/utils/comboboxlineedit.hpp +++ /dev/null @@ -1,35 +0,0 @@ -/**************************************************************************** -** -** Copyright (c) 2007 Trolltech ASA -** -** Use, modification and distribution is allowed without limitation, -** warranty, liability or support of any kind. -** -****************************************************************************/ - -#ifndef LINEEDIT_H -#define LINEEDIT_H - -#include - -class QToolButton; - -class ComboBoxLineEdit : public QLineEdit -{ - Q_OBJECT - -public: - ComboBoxLineEdit(QWidget *parent = 0); - -protected: - void resizeEvent(QResizeEvent *); - -private slots: - void updateClearButton(const QString &text); - -private: - QToolButton *mClearButton; -}; - -#endif // LIENEDIT_H - diff --git a/components/fileorderlist/utils/naturalsort.hpp b/components/fileorderlist/utils/naturalsort.hpp deleted file mode 100644 index 59271547a..000000000 --- a/components/fileorderlist/utils/naturalsort.hpp +++ /dev/null @@ -1,11 +0,0 @@ -#ifndef NATURALSORT_H -#define NATURALSORT_H - -#include - -bool naturalSortLessThanCS( const QString &left, const QString &right ); -bool naturalSortLessThanCI( const QString &left, const QString &right ); -bool naturalSortGreaterThanCS( const QString &left, const QString &right ); -bool naturalSortGreaterThanCI( const QString &left, const QString &right ); - -#endif diff --git a/components/fileorderlist/utils/profilescombobox.hpp b/components/fileorderlist/utils/profilescombobox.hpp deleted file mode 100644 index 08ead9a7a..000000000 --- a/components/fileorderlist/utils/profilescombobox.hpp +++ /dev/null @@ -1,30 +0,0 @@ -#ifndef PROFILESCOMBOBOX_HPP -#define PROFILESCOMBOBOX_HPP - -#include - -class QString; -class QRegExpValidator; - -class ProfilesComboBox : public QComboBox -{ - Q_OBJECT -public: - explicit ProfilesComboBox(QWidget *parent = 0); - void setEditEnabled(bool editable); - -signals: - void profileChanged(const QString &previous, const QString ¤t); - void profileRenamed(const QString &oldName, const QString &newName); - -private slots: - void slotEditingFinished(); - void slotIndexChanged(int index); - void slotTextChanged(const QString &text); - -private: - QString mOldProfile; - QRegExpValidator *mValidator; -}; - -#endif // PROFILESCOMBOBOX_HPP diff --git a/components/files/filelibrary.cpp b/components/files/filelibrary.cpp deleted file mode 100644 index ce2d95f57..000000000 --- a/components/files/filelibrary.cpp +++ /dev/null @@ -1,120 +0,0 @@ -#include "filelibrary.hpp" - -#include - -#include -#include <../components/misc/stringops.hpp> - -namespace Files -{ - // Looks for a string in a vector of strings - bool containsVectorString(const StringVector& list, const std::string& str) - { - for (StringVector::const_iterator iter = list.begin(); - iter != list.end(); ++iter) - { - if (*iter == str) - return true; - } - return false; - } - - // Searches a path and adds the results to the library - void FileLibrary::add(const boost::filesystem::path &root, bool recursive, bool strict, - const StringVector &acceptableExtensions) - { - if (!boost::filesystem::exists(root)) - { - std::cout << "Warning " << root.string() << " does not exist.\n"; - return; - } - - std::string fileExtension; - std::string type; - - // remember the last location of the priority list when listing new items - int length = mPriorityList.size(); - - // First makes a list of all candidate files - FileLister(root, mPriorityList, recursive); - - // Then sort these files into sections according to the folder they belong to - for (PathContainer::iterator listIter = mPriorityList.begin() + length; - listIter != mPriorityList.end(); ++listIter) - { - if( !acceptableExtensions.empty() ) - { - fileExtension = boost::filesystem::path (listIter->extension()).string(); - Misc::StringUtils::toLower(fileExtension); - if(!containsVectorString(acceptableExtensions, fileExtension)) - continue; - } - - type = boost::filesystem::path (listIter->parent_path().leaf()).string(); - if (!strict) - Misc::StringUtils::toLower(type); - - mMap[type].push_back(*listIter); - // std::cout << "Added path: " << listIter->string() << " in section "<< type <second); - } - } - - // Searches the library for an item and returns a boost path to it - boost::filesystem::path FileLibrary::locate(std::string item, bool strict, bool ignoreExtensions, std::string sectionName) - { - boost::filesystem::path result(""); - if (sectionName == "") - { - return FileListLocator(mPriorityList, boost::filesystem::path(item), strict, ignoreExtensions); - } - else - { - if (!containsSection(sectionName, strict)) - { - std::cout << "Warning: There is no section named " << sectionName << "\n"; - return result; - } - result = FileListLocator(mMap[sectionName], boost::filesystem::path(item), strict, ignoreExtensions); - } - return result; - } - - // Prints all the available sections, used for debugging - void FileLibrary::printSections() - { - for(StringPathContMap::const_iterator mapIter = mMap.begin(); - mapIter != mMap.end(); ++mapIter) - { - std::cout << mapIter->first < - -namespace Files -{ - typedef std::map StringPathContMap; - typedef std::vector StringVector; - - /// Looks for a string in a vector of strings - bool containsVectorString(const StringVector& list, const std::string& str); - - /// \brief Searches directories and makes lists of files according to folder name - class FileLibrary - { - private: - StringPathContMap mMap; - PathContainer mEmptyPath; - PathContainer mPriorityList; - - public: - /// Searches a path and adds the results to the library - /// Recursive search and fs strict options are available - /// Takes a vector of acceptable files extensions, if none is given it lists everything. - void add(const boost::filesystem::path &root, bool recursive, bool strict, - const StringVector &acceptableExtensions); - - /// Returns true if the named section exists - /// You can run this check before running section() - bool containsSection(std::string sectionName, bool strict); - - /// Returns a pointer to const for a section of the library - /// which is essentially a PathContainer. - /// If the section does not exists it returns a pointer to an empty path. - const PathContainer* section(std::string sectionName, bool strict); - - /// Searches the library for an item and returns a boost path to it - /// Optionally you can provide a specific section - /// The result is the first that comes up according to alphabetical - /// section naming - boost::filesystem::path locate(std::string item, bool strict, bool ignoreExtensions, std::string sectionName=""); - - /// Prints all the available sections, used for debugging - void printSections(); - }; -} - -#endif diff --git a/components/files/fileops.cpp b/components/files/fileops.cpp deleted file mode 100644 index fbc2eef05..000000000 --- a/components/files/fileops.cpp +++ /dev/null @@ -1,120 +0,0 @@ -#include "fileops.hpp" - -#include - -#include -#include -#include <../components/misc/stringops.hpp> - -namespace Files -{ - -bool isFile(const char *name) -{ - return boost::filesystem::exists(boost::filesystem::path(name)); -} - - // Returns true if the last part of the superset matches the subset - bool endingMatches(const std::string& superset, const std::string& subset) - { - if (subset.length() > superset.length()) - return false; - return superset.substr(superset.length() - subset.length()) == subset; - } - - // Makes a list of files from a directory - void FileLister( boost::filesystem::path currentPath, Files::PathContainer& list, bool recursive) - { - if (!boost::filesystem::exists(currentPath)) - { - std::cout << "WARNING: " << currentPath.string() << " does not exist.\n"; - return ; - } - if (recursive) - { - for ( boost::filesystem::recursive_directory_iterator end, itr(currentPath.string()); - itr != end; ++itr ) - { - if ( boost::filesystem::is_regular_file(*itr)) - list.push_back(itr->path()); - } - } - else - { - for ( boost::filesystem::directory_iterator end, itr(currentPath.string()); - itr != end; ++itr ) - { - if ( boost::filesystem::is_regular_file(*itr)) - list.push_back(itr->path()); - } - } - } - - // Locates path in path container - boost::filesystem::path FileListLocator (const Files::PathContainer& list, const boost::filesystem::path& toFind, - bool strict, bool ignoreExtensions) - { - boost::filesystem::path result(""); - if (list.empty()) - return result; - - std::string toFindStr; - if (ignoreExtensions) - toFindStr = boost::filesystem::basename(toFind); - else - toFindStr = toFind.string(); - - std::string fullPath; - - // The filesystems slash sets the default slash - std::string slash; - std::string wrongslash; - if(list[0].string().find("\\") != std::string::npos) - { - slash = "\\"; - wrongslash = "/"; - } - else - { - slash = "/"; - wrongslash = "\\"; - } - - // The file being looked for is converted to the new slash - if(toFindStr.find(wrongslash) != std::string::npos ) - { - boost::replace_all(toFindStr, wrongslash, slash); - } - - if (!strict) - { - Misc::StringUtils::toLower(toFindStr); - } - - for (Files::PathContainer::const_iterator it = list.begin(); it != list.end(); ++it) - { - fullPath = it->string(); - if (ignoreExtensions) - fullPath.erase(fullPath.length() - - boost::filesystem::path (it->extension()).string().length()); - - if (!strict) - { - Misc::StringUtils::toLower(fullPath); - } - if(endingMatches(fullPath, toFindStr)) - { - result = *it; - break; - } - } - return result; - } - - // Overloaded form of the locator that takes a string and returns a string - std::string FileListLocator (const Files::PathContainer& list,const std::string& toFind, bool strict, bool ignoreExtensions) - { - return FileListLocator(list, boost::filesystem::path(toFind), strict, ignoreExtensions).string(); - } - -} diff --git a/components/files/fileops.hpp b/components/files/fileops.hpp deleted file mode 100644 index bf1c51485..000000000 --- a/components/files/fileops.hpp +++ /dev/null @@ -1,38 +0,0 @@ -#ifndef COMPONENTS_FILES_FILEOPS_HPP -#define COMPONENTS_FILES_FILEOPS_HPP - -#include -#include -#include - -#include - -namespace Files -{ - -///\brief Check if a given path is an existing file (not a directory) -///\param [in] name - filename -bool isFile(const char *name); - - /// A vector of Boost Paths, very handy - typedef std::vector PathContainer; - - /// Makes a list of files from a directory by taking a boost - /// path and a Path Container and adds to the Path container - /// all files in the path. It has a recursive option. - void FileLister( boost::filesystem::path currentPath, Files::PathContainer& list, bool recursive); - - /// Locates boost path in path container - /// returns the path from the container - /// that contains the searched path. - /// If it's not found it returns and empty path - /// Takes care of slashes, backslashes and it has a strict option. - boost::filesystem::path FileListLocator (const Files::PathContainer& list, const boost::filesystem::path& toFind, - bool strict, bool ignoreExtensions); - - /// Overloaded form of the locator that takes a string and returns a string - std::string FileListLocator (const Files::PathContainer& list,const std::string& toFind, bool strict, bool ignoreExtensions); - -} - -#endif /* COMPONENTS_FILES_FILEOPS_HPP */ diff --git a/components/nif/controller.hpp b/components/nif/controller.hpp index 011e0e445..e44f4a6f3 100644 --- a/components/nif/controller.hpp +++ b/components/nif/controller.hpp @@ -306,7 +306,7 @@ public: class NiFlipController : public Controller { public: - int mTexSlot; + int mTexSlot; // NiTexturingProperty::TextureType float mDelta; // Time between two flips. delta = (start_time - stop_time) / num_sources NiSourceTextureList mSources; diff --git a/components/nif/node.hpp b/components/nif/node.hpp index 917bc8add..6816a79a2 100644 --- a/components/nif/node.hpp +++ b/components/nif/node.hpp @@ -137,7 +137,8 @@ struct NiNode : Node AnimFlag_AutoPlay = 0x0020 }; enum BSParticleFlags { - ParticleFlag_AutoPlay = 0x0020 + ParticleFlag_AutoPlay = 0x0020, + ParticleFlag_LocalSpace = 0x0080 }; void read(NIFStream *nif) diff --git a/components/nifogre/controller.hpp b/components/nifogre/controller.hpp new file mode 100644 index 000000000..6d7f6ab3f --- /dev/null +++ b/components/nifogre/controller.hpp @@ -0,0 +1,95 @@ +#ifndef COMPONENTS_NIFOGRE_CONTROLLER_H +#define COMPONENTS_NIFOGRE_CONTROLLER_H + +#include +#include + +namespace NifOgre +{ + + class ValueInterpolator + { + protected: + float interpKey(const Nif::FloatKeyList::VecType &keys, float time, float def=0.f) const + { + if (keys.size() == 0) + return def; + + if(time <= keys.front().mTime) + return keys.front().mValue; + + Nif::FloatKeyList::VecType::const_iterator iter(keys.begin()+1); + for(;iter != keys.end();iter++) + { + if(iter->mTime < time) + continue; + + Nif::FloatKeyList::VecType::const_iterator last(iter-1); + float a = (time-last->mTime) / (iter->mTime-last->mTime); + return last->mValue + ((iter->mValue - last->mValue)*a); + } + return keys.back().mValue; + } + + Ogre::Vector3 interpKey(const Nif::Vector3KeyList::VecType &keys, float time) const + { + if(time <= keys.front().mTime) + return keys.front().mValue; + + Nif::Vector3KeyList::VecType::const_iterator iter(keys.begin()+1); + for(;iter != keys.end();iter++) + { + if(iter->mTime < time) + continue; + + Nif::Vector3KeyList::VecType::const_iterator last(iter-1); + float a = (time-last->mTime) / (iter->mTime-last->mTime); + return last->mValue + ((iter->mValue - last->mValue)*a); + } + return keys.back().mValue; + } + }; + + // FIXME: Should not be here. + class DefaultFunction : public Ogre::ControllerFunction + { + private: + float mFrequency; + float mPhase; + float mStartTime; + public: + float mStopTime; + + public: + DefaultFunction(const Nif::Controller *ctrl, bool deltaInput) + : Ogre::ControllerFunction(deltaInput) + , mFrequency(ctrl->frequency) + , mPhase(ctrl->phase) + , mStartTime(ctrl->timeStart) + , mStopTime(ctrl->timeStop) + { + if(mDeltaInput) + mDeltaCount = mPhase; + } + + virtual Ogre::Real calculate(Ogre::Real value) + { + if(mDeltaInput) + { + mDeltaCount += value*mFrequency; + if(mDeltaCount < mStartTime) + mDeltaCount = mStopTime - std::fmod(mStartTime - mDeltaCount, + mStopTime - mStartTime); + mDeltaCount = std::fmod(mDeltaCount - mStartTime, + mStopTime - mStartTime) + mStartTime; + return mDeltaCount; + } + + value = std::min(mStopTime, std::max(mStartTime, value+mPhase)); + return value; + } + }; + +} + +#endif diff --git a/components/nifogre/material.cpp b/components/nifogre/material.cpp index 55f064c55..bef0ec1d1 100644 --- a/components/nifogre/material.cpp +++ b/components/nifogre/material.cpp @@ -237,7 +237,8 @@ Ogre::String NIFMaterialLoader::getMaterial(const Nif::ShapeData *shapedata, Nif::ControllerPtr ctrls = matprop->controller; while(!ctrls.empty()) { - warn("Unhandled material controller "+ctrls->recName+" in "+name); + if (ctrls->recType != Nif::RC_NiAlphaController && ctrls->recType != Nif::RC_NiMaterialColorController) + warn("Unhandled material controller "+ctrls->recName+" in "+name); ctrls = ctrls->next; } } @@ -334,6 +335,10 @@ Ogre::String NIFMaterialLoader::getMaterial(const Nif::ShapeData *shapedata, instance->setProperty("detailMapUVSet", sh::makeProperty(new sh::IntValue(texprop->textures[Nif::NiTexturingProperty::DetailTexture].uvSet))); } + bool useParallax = !texName[Nif::NiTexturingProperty::BumpTexture].empty() + && texName[Nif::NiTexturingProperty::BumpTexture].find("_nh.") != std::string::npos; + instance->setProperty("use_parallax", sh::makeProperty(new sh::BooleanValue(useParallax))); + for(int i = 0;i < 7;i++) { if(i == Nif::NiTexturingProperty::BaseTexture || diff --git a/components/nifogre/material.hpp b/components/nifogre/material.hpp index 8843ac6c6..b02c7c236 100644 --- a/components/nifogre/material.hpp +++ b/components/nifogre/material.hpp @@ -37,9 +37,9 @@ class NIFMaterialLoader { static std::map sMaterialMap; +public: static std::string findTextureName(const std::string &filename); -public: static Ogre::String getMaterial(const Nif::ShapeData *shapedata, const Ogre::String &name, const Ogre::String &group, const Nif::NiTexturingProperty *texprop, diff --git a/components/nifogre/mesh.cpp b/components/nifogre/mesh.cpp index ca92f62d4..ef4fbbe8d 100644 --- a/components/nifogre/mesh.cpp +++ b/components/nifogre/mesh.cpp @@ -116,6 +116,7 @@ void NIFMeshLoader::createSubMesh(Ogre::Mesh *mesh, const Nif::NiTriShape *shape Ogre::HardwareBuffer::Usage vertUsage = Ogre::HardwareBuffer::HBU_STATIC; bool vertShadowBuffer = false; + bool geomMorpherController = false; if(!shape->controller.empty()) { Nif::ControllerPtr ctrl = shape->controller; @@ -124,6 +125,7 @@ void NIFMeshLoader::createSubMesh(Ogre::Mesh *mesh, const Nif::NiTriShape *shape { vertUsage = Ogre::HardwareBuffer::HBU_DYNAMIC_WRITE_ONLY; vertShadowBuffer = true; + geomMorpherController = true; break; } } while(!(ctrl=ctrl->next).empty()); @@ -347,6 +349,11 @@ void NIFMeshLoader::createSubMesh(Ogre::Mesh *mesh, const Nif::NiTriShape *shape if (!mesh->suggestTangentVectorBuildParams(Ogre::VES_TANGENT, src,dest)) mesh->buildTangentVectors(Ogre::VES_TANGENT, src,dest); } + + // Create a dummy vertex animation track if there's a geom morpher controller + // This is required to make Ogre create the buffers we will use for software vertex animation + if (srcVerts.size() && geomMorpherController) + mesh->createAnimation("dummy", 0)->createVertexTrack(1, sub->vertexData, Ogre::VAT_MORPH); } diff --git a/components/nifogre/ogrenifloader.cpp b/components/nifogre/ogrenifloader.cpp index 3bb9ea230..acf8ac13a 100644 --- a/components/nifogre/ogrenifloader.cpp +++ b/components/nifogre/ogrenifloader.cpp @@ -37,53 +37,241 @@ #include #include +#include + #include #include #include "skeleton.hpp" #include "material.hpp" #include "mesh.hpp" +#include "controller.hpp" namespace NifOgre { -// FIXME: Should not be here. -class DefaultFunction : public Ogre::ControllerFunction +Ogre::MaterialPtr MaterialControllerManager::getWritableMaterial(Ogre::MovableObject *movable) { -private: - float mFrequency; - float mPhase; - float mStartTime; - float mStopTime; + if (mClonedMaterials.find(movable) != mClonedMaterials.end()) + return mClonedMaterials[movable]; -public: - DefaultFunction(const Nif::Controller *ctrl, bool deltaInput) - : Ogre::ControllerFunction(deltaInput) - , mFrequency(ctrl->frequency) - , mPhase(ctrl->phase) - , mStartTime(ctrl->timeStart) - , mStopTime(ctrl->timeStop) + else { - if(mDeltaInput) - mDeltaCount = mPhase; + Ogre::MaterialPtr mat; + if (Ogre::Entity* ent = dynamic_cast(movable)) + mat = ent->getSubEntity(0)->getMaterial(); + else if (Ogre::ParticleSystem* partSys = dynamic_cast(movable)) + mat = Ogre::MaterialManager::getSingleton().getByName(partSys->getMaterialName()); + + static int count=0; + Ogre::String newName = mat->getName() + Ogre::StringConverter::toString(count++); + sh::Factory::getInstance().createMaterialInstance(newName, mat->getName()); + // Make sure techniques are created + sh::Factory::getInstance()._ensureMaterial(newName, "Default"); + mat = Ogre::MaterialManager::getSingleton().getByName(newName); + + mClonedMaterials[movable] = mat; + + if (Ogre::Entity* ent = dynamic_cast(movable)) + ent->getSubEntity(0)->setMaterial(mat); + else if (Ogre::ParticleSystem* partSys = dynamic_cast(movable)) + partSys->setMaterialName(mat->getName()); + + return mat; } +} - virtual Ogre::Real calculate(Ogre::Real value) +MaterialControllerManager::~MaterialControllerManager() +{ + for (std::map::iterator it = mClonedMaterials.begin(); it != mClonedMaterials.end(); ++it) { - if(mDeltaInput) + sh::Factory::getInstance().destroyMaterialInstance(it->second->getName()); + } +} + +ObjectScene::~ObjectScene() +{ + for(size_t i = 0;i < mLights.size();i++) + { + Ogre::Light *light = mLights[i]; + // If parent is a scene node, it was created specifically for this light. Destroy it now. + if(light->isAttached() && !light->isParentTagPoint()) + mSceneMgr->destroySceneNode(light->getParentSceneNode()); + mSceneMgr->destroyLight(light); + } + for(size_t i = 0;i < mParticles.size();i++) + mSceneMgr->destroyParticleSystem(mParticles[i]); + for(size_t i = 0;i < mEntities.size();i++) + mSceneMgr->destroyEntity(mEntities[i]); + mControllers.clear(); + mLights.clear(); + mParticles.clear(); + mEntities.clear(); + mSkelBase = NULL; +} + +// Animates a texture +class FlipController +{ +public: + class Value : public Ogre::ControllerValue + { + private: + Ogre::MovableObject* mMovable; + int mTexSlot; + float mDelta; + std::vector mTextures; + MaterialControllerManager* mMaterialControllerMgr; + + public: + Value(Ogre::MovableObject *movable, const Nif::NiFlipController *ctrl, MaterialControllerManager* materialControllerMgr) + : mMovable(movable) + , mMaterialControllerMgr(materialControllerMgr) { - mDeltaCount += value*mFrequency; - if(mDeltaCount < mStartTime) - mDeltaCount = mStopTime - std::fmod(mStartTime - mDeltaCount, - mStopTime - mStartTime); - mDeltaCount = std::fmod(mDeltaCount - mStartTime, - mStopTime - mStartTime) + mStartTime; - return mDeltaCount; + mTexSlot = ctrl->mTexSlot; + mDelta = ctrl->mDelta; + for (unsigned int i=0; imSources.length(); ++i) + { + const Nif::NiSourceTexture* tex = ctrl->mSources[i].getPtr(); + if (!tex->external) + std::cerr << "Warning: Found internal texture, ignoring." << std::endl; + mTextures.push_back(NIFMaterialLoader::findTextureName(tex->filename)); + } } - value = std::min(mStopTime, std::max(mStartTime, value+mPhase)); - return value; - } + virtual Ogre::Real getValue() const + { + // Should not be called + return 0.0f; + } + + virtual void setValue(Ogre::Real time) + { + if (mDelta == 0) + return; + int curTexture = int(time / mDelta) % mTextures.size(); + + Ogre::MaterialPtr mat = mMaterialControllerMgr->getWritableMaterial(mMovable); + Ogre::Material::TechniqueIterator techs = mat->getTechniqueIterator(); + while(techs.hasMoreElements()) + { + Ogre::Technique *tech = techs.getNext(); + Ogre::Technique::PassIterator passes = tech->getPassIterator(); + while(passes.hasMoreElements()) + { + Ogre::Pass *pass = passes.getNext(); + Ogre::Pass::TextureUnitStateIterator textures = pass->getTextureUnitStateIterator(); + while (textures.hasMoreElements()) + { + Ogre::TextureUnitState *texture = textures.getNext(); + if ((texture->getName() == "diffuseMap" && mTexSlot == Nif::NiTexturingProperty::BaseTexture) + || (texture->getName() == "normalMap" && mTexSlot == Nif::NiTexturingProperty::BumpTexture) + || (texture->getName() == "detailMap" && mTexSlot == Nif::NiTexturingProperty::DetailTexture) + || (texture->getName() == "emissiveMap" && mTexSlot == Nif::NiTexturingProperty::GlowTexture)) + texture->setTextureName(mTextures[curTexture]); + } + } + } + } + }; + + typedef DefaultFunction Function; +}; + +class AlphaController +{ +public: + class Value : public Ogre::ControllerValue, public ValueInterpolator + { + private: + Ogre::MovableObject* mMovable; + Nif::FloatKeyList mData; + MaterialControllerManager* mMaterialControllerMgr; + + public: + Value(Ogre::MovableObject *movable, const Nif::NiFloatData *data, MaterialControllerManager* materialControllerMgr) + : mMovable(movable) + , mData(data->mKeyList) + , mMaterialControllerMgr(materialControllerMgr) + { + } + + virtual Ogre::Real getValue() const + { + // Should not be called + return 0.0f; + } + + virtual void setValue(Ogre::Real time) + { + float value = interpKey(mData.mKeys, time); + Ogre::MaterialPtr mat = mMaterialControllerMgr->getWritableMaterial(mMovable); + Ogre::Material::TechniqueIterator techs = mat->getTechniqueIterator(); + while(techs.hasMoreElements()) + { + Ogre::Technique *tech = techs.getNext(); + Ogre::Technique::PassIterator passes = tech->getPassIterator(); + while(passes.hasMoreElements()) + { + Ogre::Pass *pass = passes.getNext(); + Ogre::ColourValue diffuse = pass->getDiffuse(); + diffuse.a = value; + pass->setDiffuse(diffuse); + } + } + } + }; + + typedef DefaultFunction Function; +}; + +class MaterialColorController +{ +public: + class Value : public Ogre::ControllerValue, public ValueInterpolator + { + private: + Ogre::MovableObject* mMovable; + Nif::Vector3KeyList mData; + MaterialControllerManager* mMaterialControllerMgr; + + public: + Value(Ogre::MovableObject *movable, const Nif::NiPosData *data, MaterialControllerManager* materialControllerMgr) + : mMovable(movable) + , mData(data->mKeyList) + , mMaterialControllerMgr(materialControllerMgr) + { + } + + virtual Ogre::Real getValue() const + { + // Should not be called + return 0.0f; + } + + virtual void setValue(Ogre::Real time) + { + Ogre::Vector3 value = interpKey(mData.mKeys, time); + Ogre::MaterialPtr mat = mMaterialControllerMgr->getWritableMaterial(mMovable); + Ogre::Material::TechniqueIterator techs = mat->getTechniqueIterator(); + while(techs.hasMoreElements()) + { + Ogre::Technique *tech = techs.getNext(); + Ogre::Technique::PassIterator passes = tech->getPassIterator(); + while(passes.hasMoreElements()) + { + Ogre::Pass *pass = passes.getNext(); + Ogre::ColourValue diffuse = pass->getDiffuse(); + diffuse.r = value.x; + diffuse.g = value.y; + diffuse.b = value.z; + pass->setDiffuse(diffuse); + } + } + } + }; + + typedef DefaultFunction Function; }; class VisController @@ -162,48 +350,14 @@ public: class KeyframeController { public: - class Value : public NodeTargetValue + class Value : public NodeTargetValue, public ValueInterpolator { private: Nif::QuaternionKeyList mRotations; Nif::Vector3KeyList mTranslations; Nif::FloatKeyList mScales; - static float interpKey(const Nif::FloatKeyList::VecType &keys, float time) - { - if(time <= keys.front().mTime) - return keys.front().mValue; - - Nif::FloatKeyList::VecType::const_iterator iter(keys.begin()+1); - for(;iter != keys.end();iter++) - { - if(iter->mTime < time) - continue; - - Nif::FloatKeyList::VecType::const_iterator last(iter-1); - float a = (time-last->mTime) / (iter->mTime-last->mTime); - return last->mValue + ((iter->mValue - last->mValue)*a); - } - return keys.back().mValue; - } - - static Ogre::Vector3 interpKey(const Nif::Vector3KeyList::VecType &keys, float time) - { - if(time <= keys.front().mTime) - return keys.front().mValue; - - Nif::Vector3KeyList::VecType::const_iterator iter(keys.begin()+1); - for(;iter != keys.end();iter++) - { - if(iter->mTime < time) - continue; - - Nif::Vector3KeyList::VecType::const_iterator last(iter-1); - float a = (time-last->mTime) / (iter->mTime-last->mTime); - return last->mValue + ((iter->mValue - last->mValue)*a); - } - return keys.back().mValue; - } + using ValueInterpolator::interpKey; static Ogre::Quaternion interpKey(const Nif::QuaternionKeyList::VecType &keys, float time) { @@ -275,43 +429,24 @@ public: class UVController { public: - class Value : public Ogre::ControllerValue + class Value : public Ogre::ControllerValue, public ValueInterpolator { private: - Ogre::MaterialPtr mMaterial; + Ogre::MovableObject* mMovable; Nif::FloatKeyList mUTrans; Nif::FloatKeyList mVTrans; Nif::FloatKeyList mUScale; Nif::FloatKeyList mVScale; - - static float lookupValue(const Nif::FloatKeyList &keys, float time, float def) - { - if(keys.mKeys.size() == 0) - return def; - - if(time <= keys.mKeys.front().mTime) - return keys.mKeys.front().mValue; - - Nif::FloatKeyList::VecType::const_iterator iter(keys.mKeys.begin()+1); - for(;iter != keys.mKeys.end();iter++) - { - if(iter->mTime < time) - continue; - - Nif::FloatKeyList::VecType::const_iterator last(iter-1); - float a = (time-last->mTime) / (iter->mTime-last->mTime); - return last->mValue + ((iter->mValue - last->mValue)*a); - } - return keys.mKeys.back().mValue; - } + MaterialControllerManager* mMaterialControllerMgr; public: - Value(const Ogre::MaterialPtr &material, const Nif::NiUVData *data) - : mMaterial(material) + Value(Ogre::MovableObject* movable, const Nif::NiUVData *data, MaterialControllerManager* materialControllerMgr) + : mMovable(movable) , mUTrans(data->mKeyList[0]) , mVTrans(data->mKeyList[1]) , mUScale(data->mKeyList[2]) , mVScale(data->mKeyList[3]) + , mMaterialControllerMgr(materialControllerMgr) { } virtual Ogre::Real getValue() const @@ -322,12 +457,14 @@ public: virtual void setValue(Ogre::Real value) { - float uTrans = lookupValue(mUTrans, value, 0.0f); - float vTrans = lookupValue(mVTrans, value, 0.0f); - float uScale = lookupValue(mUScale, value, 1.0f); - float vScale = lookupValue(mVScale, value, 1.0f); + float uTrans = interpKey(mUTrans.mKeys, value, 0.0f); + float vTrans = interpKey(mVTrans.mKeys, value, 0.0f); + float uScale = interpKey(mUScale.mKeys, value, 1.0f); + float vScale = interpKey(mVScale.mKeys, value, 1.0f); - Ogre::Material::TechniqueIterator techs = mMaterial->getTechniqueIterator(); + Ogre::MaterialPtr material = mMaterialControllerMgr->getWritableMaterial(mMovable); + + Ogre::Material::TechniqueIterator techs = material->getTechniqueIterator(); while(techs.hasMoreElements()) { Ogre::Technique *tech = techs.getNext(); @@ -379,17 +516,22 @@ public: class GeomMorpherController { public: - class Value : public Ogre::ControllerValue + class Value : public Ogre::ControllerValue, public ValueInterpolator { private: Ogre::SubEntity *mSubEntity; std::vector mMorphs; + std::vector mValues; + + std::vector mVertices; public: Value(Ogre::SubEntity *subent, const Nif::NiMorphData *data) : mSubEntity(subent) , mMorphs(data->mMorphs) - { } + { + mValues.resize(mMorphs.size()-1, 0.f); + } virtual Ogre::Real getValue() const { @@ -397,9 +539,63 @@ public: return 0.0f; } - virtual void setValue(Ogre::Real value) + virtual void setValue(Ogre::Real time) { - // TODO: Implement + if (mMorphs.size() <= 1) + return; + +#if OGRE_DOUBLE_PRECISION +#error "This code needs to be rewritten for double precision mode" +#endif + + Ogre::VertexData* data = mSubEntity->_getSoftwareVertexAnimVertexData(); + + const Ogre::VertexElement* posElem = + data->vertexDeclaration->findElementBySemantic(Ogre::VES_POSITION); + + Ogre::HardwareVertexBufferSharedPtr vbuf = + data->vertexBufferBinding->getBuffer(posElem->getSource()); + + bool needToUpdate = false; + int i=0; + for (std::vector::iterator it = mMorphs.begin()+1; it != mMorphs.end(); ++it,++i) + { + float val = 0; + if (!it->mData.mKeys.empty()) + val = interpKey(it->mData.mKeys, time); + val = std::max(0.f, std::min(1.f, val)); + + if (val != mValues[i]) + needToUpdate = true; + mValues[i] = val; + } + if (!needToUpdate) + return; + + // The first morph key always contains the original positions + mVertices = mMorphs[0].mVertices; + + i = 0; + for (std::vector::iterator it = mMorphs.begin()+1; it != mMorphs.end(); ++it,++i) + { + float val = mValues[i]; + + if (it->mVertices.size() != mMorphs[0].mVertices.size()) + continue; + + if (val != 0) + { + for (unsigned int v=0; vmVertices[v] * val; + } + } + + if (mVertices.size() * sizeof(float)*3 != vbuf->getSizeInBytes()) + return; + + vbuf->writeData(0, vbuf->getSizeInBytes(), &mVertices[0]); + + mSubEntity->_markBuffersUsedForAnimation(); } }; @@ -426,7 +622,7 @@ class NIFObjectLoader static void createEntity(const std::string &name, const std::string &group, - Ogre::SceneManager *sceneMgr, ObjectList &objectlist, + Ogre::SceneManager *sceneMgr, ObjectScenePtr scene, const Nif::Node *node, int flags, int animflags) { const Nif::NiTriShape *shape = static_cast(node); @@ -443,16 +639,16 @@ class NIFObjectLoader Ogre::Entity *entity = sceneMgr->createEntity(fullname); entity->setVisible(!(flags&Nif::NiNode::Flag_Hidden)); - objectlist.mEntities.push_back(entity); - if(objectlist.mSkelBase) + scene->mEntities.push_back(entity); + if(scene->mSkelBase) { if(entity->hasSkeleton()) - entity->shareSkeletonInstanceWith(objectlist.mSkelBase); + entity->shareSkeletonInstanceWith(scene->mSkelBase); else { int trgtid = NIFSkeletonLoader::lookupOgreBoneHandle(name, shape->recIndex); - Ogre::Bone *trgtbone = objectlist.mSkelBase->getSkeleton()->getBone(trgtid); - objectlist.mSkelBase->attachObjectToBone(trgtbone->getName(), entity); + Ogre::Bone *trgtbone = scene->mSkelBase->getSkeleton()->getBone(trgtid); + scene->mSkelBase->attachObjectToBone(trgtbone->getName(), entity); } } @@ -463,34 +659,106 @@ class NIFObjectLoader { const Nif::NiUVController *uv = static_cast(ctrl.getPtr()); - const Ogre::MaterialPtr &material = entity->getSubEntity(0)->getMaterial(); Ogre::ControllerValueRealPtr srcval((animflags&Nif::NiNode::AnimFlag_AutoPlay) ? Ogre::ControllerManager::getSingleton().getFrameTimeSource() : Ogre::ControllerValueRealPtr()); - Ogre::ControllerValueRealPtr dstval(OGRE_NEW UVController::Value(material, uv->data.getPtr())); - Ogre::ControllerFunctionRealPtr func(OGRE_NEW UVController::Function(uv, (animflags&Nif::NiNode::AnimFlag_AutoPlay))); + Ogre::ControllerValueRealPtr dstval(OGRE_NEW UVController::Value(entity, uv->data.getPtr(), &scene->mMaterialControllerMgr)); - objectlist.mControllers.push_back(Ogre::Controller(srcval, dstval, func)); + UVController::Function* function = OGRE_NEW UVController::Function(uv, (animflags&Nif::NiNode::AnimFlag_AutoPlay)); + scene->mMaxControllerLength = std::max(function->mStopTime, scene->mMaxControllerLength); + Ogre::ControllerFunctionRealPtr func(function); + + scene->mControllers.push_back(Ogre::Controller(srcval, dstval, func)); } else if(ctrl->recType == Nif::RC_NiGeomMorpherController) { const Nif::NiGeomMorpherController *geom = static_cast(ctrl.getPtr()); - Ogre::SubEntity *subent = entity->getSubEntity(0); Ogre::ControllerValueRealPtr srcval((animflags&Nif::NiNode::AnimFlag_AutoPlay) ? Ogre::ControllerManager::getSingleton().getFrameTimeSource() : Ogre::ControllerValueRealPtr()); - Ogre::ControllerValueRealPtr dstval(OGRE_NEW GeomMorpherController::Value(subent, geom->data.getPtr())); - Ogre::ControllerFunctionRealPtr func(OGRE_NEW GeomMorpherController::Function(geom, (animflags&Nif::NiNode::AnimFlag_AutoPlay))); + Ogre::ControllerValueRealPtr dstval(OGRE_NEW GeomMorpherController::Value(entity->getSubEntity(0), geom->data.getPtr())); - objectlist.mControllers.push_back(Ogre::Controller(srcval, dstval, func)); + GeomMorpherController::Function* function = OGRE_NEW GeomMorpherController::Function(geom, (animflags&Nif::NiNode::AnimFlag_AutoPlay)); + scene->mMaxControllerLength = std::max(function->mStopTime, scene->mMaxControllerLength); + Ogre::ControllerFunctionRealPtr func(function); + + scene->mControllers.push_back(Ogre::Controller(srcval, dstval, func)); } ctrl = ctrl->next; } + + createMaterialControllers(shape, entity, animflags, scene); } + static void createMaterialControllers (const Nif::Node* node, Ogre::MovableObject* movable, int animflags, ObjectScenePtr scene) + { + const Nif::NiTexturingProperty *texprop = NULL; + const Nif::NiMaterialProperty *matprop = NULL; + const Nif::NiAlphaProperty *alphaprop = NULL; + const Nif::NiVertexColorProperty *vertprop = NULL; + const Nif::NiZBufferProperty *zprop = NULL; + const Nif::NiSpecularProperty *specprop = NULL; + const Nif::NiWireframeProperty *wireprop = NULL; + node->getProperties(texprop, matprop, alphaprop, vertprop, zprop, specprop, wireprop); - static void createParticleEmitterAffectors(Ogre::ParticleSystem *partsys, const Nif::NiParticleSystemController *partctrl) + Ogre::ControllerValueRealPtr srcval((animflags&Nif::NiNode::AnimFlag_AutoPlay) ? + Ogre::ControllerManager::getSingleton().getFrameTimeSource() : + Ogre::ControllerValueRealPtr()); + + if(matprop) + { + Nif::ControllerPtr ctrls = matprop->controller; + while(!ctrls.empty()) + { + if (ctrls->recType == Nif::RC_NiAlphaController) + { + const Nif::NiAlphaController *alphaCtrl = dynamic_cast(ctrls.getPtr()); + Ogre::ControllerValueRealPtr dstval(OGRE_NEW AlphaController::Value(movable, alphaCtrl->data.getPtr(), &scene->mMaterialControllerMgr)); + AlphaController::Function* function = OGRE_NEW AlphaController::Function(alphaCtrl, (animflags&Nif::NiNode::AnimFlag_AutoPlay)); + scene->mMaxControllerLength = std::max(function->mStopTime, scene->mMaxControllerLength); + Ogre::ControllerFunctionRealPtr func(function); + scene->mControllers.push_back(Ogre::Controller(srcval, dstval, func)); + } + else if (ctrls->recType == Nif::RC_NiMaterialColorController) + { + const Nif::NiMaterialColorController *matCtrl = dynamic_cast(ctrls.getPtr()); + Ogre::ControllerValueRealPtr dstval(OGRE_NEW MaterialColorController::Value(movable, matCtrl->data.getPtr(), &scene->mMaterialControllerMgr)); + MaterialColorController::Function* function = OGRE_NEW MaterialColorController::Function(matCtrl, (animflags&Nif::NiNode::AnimFlag_AutoPlay)); + scene->mMaxControllerLength = std::max(function->mStopTime, scene->mMaxControllerLength); + Ogre::ControllerFunctionRealPtr func(function); + scene->mControllers.push_back(Ogre::Controller(srcval, dstval, func)); + } + + ctrls = ctrls->next; + } + } + if (texprop) + { + Nif::ControllerPtr ctrls = texprop->controller; + while(!ctrls.empty()) + { + if (ctrls->recType == Nif::RC_NiFlipController) + { + const Nif::NiFlipController *flipCtrl = dynamic_cast(ctrls.getPtr()); + + + Ogre::ControllerValueRealPtr dstval(OGRE_NEW FlipController::Value( + movable, flipCtrl, &scene->mMaterialControllerMgr)); + FlipController::Function* function = OGRE_NEW FlipController::Function(flipCtrl, (animflags&Nif::NiNode::AnimFlag_AutoPlay)); + scene->mMaxControllerLength = std::max(function->mStopTime, scene->mMaxControllerLength); + Ogre::ControllerFunctionRealPtr func(function); + scene->mControllers.push_back(Ogre::Controller(srcval, dstval, func)); + } + + ctrls = ctrls->next; + } + } + } + + static void createParticleEmitterAffectors(Ogre::ParticleSystem *partsys, + const Nif::NiParticleSystemController *partctrl, Ogre::Bone* bone, + const std::string& skelBaseName) { Ogre::ParticleEmitter *emitter = partsys->addEmitter("Nif"); emitter->setParticleVelocity(partctrl->velocity - partctrl->velocityRandom*0.5f, @@ -505,6 +773,8 @@ class NIFObjectLoader emitter->setParameter("vertical_angle", Ogre::StringConverter::toString(Ogre::Radian(partctrl->verticalAngle).valueDegrees())); emitter->setParameter("horizontal_direction", Ogre::StringConverter::toString(Ogre::Radian(partctrl->horizontalDir).valueDegrees())); emitter->setParameter("horizontal_angle", Ogre::StringConverter::toString(Ogre::Radian(partctrl->horizontalAngle).valueDegrees())); + emitter->setParameter("skelbase", skelBaseName); + emitter->setParameter("bone", bone->getName()); Nif::ExtraPtr e = partctrl->extra; while(!e.empty()) @@ -526,6 +796,8 @@ class NIFObjectLoader affector->setParameter("force_type", (gr->mType==0) ? "wind" : "point"); affector->setParameter("direction", Ogre::StringConverter::toString(gr->mDirection)); affector->setParameter("position", Ogre::StringConverter::toString(gr->mPosition)); + affector->setParameter("skelbase", skelBaseName); + affector->setParameter("bone", bone->getName()); } else if(e->recType == Nif::RC_NiParticleColorModifier) { @@ -558,8 +830,8 @@ class NIFObjectLoader } static void createParticleSystem(const std::string &name, const std::string &group, - Ogre::SceneManager *sceneMgr, ObjectList &objectlist, - const Nif::Node *partnode, int flags, int partflags) + Ogre::SceneNode *sceneNode, ObjectScenePtr scene, + const Nif::Node *partnode, int flags, int partflags, int animflags) { const Nif::NiAutoNormalParticlesData *particledata = NULL; if(partnode->recType == Nif::RC_NiAutoNormalParticles) @@ -572,7 +844,7 @@ class NIFObjectLoader fullname += "@type="+partnode->name; Misc::StringUtils::toLower(fullname); - Ogre::ParticleSystem *partsys = sceneMgr->createParticleSystem(); + Ogre::ParticleSystem *partsys = sceneNode->getCreator()->createParticleSystem(); const Nif::NiTexturingProperty *texprop = NULL; const Nif::NiMaterialProperty *matprop = NULL; @@ -593,9 +865,9 @@ class NIFObjectLoader particledata->particleRadius*2.0f); partsys->setCullIndividually(false); partsys->setParticleQuota(particledata->numParticles); - // TODO: There is probably a field or flag to specify this, as some - // particle effects have it and some don't. - partsys->setKeepParticlesInLocalSpace(true); + partsys->setKeepParticlesInLocalSpace(partflags & (Nif::NiNode::ParticleFlag_LocalSpace)); + + sceneNode->attachObject(partsys); Nif::ControllerPtr ctrl = partnode->controller; while(!ctrl.empty()) @@ -604,38 +876,36 @@ class NIFObjectLoader { const Nif::NiParticleSystemController *partctrl = static_cast(ctrl.getPtr()); - createParticleEmitterAffectors(partsys, partctrl); - if(!partctrl->emitter.empty() && !partsys->isAttached()) + if(!partctrl->emitter.empty()) { int trgtid = NIFSkeletonLoader::lookupOgreBoneHandle(name, partctrl->emitter->recIndex); - Ogre::Bone *trgtbone = objectlist.mSkelBase->getSkeleton()->getBone(trgtid); - objectlist.mSkelBase->attachObjectToBone(trgtbone->getName(), partsys); + Ogre::Bone *trgtbone = scene->mSkelBase->getSkeleton()->getBone(trgtid); + createParticleEmitterAffectors(partsys, partctrl, trgtbone, scene->mSkelBase->getName()); } Ogre::ControllerValueRealPtr srcval((partflags&Nif::NiNode::ParticleFlag_AutoPlay) ? Ogre::ControllerManager::getSingleton().getFrameTimeSource() : Ogre::ControllerValueRealPtr()); Ogre::ControllerValueRealPtr dstval(OGRE_NEW ParticleSystemController::Value(partsys, partctrl)); - Ogre::ControllerFunctionRealPtr func(OGRE_NEW ParticleSystemController::Function(partctrl, (partflags&Nif::NiNode::ParticleFlag_AutoPlay))); - objectlist.mControllers.push_back(Ogre::Controller(srcval, dstval, func)); + ParticleSystemController::Function* function = + OGRE_NEW ParticleSystemController::Function(partctrl, (partflags&Nif::NiNode::ParticleFlag_AutoPlay)); + scene->mMaxControllerLength = std::max(function->mStopTime, scene->mMaxControllerLength); + Ogre::ControllerFunctionRealPtr func(function); + + scene->mControllers.push_back(Ogre::Controller(srcval, dstval, func)); } ctrl = ctrl->next; } - if(!partsys->isAttached()) - { - int trgtid = NIFSkeletonLoader::lookupOgreBoneHandle(name, partnode->recIndex); - Ogre::Bone *trgtbone = objectlist.mSkelBase->getSkeleton()->getBone(trgtid); - objectlist.mSkelBase->attachObjectToBone(trgtbone->getName(), partsys); - } - partsys->setVisible(!(flags&Nif::NiNode::Flag_Hidden)); - objectlist.mParticles.push_back(partsys); + scene->mParticles.push_back(partsys); + + createMaterialControllers(partnode, partsys, animflags, scene); } - static void createNodeControllers(const std::string &name, Nif::ControllerPtr ctrl, ObjectList &objectlist, int animflags) + static void createNodeControllers(const std::string &name, Nif::ControllerPtr ctrl, ObjectScenePtr scene, int animflags) { do { if(ctrl->recType == Nif::RC_NiVisController) @@ -643,14 +913,17 @@ class NIFObjectLoader const Nif::NiVisController *vis = static_cast(ctrl.getPtr()); int trgtid = NIFSkeletonLoader::lookupOgreBoneHandle(name, ctrl->target->recIndex); - Ogre::Bone *trgtbone = objectlist.mSkelBase->getSkeleton()->getBone(trgtid); + Ogre::Bone *trgtbone = scene->mSkelBase->getSkeleton()->getBone(trgtid); Ogre::ControllerValueRealPtr srcval((animflags&Nif::NiNode::AnimFlag_AutoPlay) ? Ogre::ControllerManager::getSingleton().getFrameTimeSource() : Ogre::ControllerValueRealPtr()); Ogre::ControllerValueRealPtr dstval(OGRE_NEW VisController::Value(trgtbone, vis->data.getPtr())); - Ogre::ControllerFunctionRealPtr func(OGRE_NEW VisController::Function(vis, (animflags&Nif::NiNode::AnimFlag_AutoPlay))); - objectlist.mControllers.push_back(Ogre::Controller(srcval, dstval, func)); + VisController::Function* function = OGRE_NEW VisController::Function(vis, (animflags&Nif::NiNode::AnimFlag_AutoPlay)); + scene->mMaxControllerLength = std::max(function->mStopTime, scene->mMaxControllerLength); + Ogre::ControllerFunctionRealPtr func(function); + + scene->mControllers.push_back(Ogre::Controller(srcval, dstval, func)); } else if(ctrl->recType == Nif::RC_NiKeyframeController) { @@ -658,14 +931,16 @@ class NIFObjectLoader if(!key->data.empty()) { int trgtid = NIFSkeletonLoader::lookupOgreBoneHandle(name, ctrl->target->recIndex); - Ogre::Bone *trgtbone = objectlist.mSkelBase->getSkeleton()->getBone(trgtid); + Ogre::Bone *trgtbone = scene->mSkelBase->getSkeleton()->getBone(trgtid); Ogre::ControllerValueRealPtr srcval((animflags&Nif::NiNode::AnimFlag_AutoPlay) ? Ogre::ControllerManager::getSingleton().getFrameTimeSource() : Ogre::ControllerValueRealPtr()); Ogre::ControllerValueRealPtr dstval(OGRE_NEW KeyframeController::Value(trgtbone, key->data.getPtr())); - Ogre::ControllerFunctionRealPtr func(OGRE_NEW KeyframeController::Function(key, (animflags&Nif::NiNode::AnimFlag_AutoPlay))); + KeyframeController::Function* function = OGRE_NEW KeyframeController::Function(key, (animflags&Nif::NiNode::AnimFlag_AutoPlay)); + scene->mMaxControllerLength = std::max(function->mStopTime, scene->mMaxControllerLength); + Ogre::ControllerFunctionRealPtr func(function); - objectlist.mControllers.push_back(Ogre::Controller(srcval, dstval, func)); + scene->mControllers.push_back(Ogre::Controller(srcval, dstval, func)); } } ctrl = ctrl->next; @@ -713,8 +988,8 @@ class NIFObjectLoader static void createObjects(const std::string &name, const std::string &group, - Ogre::SceneManager *sceneMgr, const Nif::Node *node, - ObjectList &objectlist, int flags, int animflags, int partflags) + Ogre::SceneNode *sceneNode, const Nif::Node *node, + ObjectScenePtr scene, int flags, int animflags, int partflags) { // Do not create objects for the collision shape (includes all children) if(node->recType == Nif::RC_RootCollisionNode) @@ -740,7 +1015,7 @@ class NIFObjectLoader const Nif::NiTextKeyExtraData *tk = static_cast(e.getPtr()); int trgtid = NIFSkeletonLoader::lookupOgreBoneHandle(name, node->recIndex); - extractTextKeys(tk, objectlist.mTextKeys[trgtid]); + extractTextKeys(tk, scene->mTextKeys[trgtid]); } else if(e->recType == Nif::RC_NiStringExtraData) { @@ -759,7 +1034,7 @@ class NIFObjectLoader } if(!node->controller.empty() && (node->parent || node->recType != Nif::RC_NiNode)) - createNodeControllers(name, node->controller, objectlist, animflags); + createNodeControllers(name, node->controller, scene, animflags); if(node->recType == Nif::RC_NiCamera) { @@ -768,13 +1043,13 @@ class NIFObjectLoader if(node->recType == Nif::RC_NiTriShape && !(flags&0x80000000)) { - createEntity(name, group, sceneMgr, objectlist, node, flags, animflags); + createEntity(name, group, sceneNode->getCreator(), scene, node, flags, animflags); } if((node->recType == Nif::RC_NiAutoNormalParticles || node->recType == Nif::RC_NiRotatingParticles) && !(flags&0x40000000)) { - createParticleSystem(name, group, sceneMgr, objectlist, node, flags, partflags); + createParticleSystem(name, group, sceneNode, scene, node, flags, partflags, animflags); } const Nif::NiNode *ninode = dynamic_cast(node); @@ -784,14 +1059,14 @@ class NIFObjectLoader for(size_t i = 0;i < children.length();i++) { if(!children[i].empty()) - createObjects(name, group, sceneMgr, children[i].getPtr(), objectlist, flags, animflags, partflags); + createObjects(name, group, sceneNode, children[i].getPtr(), scene, flags, animflags, partflags); } } } static void createSkelBase(const std::string &name, const std::string &group, Ogre::SceneManager *sceneMgr, const Nif::Node *node, - ObjectList &objectlist) + ObjectScenePtr scene) { /* This creates an empty mesh to which a skeleton gets attached. This * is to ensure we have an entity with a skeleton instance, even if all @@ -800,12 +1075,12 @@ class NIFObjectLoader if(meshMgr.getByName(name).isNull()) NIFMeshLoader::createMesh(name, name, group, ~(size_t)0); - objectlist.mSkelBase = sceneMgr->createEntity(name); - objectlist.mEntities.push_back(objectlist.mSkelBase); + scene->mSkelBase = sceneMgr->createEntity(name); + scene->mEntities.push_back(scene->mSkelBase); } public: - static void load(Ogre::SceneManager *sceneMgr, ObjectList &objectlist, const std::string &name, const std::string &group, int flags=0) + static void load(Ogre::SceneNode *sceneNode, ObjectScenePtr scene, const std::string &name, const std::string &group, int flags=0) { Nif::NIFFile::ptr nif = Nif::NIFFile::create(name); if(nif->numRoots() < 1) @@ -829,9 +1104,9 @@ public: !NIFSkeletonLoader::createSkeleton(name, group, node).isNull()) { // Create a base skeleton entity if this NIF needs one - createSkelBase(name, group, sceneMgr, node, objectlist); + createSkelBase(name, group, sceneNode->getCreator(), node, scene); } - createObjects(name, group, sceneMgr, node, objectlist, flags, 0, 0); + createObjects(name, group, sceneNode, node, scene, flags, 0, 0); } static void loadKf(Ogre::Skeleton *skel, const std::string &name, @@ -894,37 +1169,37 @@ public: }; -ObjectList Loader::createObjects(Ogre::SceneNode *parentNode, std::string name, const std::string &group) +ObjectScenePtr Loader::createObjects(Ogre::SceneNode *parentNode, std::string name, const std::string &group) { - ObjectList objectlist; + ObjectScenePtr scene = ObjectScenePtr (new ObjectScene(parentNode->getCreator()));; Misc::StringUtils::toLower(name); - NIFObjectLoader::load(parentNode->getCreator(), objectlist, name, group); + NIFObjectLoader::load(parentNode, scene, name, group); - for(size_t i = 0;i < objectlist.mEntities.size();i++) + for(size_t i = 0;i < scene->mEntities.size();i++) { - Ogre::Entity *entity = objectlist.mEntities[i]; + Ogre::Entity *entity = scene->mEntities[i]; if(!entity->isAttached()) parentNode->attachObject(entity); } - return objectlist; + return scene; } -ObjectList Loader::createObjects(Ogre::Entity *parent, const std::string &bonename, +ObjectScenePtr Loader::createObjects(Ogre::Entity *parent, const std::string &bonename, Ogre::SceneNode *parentNode, std::string name, const std::string &group) { - ObjectList objectlist; + ObjectScenePtr scene = ObjectScenePtr (new ObjectScene(parentNode->getCreator())); Misc::StringUtils::toLower(name); - NIFObjectLoader::load(parentNode->getCreator(), objectlist, name, group); + NIFObjectLoader::load(parentNode, scene, name, group); bool isskinned = false; - for(size_t i = 0;i < objectlist.mEntities.size();i++) + for(size_t i = 0;i < scene->mEntities.size();i++) { - Ogre::Entity *ent = objectlist.mEntities[i]; - if(objectlist.mSkelBase != ent && ent->hasSkeleton()) + Ogre::Entity *ent = scene->mEntities[i]; + if(scene->mSkelBase != ent && ent->hasSkeleton()) { isskinned = true; break; @@ -939,12 +1214,12 @@ ObjectList Loader::createObjects(Ogre::Entity *parent, const std::string &bonena { std::string filter = "@shape=tri "+bonename; Misc::StringUtils::toLower(filter); - for(size_t i = 0;i < objectlist.mEntities.size();i++) + for(size_t i = 0;i < scene->mEntities.size();i++) { - Ogre::Entity *entity = objectlist.mEntities[i]; + Ogre::Entity *entity = scene->mEntities[i]; if(entity->hasSkeleton()) { - if(entity == objectlist.mSkelBase || + if(entity == scene->mSkelBase || entity->getMesh()->getName().find(filter) != std::string::npos) parentNode->attachObject(entity); } @@ -957,9 +1232,9 @@ ObjectList Loader::createObjects(Ogre::Entity *parent, const std::string &bonena } else { - for(size_t i = 0;i < objectlist.mEntities.size();i++) + for(size_t i = 0;i < scene->mEntities.size();i++) { - Ogre::Entity *entity = objectlist.mEntities[i]; + Ogre::Entity *entity = scene->mEntities[i]; if(!entity->isAttached()) { Ogre::TagPoint *tag = parent->attachObjectToBone(bonename, entity); @@ -968,21 +1243,32 @@ ObjectList Loader::createObjects(Ogre::Entity *parent, const std::string &bonena } } - return objectlist; + for(size_t i = 0;i < scene->mParticles.size();i++) + { + Ogre::ParticleSystem *partsys = scene->mParticles[i]; + if(partsys->isAttached()) + partsys->detachFromParent(); + + Ogre::TagPoint *tag = scene->mSkelBase->attachObjectToBone( + scene->mSkelBase->getSkeleton()->getRootBone()->getName(), partsys); + tag->setScale(scale); + } + + return scene; } -ObjectList Loader::createObjectBase(Ogre::SceneNode *parentNode, std::string name, const std::string &group) +ObjectScenePtr Loader::createObjectBase(Ogre::SceneNode *parentNode, std::string name, const std::string &group) { - ObjectList objectlist; + ObjectScenePtr scene = ObjectScenePtr (new ObjectScene(parentNode->getCreator())); Misc::StringUtils::toLower(name); - NIFObjectLoader::load(parentNode->getCreator(), objectlist, name, group, 0xC0000000); + NIFObjectLoader::load(parentNode, scene, name, group, 0xC0000000); - if(objectlist.mSkelBase) - parentNode->attachObject(objectlist.mSkelBase); + if(scene->mSkelBase) + parentNode->attachObject(scene->mSkelBase); - return objectlist; + return scene; } diff --git a/components/nifogre/ogrenifloader.hpp b/components/nifogre/ogrenifloader.hpp index edad13a9a..976a31ccd 100644 --- a/components/nifogre/ogrenifloader.hpp +++ b/components/nifogre/ogrenifloader.hpp @@ -25,6 +25,7 @@ #define OPENMW_COMPONENTS_NIFOGRE_OGRENIFLOADER_HPP #include +#include #include #include @@ -37,36 +38,60 @@ namespace NifOgre { +/** + * @brief Clones materials as necessary to not make controllers affect other objects (that share the original material). + */ +class MaterialControllerManager +{ +public: + ~MaterialControllerManager(); + Ogre::MaterialPtr getWritableMaterial (Ogre::MovableObject* movable); + +private: + std::map mClonedMaterials; +}; + typedef std::multimap TextKeyMap; static const char sTextKeyExtraDataID[] = "TextKeyExtraData"; -struct ObjectList { +struct ObjectScene { Ogre::Entity *mSkelBase; std::vector mEntities; std::vector mParticles; std::vector mLights; + Ogre::SceneManager* mSceneMgr; + + // The maximum length on any of the controllers. For animations with controllers, but no text keys, consider this the animation length. + float mMaxControllerLength; + std::map mTextKeys; + MaterialControllerManager mMaterialControllerMgr; + std::vector > mControllers; - ObjectList() : mSkelBase(0) + ObjectScene(Ogre::SceneManager* sceneMgr) : mSkelBase(0), mMaxControllerLength(0), mSceneMgr(sceneMgr) { } + + ~ObjectScene(); }; +typedef Ogre::SharedPtr ObjectScenePtr; + class Loader { public: - static ObjectList createObjects(Ogre::Entity *parent, const std::string &bonename, + static ObjectScenePtr createObjects(Ogre::Entity *parent, const std::string &bonename, Ogre::SceneNode *parentNode, std::string name, const std::string &group="General"); - static ObjectList createObjects(Ogre::SceneNode *parentNode, + static ObjectScenePtr createObjects(Ogre::SceneNode *parentNode, std::string name, const std::string &group="General"); - static ObjectList createObjectBase(Ogre::SceneNode *parentNode, + static ObjectScenePtr createObjectBase(Ogre::SceneNode *parentNode, std::string name, const std::string &group="General"); diff --git a/libs/openengine/ogre/particles.cpp b/components/nifogre/particles.cpp similarity index 83% rename from libs/openengine/ogre/particles.cpp rename to components/nifogre/particles.cpp index 707bd75e0..e54a77885 100644 --- a/libs/openengine/ogre/particles.cpp +++ b/components/nifogre/particles.cpp @@ -5,11 +5,57 @@ #include #include #include +#include +#include +#include +#include +#include +#include /* FIXME: "Nif" isn't really an appropriate emitter name. */ class NifEmitter : public Ogre::ParticleEmitter { public: + std::string mSkelBaseName; + Ogre::Bone* mBone; + + Ogre::ParticleSystem* getPartSys() { return mParent; } + + class CmdSkelBase : public Ogre::ParamCommand + { + public: + Ogre::String doGet(const void *target) const + { + assert(false && "Unimplemented"); + return ""; + } + void doSet(void *target, const Ogre::String &val) + { + NifEmitter* emitter = static_cast(target); + emitter->mSkelBaseName = val; + } + }; + + class CmdBone : public Ogre::ParamCommand + { + public: + Ogre::String doGet(const void *target) const + { + assert(false && "Unimplemented"); + return ""; + } + void doSet(void *target, const Ogre::String &val) + { + NifEmitter* emitter = static_cast(target); + assert(!emitter->mSkelBaseName.empty() && "Base entity needs to be set first"); + Ogre::ParticleSystem* partsys = emitter->getPartSys(); + Ogre::Entity* ent = partsys->getParentSceneNode()->getCreator()->getEntity(emitter->mSkelBaseName); + Ogre::Bone* bone = ent->getSkeleton()->getBone(val); + assert(bone); + emitter->mBone = bone; + } + }; + /** Command object for the emitter width (see Ogre::ParamCommand).*/ class CmdWidth : public Ogre::ParamCommand { @@ -119,6 +165,7 @@ public: NifEmitter(Ogre::ParticleSystem *psys) : Ogre::ParticleEmitter(psys) + , mBone(NULL) { initDefaults("Nif"); } @@ -133,6 +180,7 @@ public: /** See Ogre::ParticleEmitter. */ void _initParticle(Ogre::Particle *particle) { + assert (mBone && "No node set"); Ogre::Vector3 xOff, yOff, zOff; // Call superclass @@ -141,8 +189,8 @@ public: xOff = Ogre::Math::SymmetricRandom() * mXRange; yOff = Ogre::Math::SymmetricRandom() * mYRange; zOff = Ogre::Math::SymmetricRandom() * mZRange; - - particle->position = mPosition + xOff + yOff + zOff; + + particle->position = mBone->_getDerivedPosition() + xOff + yOff + zOff; // Generate complex data by reference genEmissionColour(particle->colour); @@ -150,7 +198,7 @@ public: // NOTE: We do not use mDirection/mAngle for the initial direction. Ogre::Radian hdir = mHorizontalDir + mHorizontalAngle*Ogre::Math::SymmetricRandom(); Ogre::Radian vdir = mVerticalDir + mVerticalAngle*Ogre::Math::SymmetricRandom(); - particle->direction = (Ogre::Quaternion(hdir, Ogre::Vector3::UNIT_Z) * + particle->direction = (mBone->_getDerivedOrientation() * Ogre::Quaternion(hdir, Ogre::Vector3::UNIT_Z) * Ogre::Quaternion(vdir, Ogre::Vector3::UNIT_X)) * Ogre::Vector3::UNIT_Z; @@ -313,6 +361,16 @@ protected: Ogre::PT_REAL), &msHorizontalAngleCmd); + dict->addParameter(Ogre::ParameterDef("bone", + "The bone where the particles should be spawned", + Ogre::PT_STRING), + &msBoneCmd); + + dict->addParameter(Ogre::ParameterDef("skelbase", + "The name of the entity containing the bone (see 'bone' parameter)", + Ogre::PT_STRING), + &msSkelBaseCmd); + return true; } return false; @@ -326,6 +384,8 @@ protected: static CmdVerticalAngle msVerticalAngleCmd; static CmdHorizontalDir msHorizontalDirCmd; static CmdHorizontalAngle msHorizontalAngleCmd; + static CmdBone msBoneCmd; + static CmdSkelBase msSkelBaseCmd; }; NifEmitter::CmdWidth NifEmitter::msWidthCmd; NifEmitter::CmdHeight NifEmitter::msHeightCmd; @@ -334,12 +394,14 @@ NifEmitter::CmdVerticalDir NifEmitter::msVerticalDirCmd; NifEmitter::CmdVerticalAngle NifEmitter::msVerticalAngleCmd; NifEmitter::CmdHorizontalDir NifEmitter::msHorizontalDirCmd; NifEmitter::CmdHorizontalAngle NifEmitter::msHorizontalAngleCmd; +NifEmitter::CmdBone NifEmitter::msBoneCmd; +NifEmitter::CmdSkelBase NifEmitter::msSkelBaseCmd; Ogre::ParticleEmitter* NifEmitterFactory::createEmitter(Ogre::ParticleSystem *psys) { - Ogre::ParticleEmitter *emit = OGRE_NEW NifEmitter(psys); - mEmitters.push_back(emit); - return emit; + Ogre::ParticleEmitter *emitter = OGRE_NEW NifEmitter(psys); + mEmitters.push_back(emitter); + return emitter; } @@ -492,6 +554,47 @@ class GravityAffector : public Ogre::ParticleAffector }; public: + std::string mSkelBaseName; + Ogre::Bone* mBone; + + Ogre::ParticleSystem* getPartSys() { return mParent; } + + class CmdSkelBase : public Ogre::ParamCommand + { + public: + Ogre::String doGet(const void *target) const + { + assert(false && "Unimplemented"); + return ""; + } + void doSet(void *target, const Ogre::String &val) + { + GravityAffector* affector = static_cast(target); + affector->mSkelBaseName = val; + } + }; + + class CmdBone : public Ogre::ParamCommand + { + public: + Ogre::String doGet(const void *target) const + { + assert(false && "Unimplemented"); + return ""; + } + void doSet(void *target, const Ogre::String &val) + { + GravityAffector* affector = static_cast(target); + assert(!affector->mSkelBaseName.empty() && "Base entity needs to be set first"); + Ogre::ParticleSystem* partsys = affector->getPartSys(); + Ogre::Entity* ent = partsys->getParentSceneNode()->getCreator()->getEntity(affector->mSkelBaseName); + Ogre::Bone* bone = ent->getSkeleton()->getBone(val); + assert(bone); + affector->mBone = bone; + } + }; + + /** Command object for force (see Ogre::ParamCommand).*/ class CmdForce : public Ogre::ParamCommand { @@ -585,6 +688,7 @@ public: , mForceType(Type_Wind) , mPosition(0.0f) , mDirection(0.0f) + , mBone(NULL) { mType = "Gravity"; @@ -606,6 +710,16 @@ public: dict->addParameter(Ogre::ParameterDef(force_type_title, force_type_descr, Ogre::PT_STRING), &msForceTypeCmd); dict->addParameter(Ogre::ParameterDef(direction_title, direction_descr, Ogre::PT_VECTOR3), &msDirectionCmd); dict->addParameter(Ogre::ParameterDef(position_title, position_descr, Ogre::PT_VECTOR3), &msPositionCmd); + + dict->addParameter(Ogre::ParameterDef("bone", + "The bone where the particles should be spawned", + Ogre::PT_STRING), + &msBoneCmd); + + dict->addParameter(Ogre::ParameterDef("skelbase", + "The name of the entity containing the bone (see 'bone' parameter)", + Ogre::PT_STRING), + &msSkelBaseCmd); } } @@ -647,11 +761,13 @@ public: static CmdForceType msForceTypeCmd; static CmdDirection msDirectionCmd; static CmdPosition msPositionCmd; + static CmdBone msBoneCmd; + static CmdSkelBase msSkelBaseCmd; protected: void applyWindForce(Ogre::ParticleSystem *psys, Ogre::Real timeElapsed) { - const Ogre::Vector3 vec = mDirection * mForce * timeElapsed; + const Ogre::Vector3 vec = mBone->_getDerivedOrientation() * mDirection * mForce * timeElapsed; Ogre::ParticleIterator pi = psys->_getIterator(); while (!pi.end()) { @@ -667,7 +783,8 @@ protected: while (!pi.end()) { Ogre::Particle *p = pi.getNext(); - const Ogre::Vector3 vec = (p->position - mPosition).normalisedCopy() * force; + const Ogre::Vector3 vec = ( + (mBone->_getDerivedOrientation() * mPosition + mBone->_getDerivedPosition()) - p->position).normalisedCopy() * force; p->direction += vec; } } @@ -684,6 +801,8 @@ GravityAffector::CmdForce GravityAffector::msForceCmd; GravityAffector::CmdForceType GravityAffector::msForceTypeCmd; GravityAffector::CmdDirection GravityAffector::msDirectionCmd; GravityAffector::CmdPosition GravityAffector::msPositionCmd; +GravityAffector::CmdBone GravityAffector::msBoneCmd; +GravityAffector::CmdSkelBase GravityAffector::msSkelBaseCmd; Ogre::ParticleAffector *GravityAffectorFactory::createAffector(Ogre::ParticleSystem *psys) { diff --git a/libs/openengine/ogre/particles.hpp b/components/nifogre/particles.hpp similarity index 100% rename from libs/openengine/ogre/particles.hpp rename to components/nifogre/particles.hpp diff --git a/components/ogreinit/ogreinit.cpp b/components/ogreinit/ogreinit.cpp new file mode 100644 index 000000000..c8fc621c7 --- /dev/null +++ b/components/ogreinit/ogreinit.cpp @@ -0,0 +1,165 @@ +#include "ogreinit.hpp" + +#include + +#include +#include +#include + +#include + +#include "ogreplugin.hpp" + +namespace OgreInit +{ + + OgreInit::OgreInit() + : mRoot(NULL) + #ifdef ENABLE_PLUGIN_CgProgramManager + , mCgPlugin(NULL) + #endif + #ifdef ENABLE_PLUGIN_OctreeSceneManager + , mOctreePlugin(NULL) + #endif + #ifdef ENABLE_PLUGIN_ParticleFX + , mParticleFXPlugin(NULL) + #endif + #ifdef ENABLE_PLUGIN_GL + , mGLPlugin(NULL) + #endif + #ifdef ENABLE_PLUGIN_Direct3D9 + , mD3D9Plugin(NULL) + #endif + {} + + Ogre::Root* OgreInit::init(const std::string &logPath) + { + // Set up logging first + new Ogre::LogManager; + Ogre::Log *log = Ogre::LogManager::getSingleton().createLog(logPath); + + // Disable logging to cout/cerr + log->setDebugOutputEnabled(false); + + mRoot = new Ogre::Root("", "", ""); + + #if defined(ENABLE_PLUGIN_GL) || defined(ENABLE_PLUGIN_Direct3D9) || defined(ENABLE_PLUGIN_CgProgramManager) || defined(ENABLE_PLUGIN_OctreeSceneManager) || defined(ENABLE_PLUGIN_ParticleFX) + loadStaticPlugins(); + #else + loadPlugins(); + #endif + + loadParticleFactories(); + + return mRoot; + } + + OgreInit::~OgreInit() + { + delete mRoot; + + std::vector::iterator ei; + for(ei = mEmitterFactories.begin();ei != mEmitterFactories.end();++ei) + OGRE_DELETE (*ei); + mEmitterFactories.clear(); + + std::vector::iterator ai; + for(ai = mAffectorFactories.begin();ai != mAffectorFactories.end();++ai) + OGRE_DELETE (*ai); + mAffectorFactories.clear(); + + #ifdef ENABLE_PLUGIN_GL + delete mGLPlugin; + mGLPlugin = NULL; + #endif + #ifdef ENABLE_PLUGIN_Direct3D9 + delete mD3D9Plugin; + mD3D9Plugin = NULL; + #endif + #ifdef ENABLE_PLUGIN_CgProgramManager + delete mCgPlugin; + mCgPlugin = NULL; + #endif + #ifdef ENABLE_PLUGIN_OctreeSceneManager + delete mOctreePlugin; + mOctreePlugin = NULL; + #endif + #ifdef ENABLE_PLUGIN_ParticleFX + delete mParticleFXPlugin; + mParticleFXPlugin = NULL; + #endif + } + + void OgreInit::loadStaticPlugins() + { + #ifdef ENABLE_PLUGIN_GL + mGLPlugin = new Ogre::GLPlugin(); + mRoot->installPlugin(mGLPlugin); + #endif + #ifdef ENABLE_PLUGIN_Direct3D9 + mD3D9Plugin = new Ogre::D3D9Plugin(); + mRoot->installPlugin(mD3D9Plugin); + #endif + #ifdef ENABLE_PLUGIN_CgProgramManager + mCgPlugin = new Ogre::CgPlugin(); + mRoot->installPlugin(mCgPlugin); + #endif + #ifdef ENABLE_PLUGIN_OctreeSceneManager + mOctreePlugin = new Ogre::OctreePlugin(); + mRoot->installPlugin(mOctreePlugin); + #endif + #ifdef ENABLE_PLUGIN_ParticleFX + mParticleFXPlugin = new Ogre::ParticleFXPlugin(); + mRoot->installPlugin(mParticleFXPlugin); + #endif + } + + void OgreInit::loadPlugins() + { + std::string pluginDir; + const char* pluginEnv = getenv("OPENMW_OGRE_PLUGIN_DIR"); + if (pluginEnv) + pluginDir = pluginEnv; + else + { + #if OGRE_PLATFORM == OGRE_PLATFORM_WIN32 + pluginDir = ".\\"; + #endif + #if OGRE_PLATFORM == OGRE_PLATFORM_APPLE + pluginDir = OGRE_PLUGIN_DIR; + #endif + #if OGRE_PLATFORM == OGRE_PLATFORM_LINUX + pluginDir = OGRE_PLUGIN_DIR_REL; + #endif + } + + boost::filesystem::path absPluginPath = boost::filesystem::absolute(boost::filesystem::path(pluginDir)); + + pluginDir = absPluginPath.string(); + + Files::loadOgrePlugin(pluginDir, "RenderSystem_GL", *mRoot); + Files::loadOgrePlugin(pluginDir, "RenderSystem_GLES2", *mRoot); + Files::loadOgrePlugin(pluginDir, "RenderSystem_GL3Plus", *mRoot); + Files::loadOgrePlugin(pluginDir, "RenderSystem_Direct3D9", *mRoot); + Files::loadOgrePlugin(pluginDir, "Plugin_CgProgramManager", *mRoot); + Files::loadOgrePlugin(pluginDir, "Plugin_ParticleFX", *mRoot); + } + + void OgreInit::loadParticleFactories() + { + Ogre::ParticleEmitterFactory *emitter; + emitter = OGRE_NEW NifEmitterFactory(); + Ogre::ParticleSystemManager::getSingleton().addEmitterFactory(emitter); + mEmitterFactories.push_back(emitter); + + Ogre::ParticleAffectorFactory *affector; + affector = OGRE_NEW GrowFadeAffectorFactory(); + Ogre::ParticleSystemManager::getSingleton().addAffectorFactory(affector); + mAffectorFactories.push_back(affector); + + affector = OGRE_NEW GravityAffectorFactory(); + Ogre::ParticleSystemManager::getSingleton().addAffectorFactory(affector); + mAffectorFactories.push_back(affector); + } + +} diff --git a/components/ogreinit/ogreinit.hpp b/components/ogreinit/ogreinit.hpp new file mode 100644 index 000000000..b6fe4631a --- /dev/null +++ b/components/ogreinit/ogreinit.hpp @@ -0,0 +1,75 @@ +#ifndef OPENMW_COMPONENTS_OGREINIT_H +#define OPENMW_COMPONENTS_OGREINIT_H + +#include +#include + +// Static plugin headers +#ifdef ENABLE_PLUGIN_CgProgramManager +# include "OgreCgPlugin.h" +#endif +#ifdef ENABLE_PLUGIN_OctreeSceneManager +# include "OgreOctreePlugin.h" +#endif +#ifdef ENABLE_PLUGIN_ParticleFX +# include "OgreParticleFXPlugin.h" +#endif +#ifdef ENABLE_PLUGIN_GL +# include "OgreGLPlugin.h" +#endif +#ifdef ENABLE_PLUGIN_Direct3D9 +# include "OgreD3D9Plugin.h" +#endif + +namespace Ogre +{ + class ParticleEmitterFactory; + class ParticleAffectorFactory; + class Root; +} + +namespace OgreInit +{ + /** + * @brief Starts Ogre::Root and loads required plugins and NIF particle factories + */ + class OgreInit + { + public: + OgreInit(); + + Ogre::Root* init(const std::string &logPath // Path to directory where to store log files + ); + + ~OgreInit(); + + private: + std::vector mEmitterFactories; + std::vector mAffectorFactories; + Ogre::Root* mRoot; + + void loadStaticPlugins(); + void loadPlugins(); + void loadParticleFactories(); + + + #ifdef ENABLE_PLUGIN_CgProgramManager + Ogre::CgPlugin* mCgPlugin; + #endif + #ifdef ENABLE_PLUGIN_OctreeSceneManager + Ogre::OctreePlugin* mOctreePlugin; + #endif + #ifdef ENABLE_PLUGIN_ParticleFX + Ogre::ParticleFXPlugin* mParticleFXPlugin; + #endif + #ifdef ENABLE_PLUGIN_GL + Ogre::GLPlugin* mGLPlugin; + #endif + #ifdef ENABLE_PLUGIN_Direct3D9 + Ogre::D3D9Plugin* mD3D9Plugin; + #endif + + }; +} + +#endif diff --git a/components/files/ogreplugin.cpp b/components/ogreinit/ogreplugin.cpp similarity index 100% rename from components/files/ogreplugin.cpp rename to components/ogreinit/ogreplugin.cpp diff --git a/components/files/ogreplugin.hpp b/components/ogreinit/ogreplugin.hpp similarity index 100% rename from components/files/ogreplugin.hpp rename to components/ogreinit/ogreplugin.hpp diff --git a/components/terrain/material.cpp b/components/terrain/material.cpp index ebf6046ff..5dcdb7fed 100644 --- a/components/terrain/material.cpp +++ b/components/terrain/material.cpp @@ -4,6 +4,8 @@ #include #include +#include + #include namespace @@ -36,6 +38,8 @@ namespace Terrain : mShaders(shaders) , mShadows(false) , mSplitShadows(false) + , mNormalMapping(true) + , mParallaxMapping(true) { } @@ -85,7 +89,7 @@ namespace Terrain { assert(mLayerList.size() == mBlendmapList.size()+1); std::vector::iterator blend = mBlendmapList.begin(); - for (std::vector::iterator layer = mLayerList.begin(); layer != mLayerList.end(); ++layer) + for (std::vector::iterator layer = mLayerList.begin(); layer != mLayerList.end(); ++layer) { Ogre::Pass* pass = technique->createPass(); pass->setLightingEnabled(false); @@ -117,7 +121,7 @@ namespace Terrain } // Add the actual layer texture on top of the alpha map. - tus = pass->createTextureUnitState("textures\\" + *layer); + tus = pass->createTextureUnitState(layer->mDiffuseMap); if (!first) tus->setColourOperationEx(Ogre::LBX_BLEND_DIFFUSE_ALPHA, Ogre::LBS_TEXTURE, @@ -156,6 +160,10 @@ namespace Terrain p->mShaderProperties.setProperty ("display_composite_map", sh::makeProperty(new sh::BooleanValue(true))); p->mShaderProperties.setProperty ("num_layers", sh::makeProperty (new sh::StringValue("0"))); p->mShaderProperties.setProperty ("num_blendmaps", sh::makeProperty (new sh::StringValue("0"))); + p->mShaderProperties.setProperty ("normal_map_enabled", sh::makeProperty (new sh::BooleanValue(false))); + p->mShaderProperties.setProperty ("parallax_enabled", sh::makeProperty (new sh::BooleanValue(false))); + p->mShaderProperties.setProperty ("normal_maps", + sh::makeProperty (new sh::IntValue(0))); sh::MaterialInstanceTextureUnit* tex = p->createTextureUnit ("compositeMap"); tex->setProperty ("direct_texture", sh::makeProperty (new sh::StringValue(mCompositeMap))); @@ -210,6 +218,10 @@ namespace Terrain } } ++neededTextureUnits; // layer texture + + // Check if this layer has a normal map + if (mNormalMapping && !mLayerList[layerIndex].mNormalMap.empty() && !renderCompositeMap) + ++neededTextureUnits; // normal map if (neededTextureUnits <= remainingTextureUnits) { // We can fit another! @@ -238,6 +250,8 @@ namespace Terrain p->mShaderProperties.setProperty ("num_layers", sh::makeProperty (new sh::StringValue(Ogre::StringConverter::toString(numLayersInThisPass)))); p->mShaderProperties.setProperty ("num_blendmaps", sh::makeProperty (new sh::StringValue(Ogre::StringConverter::toString(numBlendTextures)))); + p->mShaderProperties.setProperty ("normal_map_enabled", + sh::makeProperty (new sh::BooleanValue(false))); // blend maps // the index of the first blend map used in this pass @@ -254,17 +268,39 @@ namespace Terrain } // layer maps + bool anyNormalMaps = false; + bool anyParallax = false; + size_t normalMaps = 0; for (int i = 0; i < numLayersInThisPass; ++i) { + const LayerInfo& layer = mLayerList[layerOffset+i]; + // diffuse map sh::MaterialInstanceTextureUnit* diffuseTex = p->createTextureUnit ("diffuseMap" + Ogre::StringConverter::toString(i)); - diffuseTex->setProperty ("direct_texture", sh::makeProperty (new sh::StringValue("textures\\"+mLayerList[layerOffset+i]))); + diffuseTex->setProperty ("direct_texture", sh::makeProperty (new sh::StringValue(layer.mDiffuseMap))); + + // normal map (optional) + bool useNormalMap = mNormalMapping && !mLayerList[layerOffset+i].mNormalMap.empty() && !renderCompositeMap; + bool useParallax = useNormalMap && mParallaxMapping && layer.mParallax; + if (useNormalMap) + { + anyNormalMaps = true; + anyParallax = anyParallax || useParallax; + sh::MaterialInstanceTextureUnit* normalTex = p->createTextureUnit ("normalMap" + Ogre::StringConverter::toString(i)); + normalTex->setProperty ("direct_texture", sh::makeProperty (new sh::StringValue(layer.mNormalMap))); + } + p->mShaderProperties.setProperty ("use_normal_map_" + Ogre::StringConverter::toString(i), + sh::makeProperty (new sh::BooleanValue(useNormalMap))); + p->mShaderProperties.setProperty ("use_parallax_" + Ogre::StringConverter::toString(i), + sh::makeProperty (new sh::BooleanValue(useParallax))); + boost::hash_combine(normalMaps, useNormalMap); + boost::hash_combine(normalMaps, useNormalMap && layer.mParallax); if (i+layerOffset > 0) { int blendTextureIndex = getBlendmapIndexForLayer(layerOffset+i); std::string blendTextureComponent = getBlendmapComponentForLayer(layerOffset+i); p->mShaderProperties.setProperty ("blendmap_component_" + Ogre::StringConverter::toString(i), - sh::makeProperty (new sh::StringValue(Ogre::StringConverter::toString(blendTextureIndex-blendmapStart) + "." + blendTextureComponent))); + sh::makeProperty (new sh::StringValue(Ogre::StringConverter::toString(blendTextureIndex-blendmapStart) + "." + blendTextureComponent))); } else { @@ -274,6 +310,14 @@ namespace Terrain sh::makeProperty (new sh::StringValue(""))); } } + p->mShaderProperties.setProperty ("normal_map_enabled", + sh::makeProperty (new sh::BooleanValue(anyNormalMaps))); + p->mShaderProperties.setProperty ("parallax_enabled", + sh::makeProperty (new sh::BooleanValue(anyParallax))); + // Since the permutation handler can't handle dynamic property names, + // combine normal map settings for all layers into one value + p->mShaderProperties.setProperty ("normal_maps", + sh::makeProperty (new sh::IntValue(normalMaps))); // shadow if (shadows) @@ -290,6 +334,8 @@ namespace Terrain // Make sure the pass index is fed to the permutation handler, because blendmap components may be different p->mShaderProperties.setProperty ("pass_index", sh::makeProperty(new sh::IntValue(layerOffset))); + assert ((int)p->mTexUnits.size() == OGRE_MAX_TEXTURE_LAYERS - remainingTextureUnits); + layerOffset += numLayersInThisPass; } } diff --git a/components/terrain/material.hpp b/components/terrain/material.hpp index 330ed3d14..e7e067899 100644 --- a/components/terrain/material.hpp +++ b/components/terrain/material.hpp @@ -3,6 +3,8 @@ #include +#include "storage.hpp" + namespace Terrain { @@ -15,13 +17,15 @@ namespace Terrain /// so if this parameter is true, then the supplied blend maps are expected to be packed. MaterialGenerator (bool shaders); - void setLayerList (const std::vector& layerList) { mLayerList = layerList; } + void setLayerList (const std::vector& layerList) { mLayerList = layerList; } bool hasLayers() { return mLayerList.size(); } void setBlendmapList (const std::vector& blendmapList) { mBlendmapList = blendmapList; } const std::vector& getBlendmapList() { return mBlendmapList; } void setCompositeMap (const std::string& name) { mCompositeMap = name; } void enableShadows(bool shadows) { mShadows = shadows; } + void enableNormalMapping(bool normalMapping) { mNormalMapping = normalMapping; } + void enableParallaxMapping(bool parallaxMapping) { mParallaxMapping = parallaxMapping; } void enableSplitShadows(bool splitShadows) { mSplitShadows = splitShadows; } /// Creates a material suitable for displaying a chunk of terrain using alpha-blending. @@ -43,12 +47,14 @@ namespace Terrain private: Ogre::MaterialPtr create (Ogre::MaterialPtr mat, bool renderCompositeMap, bool displayCompositeMap); - std::vector mLayerList; + std::vector mLayerList; std::vector mBlendmapList; std::string mCompositeMap; bool mShaders; bool mShadows; bool mSplitShadows; + bool mNormalMapping; + bool mParallaxMapping; }; } diff --git a/components/terrain/quadtreenode.cpp b/components/terrain/quadtreenode.cpp index ef2c61013..e16ae55dd 100644 --- a/components/terrain/quadtreenode.cpp +++ b/components/terrain/quadtreenode.cpp @@ -371,7 +371,7 @@ void QuadTreeNode::destroyChunks(bool children) for (std::vector::const_iterator it = list.begin(); it != list.end(); ++it) Ogre::TextureManager::getSingleton().remove((*it)->getName()); mMaterialGenerator->setBlendmapList(std::vector()); - mMaterialGenerator->setLayerList(std::vector()); + mMaterialGenerator->setLayerList(std::vector()); mMaterialGenerator->setCompositeMap(""); } @@ -414,7 +414,7 @@ void QuadTreeNode::ensureLayerInfo() return; std::vector blendmaps; - std::vector layerList; + std::vector layerList; mTerrain->getStorage()->getBlendmaps(mSize, mCenter, mTerrain->getShadersEnabled(), blendmaps, layerList); mMaterialGenerator->setLayerList(layerList); @@ -427,11 +427,13 @@ void QuadTreeNode::prepareForCompositeMap(Ogre::TRect area) if (mIsDummy) { - // TODO - why is this completely black? // TODO - store this default material somewhere instead of creating one for each empty cell MaterialGenerator matGen(mTerrain->getShadersEnabled()); - std::vector layer; - layer.push_back("_land_default.dds"); + std::vector layer; + LayerInfo info; + info.mDiffuseMap = "textures\\_land_default.dds"; + info.mParallax = false; + layer.push_back(info); matGen.setLayerList(layer); makeQuad(sceneMgr, area.left, area.top, area.right, area.bottom, matGen.generateForCompositeMapRTT(Ogre::MaterialPtr())); return; diff --git a/components/terrain/storage.cpp b/components/terrain/storage.cpp index f00677e97..9d6b44de8 100644 --- a/components/terrain/storage.cpp +++ b/components/terrain/storage.cpp @@ -4,9 +4,10 @@ #include #include #include +#include #include -#include +#include namespace Terrain { @@ -302,7 +303,7 @@ namespace Terrain } void Storage::getBlendmaps(float chunkSize, const Ogre::Vector2 &chunkCenter, - bool pack, std::vector &blendmaps, std::vector &layerList) + bool pack, std::vector &blendmaps, std::vector &layerList) { // TODO - blending isn't completely right yet; the blending radius appears to be // different at a cell transition (2 vertices, not 4), so we may need to create a larger blendmap @@ -336,7 +337,7 @@ namespace Terrain { int size = textureIndicesMap.size(); textureIndicesMap[*it] = size; - layerList.push_back(getTextureName(*it)); + layerList.push_back(getLayerInfo(getTextureName(*it))); } int numTextures = textureIndices.size(); @@ -466,5 +467,34 @@ namespace Terrain return land->mLandData->mHeights[y * ESM::Land::LAND_SIZE + x]; } + LayerInfo Storage::getLayerInfo(const std::string& texture) + { + // Already have this cached? + if (mLayerInfoMap.find(texture) != mLayerInfoMap.end()) + return mLayerInfoMap[texture]; + + LayerInfo info; + info.mParallax = false; + info.mDiffuseMap = "textures\\" + texture; + std::string texture_ = texture; + boost::replace_last(texture_, ".", "_nh."); + if (Ogre::ResourceGroupManager::getSingleton().resourceExistsInAnyGroup("textures\\" + texture_)) + { + info.mNormalMap = "textures\\" + texture_; + info.mParallax = true; + } + else + { + texture_ = texture; + boost::replace_last(texture_, ".", "_n."); + if (Ogre::ResourceGroupManager::getSingleton().resourceExistsInAnyGroup("textures\\" + texture_)) + info.mNormalMap = "textures\\" + texture_; + } + + mLayerInfoMap[texture] = info; + + return info; + } + } diff --git a/components/terrain/storage.hpp b/components/terrain/storage.hpp index b82f6bbb6..68fae01af 100644 --- a/components/terrain/storage.hpp +++ b/components/terrain/storage.hpp @@ -11,6 +11,13 @@ namespace Terrain { + struct LayerInfo + { + std::string mDiffuseMap; + std::string mNormalMap; + bool mParallax; // Height info in normal map alpha channel? + }; + /// We keep storage of terrain data abstract here since we need different implementations for game and editor class Storage { @@ -58,7 +65,7 @@ namespace Terrain /// @param layerList names of the layer textures used will be written here void getBlendmaps (float chunkSize, const Ogre::Vector2& chunkCenter, bool pack, std::vector& blendmaps, - std::vector& layerList); + std::vector& layerList); float getHeightAt (const Ogre::Vector3& worldPos); @@ -77,6 +84,10 @@ namespace Terrain UniqueTextureId getVtexIndexAt(int cellX, int cellY, int x, int y); std::string getTextureName (UniqueTextureId id); + + std::map mLayerInfoMap; + + LayerInfo getLayerInfo(const std::string& texture); }; } diff --git a/extern/oics/tinyxml.h b/extern/oics/tinyxml.h index e69913b59..50ad417fe 100644 --- a/extern/oics/tinyxml.h +++ b/extern/oics/tinyxml.h @@ -349,7 +349,7 @@ protected: { //strncpy( _value, p, *length ); // lots of compilers don't like this function (unsafe), // and the null terminator isn't needed - for( int i=0; p[i] && i<*length; ++i ) { + for( int i=0; i<*length && p[i]; ++i ) { _value[i] = p[i]; } return p + (*length); diff --git a/extern/sdl4ogre/cursormanager.hpp b/extern/sdl4ogre/cursormanager.hpp index f45c5cdc2..35ec92a70 100644 --- a/extern/sdl4ogre/cursormanager.hpp +++ b/extern/sdl4ogre/cursormanager.hpp @@ -22,9 +22,6 @@ public: /// \brief Follow up a cursorChanged() call with enough info to create an cursor. virtual void receiveCursorInfo(const std::string &name, int rotDegrees, Ogre::TexturePtr tex, Uint8 size_x, Uint8 size_y, Uint8 hotspot_x, Uint8 hotspot_y) = 0; - /// \brief Tell the manager when the cursor visibility changed - virtual void cursorVisibilityChange(bool visible) = 0; - /// \brief sets whether to actively manage cursors or not virtual void setEnabled(bool enabled) = 0; }; diff --git a/extern/sdl4ogre/events.h b/extern/sdl4ogre/events.h index e6e8434cb..48adb4545 100644 --- a/extern/sdl4ogre/events.h +++ b/extern/sdl4ogre/events.h @@ -70,6 +70,8 @@ public: /** @remarks The window got / lost input focus */ virtual void windowFocusChange( bool have_focus ) {} + virtual void windowClosed () {} + virtual void windowResized (int x, int y) {} }; diff --git a/extern/sdl4ogre/sdlcursormanager.cpp b/extern/sdl4ogre/sdlcursormanager.cpp index d14a9ffa0..65fb7f98b 100644 --- a/extern/sdl4ogre/sdlcursormanager.cpp +++ b/extern/sdl4ogre/sdlcursormanager.cpp @@ -10,7 +10,6 @@ namespace SFO SDLCursorManager::SDLCursorManager() : mEnabled(false), - mCursorVisible(false), mInitialized(false) { } @@ -70,27 +69,7 @@ namespace SFO void SDLCursorManager::_setGUICursor(const std::string &name) { - if(mEnabled && mCursorVisible) - { - SDL_SetCursor(mCursorMap.find(name)->second); - _setCursorVisible(mCursorVisible); - } - } - - void SDLCursorManager::_setCursorVisible(bool visible) - { - if(!mEnabled) - return; - - SDL_ShowCursor(visible ? SDL_TRUE : SDL_FALSE); - } - - void SDLCursorManager::cursorVisibilityChange(bool visible) - { - mCursorVisible = visible; - - _setGUICursor(mCurrentCursor); - _setCursorVisible(visible); + SDL_SetCursor(mCursorMap.find(name)->second); } void SDLCursorManager::receiveCursorInfo(const std::string& name, int rotDegrees, Ogre::TexturePtr tex, Uint8 size_x, Uint8 size_y, Uint8 hotspot_x, Uint8 hotspot_y) diff --git a/extern/sdl4ogre/sdlcursormanager.hpp b/extern/sdl4ogre/sdlcursormanager.hpp index 8940220d4..7ba69f013 100644 --- a/extern/sdl4ogre/sdlcursormanager.hpp +++ b/extern/sdl4ogre/sdlcursormanager.hpp @@ -19,14 +19,12 @@ namespace SFO virtual bool cursorChanged(const std::string &name); virtual void receiveCursorInfo(const std::string &name, int rotDegrees, Ogre::TexturePtr tex, Uint8 size_x, Uint8 size_y, Uint8 hotspot_x, Uint8 hotspot_y); - virtual void cursorVisibilityChange(bool visible); private: void _createCursorFromResource(const std::string &name, int rotDegrees, Ogre::TexturePtr tex, Uint8 size_x, Uint8 size_y, Uint8 hotspot_x, Uint8 hotspot_y); void _putPixel(SDL_Surface *surface, int x, int y, Uint32 pixel); void _setGUICursor(const std::string& name); - void _setCursorVisible(bool visible); typedef std::map CursorMap; CursorMap mCursorMap; @@ -34,7 +32,6 @@ namespace SFO std::string mCurrentCursor; bool mEnabled; bool mInitialized; - bool mCursorVisible; }; } diff --git a/extern/sdl4ogre/sdlinputwrapper.cpp b/extern/sdl4ogre/sdlinputwrapper.cpp index df74bba3b..d48e43c01 100644 --- a/extern/sdl4ogre/sdlinputwrapper.cpp +++ b/extern/sdl4ogre/sdlinputwrapper.cpp @@ -9,7 +9,7 @@ namespace SFO { /// \brief General purpose wrapper for OGRE applications around SDL's event /// queue, mostly used for handling input-related events. - InputWrapper::InputWrapper(SDL_Window* window, Ogre::RenderWindow* ogreWindow) : + InputWrapper::InputWrapper(SDL_Window* window, Ogre::RenderWindow* ogreWindow, bool grab) : mSDLWindow(window), mOgreWindow(ogreWindow), mWarpCompensate(false), @@ -23,7 +23,12 @@ namespace SFO mJoyListener(NULL), mKeyboardListener(NULL), mMouseListener(NULL), - mWindowListener(NULL) + mWindowListener(NULL), + mWindowHasFocus(true), + mWantGrab(false), + mWantRelative(false), + mWantMouseVisible(false), + mAllowGrab(grab) { _setupOISKeys(); } @@ -51,13 +56,16 @@ namespace SFO switch(evt.type) { case SDL_MOUSEMOTION: - //ignore this if it happened due to a warp + // Ignore this if it happened due to a warp if(!_handleWarpMotion(evt.motion)) { - mMouseListener->mouseMoved(_packageMouseMotion(evt)); + // If in relative mode, don't trigger events unless window has focus + if (!mWantRelative || mWindowHasFocus) + mMouseListener->mouseMoved(_packageMouseMotion(evt)); - //try to keep the mouse inside the window - _wrapMousePointer(evt.motion); + // Try to keep the mouse inside the window + if (mWindowHasFocus) + _wrapMousePointer(evt.motion); } break; case SDL_MOUSEWHEEL: @@ -103,7 +111,8 @@ namespace SFO handleWindowEvent(evt); break; case SDL_QUIT: - Ogre::Root::getSingleton().queueEndRendering(); + if (mWindowListener) + mWindowListener->windowClosed(); break; default: std::cerr << "Unhandled SDL event of type " << evt.type << std::endl; @@ -117,16 +126,16 @@ namespace SFO switch (evt.window.event) { case SDL_WINDOWEVENT_ENTER: mMouseInWindow = true; + updateMouseSettings(); break; case SDL_WINDOWEVENT_LEAVE: mMouseInWindow = false; - SDL_SetWindowGrab(mSDLWindow, SDL_FALSE); - SDL_SetRelativeMouseMode(SDL_FALSE); + updateMouseSettings(); break; case SDL_WINDOWEVENT_SIZE_CHANGED: int w,h; SDL_GetWindowSize(mSDLWindow, &w, &h); - // TODO: Fix Ogre to handle this more consistently + // TODO: Fix Ogre to handle this more consistently (fixed in 1.9) #if OGRE_PLATFORM == OGRE_PLATFORM_LINUX mOgreWindow->resize(w, h); #else @@ -137,7 +146,7 @@ namespace SFO break; case SDL_WINDOWEVENT_RESIZED: - // TODO: Fix Ogre to handle this more consistently + // TODO: Fix Ogre to handle this more consistently (fixed in 1.9) #if OGRE_PLATFORM == OGRE_PLATFORM_LINUX mOgreWindow->resize(evt.window.data1, evt.window.data2); #else @@ -148,10 +157,15 @@ namespace SFO break; case SDL_WINDOWEVENT_FOCUS_GAINED: + mWindowHasFocus = true; + updateMouseSettings(); if (mWindowListener) mWindowListener->windowFocusChange(true); + break; case SDL_WINDOWEVENT_FOCUS_LOST: + mWindowHasFocus = false; + updateMouseSettings(); if (mWindowListener) mWindowListener->windowFocusChange(false); break; @@ -192,25 +206,43 @@ namespace SFO /// \brief Locks the pointer to the window void InputWrapper::setGrabPointer(bool grab) { - mGrabPointer = grab && mMouseInWindow; - SDL_SetWindowGrab(mSDLWindow, grab && mMouseInWindow ? SDL_TRUE : SDL_FALSE); + mWantGrab = grab; + updateMouseSettings(); } /// \brief Set the mouse to relative positioning. Doesn't move the cursor /// and disables mouse acceleration. void InputWrapper::setMouseRelative(bool relative) { - if(mMouseRelative == relative && mMouseInWindow) + mWantRelative = relative; + updateMouseSettings(); + } + + void InputWrapper::setMouseVisible(bool visible) + { + mWantMouseVisible = visible; + updateMouseSettings(); + } + + void InputWrapper::updateMouseSettings() + { + mGrabPointer = mWantGrab && mMouseInWindow && mWindowHasFocus; + SDL_SetWindowGrab(mSDLWindow, mGrabPointer && mAllowGrab ? SDL_TRUE : SDL_FALSE); + + SDL_ShowCursor(mWantMouseVisible || !mWindowHasFocus); + + bool relative = mWantRelative && mMouseInWindow && mWindowHasFocus; + if(mMouseRelative == relative) return; - mMouseRelative = relative && mMouseInWindow; + mMouseRelative = relative; mWrapPointer = false; //eep, wrap the pointer manually if the input driver doesn't support //relative positioning natively - int success = SDL_SetRelativeMouseMode(relative && mMouseInWindow ? SDL_TRUE : SDL_FALSE); - if(relative && mMouseInWindow && success != 0) + int success = SDL_SetRelativeMouseMode(relative ? SDL_TRUE : SDL_FALSE); + if(relative && success != 0) mWrapPointer = true; //now remove all mouse events using the old setting from the queue diff --git a/extern/sdl4ogre/sdlinputwrapper.hpp b/extern/sdl4ogre/sdlinputwrapper.hpp index 1bd8947a0..a2b698f86 100644 --- a/extern/sdl4ogre/sdlinputwrapper.hpp +++ b/extern/sdl4ogre/sdlinputwrapper.hpp @@ -16,7 +16,7 @@ namespace SFO class InputWrapper { public: - InputWrapper(SDL_Window *window, Ogre::RenderWindow* ogreWindow); + InputWrapper(SDL_Window *window, Ogre::RenderWindow* ogreWindow, bool grab); ~InputWrapper(); void setMouseEventCallback(MouseListener* listen) { mMouseListener = listen; } @@ -28,6 +28,7 @@ namespace SFO bool isModifierHeld(SDL_Keymod mod); bool isKeyDown(SDL_Scancode key); + void setMouseVisible (bool visible); void setMouseRelative(bool relative); bool getMouseRelative() { return mMouseRelative; } void setGrabPointer(bool grab); @@ -36,6 +37,8 @@ namespace SFO void warpMouse(int x, int y); + void updateMouseSettings(); + private: void handleWindowEvent(const SDL_Event& evt); @@ -57,14 +60,20 @@ namespace SFO Uint16 mWarpX; Uint16 mWarpY; bool mWarpCompensate; - bool mMouseRelative; bool mWrapPointer; + + bool mAllowGrab; + bool mWantMouseVisible; + bool mWantGrab; + bool mWantRelative; bool mGrabPointer; + bool mMouseRelative; Sint32 mMouseZ; Sint32 mMouseX; Sint32 mMouseY; + bool mWindowHasFocus; bool mMouseInWindow; SDL_Window* mSDLWindow; diff --git a/extern/shiny/Main/Factory.hpp b/extern/shiny/Main/Factory.hpp index 97984609e..7d52266b5 100644 --- a/extern/shiny/Main/Factory.hpp +++ b/extern/shiny/Main/Factory.hpp @@ -259,8 +259,9 @@ namespace sh Platform* mPlatform; MaterialInstance* findInstance (const std::string& name); + public: MaterialInstance* searchInstance (const std::string& name); - + private: /// @return was anything removed? bool removeCache (const std::string& pattern); diff --git a/extern/shiny/Platforms/Ogre/OgrePlatform.cpp b/extern/shiny/Platforms/Ogre/OgrePlatform.cpp index 3725d5f35..9f309fbcd 100644 --- a/extern/shiny/Platforms/Ogre/OgrePlatform.cpp +++ b/extern/shiny/Platforms/Ogre/OgrePlatform.cpp @@ -64,8 +64,11 @@ namespace sh bool OgrePlatform::supportsShaderSerialization () { - // Not very reliable in OpenGL mode (requires extension), and somehow doesn't work on linux even if the extension is present + #if OGRE_VERSION >= (1 << 16 | 9 << 8 | 0) + return true; + #else return Ogre::Root::getSingleton ().getRenderSystem ()->getName ().find("OpenGL") == std::string::npos; + #endif } bool OgrePlatform::supportsMaterialQueuedListener () @@ -110,10 +113,15 @@ namespace sh void OgrePlatform::serializeShaders (const std::string& file) { - std::fstream output; - output.open(file.c_str(), std::ios::out | std::ios::binary); - Ogre::DataStreamPtr shaderCache (OGRE_NEW Ogre::FileStreamDataStream(file, &output, false)); - Ogre::GpuProgramManager::getSingleton().saveMicrocodeCache(shaderCache); + #if OGRE_VERSION >= (1 << 16 | 9 << 8 | 0) + if (Ogre::GpuProgramManager::getSingleton().isCacheDirty()) + #endif + { + std::fstream output; + output.open(file.c_str(), std::ios::out | std::ios::binary); + Ogre::DataStreamPtr shaderCache (OGRE_NEW Ogre::FileStreamDataStream(file, &output, false)); + Ogre::GpuProgramManager::getSingleton().saveMicrocodeCache(shaderCache); + } } void OgrePlatform::deserializeShaders (const std::string& file) @@ -143,7 +151,7 @@ namespace sh else if (typeid(*value) == typeid(IntValue)) type = Ogre::GCT_INT1; else - assert(0); + throw std::runtime_error("unexpected type"); params->addConstantDefinition(name, type); mSharedParameters[name] = params; } diff --git a/extern/shiny/Platforms/Ogre/OgreTextureUnitState.cpp b/extern/shiny/Platforms/Ogre/OgreTextureUnitState.cpp index 54dda3523..f215f4ab7 100644 --- a/extern/shiny/Platforms/Ogre/OgreTextureUnitState.cpp +++ b/extern/shiny/Platforms/Ogre/OgreTextureUnitState.cpp @@ -1,5 +1,8 @@ #include "OgreTextureUnitState.hpp" +#include +#include + #include "OgrePass.hpp" #include "OgrePlatform.hpp" #include "OgreMaterialSerializer.hpp" @@ -28,6 +31,32 @@ namespace sh setTextureName (retrieveValue(value, context).get()); return true; } + else if (name == "anim_texture2") + { + std::string val = retrieveValue(value, context).get(); + std::vector tokens; + boost::split(tokens, val, boost::is_any_of(" ")); + assert(tokens.size() == 3); + std::string texture = tokens[0]; + int frames = boost::lexical_cast(tokens[1]); + float duration = boost::lexical_cast(tokens[2]); + + std::vector frameTextures; + for (int i=0; isetAnimatedTextureName(&frameTextures[0], frames, duration); + return true; + } else if (name == "create_in_ffp") return true; // handled elsewhere diff --git a/files/mac/opencs.icns b/files/mac/opencs.icns new file mode 100644 index 000000000..98812f871 Binary files /dev/null and b/files/mac/opencs.icns differ diff --git a/files/materials/core.h b/files/materials/core.h index 6f8179c08..a912e2356 100644 --- a/files/materials/core.h +++ b/files/materials/core.h @@ -91,7 +91,7 @@ precision mediump float; #define shSamplerCube(name) uniform samplerCube name; @shUseSampler(name) - #define shMatrixMult(m, v) (m * v) + #define shMatrixMult(m, v) ((m) * (v)) #define shOutputPosition gl_Position diff --git a/files/materials/objects.mat b/files/materials/objects.mat index 8f8734d62..32787e159 100644 --- a/files/materials/objects.mat +++ b/files/materials/objects.mat @@ -1,7 +1,7 @@ material openmw_objects_base { diffuse 1.0 1.0 1.0 1.0 - specular 0 0 0 0 + specular 0 0 0 0 1 ambient 1.0 1.0 1.0 emissive 0.0 0.0 0.0 vertmode 0 @@ -12,6 +12,7 @@ material openmw_objects_base use_detail_map false emissiveMapUVSet 0 detailMapUVSet 0 + use_parallax false scene_blend default depth_write default @@ -19,6 +20,8 @@ material openmw_objects_base alpha_rejection default transparent_sorting default polygon_mode default + env_map false + env_map_color 1 1 1 pass { @@ -33,6 +36,9 @@ material openmw_objects_base detailMapUVSet $detailMapUVSet emissiveMap $emissiveMap detailMap $detailMap + env_map $env_map + env_map_color $env_map_color + use_parallax $use_parallax } diffuse $diffuse @@ -75,6 +81,14 @@ material openmw_objects_base direct_texture $detailMap tex_coord_set $detailMapUVSet } + + texture_unit envMap + { + create_in_ffp $env_map + env_map spherical + anim_texture2 textures\magicitem\caust.dds 32 2 + colour_op add + } texture_unit shadowMap0 { diff --git a/files/materials/objects.shader b/files/materials/objects.shader index 36f92bfd9..3d873f463 100644 --- a/files/materials/objects.shader +++ b/files/materials/objects.shader @@ -18,6 +18,10 @@ #define EMISSIVE_MAP @shPropertyHasValue(emissiveMap) #define DETAIL_MAP @shPropertyHasValue(detailMap) +#define PARALLAX @shPropertyBool(use_parallax) +#define PARALLAX_SCALE 0.04 +#define PARALLAX_BIAS -0.02 + // right now we support 2 UV sets max. implementing them is tedious, and we're probably not going to need more #define SECOND_UV_SET (@shPropertyString(emissiveMapUVSet) || @shPropertyString(detailMapUVSet)) @@ -30,6 +34,12 @@ #define VIEWPROJ_FIX @shGlobalSettingBool(viewproj_fix) +#define ENV_MAP @shPropertyBool(env_map) + +#define SPECULAR 1 + +#define NEED_NORMAL (!VERTEX_LIGHTING || ENV_MAP) || SPECULAR + #ifdef SH_VERTEX_SHADER // ------------------------------------- VERTEX --------------------------------------- @@ -61,15 +71,12 @@ shOutput(float3, tangentPassthrough) #endif -#if !VERTEX_LIGHTING +#if NEED_NORMAL shOutput(float3, normalPassthrough) #endif -#ifdef NEED_DEPTH - shOutput(float, depthPassthrough) -#endif - - shOutput(float3, objSpacePositionPassthrough) + // Depth in w + shOutput(float4, objSpacePositionPassthrough) #if VERTEXCOLOR_MODE != 0 shColourInput(float4) @@ -79,18 +86,19 @@ shOutput(float4, colourPassthrough) #endif +#if ENV_MAP || VERTEX_LIGHTING + shUniform(float4x4, worldView) @shAutoConstant(worldView, worldview_matrix) +#endif + #if VERTEX_LIGHTING shUniform(float4, lightPosition[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightPosition, light_position_view_space_array, @shGlobalSettingString(num_lights)) shUniform(float4, lightDiffuse[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightDiffuse, light_diffuse_colour_array, @shGlobalSettingString(num_lights)) shUniform(float4, lightAttenuation[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightAttenuation, light_attenuation_array, @shGlobalSettingString(num_lights)) shUniform(float4, lightAmbient) @shAutoConstant(lightAmbient, ambient_light_colour) - shUniform(float4x4, worldView) @shAutoConstant(worldView, worldview_matrix) #if VERTEXCOLOR_MODE != 2 shUniform(float4, materialAmbient) @shAutoConstant(materialAmbient, surface_ambient_colour) #endif -#if VERTEXCOLOR_MODE != 2 shUniform(float4, materialDiffuse) @shAutoConstant(materialDiffuse, surface_diffuse_colour) -#endif #if VERTEXCOLOR_MODE != 1 shUniform(float4, materialEmissive) @shAutoConstant(materialEmissive, surface_emissive_colour) #endif @@ -125,10 +133,23 @@ UV.zw = uv1; #endif +#if ENV_MAP || VERTEX_LIGHTING + float3 viewNormal = normalize(shMatrixMult(worldView, float4(normal.xyz, 0)).xyz); +#endif + +#if ENV_MAP + float3 viewVec = normalize( shMatrixMult(worldView, shInputPosition).xyz); + + float3 r = reflect( viewVec, viewNormal ); + float m = 2.0 * sqrt( r.x*r.x + r.y*r.y + (r.z+1.0)*(r.z+1.0) ); + UV.z = r.x/m + 0.5; + UV.w = r.y/m + 0.5; +#endif + #if NORMAL_MAP tangentPassthrough = tangent.xyz; #endif -#if !VERTEX_LIGHTING +#if NEED_NORMAL normalPassthrough = normal.xyz; #endif #if VERTEXCOLOR_MODE != 0 && !VERTEX_LIGHTING @@ -151,14 +172,14 @@ float4x4 fixedWVP = shMatrixMult(vpFixed, worldMatrix); - depthPassthrough = shMatrixMult(fixedWVP, shInputPosition).z; + objSpacePositionPassthrough.w = shMatrixMult(fixedWVP, shInputPosition).z; #else - depthPassthrough = shOutputPosition.z; + objSpacePositionPassthrough.w = shOutputPosition.z; #endif #endif - objSpacePositionPassthrough = shInputPosition.xyz; + objSpacePositionPassthrough.xyz = shInputPosition.xyz; #if SHADOWS lightSpacePos0 = shMatrixMult(texViewProjMatrix0, shMatrixMult(worldMatrix, shInputPosition)); @@ -173,7 +194,6 @@ #if VERTEX_LIGHTING float3 viewPos = shMatrixMult(worldView, shInputPosition).xyz; - float3 viewNormal = normalize(shMatrixMult(worldView, float4(normal.xyz, 0)).xyz); float3 lightDir; float d; @@ -212,9 +232,7 @@ lightResult.xyz += lightAmbient.xyz * materialAmbient.xyz + materialEmissive.xyz; #endif -#if VERTEXCOLOR_MODE != 2 lightResult.a *= materialDiffuse.a; -#endif #endif } @@ -242,20 +260,31 @@ shSampler2D(detailMap) #endif +#if ENV_MAP + shSampler2D(envMap) + shUniform(float3, env_map_color) @shUniformProperty3f(env_map_color, env_map_color) +#endif + +#if ENV_MAP || SPECULAR || PARALLAX + shUniform(float3, cameraPosObjSpace) @shAutoConstant(cameraPosObjSpace, camera_position_object_space) +#endif +#if SPECULAR + shUniform(float3, lightSpec0) @shAutoConstant(lightSpec0, light_specular_colour, 0) + shUniform(float3, lightPosObjSpace0) @shAutoConstant(lightPosObjSpace0, light_position_object_space, 0) + shUniform(float, matShininess) @shAutoConstant(matShininess, surface_shininess) + shUniform(float3, matSpec) @shAutoConstant(matSpec, surface_specular_colour) +#endif + shInput(float4, UV) #if NORMAL_MAP shInput(float3, tangentPassthrough) #endif -#if !VERTEX_LIGHTING +#if NEED_NORMAL shInput(float3, normalPassthrough) #endif -#ifdef NEED_DEPTH - shInput(float, depthPassthrough) -#endif - - shInput(float3, objSpacePositionPassthrough) + shInput(float4, objSpacePositionPassthrough) #if VERTEXCOLOR_MODE != 0 && !VERTEX_LIGHTING shInput(float4, colourPassthrough) @@ -298,7 +327,6 @@ shInput(float4, lightResult) shInput(float3, directionalResult) #else - shUniform(float, lightCount) @shAutoConstant(lightCount, light_count) shUniform(float4, lightPosition[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightPosition, light_position_view_space_array, @shGlobalSettingString(num_lights)) shUniform(float4, lightDiffuse[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightDiffuse, light_diffuse_colour_array, @shGlobalSettingString(num_lights)) shUniform(float4, lightAttenuation[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightAttenuation, light_attenuation_array, @shGlobalSettingString(num_lights)) @@ -307,9 +335,7 @@ #if VERTEXCOLOR_MODE != 2 shUniform(float4, materialAmbient) @shAutoConstant(materialAmbient, surface_ambient_colour) #endif - #if VERTEXCOLOR_MODE != 2 shUniform(float4, materialDiffuse) @shAutoConstant(materialDiffuse, surface_diffuse_colour) - #endif #if VERTEXCOLOR_MODE != 1 shUniform(float4, materialEmissive) @shAutoConstant(materialEmissive, surface_emissive_colour) #endif @@ -317,18 +343,17 @@ SH_START_PROGRAM { - shOutputColour(0) = shSample(diffuseMap, UV.xy); + float4 newUV = UV; -#if DETAIL_MAP -#if @shPropertyString(detailMapUVSet) - shOutputColour(0) *= shSample(detailMap, UV.zw)*2; -#else - shOutputColour(0) *= shSample(detailMap, UV.xy)*2; +#ifdef NEED_DEPTH + float depthPassthrough = objSpacePositionPassthrough.w; #endif + +#if NEED_NORMAL + float3 normal = normalPassthrough; #endif #if NORMAL_MAP - float3 normal = normalPassthrough; float3 binormal = cross(tangentPassthrough.xyz, normal.xyz); float3x3 tbn = float3x3(tangentPassthrough.xyz, binormal, normal.xyz); @@ -336,13 +361,35 @@ tbn = transpose(tbn); #endif - float3 TSnormal = shSample(normalMap, UV.xy).xyz * 2 - 1; + float4 normalTex = shSample(normalMap, UV.xy); - normal = normalize (shMatrixMult( transpose(tbn), TSnormal )); + normal = normalize (shMatrixMult( transpose(tbn), normalTex.xyz * 2 - 1 )); #endif +#if ENV_MAP || SPECULAR || PARALLAX + float3 eyeDir = normalize(cameraPosObjSpace.xyz - objSpacePositionPassthrough.xyz); +#endif + +#if PARALLAX + float3 TSeyeDir = normalize(shMatrixMult(tbn, eyeDir)); + + newUV += (TSeyeDir.xyxy * ( normalTex.a * PARALLAX_SCALE + PARALLAX_BIAS )).xyxy; +#endif + + float4 diffuse = shSample(diffuseMap, newUV.xy); + shOutputColour(0) = diffuse; + +#if DETAIL_MAP +#if @shPropertyString(detailMapUVSet) + shOutputColour(0) *= shSample(detailMap, newUV.zw)*2; +#else + shOutputColour(0) *= shSample(detailMap, newUV.xy)*2; +#endif +#endif + + #if !VERTEX_LIGHTING - float3 viewPos = shMatrixMult(worldView, float4(objSpacePositionPassthrough,1)).xyz; + float3 viewPos = shMatrixMult(worldView, float4(objSpacePositionPassthrough.xyz,1)).xyz; float3 viewNormal = normalize(shMatrixMult(worldView, float4(normal.xyz, 0)).xyz); float3 lightDir; @@ -381,9 +428,7 @@ lightResult.xyz += lightAmbient.xyz * materialAmbient.xyz + materialEmissive.xyz; #endif -#if VERTEXCOLOR_MODE != 2 lightResult.a *= materialDiffuse.a; -#endif #endif // shadows only for the first (directional) light @@ -407,7 +452,7 @@ #if (UNDERWATER) || (FOG) - float3 worldPos = shMatrixMult(worldMatrix, float4(objSpacePositionPassthrough,1)).xyz; + float3 worldPos = shMatrixMult(worldMatrix, float4(objSpacePositionPassthrough.xyz,1)).xyz; #endif #if UNDERWATER @@ -420,6 +465,32 @@ shOutputColour(0) *= lightResult; #endif +#if EMISSIVE_MAP + #if @shPropertyString(emissiveMapUVSet) + shOutputColour(0).xyz += shSample(emissiveMap, newUV.zw).xyz; + #else + shOutputColour(0).xyz += shSample(emissiveMap, newUV.xy).xyz; + #endif +#endif + +#if ENV_MAP + // Everything looks better with fresnel + float facing = 1.0 - max(abs(dot(-eyeDir, normal)), 0); + float envFactor = shSaturate(0.25 + 0.75 * pow(facing, 1)); + + shOutputColour(0).xyz += shSample(envMap, UV.zw).xyz * envFactor * env_map_color; +#endif + +#if SPECULAR + float3 light0Dir = normalize(lightPosObjSpace0.xyz); + + float NdotL = max(dot(normal, light0Dir), 0); + float3 halfVec = normalize (light0Dir + eyeDir); + + float3 specular = pow(max(dot(normal, halfVec), 0), matShininess) * lightSpec0 * matSpec; + shOutputColour(0).xyz += specular * shadow * diffuse.a; +#endif + #if FOG float fogValue = shSaturate((depthPassthrough - fogParams.y) * fogParams.w); @@ -430,14 +501,6 @@ shOutputColour(0).xyz = shLerp (shOutputColour(0).xyz, fogColour, fogValue); #endif -#endif - -#if EMISSIVE_MAP - #if @shPropertyString(emissiveMapUVSet) - shOutputColour(0).xyz += shSample(emissiveMap, UV.zw).xyz; - #else - shOutputColour(0).xyz += shSample(emissiveMap, UV.xy).xyz; - #endif #endif // prevent negative colour output (for example with negative lights) diff --git a/files/materials/terrain.shader b/files/materials/terrain.shader index 861841a84..7903292d3 100644 --- a/files/materials/terrain.shader +++ b/files/materials/terrain.shader @@ -27,6 +27,16 @@ #define COMPOSITE_MAP @shPropertyBool(display_composite_map) +#define NORMAL_MAP @shPropertyBool(normal_map_enabled) +#define PARALLAX @shPropertyBool(parallax_enabled) + +#define VERTEX_LIGHTING (!NORMAL_MAP) + +#define PARALLAX_SCALE 0.04 +#define PARALLAX_BIAS -0.02 + +// This is just for the permutation handler +#define NORMAL_MAPS @shPropertyString(normal_maps) #if NEED_DEPTH @shAllocatePassthrough(1, depth) @@ -37,8 +47,13 @@ @shAllocatePassthrough(3, worldPos) #if LIGHTING +@shAllocatePassthrough(3, normalPassthrough) +#if VERTEX_LIGHTING @shAllocatePassthrough(3, lightResult) @shAllocatePassthrough(3, directionalResult) +#else +@shAllocatePassthrough(3, colourPassthrough) +#endif #if SHADOWS @shAllocatePassthrough(4, lightSpacePos0) @@ -69,12 +84,13 @@ shNormalInput(float4) shColourInput(float4) - shUniform(float, lightCount) @shAutoConstant(lightCount, light_count) +#if VERTEX_LIGHTING shUniform(float4, lightPosition[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightPosition, light_position_object_space_array, @shGlobalSettingString(num_lights)) shUniform(float4, lightDiffuse[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightDiffuse, light_diffuse_colour_array, @shGlobalSettingString(num_lights)) shUniform(float4, lightAttenuation[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightAttenuation, light_attenuation_array, @shGlobalSettingString(num_lights)) shUniform(float4, lightAmbient) @shAutoConstant(lightAmbient, ambient_light_colour) - +#endif + #if SHADOWS shUniform(float4x4, texViewProjMatrix0) @shAutoConstant(texViewProjMatrix0, texture_viewproj_matrix) #endif @@ -122,6 +138,13 @@ @shPassthroughAssign(worldPos, worldPos.xyz); +#if LIGHTING + @shPassthroughAssign(normalPassthrough, normal.xyz); +#endif +#if LIGHTING && !VERTEX_LIGHTING + @shPassthroughAssign(colourPassthrough, colour.xyz); +#endif + #if LIGHTING #if SHADOWS @@ -139,6 +162,7 @@ #endif +#if VERTEX_LIGHTING // Lighting float3 lightDir; float d; @@ -164,6 +188,7 @@ @shPassthroughAssign(lightResult, lightResult); @shPassthroughAssign(directionalResult, directionalResult); +#endif #endif } @@ -189,6 +214,9 @@ @shForeach(@shPropertyString(num_layers)) shSampler2D(diffuseMap@shIterator) +#if @shPropertyBool(use_normal_map_@shIterator) + shSampler2D(normalMap@shIterator) +#endif @shEndForeach #endif @@ -201,6 +229,15 @@ @shPassthroughFragmentInputs #if LIGHTING + +#if !VERTEX_LIGHTING +shUniform(float4, lightPosition[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightPosition, light_position_array, @shGlobalSettingString(num_lights)) +shUniform(float4, lightDiffuse[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightDiffuse, light_diffuse_colour_array, @shGlobalSettingString(num_lights)) +shUniform(float4, lightAttenuation[@shGlobalSettingString(num_lights)]) @shAutoConstant(lightAttenuation, light_attenuation_array, @shGlobalSettingString(num_lights)) +shUniform(float4, lightAmbient) @shAutoConstant(lightAmbient, ambient_light_colour) +shUniform(float4x4, worldView) @shAutoConstant(worldView, worldview_matrix) +#endif + #if SHADOWS shSampler2D(shadowMap0) shUniform(float2, invShadowmapSize0) @shAutoConstant(invShadowmapSize0, inverse_texture_size, @shPropertyString(shadowtexture_offset)) @@ -220,13 +257,21 @@ #if (UNDERWATER) || (FOG) shUniform(float4x4, worldMatrix) @shAutoConstant(worldMatrix, world_matrix) - shUniform(float4, cameraPos) @shAutoConstant(cameraPos, camera_position) #endif #if UNDERWATER shUniform(float, waterLevel) @shSharedParameter(waterLevel) #endif + +// For specular +#if LIGHTING + shUniform(float3, lightSpec0) @shAutoConstant(lightSpec0, light_specular_colour, 0) + shUniform(float3, lightPos0) @shAutoConstant(lightPos0, light_position, 0) +#endif + +shUniform(float4, cameraPos) @shAutoConstant(cameraPos, camera_position) + SH_START_PROGRAM { @@ -237,12 +282,32 @@ float2 UV = @shPassthroughReceive(UV); float3 worldPos = @shPassthroughReceive(worldPos); - - + +#if LIGHTING + float3 normal = @shPassthroughReceive(normalPassthrough); +#endif + +#if LIGHTING && !VERTEX_LIGHTING + +#if NORMAL_MAP + // derive the tangent space basis + float3 tangent = float3(1,0, 0); + + float3 binormal = normalize(cross(tangent, normal)); + tangent = normalize(cross(normal, binormal)); // note, now we need to re-cross to derive tangent again because it wasn't orthonormal + + // derive final matrix + float3x3 tbn = float3x3(tangent, binormal, normal); + #if SH_GLSL + tbn = transpose(tbn); + #endif +#endif + +#endif + #if UNDERWATER float3 waterEyePos = intercept(worldPos, cameraPos.xyz - worldPos, float3(0,0,1), waterLevel); #endif - #if !IS_FIRST_PASS // Opacity the previous passes should have, i.e. 1 - (opacity of this pass) @@ -252,6 +317,8 @@ float previousAlpha = 1.f; shOutputColour(0) = float4(1,1,1,1); +float3 TSnormal = float3(0,0,1); + #if COMPOSITE_MAP shOutputColour(0).xyz = shSample(compositeMap, UV).xyz; #else @@ -266,39 +333,88 @@ float2 blendUV = (UV - 0.5) * (16.0 / (16.0+1.0)) + 0.5; @shEndForeach - float3 albedo = float3(0,0,0); + float4 albedo = float4(0,0,0,1); - float2 layerUV = UV * 16; + float2 layerUV = float2(UV.x, 1.f-UV.y) * 16; // Reverse Y, required to get proper tangents + float2 thisLayerUV; + float4 normalTex; + + float3 eyeDir = normalize(cameraPos.xyz - worldPos); +#if PARALLAX + float3 TSeyeDir = normalize(shMatrixMult(tbn, eyeDir)); +#endif @shForeach(@shPropertyString(num_layers)) +#if @shPropertyBool(use_normal_map_@shIterator) + normalTex = shSample(normalMap@shIterator, thisLayerUV); +#if @shIterator == 0 && IS_FIRST_PASS + TSnormal = normalize(normalTex.xyz * 2 - 1); +#else + TSnormal = shLerp(TSnormal, normalTex.xyz * 2 - 1, blendValues@shPropertyString(blendmap_component_@shIterator)); +#endif +#endif + thisLayerUV = layerUV; +#if @shPropertyBool(use_parallax_@shIterator) + thisLayerUV += TSeyeDir.xy * ( normalTex.a * PARALLAX_SCALE + PARALLAX_BIAS ); +#endif #if IS_FIRST_PASS #if @shIterator == 0 // first layer of first pass is the base layer and doesn't need a blend map - albedo = shSample(diffuseMap0, layerUV).rgb; + albedo = shSample(diffuseMap0, layerUV); #else - albedo = shLerp(albedo, shSample(diffuseMap@shIterator, layerUV).rgb, blendValues@shPropertyString(blendmap_component_@shIterator)); + albedo = shLerp(albedo, shSample(diffuseMap@shIterator, thisLayerUV), blendValues@shPropertyString(blendmap_component_@shIterator)); #endif #else #if @shIterator == 0 - albedo = shSample(diffuseMap@shIterator, layerUV).rgb, blendValues@shPropertyString(blendmap_component_@shIterator); + albedo = shSample(diffuseMap@shIterator, layerUV); #else - albedo = shLerp(albedo, shSample(diffuseMap@shIterator, layerUV).rgb, blendValues@shPropertyString(blendmap_component_@shIterator)); + albedo = shLerp(albedo, shSample(diffuseMap@shIterator, thisLayerUV), blendValues@shPropertyString(blendmap_component_@shIterator)); #endif previousAlpha *= 1.f-blendValues@shPropertyString(blendmap_component_@shIterator); #endif + + @shEndForeach - shOutputColour(0).rgb *= albedo; + shOutputColour(0).rgb *= albedo.xyz; #endif #if LIGHTING + +#if VERTEX_LIGHTING // Lighting float3 lightResult = @shPassthroughReceive(lightResult); float3 directionalResult = @shPassthroughReceive(directionalResult); - +#else + +#if NORMAL_MAP + normal = normalize (shMatrixMult( transpose(tbn), TSnormal )); +#endif + + float3 colour = @shPassthroughReceive(colourPassthrough); + float3 lightDir; + float d; + float3 lightResult = float3(0,0,0); + @shForeach(@shGlobalSettingString(num_lights)) + lightDir = lightPosition[@shIterator].xyz - (worldPos * lightPosition[@shIterator].w); + d = length(lightDir); + lightDir = normalize(lightDir); + + lightResult.xyz += lightDiffuse[@shIterator].xyz + * shSaturate(1.0 / ((lightAttenuation[@shIterator].y) + (lightAttenuation[@shIterator].z * d) + (lightAttenuation[@shIterator].w * d * d))) + * max(dot(normal.xyz, lightDir), 0); +#if @shIterator == 0 + float3 directionalResult = lightResult.xyz; +#endif + @shEndForeach + lightResult.xyz += lightAmbient.xyz; + lightResult.xyz *= colour.xyz; + directionalResult.xyz *= colour.xyz; +#endif + // shadows only for the first (directional) light #if SHADOWS float4 lightSpacePos0 = @shPassthroughReceive(lightSpacePos0); @@ -325,6 +441,17 @@ float2 blendUV = (UV - 0.5) * (16.0 / (16.0+1.0)) + 0.5; shOutputColour(0).xyz *= (lightResult - directionalResult * (1.0-shadow)); #endif +#if LIGHTING && !COMPOSITE_MAP + // Specular + float3 light0Dir = normalize(lightPos0.xyz); + + float NdotL = max(dot(normal, light0Dir), 0); + float3 halfVec = normalize (light0Dir + eyeDir); + + float3 specular = pow(max(dot(normal, halfVec), 0), 32) * lightSpec0; + shOutputColour(0).xyz += specular * (1.f-albedo.a) * shadow; +#endif + #if FOG float fogValue = shSaturate((depth - fogParams.y) * fogParams.w); diff --git a/files/mygui/CMakeLists.txt b/files/mygui/CMakeLists.txt index 1ec1e08cb..70fdf4248 100644 --- a/files/mygui/CMakeLists.txt +++ b/files/mygui/CMakeLists.txt @@ -9,7 +9,6 @@ set(MYGUI_FILES core.skin core.xml EBGaramond-Regular.ttf - Obliviontt.zip openmw_alchemy_window.layout openmw_book.layout openmw_box.skin.xml @@ -81,6 +80,8 @@ set(MYGUI_FILES openmw_merchantrepair.layout openmw_repair.layout openmw_companion_window.layout + openmw_savegame_dialog.layout + openmw_recharge_dialog.layout smallbars.png DejaVuLGCSansMono.ttf markers.png diff --git a/files/mygui/Obliviontt.zip b/files/mygui/Obliviontt.zip deleted file mode 100644 index af4f809fd..000000000 Binary files a/files/mygui/Obliviontt.zip and /dev/null differ diff --git a/files/mygui/openmw_chargen_birth.layout b/files/mygui/openmw_chargen_birth.layout index b368a6407..d13a5a02d 100644 --- a/files/mygui/openmw_chargen_birth.layout +++ b/files/mygui/openmw_chargen_birth.layout @@ -1,20 +1,20 @@ - + - + - + - + - + diff --git a/files/mygui/openmw_chargen_class.layout b/files/mygui/openmw_chargen_class.layout index 3c0348b66..aae3c7035 100644 --- a/files/mygui/openmw_chargen_class.layout +++ b/files/mygui/openmw_chargen_class.layout @@ -1,20 +1,20 @@ - + - + - + - + - + @@ -22,12 +22,12 @@ - + - + @@ -35,37 +35,37 @@ - - + + - + - - - - - + + + + + - + - - - - - + + + + + - + diff --git a/files/mygui/openmw_chargen_create_class.layout b/files/mygui/openmw_chargen_create_class.layout index 92382640b..890e2aac1 100644 --- a/files/mygui/openmw_chargen_create_class.layout +++ b/files/mygui/openmw_chargen_create_class.layout @@ -1,13 +1,14 @@ - + - + + - + @@ -22,12 +23,12 @@ - + - + @@ -35,37 +36,37 @@ - - + + - - + + - - - - - + + + + + - - + + - - - - - + + + + + - + diff --git a/files/mygui/openmw_chargen_review.layout b/files/mygui/openmw_chargen_review.layout index 5d18f4bff..db55e8754 100644 --- a/files/mygui/openmw_chargen_review.layout +++ b/files/mygui/openmw_chargen_review.layout @@ -1,10 +1,10 @@ - + - + @@ -17,27 +17,27 @@ - - - - + + + + - - + + - + - + @@ -46,57 +46,57 @@ - - + + - + - + - + - + - + - + - + @@ -106,12 +106,12 @@ - + - + diff --git a/files/mygui/openmw_hud.layout b/files/mygui/openmw_hud.layout index e39777dd0..72d337e45 100644 --- a/files/mygui/openmw_hud.layout +++ b/files/mygui/openmw_hud.layout @@ -45,6 +45,7 @@ + diff --git a/files/mygui/openmw_itemselection_dialog.layout b/files/mygui/openmw_itemselection_dialog.layout index 003eb1c6a..5fc286298 100644 --- a/files/mygui/openmw_itemselection_dialog.layout +++ b/files/mygui/openmw_itemselection_dialog.layout @@ -1,13 +1,13 @@ - + - + - + diff --git a/files/mygui/openmw_list.skin.xml b/files/mygui/openmw_list.skin.xml index 02c11c354..7972527ac 100644 --- a/files/mygui/openmw_list.skin.xml +++ b/files/mygui/openmw_list.skin.xml @@ -126,6 +126,19 @@ + + + + + + + + + + + + + diff --git a/files/mygui/openmw_messagebox.layout b/files/mygui/openmw_messagebox.layout index dfdb57648..b2d29271b 100644 --- a/files/mygui/openmw_messagebox.layout +++ b/files/mygui/openmw_messagebox.layout @@ -1,11 +1,11 @@ - - - + + + + + diff --git a/files/mygui/openmw_progress.skin.xml b/files/mygui/openmw_progress.skin.xml index 35114ffeb..f5418e3f8 100644 --- a/files/mygui/openmw_progress.skin.xml +++ b/files/mygui/openmw_progress.skin.xml @@ -17,6 +17,11 @@ + + + + + @@ -65,6 +70,10 @@ + + + + diff --git a/files/mygui/openmw_recharge_dialog.layout b/files/mygui/openmw_recharge_dialog.layout new file mode 100644 index 000000000..49e735764 --- /dev/null +++ b/files/mygui/openmw_recharge_dialog.layout @@ -0,0 +1,29 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/files/mygui/openmw_resources.xml b/files/mygui/openmw_resources.xml index 2c3908a1b..3901ab825 100644 --- a/files/mygui/openmw_resources.xml +++ b/files/mygui/openmw_resources.xml @@ -301,4 +301,22 @@ + + + + + + + + + + + + + + + + + + diff --git a/files/mygui/openmw_savegame_dialog.layout b/files/mygui/openmw_savegame_dialog.layout new file mode 100644 index 000000000..18de6a239 --- /dev/null +++ b/files/mygui/openmw_savegame_dialog.layout @@ -0,0 +1,81 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/files/mygui/openmw_settings_window.layout b/files/mygui/openmw_settings_window.layout index ebfaf678a..e6002b51d 100644 --- a/files/mygui/openmw_settings_window.layout +++ b/files/mygui/openmw_settings_window.layout @@ -216,7 +216,11 @@ - + + + + + @@ -308,9 +312,9 @@ - + - + @@ -336,9 +340,14 @@ - + + + + + + - + diff --git a/files/mygui/openmw_stats_window.layout b/files/mygui/openmw_stats_window.layout index 5ae3f96ca..36c28c450 100644 --- a/files/mygui/openmw_stats_window.layout +++ b/files/mygui/openmw_stats_window.layout @@ -2,7 +2,7 @@ - + diff --git a/files/opencs.desktop b/files/opencs.desktop index f6aad5b09..80afa26bc 100644 --- a/files/opencs.desktop +++ b/files/opencs.desktop @@ -3,6 +3,7 @@ Type=Application Name=OpenMW Content Editor GenericName=Content Editor Comment=A replacement for the Morrowind Construction Set. +Keywords=Morrowind;Construction Set;Creation Kit Editor;Set;Kit TryExec=opencs Exec=opencs Icon=opencs diff --git a/files/opencs/defaultfilters b/files/opencs/defaultfilters new file mode 100644 index 000000000..0ac3c8db4 Binary files /dev/null and b/files/opencs/defaultfilters differ diff --git a/files/openmw.desktop b/files/openmw.desktop index 118cd3bbe..3e26018d0 100644 --- a/files/openmw.desktop +++ b/files/openmw.desktop @@ -3,6 +3,7 @@ Type=Application Name=OpenMW Launcher GenericName=Role Playing Game Comment=An engine replacement for The Elder Scrolls III: Morrowind +Keywords=Morrowind;Reimplementation Mods;esm;bsa TryExec=omwlauncher Exec=omwlauncher Icon=openmw diff --git a/files/settings-default.cfg b/files/settings-default.cfg index f191430df..94bdd8c9d 100644 --- a/files/settings-default.cfg +++ b/files/settings-default.cfg @@ -169,3 +169,69 @@ ui y multiplier = 1.0 [Game] # Always use the most powerful attack when striking with a weapon (chop, slash or thrust) best attack = false + +[Windows] +inventory x = 0 +inventory y = 0.4275 +inventory w = 0.6225 +inventory h = 0.5725 + +inventory container x = 0 +inventory container y = 0.4275 +inventory container w = 0.6225 +inventory container h = 0.5725 + +inventory barter x = 0 +inventory barter y = 0.4275 +inventory barter w = 0.6225 +inventory barter h = 0.5725 + +inventory companion x = 0 +inventory companion y = 0.4275 +inventory companion w = 0.6225 +inventory companion h = 0.5725 + +container x = 0.25 +container y = 0 +container w = 0.75 +container h = 0.375 + +companion x = 0.25 +companion y = 0 +companion w = 0.75 +companion h = 0.375 + +map x = 0.625 +map y = 0 +map w = 0.375 +map h = 0.5725 + +barter x = 0.25 +barter y = 0 +barter w = 0.75 +barter h = 0.375 + +alchemy x = 0.25 +alchemy y = 0.25 +alchemy w = 0.5 +alchemy h = 0.5 + +stats x = 0 +stats y = 0 +stats w = 0.375 +stats h = 0.4275 + +spells x = 0.3775 +spells y = 0.4275 +spells w = 0.375 +spells h = 0.5725 + +console x = 0 +console y = 0 +console w = 1 +console h = 0.5 + +dialogue h = 0.810 +dialogue w = 0.810 +dialogue x = 0.095 +dialogue y = 0.095 diff --git a/files/ui/contentselector.ui b/files/ui/contentselector.ui new file mode 100644 index 000000000..b9b5ba5a0 --- /dev/null +++ b/files/ui/contentselector.ui @@ -0,0 +1,111 @@ + + + ContentSelector + + + + 0 + 0 + 518 + 436 + + + + + 0 + 0 + + + + Qt::DefaultContextMenu + + + + 0 + + + + + Content + + + + 3 + + + + + false + + + + + + + + 0 + 0 + + + + Qt::DefaultContextMenu + + + true + + + QAbstractItemView::NoEditTriggers + + + true + + + false + + + QAbstractItemView::DragDrop + + + Qt::MoveAction + + + true + + + QAbstractItemView::SingleSelection + + + QAbstractItemView::SelectRows + + + Qt::ElideLeft + + + false + + + false + + + true + + + false + + + + + + + + + + + ContentSelectorView::ComboBox + QComboBox +

components/contentselector/view/combobox.hpp
+ + + + + diff --git a/files/ui/datafilespage.ui b/files/ui/datafilespage.ui index 041a9576d..eb5ebc61d 100644 --- a/files/ui/datafilespage.ui +++ b/files/ui/datafilespage.ui @@ -7,108 +7,97 @@ 0 0 518 - 304 + 108 + + + 0 + 0 + + + + Qt::DefaultContextMenu + - - - - - Qt::Horizontal - - - - 40 - 20 - - - - - - - - Filter: - - - - - - - + - - - - 0 - 0 - + + + Qt::NoFocus - - Qt::Horizontal + + Profile - + false - - + + + 6 + + + 3 + + + 6 + + + 0 + + + 6 + + + + + true + + + + 0 + 0 + + + + Select a profiile + + + + + + + New Profile + + + &New Profile + + + true + + + + + + + Delete Profile + + + Delete Profile + + + Ctrl+D + + + true + + + + - - - - - - Current Profile: - - - - - - - true - - - - 0 - 0 - - - - - - - - New Profile - - - &New Profile - - - true - - - - - - - Delete Profile - - - Delete Profile - - - Ctrl+D - - - true - - - - - @@ -127,6 +116,9 @@ + + false + @@ -140,6 +132,9 @@ + + true + Check Selection @@ -151,15 +146,10 @@ - - LineEdit - QLineEdit -
components/fileorderlist/utils/lineedit.hpp
- ProfilesComboBox QComboBox -
components/fileorderlist/utils/profilescombobox.hpp
+
apps/launcher/utils/profilescombobox.hpp
 diff --git a/files/ui/filedialog.ui b/files/ui/filedialog.ui new file mode 100644 index 000000000..b3af166da --- /dev/null +++ b/files/ui/filedialog.ui @@ -0,0 +1,73 @@ + + + FileDialog + + + + 0 + 0 + 518 + 109 + + + + + 0 + 0 + + + + Qt::DefaultContextMenu + + + + + + + + + Qt::NoFocus + + + Project Name + + + false + + + + 6 + + + 3 + + + 6 + + + 0 + + + 6 + + + + + + + + QDialogButtonBox::Cancel|QDialogButtonBox::Ok + + + + + + + + + + + + + + diff --git a/libs/openengine/bullet/BtOgre.cpp b/libs/openengine/bullet/BtOgre.cpp index b0fa07fd6..de9ea6f57 100644 --- a/libs/openengine/bullet/BtOgre.cpp +++ b/libs/openengine/bullet/BtOgre.cpp @@ -819,6 +819,8 @@ namespace BtOgre { */ DynamicRenderable::DynamicRenderable() + : mVertexBufferCapacity(0) + , mIndexBufferCapacity(0) { } diff --git a/libs/openengine/gui/layout.hpp b/libs/openengine/gui/layout.hpp index 9040dfb90..26a3fdab8 100644 --- a/libs/openengine/gui/layout.hpp +++ b/libs/openengine/gui/layout.hpp @@ -150,10 +150,10 @@ namespace GUI MyGUI::IntSize size = button->getTextSize(); button->setSize(size.width + 24, button->getSize().height); } + MyGUI::Widget* mMainWidget; protected: - MyGUI::Widget* mMainWidget; std::string mPrefix; std::string mLayoutName; MyGUI::VectorWidgetPtr mListWindowRoot; diff --git a/libs/openengine/ogre/renderer.cpp b/libs/openengine/ogre/renderer.cpp index 912781240..a0fe6ca84 100644 --- a/libs/openengine/ogre/renderer.cpp +++ b/libs/openengine/ogre/renderer.cpp @@ -1,138 +1,33 @@ #include "renderer.hpp" #include "fader.hpp" -#include "particles.hpp" #include -#include "OgreRoot.h" -#include "OgreRenderWindow.h" -#include "OgreLogManager.h" -#include "OgreLog.h" -#include "OgreTextureManager.h" -#include "OgreTexture.h" -#include "OgreHardwarePixelBuffer.h" -#include -#include "OgreParticleAffectorFactory.h" - -#include - -#include +#include +#include +#include +#include +#include #include #include -#include #include using namespace Ogre; using namespace OEngine::Render; -#if OGRE_PLATFORM == OGRE_PLATFORM_APPLE - -CustomRoot::CustomRoot(const Ogre::String& pluginFileName, - const Ogre::String& configFileName, - const Ogre::String& logFileName) -: Ogre::Root(pluginFileName, configFileName, logFileName) -{} - -bool CustomRoot::isQueuedEnd() const -{ - return mQueuedEnd; -} - -#endif - void OgreRenderer::cleanup() { delete mFader; mFader = NULL; - delete mRoot; - mRoot = NULL; - // If we don't do this, the desktop resolution is not restored on exit SDL_SetWindowFullscreen(mSDLWindow, 0); SDL_DestroyWindow(mSDLWindow); mSDLWindow = NULL; - - unloadPlugins(); -} - -void OgreRenderer::start() -{ -#if OGRE_PLATFORM == OGRE_PLATFORM_APPLE - // we need this custom main loop because otherwise Ogre's Carbon message pump will - // steal input events even from our Cocoa window - // There's no way to disable Ogre's message pump other that comment pump code in Ogre's source - do { - if (!mRoot->renderOneFrame()) { - break; - } - - } while (!mRoot->isQueuedEnd()); -#else - mRoot->startRendering(); -#endif -} - -void OgreRenderer::loadPlugins() -{ - #ifdef ENABLE_PLUGIN_GL - mGLPlugin = new Ogre::GLPlugin(); - mRoot->installPlugin(mGLPlugin); - #endif - #ifdef ENABLE_PLUGIN_Direct3D9 - mD3D9Plugin = new Ogre::D3D9Plugin(); - mRoot->installPlugin(mD3D9Plugin); - #endif - #ifdef ENABLE_PLUGIN_CgProgramManager - mCgPlugin = new Ogre::CgPlugin(); - mRoot->installPlugin(mCgPlugin); - #endif - #ifdef ENABLE_PLUGIN_OctreeSceneManager - mOctreePlugin = new Ogre::OctreePlugin(); - mRoot->installPlugin(mOctreePlugin); - #endif - #ifdef ENABLE_PLUGIN_ParticleFX - mParticleFXPlugin = new Ogre::ParticleFXPlugin(); - mRoot->installPlugin(mParticleFXPlugin); - #endif -} - -void OgreRenderer::unloadPlugins() -{ - std::vector::iterator ei; - for(ei = mEmitterFactories.begin();ei != mEmitterFactories.end();++ei) - OGRE_DELETE (*ei); - mEmitterFactories.clear(); - - std::vector::iterator ai; - for(ai = mAffectorFactories.begin();ai != mAffectorFactories.end();++ai) - OGRE_DELETE (*ai); - mAffectorFactories.clear(); - - #ifdef ENABLE_PLUGIN_GL - delete mGLPlugin; - mGLPlugin = NULL; - #endif - #ifdef ENABLE_PLUGIN_Direct3D9 - delete mD3D9Plugin; - mD3D9Plugin = NULL; - #endif - #ifdef ENABLE_PLUGIN_CgProgramManager - delete mCgPlugin; - mCgPlugin = NULL; - #endif - #ifdef ENABLE_PLUGIN_OctreeSceneManager - delete mOctreePlugin; - mOctreePlugin = NULL; - #endif - #ifdef ENABLE_PLUGIN_ParticleFX - delete mParticleFXPlugin; - mParticleFXPlugin = NULL; - #endif } void OgreRenderer::update(float dt) @@ -152,75 +47,10 @@ float OgreRenderer::getFPS() void OgreRenderer::configure(const std::string &logPath, const std::string& renderSystem, - const std::string& rttMode, - bool _logging) + const std::string& rttMode + ) { - // Set up logging first - new LogManager; - Log *log = LogManager::getSingleton().createLog(logPath + std::string("Ogre.log")); - logging = _logging; - - if(logging) - // Full log detail - log->setLogDetail(LL_BOREME); - else - // Disable logging - log->setDebugOutputEnabled(false); - -#if OGRE_PLATFORM == OGRE_PLATFORM_APPLE - mRoot = new CustomRoot("", "", ""); -#else - mRoot = new Root("", "", ""); -#endif - - #if defined(ENABLE_PLUGIN_GL) || defined(ENABLE_PLUGIN_Direct3D9) || defined(ENABLE_PLUGIN_CgProgramManager) || defined(ENABLE_PLUGIN_OctreeSceneManager) || defined(ENABLE_PLUGIN_ParticleFX) - loadPlugins(); - #endif - - std::string pluginDir; - const char* pluginEnv = getenv("OPENMW_OGRE_PLUGIN_DIR"); - if (pluginEnv) - pluginDir = pluginEnv; - else - { -#if OGRE_PLATFORM == OGRE_PLATFORM_WIN32 - pluginDir = ".\\"; -#endif -#if OGRE_PLATFORM == OGRE_PLATFORM_APPLE - pluginDir = OGRE_PLUGIN_DIR; -#endif -#if OGRE_PLATFORM == OGRE_PLATFORM_LINUX - pluginDir = OGRE_PLUGIN_DIR_REL; -#endif - } - - boost::filesystem::path absPluginPath = boost::filesystem::absolute(boost::filesystem::path(pluginDir)); - - pluginDir = absPluginPath.string(); - - Files::loadOgrePlugin(pluginDir, "RenderSystem_GL", *mRoot); - Files::loadOgrePlugin(pluginDir, "RenderSystem_GLES2", *mRoot); - Files::loadOgrePlugin(pluginDir, "RenderSystem_GL3Plus", *mRoot); - Files::loadOgrePlugin(pluginDir, "RenderSystem_Direct3D9", *mRoot); - Files::loadOgrePlugin(pluginDir, "Plugin_CgProgramManager", *mRoot); - Files::loadOgrePlugin(pluginDir, "Plugin_ParticleFX", *mRoot); - - - Ogre::ParticleEmitterFactory *emitter; - emitter = OGRE_NEW NifEmitterFactory(); - Ogre::ParticleSystemManager::getSingleton().addEmitterFactory(emitter); - mEmitterFactories.push_back(emitter); - - - Ogre::ParticleAffectorFactory *affector; - affector = OGRE_NEW GrowFadeAffectorFactory(); - Ogre::ParticleSystemManager::getSingleton().addAffectorFactory(affector); - mAffectorFactories.push_back(affector); - - affector = OGRE_NEW GravityAffectorFactory(); - Ogre::ParticleSystemManager::getSingleton().addAffectorFactory(affector); - mAffectorFactories.push_back(affector); - + mRoot = mOgreInit.init(logPath + "/ogre.log"); RenderSystem* rs = mRoot->getRenderSystemByName(renderSystem); if (rs == 0) diff --git a/libs/openengine/ogre/renderer.hpp b/libs/openengine/ogre/renderer.hpp index 89edc567d..e4af0bf77 100644 --- a/libs/openengine/ogre/renderer.hpp +++ b/libs/openengine/ogre/renderer.hpp @@ -7,38 +7,17 @@ #include -// Static plugin headers -#ifdef ENABLE_PLUGIN_CgProgramManager -# include "OgreCgPlugin.h" -#endif -#ifdef ENABLE_PLUGIN_OctreeSceneManager -# include "OgreOctreePlugin.h" -#endif -#ifdef ENABLE_PLUGIN_ParticleFX -# include "OgreParticleFXPlugin.h" -#endif -#ifdef ENABLE_PLUGIN_GL -# include "OgreGLPlugin.h" -#endif -#ifdef ENABLE_PLUGIN_Direct3D9 -# include "OgreD3D9Plugin.h" -#endif +#include -#include "OgreTexture.h" -#include +#include -#if OGRE_PLATFORM == OGRE_PLATFORM_APPLE -#include -#endif struct SDL_Window; struct SDL_Surface; namespace Ogre { -#if OGRE_PLATFORM != OGRE_PLATFORM_APPLE class Root; -#endif class RenderWindow; class SceneManager; class Camera; @@ -61,17 +40,6 @@ namespace OEngine std::string icon; }; -#if OGRE_PLATFORM == OGRE_PLATFORM_APPLE - class CustomRoot : public Ogre::Root { - public: - bool isQueuedEnd() const; - - CustomRoot(const Ogre::String& pluginFileName = "plugins.cfg", - const Ogre::String& configFileName = "ogre.cfg", - const Ogre::String& logFileName = "Ogre.log"); - }; -#endif - class Fader; class WindowSizeListener @@ -82,35 +50,16 @@ namespace OEngine class OgreRenderer { -#if OGRE_PLATFORM == OGRE_PLATFORM_APPLE - CustomRoot *mRoot; -#else Ogre::Root *mRoot; -#endif Ogre::RenderWindow *mWindow; SDL_Window *mSDLWindow; Ogre::SceneManager *mScene; Ogre::Camera *mCamera; Ogre::Viewport *mView; - #ifdef ENABLE_PLUGIN_CgProgramManager - Ogre::CgPlugin* mCgPlugin; - #endif - #ifdef ENABLE_PLUGIN_OctreeSceneManager - Ogre::OctreePlugin* mOctreePlugin; - #endif - #ifdef ENABLE_PLUGIN_ParticleFX - Ogre::ParticleFXPlugin* mParticleFXPlugin; - #endif - #ifdef ENABLE_PLUGIN_GL - Ogre::GLPlugin* mGLPlugin; - #endif - #ifdef ENABLE_PLUGIN_Direct3D9 - Ogre::D3D9Plugin* mD3D9Plugin; - #endif + + OgreInit::OgreInit mOgreInit; + Fader* mFader; - std::vector mEmitterFactories; - std::vector mAffectorFactories; - bool logging; WindowSizeListener* mWindowListener; @@ -123,23 +72,7 @@ namespace OEngine , mCamera(NULL) , mView(NULL) , mWindowListener(NULL) - #ifdef ENABLE_PLUGIN_CgProgramManager - , mCgPlugin(NULL) - #endif - #ifdef ENABLE_PLUGIN_OctreeSceneManager - , mOctreePlugin(NULL) - #endif - #ifdef ENABLE_PLUGIN_ParticleFX - , mParticleFXPlugin(NULL) - #endif - #ifdef ENABLE_PLUGIN_GL - , mGLPlugin(NULL) - #endif - #ifdef ENABLE_PLUGIN_Direct3D9 - , mD3D9Plugin(NULL) - #endif , mFader(NULL) - , logging(false) { } @@ -150,8 +83,7 @@ namespace OEngine void configure( const std::string &logPath, // Path to directory where to store log files const std::string &renderSystem, - const std::string &rttMode, - bool _logging); // Enable or disable logging + const std::string &rttMode); // Enable or disable logging /// Create a window with the given title void createWindow(const std::string &title, const WindowSettings& settings); @@ -167,13 +99,6 @@ namespace OEngine /// Kill the renderer. void cleanup(); - /// Start the main rendering loop - void start(); - - void loadPlugins(); - - void unloadPlugins(); - void update(float dt); /// Write a screenshot to file diff --git a/manual/opencs/.gitignore b/manual/opencs/.gitignore new file mode 100644 index 000000000..ce5852a37 --- /dev/null +++ b/manual/opencs/.gitignore @@ -0,0 +1,6 @@ +*.backup +*.aux +*.log +*.toc +*.pdf +*.out diff --git a/manual/opencs/creating_file.tex b/manual/opencs/creating_file.tex new file mode 100644 index 000000000..2c1377ec1 --- /dev/null +++ b/manual/opencs/creating_file.tex @@ -0,0 +1,25 @@ +\section{OpenCS starting dialog} +\subsection{Introduction} +The great day has come. Today, you shall open \OCS{} application. And when you do this, you shall see our starting dialog window that holds three buttons +that can bring both pain and happiness. So just do this, please. + +\subsection{Basics} +Back to the manual? Great! As you can see, the starting window holds just three buttons. Since you are already familiar with our files system, they come +to you with no surprise.\\ + +First, there is a \textbf{Create A New Game} button. Clearly, you should press it when you want to create a game file. Than, what \textbf{Create A New Addon} button do? +Yes! You are right! This button will create any addon content file (and new project file associated with it)! Wonderful! And what the last remaining button do? \textbf{Edit A Content File}? Well, it comes with no surprise that this should be used when you need to alter existing content file, either a game or addon.\\ + +\paragraph{Selecting Files For New Addon} +As We wrote earlier, both \OMW{} and \OCS{} are operating with dependency idea in mind. As You remember you should only depend on files you are actually using. But how?\\ +It is simple. When you click either \textbf{Create new Addon} you will be asked to choose those with a new dialog window. The window is using vertical layout, first you should consider the the top element, the one that allows you to select a game file with drop down menu. Since we are operating on the assumption that there is only one game file loaded at the time, you can depend only on one game file. Next, choose addons that you want to use in your addon with checkboxes.\\ + +The last thing to do is to name your your addon and click create. + +\paragraph{Selecting File for Editing} +Clicking \textbf{Edit A Content File} will show somewhat similar window. Here you should select your Game file with drop down menu. If you want to edit this game file, simply click \textbf{OK} button. If you want to alter addon depending on that file, mark it with checkbox and than click \textbf{Ok} button. + +\subsection{Advanced} +If you are paying attention, you noticed any extra icon with wrench. This one will open small settings window. Those are general OpenCS settings. We will cover this is separate section.\\ + +And that would be it. There is no point spending more time here. We should go forward now. \ No newline at end of file diff --git a/manual/opencs/files_and_directories.tex b/manual/opencs/files_and_directories.tex new file mode 100644 index 000000000..b483dac5a --- /dev/null +++ b/manual/opencs/files_and_directories.tex @@ -0,0 +1,120 @@ +\section{Files and Directories} +\subsection{Introduction} +This section of the manual covers usage of files and directories by the OpenCS. Files and directories are file system concepts, +and you are probably already familiar with it. We won't try to explain this concepts, we will just focus on \OCS. + +\subsection{Used terms} %TODO + +\subsection{Basics} + +\paragraph{Directories} +OpenMW and \OCS{} uses multiple directories on file systems. First of, there is a \textbf{user directory} that holds configuration +files and few different folders. The location of the user directory is hard coded for each supported operating system. + +%TODO list paths. +In addition to this single hard coded directory, both \OMW{} and \OCS{} need a~place to seek for actual data files of the game: +textures, models, sounds and files that store records of objects in game; dialogues and so one -- so called content files. We support +multiple such paths (we call it \textbf{data paths}) as specified in the configuration. Usually one data path points to the directory +where original \MW{} is either installed or unpacked. You are free to specify as many data paths as you would like, +however, there is one special data path that, as described later, is used to store newly created content files. + +\paragraph{Content files} +\BS{} \MW{} engine is using two types of files: ESM (master) and ESP (plugin). The distinction between those +is not clear, and often confusing. You would expect the ESM (master) file is used to specify one master, that is modified by the ESPs plugins, +and indeed: this is the basic idea. However, original expansions also were made as ESM files, even though they essentially could be +described as a really large plugins, and therefore rather use ESP files. There were technical reasons behind this decision -- somewhat valid +in the case of original engine, but clearly it's better to create a system that can be used is more sensible way. \OMW{} achieves +this with our own content file types. + +We support both ESM and ESP files, but in order to make use of new features of OpenMW one should consider using new file types designed +with our engine in mind: game files and addon files together called ``content files``. + +\subparagraph{OpenMW content files} +Game and Addon files are concept somewhat similar to the old ESM/ESP, only in the way it should be from the very beginning. Nothing easier +to describe. If you want to make new game using \OMW{} as engine (so called ``total conversion'') you should create a game file. +If you want to create a addon for existing game file -- simply create addon file. Nothing else matters: The only distinction you should +consider is if your project is about changing other game, or creating a new one. Simple as that. + +Other simple thing about content files are extensions. We are using .omwaddon for addon files and .omwgame for game files. + +%TODO describe what content files contains. and what not. +\subparagraph{\MW{} content files} +Using our content files is recommended solution for projects that are intended to used with \OMW{} engine. However some players +wish to use original \MW{} engine, even with it large flaws and lacking features\footnote{If this is actually wrong, we are very +successful project. Yay!}. Also, since 2002 thousands of ESP/ESM files were created, some with really outstanding content. +Because of this \OCS{} simply has no other choice but support ESP/ESM files. However, if you decided to choose ESP/ESM file instead +using our own content file types you are most likely aim at the original engine compatibility. This subject is covered in the very +last section of this manual. %not finished TODO add the said section. Most likely when more features are present. + +The actual creation of new files is described in the next chapter. Here we are gonna focus only on details that you need to know +in order to create your first \OCS{} file while full understanding your needs. For now let's jut remember that content files +are created inside the user directory, in the the \textbf{data} subfolder (that is the one special data directory mentioned earlier). + +\subparagraph{Dependencies} +Since addon is supposed to change the game it is logical that it also depends on the said game. It simply can not work otherwise. +Just think about it: your modification is changing prize of the iron sword. But what if there is no iron sword in game? That is right: +we get nonsense. What you want to do is to tie your addon to the files you are changing. Those can be either game files (expansion island +for a game) or other addon files (house on the said island). It is a good idea to be dependent only on files that are really changed +in your addon obviously, but sadly there is no other way to achieve this than knowing what you want to do. Again, please remember that +this section of the manual does not cover creating the content files -- it is only theoretical introduction to the subject. For now just +keep in mind that dependencies exist, and is up to you what to decide if your content file should depend on other content file. + +Game files are not intend to have any dependencies for a very simple reasons: player is using only one game file (excluding original +and dirty {ESP/ESM} system) at the time and therefore no game file can depend on other game file, and since game file makes the base +for addon files -- it can not depend on addon files. + +%\subparagraph{Loading order} %TODO +\paragraph{Project files} +Project files act as containers for data not used by the \OMW{} game engine itself, but still useful for OpenCS. The shining example +of this data category are without doubt record filters (described in the later section of the manual you are reading currently). +As a mod author you probably do not need and/or want to distribute project files at all, they are meant to be used only by you. + +As you would imagine, project file makes sense only in combination with actual content files. In fact, each time you start to work +on new content file and project file was not found, it will be created. +Project files extension is, to not surprise ``.project''. The whole name of the project file is the whole name of the content file +with appended extensions. For instance swords.omwaddon file is associated with swords.omwaddon.project file. + +%TODO where are they stored. +Project files are stored inside the user directory, in the \textbf{projects} subfolder. This is the path location for both freshly +created project files, and a place where \OCS{} looks for already existing files. + +\paragraph{Resources files} +%textures, sounds, whatever +Unless we are talking about the fully text based game, like Zork or Rogue, you are expecting that a video game is using some media files: +models with textures, pictures acting as icons, sounds and everything else. Since content files, no matter if it is ESP, ESM or new \OMW{} +file type do not contain any of those, it is clear that they have to be deliver with a different file. It is also clear that this, +let's call it ``resources file``, have to be supported by the engine. Without code handling those files, it is nothing more than +a mathematical abstraction -- something, that lacks meaning for human beings\footnote{Unless we call programmers a human beings.}. +Therefore this section must cover ways to add resources files to your content file, and point out what is supported. We are going +to do just that. Later, you will learn how to make use of those files in your content. + +\subparagraph{Audio} +OpenMW is using {FFmpeg} for audio playback, and so we support every audio type that is supported by this library. This makes a huge list. +Below is only small portion of supported file types. + +\begin{description} + \item mp3 ({MPEG}-1 {Part 3 Layer 3}) popular audio file format and \textit{de facto} standard for storing audio. Used by the \MW{} game. + \item ogg open source, multimedia container file using high quality vorbis audio codec. Recommended. +\end{description} + +\subparagraph{Video} +As in the case of audio files, we are using {FFmepg} to decode video files. The list of supported files is long, we will cover +only the most significant. + +\begin{description} + \item bik videos used by original \MW{} game. + \item mp4 multimedia container which use more advanced codecs ({MPEG-4 Parts 2,3,10}) with a better audio and video compression rate, + but also requiring more {CPU} intensive decoding -- this makes it probably less suited for storing sounds in computer games, but good for videos. + \item webm is a new, shiny and open source video format with excellent compression. It needs quite a lot of processing power to be decoded, + but since game logic is not running during cut scenes we can recommend it for use with \OMW. + \item ogv alternative, open source container using theora codec for video and vorbis for audio. +\end{description} + +\subparagraph{Textures and images} +Original \MW{} game uses {DDS} and {TGA} files for all kind of two dimensional images and textures alike. In addition, engine supported BMP +files for some reason ({BMP} is a terrible format for a video game). We also support extended set of image files -- including {JPEG} and {PNG}. +JPEG and PNG files can be useful in some cases, for instance JPEG file is a valid option for skybox texture and PNG can useful for masks. +However please, keep in mind that JPEG can grow into large sizes quickly and are not the best option with {DirectX} rendering backend. You probabbly still want +to use {DDS} files for textures. + +%\subparagraph{Meshes} %TODO once we will support something more than just nifs \ No newline at end of file diff --git a/manual/opencs/filters.tex b/manual/opencs/filters.tex new file mode 100644 index 000000000..36d97e0f5 --- /dev/null +++ b/manual/opencs/filters.tex @@ -0,0 +1,205 @@ +\section{Record filters} +\subsection{Introduction} +Filters are the key element of \OCS{} use cases by allowing rapid and easy access to the searched records presented in all tables. +Therefore: in order to use this application fully effective you should make sure that all concepts and instructions written in +the this section of the manual are perfectly clear to you. + +Do not be afraid though, filters are fairly intuitive and easy to use. + +\subsubsection{Used Terms} + +\begin{description} + \item[Filter] is generally speaking a tool able to ``Filter'' (that is: select some elements, while discarding others) according + to the some criteria. In case of \OCS: records are being filtered according to the criteria of user choice. Criteria are written + down in language with simple syntax. + \item[Criteria] describes condition under with any any record is being select by the filter. + \item[Syntax] as you may noticed computers (in general) are rather strict, and expect only strictly formulated orders -- that is: + written with correct syntax. + \item[Expression] is way we are actually performing filtering. Filter can be treated as ``functions'': accepts arguments, and evaluates + either to the true or false for every column record at the time. + \item[N-ary] is any expression that expects one or more expressions as arguments. It is useful for grouping two (or more) other expressions + together in order to create filter that will check for criteria placed in two (again: or more) columns (logical \textit{or}, \textit{and}). + \item[unary] is any expression that expects one other expression. The example is \textit{not} expression. In fact \textit{not} is the only useful + unary expression in \OCS{} record filters. + \item[nullary] is expression that does not accepts other expressions. It accepts arguments specified later. +\end{description} + +\subsubsection{Basics} +In fact you do not need to learn everything about filters in order to use them. In fact all you need to know to achieve decent productivity +with \OCS{} is inside basics section. + +\subsubsection{Interface} +Above each table there is a field that is used to enter filter: either predefined by the \OMW{} developers or made by you, the user. +You probably noticed it before. However there is also completely new element, although using familiar table layout. Go to the application +menu view, and click filters. You should see set of default filters, made by the \OMW{} team in the table with the following columns: filter, +description and modified. + +\begin{description} + \item[ID] contains the name of the filter. + \item[Modified] just like in all other tables you have seen so far modified indicates if a filter was added, modified or removed. + \item[Filter] column containing expression of the filter. + \item[Description] contains the short description of the filter function. Do not expect any surprises there. +\end{description} + +So let's learn how to actually use those to speed up your work. +\subsubsection{Using predefined filters} +Using those filters is quite easy and involves typing inside the filter field above the table. For instance, try to open referencables +table and type in the filters field the following: \mono{project::weapons}. As soon as you complete the text, table will magicly alter +and will show only the weapons. As you could noticed \mono{project::weapons} is nothing else than a~ID of one of the predefined filters. That is it: +in order to use the filter inside the table you simply type it is name inside the filter field. + +To make life easier filter IDs follow simple convention. + +\begin{itemize} + \item Filter ID filtering a specific record type contains usually the name of a specific group. For instance \mono{project::weapons} filter + contains the word weapons (did you noticed?). Plural form is always used. + \item When filtering specific subgroup the ID starts just like in the case of general filter. For instance \mono{project::weaponssilver} will + filter only silver weapons (new mechanic introduced by the \BM{}, silver weapons deal double damage against werewolfs) and + \mono{project::weaponsmagical} will filter only magical weapons (able to hurt ghosts and other supernatural creatures). + \item There are few exceptions from the above rule. For instance there is a \mono{project::added}, \mono{project::removed}, + \mono{project::modyfied}, \mono{project::base}. + You would probably except something more like \mono{project::statusadded} but in this case typing this few extra characters would only + help to break your keyboard faster. +\end{itemize} + +We strongly recommend to take a look at the filters table right now to see what you can filter with that. And try using it! It is very simple. + +\subsection{Advanced} +Back to the manual? Great. + +If you want to create your own filter you have to know exactly what do you want to get in order to translate this into the expressions. +Finally, you will have to write this with correct syntax. As a result table will show only desired rows. + +Advance subsection covers everything that you need to know in order to create any filter you may want to %TODO the filter part is actually wrong +\subsubsection{Namespaces} +Did you noticed that every default filter has \mono{project::} prefix? It is a \textit{namespace}, a~term borrowed from the \CPP{} language. +In case of \OCS{} namespace always means scope of the said object\footnote{You are not supposed to understand this at the moment.}. +But what does it mean in case of filters? Well, short explanation is actually simple. +\begin{description} + \item[project::] namespace indicates that filter is used with the project, in multiple sessions. You can restart \OCS{} and filter + is still there. + \item[session::] namespace indicates that filter is not stored trough multiple sessions and once you will quit \OCS{} (close session) + the filter will be gone. Forever! Until then it can be found inside the filters table. +\end{description} +In addition to this two scopes, there is a third one; called one-shot. One-shot filters are not stored (even during single session) +anywhere and as the name implies they are supposed to be created when needed only once. Good thing about the one-shot filters is that +you do not need to open filters table in order to create it. Instead you just type it directly inside the filter field, starting with +exclamation mark: ``!''. + +Still, you may wonder how you are supposed to write expressions, what expressions you should use, and what syntax looks like. Let's start +with nullary expressions that will allow you to create a basic filter. + +\subsubsection{Nullary expressions} +All nullary expressions are used in similar manner. First off: you have to write it is name (for instance: \mono{string}) and secondly: +condition that will be checked inside brackets (for instance \mono{string(something, something)}). If conditions of your expression will be meet +by a record (technical speaking: expression will evaluate to true) the record will show up in the table. + +It is clear that you need to know what are you checking, that is: what column of the table contains information that you are interested +in and what should be inside specific cell inside this column to meet your requirements. In most cases first word inside brackets sets column +you want to see, while the second one sets desired value inside of the cell. To separate column argument from the value argument use comma. + +\paragraph{String -- string(``column'', ``value'')} +String in programmers language is often\footnote{Often, not always. There are different programming languages using slightly different terms.} +just a word for anything composed of characters. In case of \OCS{} this is in fact true for every value inside the column that is not composed +of the pure numbers. Even columns containing only ``true`` and ``false`` values can be targeted by the string expression\footnote{There is no +Boolean (``true'' or ``false'') value in the \OCS. You should use string for those.}. String evaluates to true, +when record contains in the specified column exactly the same value as specified. + +Since majority of the columns contain string values, string is among the most often used expressions. Examples: +\begin{itemize} + \item \mono{string(``Record Type'', ``Weapon'')} -- will evaluate to true for all records containing \mono{Weapon} in the \mono{Record Type} column cell. + This group contains every weapon (including arrows and bolts) found in the game. + \item \mono{string(``Portable'', ``true'')} -- will evaluate to true for all records containing word true inside \mono{Portable} column cell. + This group contains every portable light sources (lanterns, torches etc.). +\end{itemize} +This is probably enough to create around 90 string filters you will eventually need. However, this expression is even more powerful +-- it accepts regular expressions (also called regexps). Regular expressions is a way to create string criteria that will be matched +by one than just one specific value in the column. For instance, you can display both left and right gauntlets with the following expression: +\mono{string("armor type", ".* gauntlet"))} because \mono{.*} in regexps means just: ``anything''. This filter says: please, show me ``any'' gauntlet. +There are left and right gauntlets in the morrowind so this will evaluate to true for both. Simple, isn't it? + +Creating regexps can be a difficult and annoying -- especially when you need complex criteria. On the other hand, we are under impression +that in reality complex expressions are needed only in sporadic cases. In fact, the truth is: that most of the time only already mentioned +\mono{.*} is needed and therefore the following description of regexps can be skipped by vast majority of readers. + +Before working with Regular Expressions, you should understand what actually are regular expressions. Essentially, the idea is simple: +when you are writing any word, you are using strictly defined letters -- that is: letters create a word. What you want to do with regular +expression is to use set of rules that will match to many words. It is not that difficult to see what it's needed to do so: first, +you will clearly need way to determinate what letters you want to match (word is composed by letters). + +Before introducing other ways to choose between characters, I want explain anchors. Anchors allows you to decide where to ``look'' in the string. +You surely should know about \mono{\textasciicircum} anchor and \mono{\textdollar}. Putting \mono{\textasciicircum} will tell to \OCS{} +to look on the beginning of string, while \mono{\textdollar} is used to mark the end of it. For instance, pattern +\mono{\textasciicircum{}Pink.* elephant.\textdollar} will match any sentence beginning with the word \mono{Pink} and ending with +\mono{ elephant.}. Pink fat elephant. Pink cute elephant. It does not matter what is in between, because \mono{.*} is used. + +You have already seen the power of the simple \mono{.*}. But what if you want to chose between only two (or more) letters? Well, this is when +\mono{[|]} comes in handy. If you write something like: \mono{\textasciicircum[a|k].*} you are simply telling \OCS{} to filter anything that +starts with either \mono{a} or \mono{k}. Using \mono{\textasciicircum[a|k|l].*} will work in the same manner, but it will also cover +strings starting with \mono{l}. + +What if you want to match more than just one latter? Just use \mono{(|)}. it is pretty similar to the above one letter as you see, but it is +used to fit more than just one character. For instance: \mono{\textasciicircum(Pink|Green).* (elephant|crocodile).\textdollar} will be +true for all sentences starting with \mono{Pink} or \mono{Green} and ending with either \mono{elephant.} or \mono{crocodile.}. + +Regular expressions are not the main topic of this manual. If you wish to learn more on this subject please, read the documentation on +Qt regular expressions syntax, or TRE regexp syntax (it is almost like in Qt). Above is just enough to use \OCS{} effectively to be sure. + +\paragraph{Value -- value(``value'', (``open'', ``close''))} +While string expression covers vast group of columns containing string values, there are in fact columns with just numerical values like +``weight``. To filter those we need a value expression. This one works in similar manner to the string filter: first token name and criteria +inside brackets. Clearly, conditions should hold column to test in. However in this case wanted value is specified as a range. +As you would imagine the range can be specified as including a border value, or excluding. We are using two types of brackets for this: +\begin{itemize} + \item To include value use [] brackets. For value equal 5, expression \mono{value(something, [5, 10])} will evaluate to true. + \item To exclude value use () brackets. For value equal 5, expression \mono{value(something, (5, 10))} will evaluate to false. + \item Mixing brackets is completely legal. For value equal 10, expression \mono{value(something, [5, 10)} will evaluate to true. + The same expression will evaluate to false for value equal 10. +\end{itemize} + +\paragraph{``true'' and ``false''} +Nullary \textit{true} and \textit{false} do not accept any arguments, and always evaluates to true (in case of \textit{true}) +and false (in case of \textit{false}) no matter what. The main usage of this expressions is the give users ability to quickly +disable some part of the filter that makes heavy use of the logical expressions. + +\subsubsection{Logical expressions} +This subsection takes care of two remaining groups of expressions: binary and unary. The only unary expression present in the \OCS{} is logical +\textit{not}, while the remaining binary expressions are: \textit{or}, \textit{and}. This clearly makes them (from the user point of view) +belonging to the same group of logical expressions. + +\paragraph{not -- not expression()} +Sometimes you may be in need of reversing the output of the expression. This is where \textit{not} comes in handy. Adding \textit{not} before +expression will revert it: if expression was returning true, it will return false; if it was returning false, it will return true. Brackets +are not needed: \textit{not} will revert only the first expression following it. + +To show this on know example, let's consider the \mono{string("armor type", ".* gauntlet"))} filter. As we mentioned earlier this will return true +for every gauntlet found in game. In order to show everything, but gauntlets we simply do \mono{not string("armor type", ".* gauntlet"))}. +This is probably not the most useful filter on earth, but this is not a surprise: real value of \textit{not} expression shines when combined with +\textit{or}, \textit{and} filters. + +\paragraph{or -- or(expression1(), expression2())} +\textit{Or} is a expression that will return true if one of the arguments evaluates to true. You can use two or more arguments, separated by the comma. + +\textit{Or} expression is useful when showing two different group of records is needed. For instance the standard actor filter is using the following +\mono{or(string(``record type'', npc), string(``record type'', creature))} and will show both npcs and creatures. + +\paragraph{and -- and(expression1(), expression2())} +\textit{And} is a expression that will return true if all arguments evaluates to true. As in the case of ``or'' you can use two or more arguments, +separated by a comma. +As we mentioned earlier in the \textit{not} filter, combining \textit{not} with \textit{and} can be very useful. For instance to show all armor types, +excluding gauntlets you can write the following: \mono{and (not string(``armor type'', ``.* gauntlet''), string(``Record Type'', ``Armor''))}. + +\subsubsection{Creating and saving filter} +In order to create and save new filter, you should go to the filters table, right click and select option ``add record'' from the context menu. +A horizontal widget group at the bottom of the table should show up. From there you should select a namespace responsible for scope of +the filter (described earlier) and desired ID of the filter. After pressing OK button new entry will show up in the filters table. This filter +does nothing at the moment, since it still lacks expressions. In order to add your formula simply double click the filter cell of the new entry +and write it down there. +Done! You are free to use your filter. + +\subsubsection{Replacing the default filters set} +OpenCS allows you to substitute default filters set provided by us, with your own filters. In order to do so you should create a new project, +add desired filters, remove undesired and save. Rename the file to the ``defaultfilters'' (do not forget to remove .omwaddon.project extension) +and place it inside your configuration directory. + +The file acts as template for all new project files from now. If you wish to go back to the old default set, simply rename or remove the custom file. diff --git a/manual/opencs/img/water.png b/manual/opencs/img/water.png new file mode 100644 index 000000000..885c2d9a7 Binary files /dev/null and b/manual/opencs/img/water.png differ diff --git a/manual/opencs/main.tex b/manual/opencs/main.tex new file mode 100644 index 000000000..1d8aebe40 --- /dev/null +++ b/manual/opencs/main.tex @@ -0,0 +1,34 @@ +\documentclass[american]{article} +\usepackage[T1]{fontenc} +\usepackage{babel} +\usepackage{txfonts} % Public Times New Roman text & math font +\usepackage[pdftex]{graphicx} +\usepackage[final,colorlinks,pdftex,pdfpagelabels=true]{hyperref} +\author{OpenMW Team} + +\def\pdfBorderAttrs{/Border [0 0 0] } % No border arround Links + +\def\CPP{{C\kern-.05em\raise.23ex\hbox{+\kern-.05em+}}} +\hypersetup{% + pdfauthor={Copyright \textcopyright{} OpenMW Team }, + pdftitle={OpenCS user manual} +} +\def\mono{\texttt} +\def\MW{\textit{Morrowind\texttrademark{}}} +\def\TB{\textit{Tribunal}} +\def\BM{\textit{Bloodmon}} +\def\BS{Bethesda Softworks} +\def\OMW{\hbox{OpenMW}} +\def\OCS{\hbox{OpenCS}} + +\begin{document} + +\title{OpenCS User Manual} +\maketitle +\tableofcontents{} +\input{files_and_directories} +\input{creating_file} +\input{windows} +\input{tables} +\input{filters} +\end{document} diff --git a/manual/opencs/tables.tex b/manual/opencs/tables.tex new file mode 100644 index 000000000..e7cc06735 --- /dev/null +++ b/manual/opencs/tables.tex @@ -0,0 +1,103 @@ +\section{Tables} + +\subsection{Introduction} +If you have launched \OCS{} already and played around with it for a bit, you have probably gotten the impression that it contains lots of tables. +You'd be spot on: \OCS{} is built around using tables. This does not mean it works just like Microsoft Excel or Libre Office Calc, though. +Due to the vast amounts of information involved with \MW, tables just made the most sense. You have to be able to spot information quickly +and be able to change them on the fly. +Let's browse through the various screens and see what all these tables show. + +\subsection{Used Terms} + +\subsubsection{Glossary} + +\begin{description} + \item[Record:] An entry in \OCS{} representing an item, location, sound, NPC or anything else. + + \item[Reference, Referenceable:] When an item is placed in the world, it does not create a new record each time. For example, the game world might + contain a lot of exquisite belts on different NPCs and in many crates, but they all refer to one specific record: the Exquisite Belt record. + In this case, all those belts in crates and on NPCs are references. The central Exquisite Belt record is called a referenceable. This allows modders + to make changes to all items of the same type. For example, if you want all exquisite belts to have 4000 enchantment points rather than 400, you will + only need to change the referenceable Exquisite Belt rather than all exquisite belts references individually. +\end{description} + +\subsubsection{Recurring Terms} +Some columns are recurring throughout \OCS. They show up in (nearly) every table in \OCS. + +\begin{description} +\item[ID] Each item, location, sound, etc. gets the same unique identifier in both \OCS{} and \MW. This is usually a very self-explanatory name. +For example, the ID for the (unique) black pants of Caius Cosades is ``Caius\_pants''. This allows you to manipulate the game in many ways. For example, +you could add these pants to your inventory by simply opening the console and write: ``player->addItem Caius\_pants''. Either way, in both Morrowind +and \OCS, the ID is the primary way to identify all these different parts of the game. %Wrong! Cells do not have ID, only name. +\item[Modified] This column shows what has happened (if something has happened) to this record. There are four possible states in which it can exist. +\item[Base] means that this record is part of the base game and is in its original state. Usually, if you create a mod, the base game is Morrowind with +optionally the Bloodmoon and Tribunal expansions. +\item[Added] means that this record was not in the base game and has been added by a~modder. +\item[Modified] means that the record is part of the base game, but has been changed in some way. +\item[Deleted] means that this record used to be part of the base game, but has been removed as an entry. This does not mean, however, that the occurrences +in the game itself have been removed! For example, if you remove the CharGen\_Bed entry from morrowind.esm, it does not mean the bedroll in the basement +of the Census and Excise Office in Seyda Neen is gone. You're going to have to delete that reference yourself or make sure that that object is replaced +by something that still exists otherwise you will get crashes in the worst case scenario. +\end{description} + +\subsection{World Screens} +The contents of the game world can be changed by choosing one of the options in the appropriate menu at the top of the screen. + +\subsubsection{Regions} +This describes the general areas of Vvardenfell. Each of these areas has different rules about things such as encounters and weather. + +\begin{description} + \item[Name:] This is how the game will show your location in-game. + \item[Map Colour:] This is a six-digit hexidecimal representation of the colour used to identify the region on the map available in + World > Region Map. If you do not have an application with a colour picker, you can use your favourite search engine to find a colour picker online. + \item[Sleep Encounter:] These are the rules for what kind of enemies you might encounter when you sleep outside in the wild. +\end{description} + +\subsubsection{Cells} +Expansive worlds such as Vvardenfell, with all its items, NPCs, etc. have a lot going on simultaneously. But if you are in Balmora, +why would the computer need to keep track the exact locations of NPCs walking through the corridors in a Vivec canton? All that work would +be quite useless and bring your system to its knees! So the world has been divided up into squares we call "cells". Once your character enters a cell, +the game will load everything that is going on in that cell so you can interact with it. + +In the original \MW{} this could be seen when you were travelling and you would see a small loading bar at the bottom of the screen; +you had just entered a new cell and the game would have to load all the items and NPCs. The Cells screen in \OCS{} provides you with a list of cells +in the game, both the interior cells (houses, dungeons, mines, etc.) and the exterior cells (the outside world). + +\begin{description} + \item[Sleep Forbidden:] Can the player sleep on the floor? In most cities it is forbidden to sleep outside. Sleeping in the wild carries its + own risks of attack, though, and this entry lets you decide if a player should be allowed to sleep on the floor in this cell or not. + + \item[Interior Water:] Should water be rendered in this interior cell? The game world consists of an endless ocean at height 0. Then the landscape + is added. If part of the landscape goes below height 0, the player will see water. (See illustration.) + + Setting the cell's Interior Water to true tells the game that this cell is both an interior cell (inside a building, for example, rather than + in the open air) but that there still needs to be water at height 0. This is useful for dungeons or mines that have water in them. + + Setting the cell's Interior Water to false tells the game that the water at height 0 should not be used. Remember that cells that are in + the outside world are exterior cells and should thus \textit{always} be set to false! + + \item[Interior Sky:] Should this interior cell have a sky? This is a rather unique case. The \TB{} expansion took place in a city on + the mainland. Normally this would require the city to be composed of exterior cells so it has a sky, weather and the like. But if the player is + in an exterior cell and looks at his in-game map, he sees Vvardenfell with an overview of all exterior cells. The player would have to see + the city's very own map, as if he was walking around in an interior cell. + + So the developers decided to create a workaround and take a bit of both: The whole city would technically work exactly like an interior cell, + but it would need a sky as if it was an exterior cell. That is what this is. This is why the vast majority of the cells you will find in this screen + will have this option set to false: It is only meant for these "fake exteriors". + + \item[Region:] To which Region does this cell belong? This has an impact on the way the game handles weather and encounters in this area. + It is also possible for a cell not to belong to any region. + +\end{description} + +\subsubsection{Referenceables} +This is a library of all the items, triggers, containers, NPCs, etc. in the game. There are several kinds of Record Types. Depending on which type +a record is, it will need specific information to function. For example, an NPC needs a value attached to its aggression level. A chest, of course, +does not. All Record Types contain at least a~model. How else would the player see them? Usually they also have a Name, which is what you see +when you hover your reticle over the object. + +Let's go through all Record Types and discuss what you can tell \OCS{} about them. + +\begin{description} + \item[Activator:] This is an item that, when activated, starts a script or even just shows a~tooltip. +\end{description} \ No newline at end of file diff --git a/manual/opencs/windows.tex b/manual/opencs/windows.tex new file mode 100644 index 000000000..97bb75e79 --- /dev/null +++ b/manual/opencs/windows.tex @@ -0,0 +1,54 @@ +\section{Windows} +\subsection{Introduction} +This section describes the multiple windows interface of the \OCS{} editor. This design principle was chosen in order +to extend the flexibility of the editor, especially on the multiple screens setups and on environments providing advanced +windows management features, like for instance: multiple desktops found commonly on many open source desktop environments. +However, it is enough to have a single large screen to see the advantages of this concept. + +OpenCS windows interface is easy to describe and understand. In fact we decided to minimize use of many windows concepts +applied commonly in various applications. For instance dialog windows are really hard to find in the \OCS. You are free to try, +though. + +Because of this, and the fact that we expect that user is familiar with other applications using windows this section is mostly +focused on practical ways of organizing work with the \OCS. + +\subsection{Basics} +After starting \OCS{} and choosing content files to use a editor window should show up. It probably does not look surprising: +there is a menubar at the top, and there is a~large empty area. That is it: a brand new \OCS{} window contains only menubar +and statusbar. In order to make it a little bit more useful you probably want to enable some panels\footnote{Also known as widgets.}. +You are free to do so, just try to explore the menubar. + +You probably founded out the way to enable and disable some interesting tables, but those will be described later. For now, let's +just focus on the windows itself. + +\paragraph{Creating new windows} +is easy! Just visit view menu, and use the ``New View'' item. Suddenly, out of the blue a new window will show up. As you would expect, +it is also blank, and you are free to add any of the \OCS{} panels. + +\paragraph{Closing opened window} +is also easy! Simply close that window decoration button. We suspect that you knew that already, but better to be sure. +Closing last \OCS{} window will also terminate application session. + +\paragraph{Multi-everything} +is the main foundation of \OCS{} interface. You are free to create as many windows as you want to, free to populate it with +any panels you may want to, and move everything as you wish to -- even if it makes no sense at all. If you just got crazy idea and +you are wonder if you are able to have one hundred \OCS{} windows showing panels of the same type, well most likely you are +able to do so. + +The principle behind this design decision is easy to see for \BS{} made editor, but maybe not so clear for users who are +just about to begin their wonderful journey of modding. + +\subsection{Advanced} +So why? Why this is created in such manner. The answer is frankly simple: because it is effective. When creating a mod, you often +have to work only with just one table. For instance you are just balancing weapons damage and other statistics. It makes sense +to have all the space for just that one table. More often, you are required to work with two and switch them from time to time. +All major graphical environments commonly present in operating systems comes with switcher feature, that is a key shortcut to change +active window. It is very effective and fast when you have only two windows, each holding only one table. Sometimes you have to work +with two at the time, and with one from time to time. Here, you can have one window holding two tables, and second holding just one. + +OpenCS is designed to simply make sense and do not slowdown users. It is as simple as possible (but not simpler), and uses one +flexible approach in all cases. + +There is no point in digging deeper in the windows of \OCS. Let's explore panels, starting with tables. + +%We should write some tips and tricks here. \ No newline at end of file diff --git a/readme.txt b/readme.txt index 7865f8dba..afcfadea3 100644 --- a/readme.txt +++ b/readme.txt @@ -3,7 +3,7 @@ OpenMW: A reimplementation of The Elder Scrolls III: Morrowind OpenMW is an attempt at recreating the engine for the popular role-playing game Morrowind by Bethesda Softworks. You need to own and install the original game for OpenMW to work. -Version: 0.26.0 +Version: 0.27.0 License: GPL (see GPL3.txt for more information) Website: http://www.openmw.org @@ -82,6 +82,32 @@ Allowed options: CHANGELOG +0.27.0 + +Bug #597: Assertion `dialogue->mId == id' failed in esmstore.cpp +Bug #794: incorrect display of decimal numbers +Bug #840: First-person sneaking camera height +Bug #887: Ambient sounds playing while paused +Bug #902: Problems with Polish character encoding +Bug #907: Entering third person using the mousewheel is possible even if it's impossible using the key +Bug #910: Some CDs not working correctly with Unshield installer +Bug #917: Quick character creation plugin does not work +Bug #918: Fatigue does not refill +Bug #919: The PC falls dead in Beshara - OpenMW nightly Win64 (708CDE2) +Feature #57: Acrobatics Skill +Feature #462: Editor: Start Dialogue +Feature #546: Modify ESX selector to handle new content file scheme +Feature #588: Editor: Adjust name/path of edited content files +Feature #644: Editor: Save +Feature #710: Editor: Configure script compiler context +Feature #790: God Mode +Feature #881: Editor: Allow only one instance of OpenCS +Feature #889: Editor: Record filtering +Feature #895: Extinguish torches +Feature #898: Breath meter enhancements +Feature #901: Editor: Default record filter +Feature #913: Merge --master and --plugin switches + 0.26.0 Bug #274: Inconsistencies in the terrain